- InChI
- InChI=1S/C10H14/c1-4-10-6-5-8(2)9(3)7-10/h5-7H,4H2,1-3H3
- InChI Key
- SBUYFICWQNHBCM-UHFFFAOYSA-N
- Formula
- C10H14
- SMILES
- CCc1ccc(C)c(C)c1
- Molecular Weight1
- 134.22
- CAS
- 934-80-5
- Other Names
-
- 1,2-Dimethyl-4-ethylbenzene
- 2-Methyl-p-ethyltoluene
- 3,4-Dimethyl-1-ethylbenzene
- 4-Ethyl o-xylene
- 4-Ethyl-1,2-dimethylbenzene
- 4-Ethyl-o-xylene
- 4-ethyL-1,2-dimethyldibenzene
- o-Xylene, 4-ethyl-
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- Ip : Polar retention indices.
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λgas : Gas thermal conductivity (W/m×K).
- λliquid : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- UQi : UNIQUAC Qi Parameter.
- URi : UNIQUAC Ri Parameter.
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | [0.4200; 0.4472] |
|
|
| ω | 0.4472 | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value | |
| ω | 0.4200 | ChemSep v8.3 pure component data Compiled value | |
| ΔcH°liquid | [-5850.70; -5849.90] | kJ/mol |
|
| ΔcH°liquid | -5849.90 ± 1.00 | kJ/mol | NIST |
| ΔcH°liquid | -5850.70 ± 2.60 | kJ/mol | NIST |
| ΔfG° | 127.40 | kJ/mol | ChemSep v8.3 pure component data Compiled value |
| ΔfH°gas | -32.09 | kJ/mol | ChemSep v8.3 pure component data Compiled value |
| ΔfH°liquid | [-86.00; -85.30] | kJ/mol |
|
| ΔfH°liquid | -86.00 ± 1.10 | kJ/mol | NIST |
| ΔfH°liquid | -85.30 ± 2.60 | kJ/mol | NIST |
| ΔfusH° | 14.92 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 53.90 | kJ/mol | NIST |
| IE | 8.18 | eV | Relay (1.0) Calculated Property |
| log10WS | -3.85 | Relay (1.0) Calculated Property | |
| logPoct/wat | 2.866 | Crippen Calculated Property | |
| McVol | 128.000 | ml/mol | McGowan Calculated Property |
| Pc | [2890.00; 2899.92] | kPa |
|
| Pc | 2899.92 | kPa | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Pc | 2890.00 | kPa | ChemSep v8.3 pure component data Compiled value |
| Ptriple | 3.43e-06 | kPa | ChemSep v8.3 pure component data Compiled value |
| Inp | [1062.00; 1104.00] |
|
|
| Inp | 1088.00 | NIST | |
| Inp | 1083.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1080.20 | NIST | |
| Inp | 1076.50 | NIST | |
| Inp | 1078.60 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1074.60 | NIST | |
| Inp | 1080.60 | NIST | |
| Inp | 1074.70 | NIST | |
| Inp | 1074.50 | NIST | |
| Inp | 1075.80 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1081.00 | NIST | |
| Inp | Outlier 1100.00 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1066.10 | NIST | |
| Inp | 1069.50 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1064.95 | NIST | |
| Inp | 1079.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1083.50 | NIST | |
| Inp | 1094.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | Outlier 1104.00 | NIST | |
| Inp | 1075.25 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1076.80 | NIST | |
| Inp | 1092.50 | NIST | |
| Inp | 1067.10 | NIST | |
| Inp | 1070.30 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1069.99 | NIST | |
| Inp | 1070.74 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1085.00 | NIST | |
| Inp | 1091.78 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1079.00 | NIST | |
| Inp | 1082.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1088.00 | NIST | |
| Inp | 1089.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1091.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1088.00 | NIST | |
| Inp | 1089.00 | NIST | |
| Inp | 1093.00 | NIST | |
| Inp | 1078.00 | NIST | |
| Inp | 1085.00 | NIST | |
| Inp | 1083.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | Outlier 1095.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1075.80 | NIST | |
| Inp | 1081.60 | NIST | |
| Inp | 1078.10 | NIST | |
| Inp | 1080.20 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1076.50 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1075.80 | NIST | |
| Ip | [1325.00; 1379.00] |
|
|
| Ip | 1325.00 | NIST | |
| Ip | 1328.00 | NIST | |
| Ip | 1357.20 | NIST | |
| Ip | 1350.50 | NIST | |
| Ip | 1332.30 | NIST | |
| Ip | 1379.00 | NIST | |
| Ip | 1330.00 | NIST | |
| Ip | 1371.00 | NIST | |
| Ip | 1364.00 | NIST | |
| Ip | 1354.00 | NIST | |
| Ip | 1332.00 | NIST | |
| Ip | 1362.00 | NIST | |
| Ip | 1355.00 | NIST | |
| Ip | 1357.00 | NIST | |
| Ip | 1332.00 | NIST | |
| Ip | 1357.00 | NIST | |
| Ip | 1355.00 | NIST | |
| Ip | 1379.00 | NIST | |
| Ip | 1332.00 | NIST | |
| Tboil | [460.00; 462.93] | K |
|
| Tboil | 462.93 | K | ChemSep v8.3 pure component data Compiled value |
| Tboil | 462.70 | K | NIST |
| Tboil | Outlier 460.15 ± 3.00 | K | NIST |
| Tboil | 462.63 ± 0.10 | K | NIST |
| Tboil | 462.65 ± 0.30 | K | NIST |
| Tboil | 462.70 ± 0.20 | K | NIST |
| Tboil | 462.90 ± 0.10 | K | NIST |
| Tboil | 462.70 ± 0.30 | K | NIST |
| Tboil | 462.70 ± 0.15 | K | NIST |
| Tboil | 462.50 ± 0.30 | K | NIST |
| Tboil | 462.70 ± 0.30 | K | NIST |
| Tboil | 462.90 ± 0.20 | K | NIST |
| Tboil | 462.70 ± 0.30 | K | NIST |
| Tboil | 460.80 ± 1.00 | K | NIST |
| Tboil | 462.00 ± 2.00 | K | NIST |
| Tboil | Outlier 460.00 ± 3.00 | K | NIST |
| Tc | [662.60; 666.00] | K |
|
| Tc | 662.60 | K | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Tc | 666.00 | K | ChemSep v8.3 pure component data Compiled value |
| Tfus | [206.00; 206.22] | K |
|
| Tfus | 206.20 | K | Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) Compiled value |
| Tfus | 206.00 | K | ChemSep v8.3 pure component data Compiled value |
| Tfus | 206.22 ± 0.02 | K | NIST |
| Ttriple | 206.22 | K | ChemSep v8.3 pure component data Compiled value |
| UQi | 4.64 | ChemSep v8.3 pure component data Compiled value | |
| URi | 6.07 | ChemSep v8.3 pure component data Compiled value | |
| Vc | [0.452; 0.452] | m3/kmol |
|
| Vc | 0.452 | m3/kmol | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Vc | 0.452 | m3/kmol | ChemSep v8.3 pure component data Compiled value |
| Zc | 0.2540000 | ChemSep v8.3 pure component data Compiled value | |
| Zra | 0.25 | ChemSep v8.3 pure component data Compiled value |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | 48.90 | kJ/mol | 416.50 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [178.88; 474.81] | J/mol×K | [298.15; 1500.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 9.06930e+01 | |||
| Coefficient B | -5.33270e+02 | |||
| Coefficient C | 6.23124e+00 | |||
| Coefficient D | 1.41430e-04 | |||
| Coefficient E | -6.08630e-08 | |||
| Temperature range, min. | 298.15 | |||
| Temperature range, max. | 1500.00 | |||
| Cp,gas | 178.88 | J/mol×K | 298.15 | Calculated Property |
| Cp,gas | 246.04 | J/mol×K | 431.69 | Calculated Property |
| Cp,gas | 300.94 | J/mol×K | 565.23 | Calculated Property |
| Cp,gas | 344.66 | J/mol×K | 698.77 | Calculated Property |
| Cp,gas | 379.59 | J/mol×K | 832.31 | Calculated Property |
| Cp,gas | 407.70 | J/mol×K | 965.84 | Calculated Property |
| Cp,gas | 430.41 | J/mol×K | 1099.38 | Calculated Property |
| Cp,gas | 448.71 | J/mol×K | 1232.92 | Calculated Property |
| Cp,gas | 463.33 | J/mol×K | 1366.46 | Calculated Property |
| Cp,gas | 474.81 | J/mol×K | 1500.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | [247.62; 326.64] | J/mol×K | [298.15; 462.93] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,liquid in J/mol×K, T in K | |||
| Coefficient A | 8.97670e+01 | |||
| Coefficient B | -7.78890e+01 | |||
| Coefficient C | 4.20524e+00 | |||
| Coefficient D | 4.93990e-03 | |||
| Coefficient E | -3.99580e-06 | |||
| Temperature range, min. | 298.15 | |||
| Temperature range, max. | 462.93 | |||
| Cp,liquid | 247.62 | J/mol×K | 298.15 | Calculated Property |
| Cp,liquid | 257.48 | J/mol×K | 316.46 | Calculated Property |
| Cp,liquid | 267.18 | J/mol×K | 334.77 | Calculated Property |
| Cp,liquid | 276.69 | J/mol×K | 353.08 | Calculated Property |
| Cp,liquid | 285.94 | J/mol×K | 371.39 | Calculated Property |
| Cp,liquid | 294.89 | J/mol×K | 389.69 | Calculated Property |
| Cp,liquid | 303.49 | J/mol×K | 408.00 | Calculated Property |
| Cp,liquid | 311.68 | J/mol×K | 426.31 | Calculated Property |
| Cp,liquid | 319.41 | J/mol×K | 444.62 | Calculated Property |
| Cp,liquid | 326.64 | J/mol×K | 462.93 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | [0.0105066; 0.0001057] | Pa×s | [206.22; 573.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is η in Pa×s, T in K | |||
| Coefficient A | -9.11590e+00 | |||
| Coefficient B | 1.41060e+03 | |||
| Coefficient C | -4.34110e-01 | |||
| Coefficient D | 7.81350e-07 | |||
| Coefficient E | 2.00000e+00 | |||
| Temperature range, min. | 206.22 | |||
| Temperature range, max. | 573.00 | |||
| η | 0.0105066 | Pa×s | 206.22 | Calculated Property |
| η | 0.0031881 | Pa×s | 246.97 | Calculated Property |
| η | 0.0013514 | Pa×s | 287.73 | Calculated Property |
| η | 0.0007083 | Pa×s | 328.48 | Calculated Property |
| η | 0.0004285 | Pa×s | 369.23 | Calculated Property |
| η | 0.0002871 | Pa×s | 409.99 | Calculated Property |
| η | 0.0002075 | Pa×s | 450.74 | Calculated Property |
| η | 0.0001589 | Pa×s | 491.49 | Calculated Property |
| η | 0.0001273 | Pa×s | 532.25 | Calculated Property |
| η | 0.0001057 | Pa×s | 573.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [57.64; 17.80] | kJ/mol | [206.22; 642.75] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is ΔvapH in kJ/mol, T in K | |||
| Coefficient A | 4.37140e+01 | |||
| Coefficient B | -2.75540e+00 | |||
| Coefficient C | 9.45780e+00 | |||
| Coefficient D | -1.10230e+01 | |||
| Coefficient E | 4.63070e+00 | |||
| Critical temperature, Tc (K) | 6.66000e+02 | |||
| Temperature range, min. | 206.22 | |||
| Temperature range, max. | 642.75 | |||
| ΔvapH | 57.64 | kJ/mol | 206.22 | Calculated Property |
| ΔvapH | 55.40 | kJ/mol | 254.72 | Calculated Property |
| ΔvapH | 52.37 | kJ/mol | 303.23 | Calculated Property |
| ΔvapH | 49.03 | kJ/mol | 351.73 | Calculated Property |
| ΔvapH | 45.67 | kJ/mol | 400.23 | Calculated Property |
| ΔvapH | 42.30 | kJ/mol | 448.74 | Calculated Property |
| ΔvapH | 38.71 | kJ/mol | 497.24 | Calculated Property |
| ΔvapH | 34.34 | kJ/mol | 545.74 | Calculated Property |
| ΔvapH | 28.18 | kJ/mol | 594.25 | Calculated Property |
| ΔvapH | 17.80 | kJ/mol | 642.75 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [340.28; 493.15] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.46261e+01 | |||
| Coefficient B | -4.06393e+03 | |||
| Coefficient C | -5.68540e+01 | |||
| Temperature range, min. | 340.28 | |||
| Temperature range, max. | 493.15 | |||
| Pvap | 1.33 | kPa | 340.28 | Calculated Property |
| Pvap | 3.00 | kPa | 357.27 | Calculated Property |
| Pvap | 6.19 | kPa | 374.25 | Calculated Property |
| Pvap | 11.85 | kPa | 391.24 | Calculated Property |
| Pvap | 21.33 | kPa | 408.22 | Calculated Property |
| Pvap | 36.36 | kPa | 425.21 | Calculated Property |
| Pvap | 59.13 | kPa | 442.19 | Calculated Property |
| Pvap | 92.30 | kPa | 459.18 | Calculated Property |
| Pvap | 138.96 | kPa | 476.16 | Calculated Property |
| Pvap | 202.66 | kPa | 493.15 | Calculated Property |
| Pvap | [5.33e-06; 2923.25] | kPa | [206.22; 667.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is Pvap in kPa, T in K | |||
| Coefficient A | 8.97862e+01 | |||
| Coefficient B | -9.14290e+03 | |||
| Coefficient C | -1.08520e+01 | |||
| Coefficient D | 5.55190e-06 | |||
| Coefficient E | 2.00000e+00 | |||
| Temperature range, min. | 206.22 | |||
| Temperature range, max. | 667.00 | |||
| Pvap | 5.33e-06 | kPa | 206.22 | Calculated Property |
| Pvap | 3.70e-03 | kPa | 257.42 | Calculated Property |
| Pvap | 0.22 | kPa | 308.62 | Calculated Property |
| Pvap | 3.40 | kPa | 359.81 | Calculated Property |
| Pvap | 23.69 | kPa | 411.01 | Calculated Property |
| Pvap | 99.82 | kPa | 462.21 | Calculated Property |
| Pvap | 302.86 | kPa | 513.41 | Calculated Property |
| Pvap | 737.29 | kPa | 564.60 | Calculated Property |
| Pvap | 1545.13 | kPa | 615.80 | Calculated Property |
| Pvap | 2923.25 | kPa | 667.00 | Calculated Property |
| Pvap | [3.49e-06; 2940.00] | kPa | [206.22; 667.00] |
KDB Vapor Pressure Data
|
| Equation | ln(Y) = A + B/T + C·ln(T) + D·T² + E/T² Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.02234e+02 | |||
| Coefficient B | -9.78228e+03 | |||
| Coefficient C | -1.26946e+01 | |||
| Coefficient D | 6.67201e-06 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 206.22 | |||
| Temperature range, max. | 667.00 | |||
| Pvap | 3.49e-06 | kPa | 206.22 | Calculated Property |
| Pvap | 3.06e-03 | kPa | 257.42 | Calculated Property |
| Pvap | 0.20 | kPa | 308.62 | Calculated Property |
| Pvap | 3.31 | kPa | 359.81 | Calculated Property |
| Pvap | 23.50 | kPa | 411.01 | Calculated Property |
| Pvap | 99.60 | kPa | 462.21 | Calculated Property |
| Pvap | 302.29 | kPa | 513.41 | Calculated Property |
| Pvap | 735.60 | kPa | 564.60 | Calculated Property |
| Pvap | 1544.53 | kPa | 615.80 | Calculated Property |
| Pvap | 2940.00 | kPa | 667.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ρl | [939.32; 465.87] | kg/m3 | [206.22; 642.75] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A / B^(1 + (1 − T/C)^D) Y is ρl in kg/m3, T in K | |||
| Coefficient A | 7.33690e+01 | |||
| Coefficient B | 2.60880e-01 | |||
| Coefficient C | 6.66000e+02 | |||
| Coefficient D | 2.91860e-01 | |||
| Temperature range, min. | 206.22 | |||
| Temperature range, max. | 642.75 | |||
| ρl | 939.32 | kg/m3 | 206.22 | Calculated Property |
| ρl | 903.75 | kg/m3 | 254.72 | Calculated Property |
| ρl | 866.59 | kg/m3 | 303.23 | Calculated Property |
| ρl | 827.49 | kg/m3 | 351.73 | Calculated Property |
| ρl | 785.93 | kg/m3 | 400.23 | Calculated Property |
| ρl | 741.13 | kg/m3 | 448.74 | Calculated Property |
| ρl | 691.80 | kg/m3 | 497.24 | Calculated Property |
| ρl | 635.58 | kg/m3 | 545.74 | Calculated Property |
| ρl | 567.06 | kg/m3 | 594.25 | Calculated Property |
| ρl | 465.87 | kg/m3 | 642.75 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| γ | [0.04; 7.28e-04] | N/m | [206.22; 642.75] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is γ in N/m, T in K | |||
| Coefficient A | -2.10750e-02 | |||
| Coefficient B | 3.99330e+01 | |||
| Coefficient C | -2.78140e+00 | |||
| Coefficient D | -4.22160e-04 | |||
| Coefficient E | -2.02140e-06 | |||
| Temperature range, min. | 206.22 | |||
| Temperature range, max. | 642.75 | |||
| γ | 0.04 | N/m | 206.22 | Calculated Property |
| γ | 0.04 | N/m | 254.72 | Calculated Property |
| γ | 0.03 | N/m | 303.23 | Calculated Property |
| γ | 0.03 | N/m | 351.73 | Calculated Property |
| γ | 0.02 | N/m | 400.23 | Calculated Property |
| γ | 0.02 | N/m | 448.74 | Calculated Property |
| γ | 0.01 | N/m | 497.24 | Calculated Property |
| γ | 0.01 | N/m | 545.74 | Calculated Property |
| γ | 0.00 | N/m | 594.25 | Calculated Property |
| γ | 7.28e-04 | N/m | 642.75 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λgas | [0.00; 0.07] | W/m×K | [206.22; 1000.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A·T^B / (1 + C/T + D/T²) Y is λgas in W/m×K, T in K | |||
| Coefficient A | 8.36970e-05 | |||
| Coefficient B | 1.04750e+00 | |||
| Coefficient C | 5.20730e+02 | |||
| Coefficient D | 4.56650e+04 | |||
| Temperature range, min. | 206.22 | |||
| Temperature range, max. | 1000.00 | |||
| λgas | 0.00 | W/m×K | 206.22 | Calculated Property |
| λgas | 0.01 | W/m×K | 294.42 | Calculated Property |
| λgas | 0.02 | W/m×K | 382.62 | Calculated Property |
| λgas | 0.02 | W/m×K | 470.81 | Calculated Property |
| λgas | 0.03 | W/m×K | 559.01 | Calculated Property |
| λgas | 0.04 | W/m×K | 647.21 | Calculated Property |
| λgas | 0.05 | W/m×K | 735.41 | Calculated Property |
| λgas | 0.06 | W/m×K | 823.60 | Calculated Property |
| λgas | 0.06 | W/m×K | 911.80 | Calculated Property |
| λgas | 0.07 | W/m×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λliquid | [0.14; 0.09] | W/m×K | [206.22; 462.93] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is λliquid in W/m×K, T in K | |||
| Coefficient A | -6.16130e-02 | |||
| Coefficient B | 4.01760e+00 | |||
| Coefficient C | -1.49360e+00 | |||
| Coefficient D | -3.72180e-04 | |||
| Coefficient E | -9.97210e-07 | |||
| Temperature range, min. | 206.22 | |||
| Temperature range, max. | 462.93 | |||
| λliquid | 0.14 | W/m×K | 206.22 | Calculated Property |
| λliquid | 0.14 | W/m×K | 234.74 | Calculated Property |
| λliquid | 0.13 | W/m×K | 263.27 | Calculated Property |
| λliquid | 0.13 | W/m×K | 291.79 | Calculated Property |
| λliquid | 0.12 | W/m×K | 320.31 | Calculated Property |
| λliquid | 0.12 | W/m×K | 348.84 | Calculated Property |
| λliquid | 0.11 | W/m×K | 377.36 | Calculated Property |
| λliquid | 0.10 | W/m×K | 405.88 | Calculated Property |
| λliquid | 0.10 | W/m×K | 434.41 | Calculated Property |
| λliquid | 0.09 | W/m×K | 462.93 | Calculated Property |
Similar Compounds
Find more compounds similar to Benzene, 4-ethyl-1,2-dimethyl-.
Sources
- KDB Vapor Pressure Data
- Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) ChEDL chemicals 1.5.2, from Bradley, J.-C.; Williams, A.; Lang, A. Jean-Claude Bradley Open Melting Point Dataset. Figshare, 2014 (CC0).
- PSRK revision IV (2005), critical constants and acentric factors of 1000 components ChEDL chemicals 1.5.2, from Horstmann, S.; Jabłoniec, A.; Krafczyk, J.; Fischer, K.; Gmehling, J. PSRK Group Contribution Equation of State: Comprehensive Revision and Extension IV, Including Critical Constants and α-Function Parameters for 1000 Components. Fluid Phase Equilib. 2005, 227, 157-164.
- Cheméo Relay (1.0)
- ChemSep v8.3 pure component data Converted from ChemSep v8.3 pure component data, H. Kooijman and R. Taylor (2021, 2022), Artistic License 2.0; see how the values differ.
- Crippen Method
- Crippen Method
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
Calculated This icon marks a calculated value or equation: a prediction, not a measurement.
Compiled This icon marks a compiled value or equation: taken from a data compilation such as ChemSep, not from an original measurement report.
These property values are available through the Cheméo API. A free account gives you an access key.