- Name
- Tetrachloroethylene
- InChI
- InChI=1S/C2Cl4/c3-1(4)2(5)6
- InChI Key
- CYTYCFOTNPOANT-UHFFFAOYSA-N
- Formula
- C2Cl4
- SMILES
- ClC(Cl)=C(Cl)Cl
- Mol. Weight (g/mol)
- 165.83
- CAS
- 127-18-4
- Name
- 1-Hexanol
- InChI
- InChI=1S/C6H14O/c1-2-3-4-5-6-7/h7H,2-6H2,1H3
- InChI Key
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CCCCCCO
- Mol. Weight (g/mol)
- 102.17
- CAS
- 111-27-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrachloroethylene (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0000 | 0.0053 |
| 0.0688 | 0.0048 |
| 0.1230 | 0.0044 |
| 0.2457 | 0.0035 |
| 0.3618 | 0.0028 |
| 0.4502 | 0.0023 |
| 0.5583 | 0.0019 |
| 0.6518 | 0.0015 |
| 0.7068 | 0.0014 |
| 0.7419 | 0.0013 |
| 0.7797 | 0.0012 |
| 0.8315 | 0.0011 |
| 0.8718 | 0.0011 |
| 0.9179 | 0.0010 |
| 0.9504 | 0.0009 |
| 1.0000 | 0.0009 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrachloroethylene (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0000 | 0.0053 |
| 0.0688 | 0.0048 |
| 0.1230 | 0.0044 |
| 0.2457 | 0.0035 |
| 0.3618 | 0.0028 |
| 0.4502 | 0.0023 |
| 0.5583 | 0.0019 |
| 0.6518 | 0.0015 |
| 0.7068 | 0.0014 |
| 0.7419 | 0.0013 |
| 0.7797 | 0.0012 |
| 0.8315 | 0.0011 |
| 0.8718 | 0.0011 |
| 0.9179 | 0.0010 |
| 0.9504 | 0.0009 |
| 1.0000 | 0.0009 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrachloroethylene (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 818.856 |
| 293.15 | 0.0688 | 864.637 |
| 293.15 | 0.1230 | 901.521 |
| 293.15 | 0.2457 | 987.759 |
| 293.15 | 0.3618 | 1072.992 |
| 293.15 | 0.4502 | 1140.457 |
| 293.15 | 0.5583 | 1226.302 |
| 293.15 | 0.6518 | 1303.622 |
| 293.15 | 0.7068 | 1350.534 |
| 293.15 | 0.7419 | 1381.185 |
| 293.15 | 0.7797 | 1414.647 |
| 293.15 | 0.8315 | 1461.437 |
| 293.15 | 0.8718 | 1498.8 |
| 293.15 | 0.9179 | 1542.246 |
| 293.15 | 0.9504 | 1573.609 |
| 293.15 | 1.0000 | 1622.745 |
| 298.15 | 0.0000 | 815.281 |
| 298.15 | 0.0688 | 860.792 |
| 298.15 | 0.1230 | 897.46 |
| 298.15 | 0.2457 | 983.18 |
| 298.15 | 0.3618 | 1067.892 |
| 298.15 | 0.4502 | 1134.94 |
| 298.15 | 0.5583 | 1220.256 |
| 298.15 | 0.6518 | 1297.102 |
| 298.15 | 0.7068 | 1343.732 |
| 298.15 | 0.7419 | 1374.186 |
| 298.15 | 0.7797 | 1407.46 |
| 298.15 | 0.8315 | 1453.969 |
| 298.15 | 0.8718 | 1491.149 |
| 298.15 | 0.9179 | 1534.331 |
| 298.15 | 0.9504 | 1565.562 |
| 298.15 | 1.0000 | 1614.427 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrachloroethylene (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 818.856 |
| 0.0688 | 864.637 |
| 0.1230 | 901.521 |
| 0.2457 | 987.759 |
| 0.3618 | 1072.992 |
| 0.4502 | 1140.457 |
| 0.5583 | 1226.302 |
| 0.6518 | 1303.622 |
| 0.7068 | 1350.534 |
| 0.7419 | 1381.185 |
| 0.7797 | 1414.647 |
| 0.8315 | 1461.437 |
| 0.8718 | 1498.8 |
| 0.9179 | 1542.246 |
| 0.9504 | 1573.609 |
| 1.0000 | 1622.745 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrachloroethylene (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 818.856 |
| 293.15 | 0.0688 | 864.637 |
| 293.15 | 0.1230 | 901.521 |
| 293.15 | 0.2457 | 987.759 |
| 293.15 | 0.3618 | 1072.992 |
| 293.15 | 0.4502 | 1140.457 |
| 293.15 | 0.5583 | 1226.302 |
| 293.15 | 0.6518 | 1303.622 |
| 293.15 | 0.7068 | 1350.534 |
| 293.15 | 0.7419 | 1381.185 |
| 293.15 | 0.7797 | 1414.647 |
| 293.15 | 0.8315 | 1461.437 |
| 293.15 | 0.8718 | 1498.8 |
| 293.15 | 0.9179 | 1542.246 |
| 293.15 | 0.9504 | 1573.609 |
| 293.15 | 1.0000 | 1622.745 |
| 298.15 | 0.0000 | 815.281 |
| 298.15 | 0.0688 | 860.792 |
| 298.15 | 0.1230 | 897.46 |
| 298.15 | 0.2457 | 983.18 |
| 298.15 | 0.3618 | 1067.892 |
| 298.15 | 0.4502 | 1134.94 |
| 298.15 | 0.5583 | 1220.256 |
| 298.15 | 0.6518 | 1297.102 |
| 298.15 | 0.7068 | 1343.732 |
| 298.15 | 0.7419 | 1374.186 |
| 298.15 | 0.7797 | 1407.46 |
| 298.15 | 0.8315 | 1453.969 |
| 298.15 | 0.8718 | 1491.149 |
| 298.15 | 0.9179 | 1534.331 |
| 298.15 | 0.9504 | 1565.562 |
| 298.15 | 1.0000 | 1614.427 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrachloroethylene (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 818.856 |
| 0.0688 | 864.637 |
| 0.1230 | 901.521 |
| 0.2457 | 987.759 |
| 0.3618 | 1072.992 |
| 0.4502 | 1140.457 |
| 0.5583 | 1226.302 |
| 0.6518 | 1303.622 |
| 0.7068 | 1350.534 |
| 0.7419 | 1381.185 |
| 0.7797 | 1414.647 |
| 0.8315 | 1461.437 |
| 0.8718 | 1498.8 |
| 0.9179 | 1542.246 |
| 0.9504 | 1573.609 |
| 1.0000 | 1622.745 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrachloroethylene (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1320.11 |
| 293.15 | 0.0688 | 1292.01 |
| 293.15 | 0.1230 | 1270.77 |
| 293.15 | 0.2457 | 1226.29 |
| 293.15 | 0.3618 | 1188.18 |
| 293.15 | 0.4502 | 1161.45 |
| 293.15 | 0.5583 | 1131.51 |
| 293.15 | 0.6518 | 1108.26 |
| 293.15 | 0.7068 | 1095.82 |
| 293.15 | 0.7419 | 1088.42 |
| 293.15 | 0.7797 | 1080.88 |
| 293.15 | 0.8315 | 1071.36 |
| 293.15 | 0.8718 | 1064.7 |
| 293.15 | 0.9179 | 1058.21 |
| 293.15 | 0.9504 | 1054.99 |
| 293.15 | 1.0000 | 1054.03 |
| 298.15 | 0.0000 | 1303.19 |
| 298.15 | 0.0688 | 1274.52 |
| 298.15 | 0.1230 | 1253.65 |
| 298.15 | 0.2457 | 1209.55 |
| 298.15 | 0.3618 | 1171.56 |
| 298.15 | 0.4502 | 1144.91 |
| 298.15 | 0.5583 | 1115.12 |
| 298.15 | 0.6518 | 1092.04 |
| 298.15 | 0.7068 | 1079.52 |
| 298.15 | 0.7419 | 1072.05 |
| 298.15 | 0.7797 | 1064.57 |
| 298.15 | 0.8315 | 1055.64 |
| 298.15 | 0.8718 | 1049.01 |
| 298.15 | 0.9179 | 1043.31 |
| 298.15 | 0.9504 | 1041.16 |
| 298.15 | 1.0000 | 1038.97 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrachloroethylene (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1320.11 |
| 293.15 | 0.0688 | 1292.01 |
| 293.15 | 0.1230 | 1270.77 |
| 293.15 | 0.2457 | 1226.29 |
| 293.15 | 0.3618 | 1188.18 |
| 293.15 | 0.4502 | 1161.45 |
| 293.15 | 0.5583 | 1131.51 |
| 293.15 | 0.6518 | 1108.26 |
| 293.15 | 0.7068 | 1095.82 |
| 293.15 | 0.7419 | 1088.42 |
| 293.15 | 0.7797 | 1080.88 |
| 293.15 | 0.8315 | 1071.36 |
| 293.15 | 0.8718 | 1064.7 |
| 293.15 | 0.9179 | 1058.21 |
| 293.15 | 0.9504 | 1054.99 |
| 293.15 | 1.0000 | 1054.03 |
| 298.15 | 0.0000 | 1303.19 |
| 298.15 | 0.0688 | 1274.52 |
| 298.15 | 0.1230 | 1253.65 |
| 298.15 | 0.2457 | 1209.55 |
| 298.15 | 0.3618 | 1171.56 |
| 298.15 | 0.4502 | 1144.91 |
| 298.15 | 0.5583 | 1115.12 |
| 298.15 | 0.6518 | 1092.04 |
| 298.15 | 0.7068 | 1079.52 |
| 298.15 | 0.7419 | 1072.05 |
| 298.15 | 0.7797 | 1064.57 |
| 298.15 | 0.8315 | 1055.64 |
| 298.15 | 0.8718 | 1049.01 |
| 298.15 | 0.9179 | 1043.31 |
| 298.15 | 0.9504 | 1041.16 |
| 298.15 | 1.0000 | 1038.97 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.6 (Liquid)
| Mole fraction of Tetrachloroethylene (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 428.45 |
| 0.0625 | 422.05 |
| 0.1198 | 417.75 |
| 0.1823 | 414.25 |
| 0.2900 | 409.65 |
| 0.3525 | 407.45 |
| 0.4051 | 405.85 |
| 0.4676 | 404.85 |
| 0.5214 | 402.75 |
| 0.5839 | 401.15 |
| 0.6476 | 399.65 |
| 0.7101 | 398.25 |
| 0.7861 | 396.65 |
| 0.8351 | 395.55 |
| 0.9168 | 393.85 |
| 1.0000 | 392.15 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.6 (Liquid)
| Mole fraction of Tetrachloroethylene (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 428.45 |
| 0.0625 | 422.05 |
| 0.1198 | 417.75 |
| 0.1823 | 414.25 |
| 0.2900 | 409.65 |
| 0.3525 | 407.45 |
| 0.4051 | 405.85 |
| 0.4676 | 404.85 |
| 0.5214 | 402.75 |
| 0.5839 | 401.15 |
| 0.6476 | 399.65 |
| 0.7101 | 398.25 |
| 0.7861 | 396.65 |
| 0.8351 | 395.55 |
| 0.9168 | 393.85 |
| 1.0000 | 392.15 |
Sources
- Densities, Excess Molar Volumes, Ultrasonic Speeds, and Isentropic Compressibilities of Hexan-1-ol with 1,2-Dichloroethane, 1,2-Dibromoethane, and 1,1,2,2-Tetrachloroethene at (293.15 and 298.15) K
- Vapor-Liquid Equilibria of Binary Mixtures Formed by Hexan-1-ol with Chloroethanes and Chloroethenes at 95.6 kPa
- Studies on Transport and Thermodynamic Properties of Binary Mixtures of Hexan-1-ol with Halogenated Compounds at 293.15 K