- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Piperazine, 1-methyl-
- InChI
- InChI=1S/C5H12N2/c1-7-4-2-6-3-5-7/h6H,2-5H2,1H3
- InChI Key
- PVOAHINGSUIXLS-UHFFFAOYSA-N
- Formula
- C5H12N2
- SMILES
- CN1CCNCC1
- Mol. Weight (g/mol)
- 100.16
- CAS
- 109-01-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0021 |
| 293.15 | 0.0998 | 0.0023 |
| 293.15 | 0.1988 | 0.0024 |
| 293.15 | 0.3003 | 0.0025 |
| 293.15 | 0.3998 | 0.0026 |
| 293.15 | 0.5000 | 0.0027 |
| 293.15 | 0.5996 | 0.0027 |
| 293.15 | 0.7000 | 0.0027 |
| 293.15 | 0.7991 | 0.0027 |
| 293.15 | 0.8503 | 0.0026 |
| 293.15 | 0.9003 | 0.0026 |
| 293.15 | 0.9489 | 0.0025 |
| 293.15 | 1.0000 | 0.0024 |
| 298.15 | 0.0000 | 0.0018 |
| 298.15 | 0.0998 | 0.0020 |
| 298.15 | 0.1988 | 0.0021 |
| 298.15 | 0.3003 | 0.0022 |
| 298.15 | 0.3998 | 0.0022 |
| 298.15 | 0.5000 | 0.0023 |
| 298.15 | 0.5996 | 0.0023 |
| 298.15 | 0.7000 | 0.0023 |
| 298.15 | 0.7991 | 0.0023 |
| 298.15 | 0.8503 | 0.0023 |
| 298.15 | 0.9003 | 0.0022 |
| 298.15 | 0.9489 | 0.0022 |
| 298.15 | 1.0000 | 0.0021 |
| 303.15 | 0.0000 | 0.0016 |
| 303.15 | 0.0998 | 0.0017 |
| 303.15 | 0.1988 | 0.0018 |
| 303.15 | 0.3003 | 0.0019 |
| 303.15 | 0.3998 | 0.0019 |
| 303.15 | 0.5000 | 0.0020 |
| 303.15 | 0.5996 | 0.0020 |
| 303.15 | 0.7000 | 0.0020 |
| 303.15 | 0.7991 | 0.0020 |
| 303.15 | 0.8503 | 0.0020 |
| 303.15 | 0.9003 | 0.0020 |
| 303.15 | 0.9489 | 0.0019 |
| 303.15 | 1.0000 | 0.0018 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0021 |
| 293.15 | 0.0998 | 0.0023 |
| 293.15 | 0.1988 | 0.0024 |
| 293.15 | 0.3003 | 0.0025 |
| 293.15 | 0.3998 | 0.0026 |
| 293.15 | 0.5000 | 0.0027 |
| 293.15 | 0.5996 | 0.0027 |
| 293.15 | 0.7000 | 0.0027 |
| 293.15 | 0.7991 | 0.0027 |
| 293.15 | 0.8503 | 0.0026 |
| 293.15 | 0.9003 | 0.0026 |
| 293.15 | 0.9489 | 0.0025 |
| 293.15 | 1.0000 | 0.0024 |
| 298.15 | 0.0000 | 0.0018 |
| 298.15 | 0.0998 | 0.0020 |
| 298.15 | 0.1988 | 0.0021 |
| 298.15 | 0.3003 | 0.0022 |
| 298.15 | 0.3998 | 0.0022 |
| 298.15 | 0.5000 | 0.0023 |
| 298.15 | 0.5996 | 0.0023 |
| 298.15 | 0.7000 | 0.0023 |
| 298.15 | 0.7991 | 0.0023 |
| 298.15 | 0.8503 | 0.0023 |
| 298.15 | 0.9003 | 0.0022 |
| 298.15 | 0.9489 | 0.0022 |
| 298.15 | 1.0000 | 0.0021 |
| 303.15 | 0.0000 | 0.0016 |
| 303.15 | 0.0998 | 0.0017 |
| 303.15 | 0.1988 | 0.0018 |
| 303.15 | 0.3003 | 0.0019 |
| 303.15 | 0.3998 | 0.0019 |
| 303.15 | 0.5000 | 0.0020 |
| 303.15 | 0.5996 | 0.0020 |
| 303.15 | 0.7000 | 0.0020 |
| 303.15 | 0.7991 | 0.0020 |
| 303.15 | 0.8503 | 0.0020 |
| 303.15 | 0.9003 | 0.0020 |
| 303.15 | 0.9489 | 0.0019 |
| 303.15 | 1.0000 | 0.0018 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 903.78 |
| 293.15 | 0.0998 | 897.99 |
| 293.15 | 0.1988 | 891.42 |
| 293.15 | 0.3003 | 883.75 |
| 293.15 | 0.3998 | 875.22 |
| 293.15 | 0.5000 | 865.48 |
| 293.15 | 0.5996 | 854.41 |
| 293.15 | 0.7000 | 841.49 |
| 293.15 | 0.7991 | 826.48 |
| 293.15 | 0.8503 | 817.61 |
| 293.15 | 0.9003 | 808.06 |
| 293.15 | 0.9489 | 797.8 |
| 293.15 | 1.0000 | 785.84 |
| 298.15 | 0.0000 | 899.8 |
| 298.15 | 0.0998 | 893.98 |
| 298.15 | 0.1988 | 887.39 |
| 298.15 | 0.3003 | 879.73 |
| 298.15 | 0.3998 | 871.21 |
| 298.15 | 0.5000 | 861.47 |
| 298.15 | 0.5996 | 850.38 |
| 298.15 | 0.7000 | 837.39 |
| 298.15 | 0.7991 | 822.27 |
| 298.15 | 0.8503 | 813.32 |
| 298.15 | 0.9003 | 803.69 |
| 298.15 | 0.9489 | 793.36 |
| 298.15 | 1.0000 | 781.3 |
| 303.15 | 0.0000 | 894.54 |
| 303.15 | 0.0998 | 888.87 |
| 303.15 | 0.1988 | 882.45 |
| 303.15 | 0.3003 | 874.96 |
| 303.15 | 0.3998 | 866.62 |
| 303.15 | 0.5000 | 857.07 |
| 303.15 | 0.5996 | 846.15 |
| 303.15 | 0.7000 | 833.32 |
| 303.15 | 0.7991 | 818.3 |
| 303.15 | 0.8503 | 809.39 |
| 303.15 | 0.9003 | 799.79 |
| 303.15 | 0.9489 | 789.46 |
| 303.15 | 1.0000 | 777.41 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 903.78 |
| 293.15 | 0.0998 | 897.99 |
| 293.15 | 0.1988 | 891.42 |
| 293.15 | 0.3003 | 883.75 |
| 293.15 | 0.3998 | 875.22 |
| 293.15 | 0.5000 | 865.48 |
| 293.15 | 0.5996 | 854.41 |
| 293.15 | 0.7000 | 841.49 |
| 293.15 | 0.7991 | 826.48 |
| 293.15 | 0.8503 | 817.61 |
| 293.15 | 0.9003 | 808.06 |
| 293.15 | 0.9489 | 797.8 |
| 293.15 | 1.0000 | 785.84 |
| 298.15 | 0.0000 | 899.8 |
| 298.15 | 0.0998 | 893.98 |
| 298.15 | 0.1988 | 887.39 |
| 298.15 | 0.3003 | 879.73 |
| 298.15 | 0.3998 | 871.21 |
| 298.15 | 0.5000 | 861.47 |
| 298.15 | 0.5996 | 850.38 |
| 298.15 | 0.7000 | 837.39 |
| 298.15 | 0.7991 | 822.27 |
| 298.15 | 0.8503 | 813.32 |
| 298.15 | 0.9003 | 803.69 |
| 298.15 | 0.9489 | 793.36 |
| 298.15 | 1.0000 | 781.3 |
| 303.15 | 0.0000 | 894.54 |
| 303.15 | 0.0998 | 888.87 |
| 303.15 | 0.1988 | 882.45 |
| 303.15 | 0.3003 | 874.96 |
| 303.15 | 0.3998 | 866.62 |
| 303.15 | 0.5000 | 857.07 |
| 303.15 | 0.5996 | 846.15 |
| 303.15 | 0.7000 | 833.32 |
| 303.15 | 0.7991 | 818.3 |
| 303.15 | 0.8503 | 809.39 |
| 303.15 | 0.9003 | 799.79 |
| 303.15 | 0.9489 | 789.46 |
| 303.15 | 1.0000 | 777.41 |