- Name
- Tridecane
- InChI
- InChI=1S/C13H28/c1-3-5-7-9-11-13-12-10-8-6-4-2/h3-13H2,1-2H3
- InChI Key
- IIYFAKIEWZDVMP-UHFFFAOYSA-N
- Formula
- C13H28
- SMILES
- CCCCCCCCCCCCC
- Mol. Weight (g/mol)
- 184.36
- CAS
- 629-50-5
- Name
- 2,3-Pentanedione
- InChI
- InChI=1S/C5H8O2/c1-3-5(7)4(2)6/h3H2,1-2H3
- InChI Key
- TZMFJUDUGYTVRY-UHFFFAOYSA-N
- Formula
- C5H8O2
- SMILES
- CCC(=O)C(C)=O
- Mol. Weight (g/mol)
- 100.12
- CAS
- 600-14-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Liquid-liquid equilibrium temperature, K (2)
- Pvap - Vapor or sublimation pressure, kPa (2)
- Tfus - Solid-liquid equilibrium temperature, K (2)
Liquid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Mole fraction of Tridecane (1) - Liquid mixture 1 | Liquid-liquid equilibrium temperature, K - Liquid mixture 1 |
|---|---|
| 0.0897 | 264.87 |
| 0.1477 | 274.35 |
| 0.1826 | 280.24 |
| 0.2280 | 283.60 |
| 0.2439 | 285.19 |
| 0.3037 | 287.13 |
| 0.3432 | 287.52 |
| 0.3736 | 286.12 |
| 0.4089 | 283.53 |
| 0.4501 | 281.35 |
| 0.4880 | 278.21 |
| 0.5306 | 273.15 |
| 0.5700 | 267.07 |
Liquid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Mole fraction of Tridecane (1) - Liquid mixture 1 | Liquid-liquid equilibrium temperature, K - Liquid mixture 1 |
|---|---|
| 0.0897 | 264.87 |
| 0.1477 | 274.35 |
| 0.1826 | 280.24 |
| 0.2280 | 283.60 |
| 0.2439 | 285.19 |
| 0.3037 | 287.13 |
| 0.3432 | 287.52 |
| 0.3736 | 286.12 |
| 0.4089 | 283.53 |
| 0.4501 | 281.35 |
| 0.4880 | 278.21 |
| 0.5306 | 273.15 |
| 0.5700 | 267.07 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Tridecane (1) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.0000 | 293.15 | 697870.00 |
| 0.0000 | 303.15 | 807350.00 |
| 0.0000 | 313.15 | 947230.00 |
| 0.0000 | 323.15 | 1117520.00 |
| 0.0000 | 333.15 | 1318200.00 |
| 0.0000 | 343.15 | 1549280.00 |
| 0.0488 | 293.15 | 195790.00 |
| 0.0488 | 303.15 | 263250.00 |
| 0.0488 | 313.15 | 334070.00 |
| 0.0488 | 323.15 | 408260.00 |
| 0.0488 | 333.15 | 485810.00 |
| 0.0488 | 343.15 | 566720.00 |
| 0.0985 | 293.15 | 180670.00 |
| 0.0985 | 303.15 | 246930.00 |
| 0.0985 | 313.15 | 317220.00 |
| 0.0985 | 323.15 | 391540.00 |
| 0.0985 | 333.15 | 469870.00 |
| 0.0985 | 343.15 | 552240.00 |
| 0.1883 | 293.15 | 162290.00 |
| 0.1883 | 303.15 | 226320.00 |
| 0.1883 | 313.15 | 295190.00 |
| 0.1883 | 323.15 | 368900.00 |
| 0.1883 | 333.15 | 447440.00 |
| 0.1883 | 343.15 | 530830.00 |
| 0.2860 | 293.15 | 156980.00 |
| 0.2860 | 303.15 | 219970.00 |
| 0.2860 | 313.15 | 287880.00 |
| 0.2860 | 323.15 | 360700.00 |
| 0.2860 | 333.15 | 438450.00 |
| 0.2860 | 343.15 | 521110.00 |
| 0.3972 | 293.15 | 154340.00 |
| 0.3972 | 303.15 | 217040.00 |
| 0.3972 | 313.15 | 284500.00 |
| 0.3972 | 323.15 | 356700.00 |
| 0.3972 | 333.15 | 433660.00 |
| 0.3972 | 343.15 | 515370.00 |
| 0.4910 | 293.15 | 152520.00 |
| 0.4910 | 303.15 | 215380.00 |
| 0.4910 | 313.15 | 282760.00 |
| 0.4910 | 323.15 | 354670.00 |
| 0.4910 | 333.15 | 431120.00 |
| 0.4910 | 343.15 | 512100.00 |
| 0.5670 | 293.15 | 150530.00 |
| 0.5670 | 303.15 | 213870.00 |
| 0.5670 | 313.15 | 281520.00 |
| 0.5670 | 323.15 | 353470.00 |
| 0.5670 | 333.15 | 429730.00 |
| 0.5670 | 343.15 | 510290.00 |
| 0.6398 | 293.15 | 148280.00 |
| 0.6398 | 303.15 | 211880.00 |
| 0.6398 | 313.15 | 279710.00 |
| 0.6398 | 323.15 | 351740.00 |
| 0.6398 | 333.15 | 428000.00 |
| 0.6398 | 343.15 | 508470.00 |
| 0.6995 | 293.15 | 146460.00 |
| 0.6995 | 303.15 | 210070.00 |
| 0.6995 | 313.15 | 277920.00 |
| 0.6995 | 323.15 | 350010.00 |
| 0.6995 | 333.15 | 426340.00 |
| 0.6995 | 343.15 | 506910.00 |
| 0.7711 | 293.15 | 143630.00 |
| 0.7711 | 303.15 | 207690.00 |
| 0.7711 | 313.15 | 275860.00 |
| 0.7711 | 323.15 | 348140.00 |
| 0.7711 | 333.15 | 424520.00 |
| 0.7711 | 343.15 | 505010.00 |
| 0.8770 | 293.15 | 139440.00 |
| 0.8770 | 303.15 | 203560.00 |
| 0.8770 | 313.15 | 271850.00 |
| 0.8770 | 323.15 | 344320.00 |
| 0.8770 | 333.15 | 420970.00 |
| 0.8770 | 343.15 | 501790.00 |
| 0.9674 | 293.15 | 134840.00 |
| 0.9674 | 303.15 | 198700.00 |
| 0.9674 | 313.15 | 266980.00 |
| 0.9674 | 323.15 | 339710.00 |
| 0.9674 | 333.15 | 416870.00 |
| 0.9674 | 343.15 | 498460.00 |
| 1.0000 | 293.15 | 132350.00 |
| 1.0000 | 303.15 | 196230.00 |
| 1.0000 | 313.15 | 264630.00 |
| 1.0000 | 323.15 | 337550.00 |
| 1.0000 | 333.15 | 415000.00 |
| 1.0000 | 343.15 | 496960.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Tridecane (1) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.0000 | 293.15 | 697870.00 |
| 0.0000 | 303.15 | 807350.00 |
| 0.0000 | 313.15 | 947230.00 |
| 0.0000 | 323.15 | 1117520.00 |
| 0.0000 | 333.15 | 1318200.00 |
| 0.0000 | 343.15 | 1549280.00 |
| 0.0488 | 293.15 | 195790.00 |
| 0.0488 | 303.15 | 263250.00 |
| 0.0488 | 313.15 | 334070.00 |
| 0.0488 | 323.15 | 408260.00 |
| 0.0488 | 333.15 | 485810.00 |
| 0.0488 | 343.15 | 566720.00 |
| 0.0985 | 293.15 | 180670.00 |
| 0.0985 | 303.15 | 246930.00 |
| 0.0985 | 313.15 | 317220.00 |
| 0.0985 | 323.15 | 391540.00 |
| 0.0985 | 333.15 | 469870.00 |
| 0.0985 | 343.15 | 552240.00 |
| 0.1883 | 293.15 | 162290.00 |
| 0.1883 | 303.15 | 226320.00 |
| 0.1883 | 313.15 | 295190.00 |
| 0.1883 | 323.15 | 368900.00 |
| 0.1883 | 333.15 | 447440.00 |
| 0.1883 | 343.15 | 530830.00 |
| 0.2860 | 293.15 | 156980.00 |
| 0.2860 | 303.15 | 219970.00 |
| 0.2860 | 313.15 | 287880.00 |
| 0.2860 | 323.15 | 360700.00 |
| 0.2860 | 333.15 | 438450.00 |
| 0.2860 | 343.15 | 521110.00 |
| 0.3972 | 293.15 | 154340.00 |
| 0.3972 | 303.15 | 217040.00 |
| 0.3972 | 313.15 | 284500.00 |
| 0.3972 | 323.15 | 356700.00 |
| 0.3972 | 333.15 | 433660.00 |
| 0.3972 | 343.15 | 515370.00 |
| 0.4910 | 293.15 | 152520.00 |
| 0.4910 | 303.15 | 215380.00 |
| 0.4910 | 313.15 | 282760.00 |
| 0.4910 | 323.15 | 354670.00 |
| 0.4910 | 333.15 | 431120.00 |
| 0.4910 | 343.15 | 512100.00 |
| 0.5670 | 293.15 | 150530.00 |
| 0.5670 | 303.15 | 213870.00 |
| 0.5670 | 313.15 | 281520.00 |
| 0.5670 | 323.15 | 353470.00 |
| 0.5670 | 333.15 | 429730.00 |
| 0.5670 | 343.15 | 510290.00 |
| 0.6398 | 293.15 | 148280.00 |
| 0.6398 | 303.15 | 211880.00 |
| 0.6398 | 313.15 | 279710.00 |
| 0.6398 | 323.15 | 351740.00 |
| 0.6398 | 333.15 | 428000.00 |
| 0.6398 | 343.15 | 508470.00 |
| 0.6995 | 293.15 | 146460.00 |
| 0.6995 | 303.15 | 210070.00 |
| 0.6995 | 313.15 | 277920.00 |
| 0.6995 | 323.15 | 350010.00 |
| 0.6995 | 333.15 | 426340.00 |
| 0.6995 | 343.15 | 506910.00 |
| 0.7711 | 293.15 | 143630.00 |
| 0.7711 | 303.15 | 207690.00 |
| 0.7711 | 313.15 | 275860.00 |
| 0.7711 | 323.15 | 348140.00 |
| 0.7711 | 333.15 | 424520.00 |
| 0.7711 | 343.15 | 505010.00 |
| 0.8770 | 293.15 | 139440.00 |
| 0.8770 | 303.15 | 203560.00 |
| 0.8770 | 313.15 | 271850.00 |
| 0.8770 | 323.15 | 344320.00 |
| 0.8770 | 333.15 | 420970.00 |
| 0.8770 | 343.15 | 501790.00 |
| 0.9674 | 293.15 | 134840.00 |
| 0.9674 | 303.15 | 198700.00 |
| 0.9674 | 313.15 | 266980.00 |
| 0.9674 | 323.15 | 339710.00 |
| 0.9674 | 333.15 | 416870.00 |
| 0.9674 | 343.15 | 498460.00 |
| 1.0000 | 293.15 | 132350.00 |
| 1.0000 | 303.15 | 196230.00 |
| 1.0000 | 313.15 | 264630.00 |
| 1.0000 | 323.15 | 337550.00 |
| 1.0000 | 333.15 | 415000.00 |
| 1.0000 | 343.15 | 496960.00 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Tridecane (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0105 | 255.26 |
| 0.0438 | 259.35 |
| 0.6022 | 264.12 |
| 0.6383 | 264.75 |
| 0.6761 | 265.39 |
| 0.7217 | 266.08 |
| 0.7639 | 266.48 |
| 0.8194 | 267.02 |
| 0.8769 | 267.57 |
| 0.9335 | 268.26 |
| 0.9828 | 268.80 |
| 1.0000 | 269.01 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Tridecane (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0105 | 255.26 |
| 0.0438 | 259.35 |
| 0.6022 | 264.12 |
| 0.6383 | 264.75 |
| 0.6761 | 265.39 |
| 0.7217 | 266.08 |
| 0.7639 | 266.48 |
| 0.8194 | 267.02 |
| 0.8769 | 267.57 |
| 0.9335 | 268.26 |
| 0.9828 | 268.80 |
| 1.0000 | 269.01 |