- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Acetic acid, methyl ester
- InChI
- InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3
- InChI Key
- KXKVLQRXCPHEJC-UHFFFAOYSA-N
- Formula
- C3H6O2
- SMILES
- COC(C)=O
- Mol. Weight (g/mol)
- 74.08
- CAS
- 79-20-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (4)
- Vapor or sublimation pressure, kPa (2)
Mole fraction of Acetic acid, methyl ester (2) [ref]
Operational condition: Temperature, K = 323.15 (Gas)
| Mole fraction of Acetic acid, methyl ester (2) - Gas | Mole fraction of Acetic acid, methyl ester (2) - Liquid |
|---|---|
| 0.0302 | 0.0048 |
| 0.0644 | 0.0102 |
| 0.1033 | 0.0109 |
| 0.1447 | 0.0251 |
| 0.1713 | 0.0298 |
| 0.2181 | 0.0433 |
| 0.2220 | 0.0430 |
| 0.2987 | 0.0557 |
| 0.3816 | 0.0804 |
| 0.4787 | 0.1147 |
| 0.5803 | 0.1533 |
| 0.6786 | 0.2155 |
| 0.7613 | 0.2893 |
| 0.8352 | 0.3692 |
| 0.9038 | 0.4881 |
| 0.9456 | 0.6140 |
| 0.9718 | 0.7305 |
| 0.9852 | 0.8180 |
Mole fraction of Acetic acid, methyl ester (2) [ref]
Operational condition: Temperature, K = 323.15 (Gas)
| Mole fraction of Acetic acid, methyl ester (2) - Gas | Mole fraction of Acetic acid, methyl ester (2) - Liquid |
|---|---|
| 0.0302 | 0.0048 |
| 0.0644 | 0.0102 |
| 0.1033 | 0.0109 |
| 0.1447 | 0.0251 |
| 0.1713 | 0.0298 |
| 0.2181 | 0.0433 |
| 0.2220 | 0.0430 |
| 0.2987 | 0.0557 |
| 0.3816 | 0.0804 |
| 0.4787 | 0.1147 |
| 0.5803 | 0.1533 |
| 0.6786 | 0.2155 |
| 0.7613 | 0.2893 |
| 0.8352 | 0.3692 |
| 0.9038 | 0.4881 |
| 0.9456 | 0.6140 |
| 0.9718 | 0.7305 |
| 0.9852 | 0.8180 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0004 |
| 293.15 | 0.0496 | 0.0004 |
| 293.15 | 0.0956 | 0.0004 |
| 293.15 | 0.1950 | 0.0005 |
| 293.15 | 0.3007 | 0.0005 |
| 293.15 | 0.3902 | 0.0006 |
| 293.15 | 0.4937 | 0.0006 |
| 293.15 | 0.5953 | 0.0007 |
| 293.15 | 0.6894 | 0.0008 |
| 293.15 | 0.7943 | 0.0009 |
| 293.15 | 0.8987 | 0.0010 |
| 293.15 | 0.9502 | 0.0011 |
| 293.15 | 1.0000 | 0.0012 |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.0496 | 0.0004 |
| 298.15 | 0.0956 | 0.0004 |
| 298.15 | 0.1950 | 0.0004 |
| 298.15 | 0.3007 | 0.0005 |
| 298.15 | 0.3902 | 0.0005 |
| 298.15 | 0.4937 | 0.0006 |
| 298.15 | 0.5953 | 0.0006 |
| 298.15 | 0.6894 | 0.0007 |
| 298.15 | 0.7943 | 0.0008 |
| 298.15 | 0.8987 | 0.0010 |
| 298.15 | 0.9502 | 0.0010 |
| 298.15 | 1.0000 | 0.0011 |
| 303.15 | 0.0000 | 0.0003 |
| 303.15 | 0.0496 | 0.0004 |
| 303.15 | 0.0956 | 0.0004 |
| 303.15 | 0.1950 | 0.0004 |
| 303.15 | 0.3007 | 0.0005 |
| 303.15 | 0.3902 | 0.0005 |
| 303.15 | 0.4937 | 0.0005 |
| 303.15 | 0.5953 | 0.0006 |
| 303.15 | 0.6894 | 0.0007 |
| 303.15 | 0.7943 | 0.0008 |
| 303.15 | 0.8987 | 0.0009 |
| 303.15 | 0.9502 | 0.0010 |
| 303.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0004 |
| 293.15 | 0.0496 | 0.0004 |
| 293.15 | 0.0956 | 0.0004 |
| 293.15 | 0.1950 | 0.0005 |
| 293.15 | 0.3007 | 0.0005 |
| 293.15 | 0.3902 | 0.0006 |
| 293.15 | 0.4937 | 0.0006 |
| 293.15 | 0.5953 | 0.0007 |
| 293.15 | 0.6894 | 0.0008 |
| 293.15 | 0.7943 | 0.0009 |
| 293.15 | 0.8987 | 0.0010 |
| 293.15 | 0.9502 | 0.0011 |
| 293.15 | 1.0000 | 0.0012 |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.0496 | 0.0004 |
| 298.15 | 0.0956 | 0.0004 |
| 298.15 | 0.1950 | 0.0004 |
| 298.15 | 0.3007 | 0.0005 |
| 298.15 | 0.3902 | 0.0005 |
| 298.15 | 0.4937 | 0.0006 |
| 298.15 | 0.5953 | 0.0006 |
| 298.15 | 0.6894 | 0.0007 |
| 298.15 | 0.7943 | 0.0008 |
| 298.15 | 0.8987 | 0.0010 |
| 298.15 | 0.9502 | 0.0010 |
| 298.15 | 1.0000 | 0.0011 |
| 303.15 | 0.0000 | 0.0003 |
| 303.15 | 0.0496 | 0.0004 |
| 303.15 | 0.0956 | 0.0004 |
| 303.15 | 0.1950 | 0.0004 |
| 303.15 | 0.3007 | 0.0005 |
| 303.15 | 0.3902 | 0.0005 |
| 303.15 | 0.4937 | 0.0005 |
| 303.15 | 0.5953 | 0.0006 |
| 303.15 | 0.6894 | 0.0007 |
| 303.15 | 0.7943 | 0.0008 |
| 303.15 | 0.8987 | 0.0009 |
| 303.15 | 0.9502 | 0.0010 |
| 303.15 | 1.0000 | 0.0010 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 933.56 |
| 293.15 | 0.0496 | 938.74 |
| 293.15 | 0.0956 | 943.44 |
| 293.15 | 0.1950 | 953.14 |
| 293.15 | 0.3007 | 963.86 |
| 293.15 | 0.3902 | 973.23 |
| 293.15 | 0.4937 | 984.52 |
| 293.15 | 0.5953 | 996.15 |
| 293.15 | 0.6894 | 1007.51 |
| 293.15 | 0.7943 | 1020.92 |
| 293.15 | 0.8987 | 1034.93 |
| 293.15 | 0.9502 | 1042.19 |
| 293.15 | 1.0000 | 1049.3 |
| 298.15 | 0.0000 | 926.98 |
| 298.15 | 0.0496 | 932.23 |
| 298.15 | 0.0956 | 936.98 |
| 298.15 | 0.1950 | 946.77 |
| 298.15 | 0.3007 | 957.58 |
| 298.15 | 0.3902 | 967.02 |
| 298.15 | 0.4937 | 978.4 |
| 298.15 | 0.5953 | 990.1 |
| 298.15 | 0.6894 | 1001.55 |
| 298.15 | 0.7943 | 1015.05 |
| 298.15 | 0.8987 | 1029.17 |
| 298.15 | 0.9502 | 1036.49 |
| 298.15 | 1.0000 | 1043.65 |
| 303.15 | 0.0000 | 920.34 |
| 303.15 | 0.0496 | 925.65 |
| 303.15 | 0.0956 | 930.46 |
| 303.15 | 0.1950 | 940.34 |
| 303.15 | 0.3007 | 951.24 |
| 303.15 | 0.3902 | 960.77 |
| 303.15 | 0.4937 | 972.24 |
| 303.15 | 0.5953 | 984.03 |
| 303.15 | 0.6894 | 995.56 |
| 303.15 | 0.7943 | 1009.16 |
| 303.15 | 0.8987 | 1023.39 |
| 303.15 | 0.9502 | 1030.77 |
| 303.15 | 1.0000 | 1038.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 933.56 |
| 293.15 | 0.0496 | 938.74 |
| 293.15 | 0.0956 | 943.44 |
| 293.15 | 0.1950 | 953.14 |
| 293.15 | 0.3007 | 963.86 |
| 293.15 | 0.3902 | 973.23 |
| 293.15 | 0.4937 | 984.52 |
| 293.15 | 0.5953 | 996.15 |
| 293.15 | 0.6894 | 1007.51 |
| 293.15 | 0.7943 | 1020.92 |
| 293.15 | 0.8987 | 1034.93 |
| 293.15 | 0.9502 | 1042.19 |
| 293.15 | 1.0000 | 1049.3 |
| 298.15 | 0.0000 | 926.98 |
| 298.15 | 0.0496 | 932.23 |
| 298.15 | 0.0956 | 936.98 |
| 298.15 | 0.1950 | 946.77 |
| 298.15 | 0.3007 | 957.58 |
| 298.15 | 0.3902 | 967.02 |
| 298.15 | 0.4937 | 978.4 |
| 298.15 | 0.5953 | 990.1 |
| 298.15 | 0.6894 | 1001.55 |
| 298.15 | 0.7943 | 1015.05 |
| 298.15 | 0.8987 | 1029.17 |
| 298.15 | 0.9502 | 1036.49 |
| 298.15 | 1.0000 | 1043.65 |
| 303.15 | 0.0000 | 920.34 |
| 303.15 | 0.0496 | 925.65 |
| 303.15 | 0.0956 | 930.46 |
| 303.15 | 0.1950 | 940.34 |
| 303.15 | 0.3007 | 951.24 |
| 303.15 | 0.3902 | 960.77 |
| 303.15 | 0.4937 | 972.24 |
| 303.15 | 0.5953 | 984.03 |
| 303.15 | 0.6894 | 995.56 |
| 303.15 | 0.7943 | 1009.16 |
| 303.15 | 0.8987 | 1023.39 |
| 303.15 | 0.9502 | 1030.77 |
| 303.15 | 1.0000 | 1038.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1174.0 |
| 293.15 | 0.0496 | 1177.0 |
| 293.15 | 0.0956 | 1177.0 |
| 293.15 | 0.1950 | 1177.0 |
| 293.15 | 0.3007 | 1176.0 |
| 293.15 | 0.3902 | 1174.0 |
| 293.15 | 0.4937 | 1172.0 |
| 293.15 | 0.5953 | 1169.0 |
| 293.15 | 0.6894 | 1166.0 |
| 293.15 | 0.7943 | 1162.0 |
| 293.15 | 0.8987 | 1156.0 |
| 293.15 | 0.9502 | 1153.0 |
| 293.15 | 1.0000 | 1149.0 |
| 298.15 | 0.0000 | 1151.0 |
| 298.15 | 0.0496 | 1154.0 |
| 298.15 | 0.0956 | 1155.0 |
| 298.15 | 0.1950 | 1155.0 |
| 298.15 | 0.3007 | 1154.0 |
| 298.15 | 0.3902 | 1153.0 |
| 298.15 | 0.4937 | 1151.0 |
| 298.15 | 0.5953 | 1149.0 |
| 298.15 | 0.6894 | 1147.0 |
| 298.15 | 0.7943 | 1143.0 |
| 298.15 | 0.8987 | 1138.0 |
| 298.15 | 0.9502 | 1136.0 |
| 298.15 | 1.0000 | 1132.0 |
| 303.15 | 0.0000 | 1128.0 |
| 303.15 | 0.0496 | 1131.0 |
| 303.15 | 0.0956 | 1133.0 |
| 303.15 | 0.1950 | 1133.0 |
| 303.15 | 0.3007 | 1133.0 |
| 303.15 | 0.3902 | 1132.0 |
| 303.15 | 0.4937 | 1131.0 |
| 303.15 | 0.5953 | 1129.0 |
| 303.15 | 0.6894 | 1127.0 |
| 303.15 | 0.7943 | 1124.0 |
| 303.15 | 0.8987 | 1120.0 |
| 303.15 | 0.9502 | 1118.0 |
| 303.15 | 1.0000 | 1115.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1174.0 |
| 293.15 | 0.0496 | 1177.0 |
| 293.15 | 0.0956 | 1177.0 |
| 293.15 | 0.1950 | 1177.0 |
| 293.15 | 0.3007 | 1176.0 |
| 293.15 | 0.3902 | 1174.0 |
| 293.15 | 0.4937 | 1172.0 |
| 293.15 | 0.5953 | 1169.0 |
| 293.15 | 0.6894 | 1166.0 |
| 293.15 | 0.7943 | 1162.0 |
| 293.15 | 0.8987 | 1156.0 |
| 293.15 | 0.9502 | 1153.0 |
| 293.15 | 1.0000 | 1149.0 |
| 298.15 | 0.0000 | 1151.0 |
| 298.15 | 0.0496 | 1154.0 |
| 298.15 | 0.0956 | 1155.0 |
| 298.15 | 0.1950 | 1155.0 |
| 298.15 | 0.3007 | 1154.0 |
| 298.15 | 0.3902 | 1153.0 |
| 298.15 | 0.4937 | 1151.0 |
| 298.15 | 0.5953 | 1149.0 |
| 298.15 | 0.6894 | 1147.0 |
| 298.15 | 0.7943 | 1143.0 |
| 298.15 | 0.8987 | 1138.0 |
| 298.15 | 0.9502 | 1136.0 |
| 298.15 | 1.0000 | 1132.0 |
| 303.15 | 0.0000 | 1128.0 |
| 303.15 | 0.0496 | 1131.0 |
| 303.15 | 0.0956 | 1133.0 |
| 303.15 | 0.1950 | 1133.0 |
| 303.15 | 0.3007 | 1133.0 |
| 303.15 | 0.3902 | 1132.0 |
| 303.15 | 0.4937 | 1131.0 |
| 303.15 | 0.5953 | 1129.0 |
| 303.15 | 0.6894 | 1127.0 |
| 303.15 | 0.7943 | 1124.0 |
| 303.15 | 0.8987 | 1120.0 |
| 303.15 | 0.9502 | 1118.0 |
| 303.15 | 1.0000 | 1115.0 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 77.3 (Liquid)
| Mole fraction of Acetic acid, methyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.1830 | 360.85 |
| 0.2790 | 353.85 |
| 0.4930 | 336.95 |
| 0.5650 | 335.65 |
| 0.7430 | 327.85 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 77.3 (Gas)
| Mole fraction of Acetic acid, methyl ester (2) - Gas | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.5380 | 360.85 |
| 0.7430 | 353.85 |
| 0.8730 | 336.95 |
| 0.9390 | 335.65 |
| 0.9870 | 327.85 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 77.3 (Liquid)
| Mole fraction of Acetic acid, methyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.1830 | 360.85 |
| 0.2790 | 353.85 |
| 0.4930 | 336.95 |
| 0.5650 | 335.65 |
| 0.7430 | 327.85 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 77.3 (Gas)
| Mole fraction of Acetic acid, methyl ester (2) - Gas | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.5380 | 360.85 |
| 0.7430 | 353.85 |
| 0.8730 | 336.95 |
| 0.9390 | 335.65 |
| 0.9870 | 327.85 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 323.15 (Gas)
| Mole fraction of Acetic acid, methyl ester (2) - Gas | Vapor or sublimation pressure, kPa - Gas |
|---|---|
| 0.0000 | 7.72 |
| 0.0302 | 8.06 |
| 0.0644 | 8.47 |
| 0.1033 | 9.06 |
| 0.1447 | 9.58 |
| 0.1713 | 9.91 |
| 0.2181 | 10.92 |
| 0.2220 | 10.80 |
| 0.2987 | 12.12 |
| 0.3816 | 13.88 |
| 0.4787 | 16.56 |
| 0.5803 | 19.47 |
| 0.6786 | 24.34 |
| 0.7613 | 30.07 |
| 0.8352 | 36.62 |
| 0.9038 | 44.91 |
| 0.9456 | 53.89 |
| 0.9718 | 61.53 |
| 0.9852 | 67.03 |
| 1.0000 | 79.21 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 323.15 (Gas)
| Mole fraction of Acetic acid, methyl ester (2) - Gas | Vapor or sublimation pressure, kPa - Gas |
|---|---|
| 0.0000 | 7.72 |
| 0.0302 | 8.06 |
| 0.0644 | 8.47 |
| 0.1033 | 9.06 |
| 0.1447 | 9.58 |
| 0.1713 | 9.91 |
| 0.2181 | 10.92 |
| 0.2220 | 10.80 |
| 0.2987 | 12.12 |
| 0.3816 | 13.88 |
| 0.4787 | 16.56 |
| 0.5803 | 19.47 |
| 0.6786 | 24.34 |
| 0.7613 | 30.07 |
| 0.8352 | 36.62 |
| 0.9038 | 44.91 |
| 0.9456 | 53.89 |
| 0.9718 | 61.53 |
| 0.9852 | 67.03 |
| 1.0000 | 79.21 |
Sources
- Isothermal vapour liquid equilibrium with chemical reaction in the quaternary water + methanol + acetic acid + methyl acetate system, and in five binary subsystems
- Experimental measurements of vapor liquid equilibria at low pressure: Systems containing alcohols, esters and organic acids
- Dynamic Viscosities, Densities, and Speed of Sound and Derived Properties of the Binary Systems Acetic Acid with Water, Methanol, Ethanol, Ethyl Acetate and Methyl Acetate at T = (293.15, 298.15, and 303.15) K at Atmospheric Pressure