- Name
- Acetaminophen
- InChI
- InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)
- InChI Key
- RZVAJINKPMORJF-UHFFFAOYSA-N
- Formula
- C8H9NO2
- SMILES
- CC(=O)Nc1ccc(O)cc1
- Mol. Weight (g/mol)
- 151.16
- CAS
- 103-90-2
- Name
- Methyl Alcohol
- InChI
- InChI=1S/CH4O/c1-2/h2H,1H3
- InChI Key
- OKKJLVBELUTLKV-UHFFFAOYSA-N
- Formula
- CH4O
- SMILES
- CO
- Mol. Weight (g/mol)
- 32.04
- CAS
- 67-56-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Osmotic coefficient [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Methyl Alcohol (2) - Liquid | Osmotic coefficient - Liquid |
|---|---|
| 0.0931 | 0.9980 |
| 0.1398 | 1.001 |
| 0.2163 | 1.001 |
| 0.3514 | 1.0000 |
| 0.5633 | 1.002 |
| 1.0057 | 1.009 |
| 1.2361 | 1.01 |
| 1.3998 | 1.015 |
| 1.578 | 1.017 |
| 1.8661 | 1.02 |
| 2.4648 | 1.027 |
| 2.7619 | 1.033 |
| 3.0965 | 1.041 |
| 3.5603 | 1.055 |
| 3.974 | 1.068 |
| 4.1748 | 1.075 |
| 4.8118 | 1.099 |
| 5.3165 | 1.12 |
| 6.17 | 1.159 |
| 6.4178 | 1.171 |
| 6.8331 | 1.193 |
| 7.0732 | 1.206 |
Osmotic coefficient [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Methyl Alcohol (2) - Liquid | Osmotic coefficient - Liquid |
|---|---|
| 0.0931 | 0.9980 |
| 0.1398 | 1.001 |
| 0.2163 | 1.001 |
| 0.3514 | 1.0000 |
| 0.5633 | 1.002 |
| 1.0057 | 1.009 |
| 1.2361 | 1.01 |
| 1.3998 | 1.015 |
| 1.578 | 1.017 |
| 1.8661 | 1.02 |
| 2.4648 | 1.027 |
| 2.7619 | 1.033 |
| 3.0965 | 1.041 |
| 3.5603 | 1.055 |
| 3.974 | 1.068 |
| 4.1748 | 1.075 |
| 4.8118 | 1.099 |
| 5.3165 | 1.12 |
| 6.17 | 1.159 |
| 6.4178 | 1.171 |
| 6.8331 | 1.193 |
| 7.0732 | 1.206 |
Mole fraction of Acetaminophen (1) [ref]
Operational condition: Pressure, kPa = 125 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (1) - Liquid |
|---|---|
| 293.45 | 0.0594 |
| 303.55 | 0.0730 |
| 313.95 | 0.0906 |
| 323.35 | 0.1105 |
| 330.95 | 0.1328 |
| 341.55 | 0.1749 |
| 354.15 | 0.2288 |
Mole fraction of Acetaminophen (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (1) - Liquid |
|---|---|
| 293.15 | 0.0594 |
| 303.15 | 0.0730 |
| 313.15 | 0.0906 |
Mole fraction of Acetaminophen (1) [ref]
Operational condition: Pressure, kPa = 125 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (1) - Liquid |
|---|---|
| 293.45 | 0.0594 |
| 303.55 | 0.0730 |
| 313.95 | 0.0906 |
| 323.35 | 0.1105 |
| 330.95 | 0.1328 |
| 341.55 | 0.1749 |
| 354.15 | 0.2288 |
Mole fraction of Acetaminophen (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (1) - Liquid |
|---|---|
| 293.15 | 0.0594 |
| 303.15 | 0.0730 |
| 313.15 | 0.0906 |