- Name
- Benzene, nitro-
- InChI
- InChI=1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H
- InChI Key
- LQNUZADURLCDLV-UHFFFAOYSA-N
- Formula
- C6H5NO2
- SMILES
- O=[N+]([O-])c1ccccc1
- Mol. Weight (g/mol)
- 123.11
- CAS
- 98-95-3
- Name
- Benzene, bromo-
- InChI
- InChI=1S/C6H5Br/c7-6-4-2-1-3-5-6/h1-5H
- InChI Key
- QARVLSVVCXYDNA-UHFFFAOYSA-N
- Formula
- C6H5Br
- SMILES
- Brc1ccccc1
- Mol. Weight (g/mol)
- 157.01
- CAS
- 108-86-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- Tboil - Boiling temperature at pressure P, K (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, bromo- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 1.0000 | 1.5598 |
| 293.15 | 0.8963 | 1.5591 |
| 293.15 | 0.8018 | 1.5584 |
| 293.15 | 0.6987 | 1.5576 |
| 293.15 | 0.5974 | 1.5569 |
| 293.15 | 0.5050 | 1.5562 |
| 293.15 | 0.3968 | 1.5554 |
| 293.15 | 0.2985 | 1.5547 |
| 293.15 | 0.2013 | 1.5539 |
| 293.15 | 0.0998 | 1.5532 |
| 293.15 | 0.0000 | 1.5524 |
| 303.15 | 1.0000 | 1.5544 |
| 303.15 | 0.8963 | 1.5537 |
| 303.15 | 0.8018 | 1.5531 |
| 303.15 | 0.6987 | 1.5525 |
| 303.15 | 0.5974 | 1.5518 |
| 303.15 | 0.5050 | 1.5512 |
| 303.15 | 0.3968 | 1.5504 |
| 303.15 | 0.2985 | 1.5497 |
| 303.15 | 0.2013 | 1.5491 |
| 303.15 | 0.0998 | 1.5483 |
| 303.15 | 0.0000 | 1.5476 |
| 313.15 | 1.0000 | 1.5489 |
| 313.15 | 0.8963 | 1.5483 |
| 313.15 | 0.8018 | 1.5478 |
| 313.15 | 0.6987 | 1.5472 |
| 313.15 | 0.5974 | 1.5466 |
| 313.15 | 0.5050 | 1.546 |
| 313.15 | 0.3968 | 1.5454 |
| 313.15 | 0.2985 | 1.5448 |
| 313.15 | 0.2013 | 1.5442 |
| 313.15 | 0.0998 | 1.5435 |
| 313.15 | 0.0000 | 1.5429 |
| 323.15 | 1.0000 | 1.5432 |
| 323.15 | 0.8963 | 1.5427 |
| 323.15 | 0.8018 | 1.5422 |
| 323.15 | 0.6987 | 1.5417 |
| 323.15 | 0.5974 | 1.5412 |
| 323.15 | 0.5050 | 1.5407 |
| 323.15 | 0.3968 | 1.5401 |
| 323.15 | 0.2985 | 1.5396 |
| 323.15 | 0.2013 | 1.5391 |
| 323.15 | 0.0998 | 1.5385 |
| 323.15 | 0.0000 | 1.5379 |
| 333.15 | 1.0000 | 1.5374 |
| 333.15 | 0.8963 | 1.5375 |
| 333.15 | 0.8018 | 1.537 |
| 333.15 | 0.6987 | 1.5365 |
| 333.15 | 0.5974 | 1.536 |
| 333.15 | 0.5050 | 1.5356 |
| 333.15 | 0.3968 | 1.535 |
| 333.15 | 0.2985 | 1.5345 |
| 333.15 | 0.2013 | 1.534 |
| 333.15 | 0.0998 | 1.5334 |
| 333.15 | 0.0000 | 1.5329 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, bromo- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 1.0000 | 1.5598 |
| 293.15 | 0.8963 | 1.5591 |
| 293.15 | 0.8018 | 1.5584 |
| 293.15 | 0.6987 | 1.5576 |
| 293.15 | 0.5974 | 1.5569 |
| 293.15 | 0.5050 | 1.5562 |
| 293.15 | 0.3968 | 1.5554 |
| 293.15 | 0.2985 | 1.5547 |
| 293.15 | 0.2013 | 1.5539 |
| 293.15 | 0.0998 | 1.5532 |
| 293.15 | 0.0000 | 1.5524 |
| 303.15 | 1.0000 | 1.5544 |
| 303.15 | 0.8963 | 1.5537 |
| 303.15 | 0.8018 | 1.5531 |
| 303.15 | 0.6987 | 1.5525 |
| 303.15 | 0.5974 | 1.5518 |
| 303.15 | 0.5050 | 1.5512 |
| 303.15 | 0.3968 | 1.5504 |
| 303.15 | 0.2985 | 1.5497 |
| 303.15 | 0.2013 | 1.5491 |
| 303.15 | 0.0998 | 1.5483 |
| 303.15 | 0.0000 | 1.5476 |
| 313.15 | 1.0000 | 1.5489 |
| 313.15 | 0.8963 | 1.5483 |
| 313.15 | 0.8018 | 1.5478 |
| 313.15 | 0.6987 | 1.5472 |
| 313.15 | 0.5974 | 1.5466 |
| 313.15 | 0.5050 | 1.546 |
| 313.15 | 0.3968 | 1.5454 |
| 313.15 | 0.2985 | 1.5448 |
| 313.15 | 0.2013 | 1.5442 |
| 313.15 | 0.0998 | 1.5435 |
| 313.15 | 0.0000 | 1.5429 |
| 323.15 | 1.0000 | 1.5432 |
| 323.15 | 0.8963 | 1.5427 |
| 323.15 | 0.8018 | 1.5422 |
| 323.15 | 0.6987 | 1.5417 |
| 323.15 | 0.5974 | 1.5412 |
| 323.15 | 0.5050 | 1.5407 |
| 323.15 | 0.3968 | 1.5401 |
| 323.15 | 0.2985 | 1.5396 |
| 323.15 | 0.2013 | 1.5391 |
| 323.15 | 0.0998 | 1.5385 |
| 323.15 | 0.0000 | 1.5379 |
| 333.15 | 1.0000 | 1.5374 |
| 333.15 | 0.8963 | 1.5375 |
| 333.15 | 0.8018 | 1.537 |
| 333.15 | 0.6987 | 1.5365 |
| 333.15 | 0.5974 | 1.536 |
| 333.15 | 0.5050 | 1.5356 |
| 333.15 | 0.3968 | 1.535 |
| 333.15 | 0.2985 | 1.5345 |
| 333.15 | 0.2013 | 1.534 |
| 333.15 | 0.0998 | 1.5334 |
| 333.15 | 0.0000 | 1.5329 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, bromo- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 1.0000 | 1495.52 |
| 293.15 | 0.8963 | 1464.97 |
| 293.15 | 0.8018 | 1437.33 |
| 293.15 | 0.6987 | 1407.3 |
| 293.15 | 0.5974 | 1377.81 |
| 293.15 | 0.5050 | 1350.9 |
| 293.15 | 0.3968 | 1319.31 |
| 293.15 | 0.2985 | 1290.56 |
| 293.15 | 0.2013 | 1262.07 |
| 293.15 | 0.0998 | 1232.31 |
| 293.15 | 0.0000 | 1203.05 |
| 303.15 | 1.0000 | 1481.97 |
| 303.15 | 0.8963 | 1451.69 |
| 303.15 | 0.8018 | 1424.41 |
| 303.15 | 0.6987 | 1394.76 |
| 303.15 | 0.5974 | 1365.65 |
| 303.15 | 0.5050 | 1339.07 |
| 303.15 | 0.3968 | 1307.88 |
| 303.15 | 0.2985 | 1279.49 |
| 303.15 | 0.2013 | 1251.35 |
| 303.15 | 0.0998 | 1221.95 |
| 303.15 | 0.0000 | 1193.15 |
| 313.15 | 1.0000 | 1468.41 |
| 313.15 | 0.8963 | 1438.42 |
| 313.15 | 0.8018 | 1411.45 |
| 313.15 | 0.6987 | 1382.18 |
| 313.15 | 0.5974 | 1353.48 |
| 313.15 | 0.5050 | 1327.25 |
| 313.15 | 0.3968 | 1296.44 |
| 313.15 | 0.2985 | 1268.39 |
| 313.15 | 0.2013 | 1240.6 |
| 313.15 | 0.0998 | 1211.59 |
| 313.15 | 0.0000 | 1183.21 |
| 323.15 | 1.0000 | 1454.85 |
| 323.15 | 0.8963 | 1425.19 |
| 323.15 | 0.8018 | 1398.53 |
| 323.15 | 0.6987 | 1369.62 |
| 323.15 | 0.5974 | 1341.27 |
| 323.15 | 0.5050 | 1315.36 |
| 323.15 | 0.3968 | 1284.95 |
| 323.15 | 0.2985 | 1257.29 |
| 323.15 | 0.2013 | 1229.85 |
| 323.15 | 0.0998 | 1201.25 |
| 323.15 | 0.0000 | 1173.27 |
| 333.15 | 1.0000 | 1441.22 |
| 333.15 | 0.8963 | 1411.84 |
| 333.15 | 0.8018 | 1385.53 |
| 333.15 | 0.6987 | 1357.01 |
| 333.15 | 0.5974 | 1329.01 |
| 333.15 | 0.5050 | 1303.45 |
| 333.15 | 0.3968 | 1273.45 |
| 333.15 | 0.2985 | 1246.12 |
| 333.15 | 0.2013 | 1219.06 |
| 333.15 | 0.0998 | 1190.87 |
| 333.15 | 0.0000 | 1163.32 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, bromo- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 1.0000 | 1495.52 |
| 293.15 | 0.8963 | 1464.97 |
| 293.15 | 0.8018 | 1437.33 |
| 293.15 | 0.6987 | 1407.3 |
| 293.15 | 0.5974 | 1377.81 |
| 293.15 | 0.5050 | 1350.9 |
| 293.15 | 0.3968 | 1319.31 |
| 293.15 | 0.2985 | 1290.56 |
| 293.15 | 0.2013 | 1262.07 |
| 293.15 | 0.0998 | 1232.31 |
| 293.15 | 0.0000 | 1203.05 |
| 303.15 | 1.0000 | 1481.97 |
| 303.15 | 0.8963 | 1451.69 |
| 303.15 | 0.8018 | 1424.41 |
| 303.15 | 0.6987 | 1394.76 |
| 303.15 | 0.5974 | 1365.65 |
| 303.15 | 0.5050 | 1339.07 |
| 303.15 | 0.3968 | 1307.88 |
| 303.15 | 0.2985 | 1279.49 |
| 303.15 | 0.2013 | 1251.35 |
| 303.15 | 0.0998 | 1221.95 |
| 303.15 | 0.0000 | 1193.15 |
| 313.15 | 1.0000 | 1468.41 |
| 313.15 | 0.8963 | 1438.42 |
| 313.15 | 0.8018 | 1411.45 |
| 313.15 | 0.6987 | 1382.18 |
| 313.15 | 0.5974 | 1353.48 |
| 313.15 | 0.5050 | 1327.25 |
| 313.15 | 0.3968 | 1296.44 |
| 313.15 | 0.2985 | 1268.39 |
| 313.15 | 0.2013 | 1240.6 |
| 313.15 | 0.0998 | 1211.59 |
| 313.15 | 0.0000 | 1183.21 |
| 323.15 | 1.0000 | 1454.85 |
| 323.15 | 0.8963 | 1425.19 |
| 323.15 | 0.8018 | 1398.53 |
| 323.15 | 0.6987 | 1369.62 |
| 323.15 | 0.5974 | 1341.27 |
| 323.15 | 0.5050 | 1315.36 |
| 323.15 | 0.3968 | 1284.95 |
| 323.15 | 0.2985 | 1257.29 |
| 323.15 | 0.2013 | 1229.85 |
| 323.15 | 0.0998 | 1201.25 |
| 323.15 | 0.0000 | 1173.27 |
| 333.15 | 1.0000 | 1441.22 |
| 333.15 | 0.8963 | 1411.84 |
| 333.15 | 0.8018 | 1385.53 |
| 333.15 | 0.6987 | 1357.01 |
| 333.15 | 0.5974 | 1329.01 |
| 333.15 | 0.5050 | 1303.45 |
| 333.15 | 0.3968 | 1273.45 |
| 333.15 | 0.2985 | 1246.12 |
| 333.15 | 0.2013 | 1219.06 |
| 333.15 | 0.0998 | 1190.87 |
| 333.15 | 0.0000 | 1163.32 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 94.95 (Liquid)
| Mole fraction of Benzene, bromo- (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 481.15 |
| 0.0652 | 478.25 |
| 0.1302 | 474.95 |
| 0.2154 | 470.65 |
| 0.3100 | 465.65 |
| 0.3805 | 461.85 |
| 0.4515 | 457.85 |
| 0.5175 | 454.05 |
| 0.5844 | 450.15 |
| 0.6695 | 445.05 |
| 0.7598 | 439.65 |
| 0.8105 | 436.65 |
| 0.8636 | 433.55 |
| 1.0000 | 426.85 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 94.95 (Liquid)
| Mole fraction of Benzene, bromo- (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 481.15 |
| 0.0652 | 478.25 |
| 0.1302 | 474.95 |
| 0.2154 | 470.65 |
| 0.3100 | 465.65 |
| 0.3805 | 461.85 |
| 0.4515 | 457.85 |
| 0.5175 | 454.05 |
| 0.5844 | 450.15 |
| 0.6695 | 445.05 |
| 0.7598 | 439.65 |
| 0.8105 | 436.65 |
| 0.8636 | 433.55 |
| 1.0000 | 426.85 |
Sources
- Excess Gibbs energies of binary mixtures formed by nitrobenzene with selected compounds at 94.95 kPa
- Volumetric and electromagnetic properties of binary mixtures consist of benzene derivatives at different temperature and ternary mixtures with 1,2-dichloroethane at T = 293.15 K with application of the Prigogine-Flory-Patterson theory and PC-SAFT