- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- 2-Pyrrolidinone, 1-methyl-
- InChI
- InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3
- InChI Key
- SECXISVLQFMRJM-UHFFFAOYSA-N
- Formula
- C5H9NO
- SMILES
- CN1CCCC1=O
- Mol. Weight (g/mol)
- 99.13
- CAS
- 872-50-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Activity coefficient (2)
- Excess molar enthalpy (molar enthalpy (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Vapor Liquid Equilibrium at Constant Pressure
- Vapor Liquid Equilibrium at Constant Temperature (2)
- Excess molar volume, m3/mol (2)
Activity coefficient of Isopropyl Alcohol (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Isopropyl Alcohol (1) - Liquid |
|---|---|
| 333.20 | 0.6270 |
| 348.20 | 0.6390 |
| 363.20 | 0.6320 |
Activity coefficient of Isopropyl Alcohol (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Isopropyl Alcohol (1) - Liquid |
|---|---|
| 333.20 | 0.6270 |
| 348.20 | 0.6390 |
| 363.20 | 0.6320 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0516 | 0.2965 |
| 0.1082 | 0.5727 |
| 0.1702 | 0.7968 |
| 0.2279 | 0.9323 |
| 0.2894 | 1.0036 |
| 0.3471 | 1.0393 |
| 0.4059 | 1.0289 |
| 0.4562 | 0.9944 |
| 0.5950 | 0.7296 |
| 0.6888 | 0.6137 |
| 0.7874 | 0.4743 |
| 0.8920 | 0.2711 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0516 | 0.2965 |
| 0.1082 | 0.5727 |
| 0.1702 | 0.7968 |
| 0.2279 | 0.9323 |
| 0.2894 | 1.0036 |
| 0.3471 | 1.0393 |
| 0.4059 | 1.0289 |
| 0.4562 | 0.9944 |
| 0.5950 | 0.7296 |
| 0.6888 | 0.6137 |
| 0.7874 | 0.4743 |
| 0.8920 | 0.2711 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.3 (Liquid)
| Mole fraction of Isopropyl Alcohol (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 473.25 |
| 0.0821 | 454.25 |
| 0.1727 | 435.25 |
| 0.3430 | 406.95 |
| 0.5562 | 381.95 |
| 0.6347 | 374.85 |
| 0.7782 | 364.25 |
| 0.8979 | 357.55 |
| 0.9438 | 355.65 |
| 1.0000 | 353.85 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.3 (Liquid)
| Mole fraction of Isopropyl Alcohol (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 473.25 |
| 0.0821 | 454.25 |
| 0.1727 | 435.25 |
| 0.3430 | 406.95 |
| 0.5562 | 381.95 |
| 0.6347 | 374.85 |
| 0.7782 | 364.25 |
| 0.8979 | 357.55 |
| 0.9438 | 355.65 |
| 1.0000 | 353.85 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 95.3 (VLE)
| T [K] - VLE | x1[mol/mol] of Isopropyl Alcohol (1) - Liquid |
|---|---|
| 473.25 | 0.0000 |
| 454.25 | 0.0821 |
| 435.25 | 0.1727 |
| 406.95 | 0.3430 |
| 381.95 | 0.5562 |
| 374.85 | 0.6347 |
| 364.25 | 0.7782 |
| 357.55 | 0.8979 |
| 355.65 | 0.9438 |
| 353.85 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 353.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Isopropyl Alcohol (1) - Liquid |
|---|---|
| 1.3 | 0.0000 |
| 16.5 | 0.2353 |
| 19.0 | 0.2796 |
| 21.7 | 0.3239 |
| 24.401 | 0.3499 |
| 26.6 | 0.3811 |
| 29.4 | 0.4205 |
| 31.4 | 0.4406 |
| 34.0 | 0.4595 |
| 40.501 | 0.5302 |
| 43.9 | 0.5600 |
| 46.7 | 0.5921 |
| 49.9 | 0.6128 |
| 53.2 | 0.6470 |
| 56.299 | 0.6730 |
| 59.7 | 0.7112 |
| 63.3 | 0.7343 |
| 67.4 | 0.7682 |
| 71.099 | 0.7955 |
| 74.401 | 0.8358 |
| 78.1 | 0.8658 |
| 82.0 | 0.9002 |
| 85.8 | 0.9302 |
| 88.099 | 0.9472 |
| 92.7 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 373.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Isopropyl Alcohol (1) - Liquid |
|---|---|
| 3.6 | 0.0000 |
| 11.1 | 0.0650 |
| 14.3 | 0.0891 |
| 16.5 | 0.1021 |
| 20.3 | 0.1330 |
| 36.6 | 0.2549 |
| 45.6 | 0.3247 |
| 61.6 | 0.4216 |
| 67.7 | 0.4465 |
| 75.8 | 0.5003 |
| 80.6 | 0.5249 |
| 84.1 | 0.5448 |
| 87.699 | 0.5619 |
| 91.001 | 0.5819 |
| 98.0 | 0.6128 |
| 104.599 | 0.6519 |
| 111.7 | 0.6748 |
| 197.7 | 1.0000 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.1498 | -5.2000e-08 |
| 0.2066 | -7.8000e-08 |
| 0.3202 | -1.2900e-07 |
| 0.4317 | -1.5700e-07 |
| 0.5027 | -1.6200e-07 |
| 0.5854 | -1.6600e-07 |
| 0.7216 | -1.4200e-07 |
| 0.8148 | -1.0600e-07 |
| 0.9062 | -5.8000e-08 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.1498 | -5.2000e-08 |
| 0.2066 | -7.8000e-08 |
| 0.3202 | -1.2900e-07 |
| 0.4317 | -1.5700e-07 |
| 0.5027 | -1.6200e-07 |
| 0.5854 | -1.6600e-07 |
| 0.7216 | -1.4200e-07 |
| 0.8148 | -1.0600e-07 |
| 0.9062 | -5.8000e-08 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Excess volumes and excess enthalpies of N-methyl-2-pyrrolidone with branched alcohols
- Isobaric (vapour + liquid) equilibrium for N-methyl-2-pyrrolidone with branched alcohols
- Activity coefficients at infinite dilution of organic solutes in N-formylmorpholine and N-methylpyrrolidone from gas-liquid chromatography