- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Acetic acid, methyl ester
- InChI
- InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3
- InChI Key
- KXKVLQRXCPHEJC-UHFFFAOYSA-N
- Formula
- C3H6O2
- SMILES
- COC(C)=O
- Mol. Weight (g/mol)
- 74.08
- CAS
- 79-20-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Pvap - Vapor or sublimation pressure, kPa (4)
- ρg - Mass density, kg/m3 (2)
- ρl - Mass density, kg/m3 (4)
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 313.15 (Liquid)
| Mole fraction of Carbon dioxide (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.1000 | 622.00 |
| 0.2000 | 1209.00 |
| 0.3000 | 1920.00 |
| 0.4000 | 2601.00 |
| 0.5000 | 3484.00 |
| 0.6000 | 4243.00 |
| 0.7000 | 5050.00 |
| 0.8000 | 6047.00 |
| 0.9000 | 7060.00 |
| 0.9500 | 7828.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mass fraction of Acetic acid, methyl ester (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.9500 | 320.00 |
| 0.9000 | 635.00 |
| 0.8500 | 980.00 |
| 0.8000 | 1320.00 |
| 0.7500 | 1653.00 |
| 0.7000 | 1952.00 |
| 0.6500 | 2247.00 |
| 0.6000 | 2593.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 313.15 (Liquid)
| Mole fraction of Carbon dioxide (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.1000 | 622.00 |
| 0.2000 | 1209.00 |
| 0.3000 | 1920.00 |
| 0.4000 | 2601.00 |
| 0.5000 | 3484.00 |
| 0.6000 | 4243.00 |
| 0.7000 | 5050.00 |
| 0.8000 | 6047.00 |
| 0.9000 | 7060.00 |
| 0.9500 | 7828.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mass fraction of Acetic acid, methyl ester (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.9500 | 320.00 |
| 0.9000 | 635.00 |
| 0.8500 | 980.00 |
| 0.8000 | 1320.00 |
| 0.7500 | 1653.00 |
| 0.7000 | 1952.00 |
| 0.6500 | 2247.00 |
| 0.6000 | 2593.00 |
Mass density, kg/m3 [ref]
Operational condition: Temperature, K = 313.15 (Gas)
| Pressure, kPa - Gas | Mass density, kg/m3 - Gas |
|---|---|
| 1313.00 | 26.5 |
| 2111.00 | 42.7 |
| 4099.00 | 93.3 |
| 4532.00 | 105.6 |
| 6361.00 | 181.8 |
| 7114.00 | 231.4 |
Mass density, kg/m3 [ref]
Operational condition: Temperature, K = 313.15 (Gas)
| Pressure, kPa - Gas | Mass density, kg/m3 - Gas |
|---|---|
| 1313.00 | 26.5 |
| 2111.00 | 42.7 |
| 4099.00 | 93.3 |
| 4532.00 | 105.6 |
| 6361.00 | 181.8 |
| 7114.00 | 231.4 |
Mass density, kg/m3 [ref]
Operational condition: Temperature, K = 313.15 (Liquid)
| Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 1313.00 | 912.6 |
| 2111.00 | 914.2 |
| 4099.00 | 904.3 |
| 4532.00 | 897.7 |
| 6361.00 | 830.4 |
| 7114.00 | 769.1 |
Mass density, kg/m3 [ref]
Operational condition: Temperature, K = 313.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Mass density, kg/m3 - Liquid |
| 1000.00 | 0.0000 | 907.9 |
| 1000.00 | 0.1000 | 910.0 |
| 2000.00 | 0.0000 | 908.9 |
| 2000.00 | 0.1000 | 911.1 |
| 2000.00 | 0.2000 | 913.9 |
| 3000.00 | 0.0000 | 909.7 |
| 3000.00 | 0.1000 | 912.4 |
| 3000.00 | 0.2000 | 915.2 |
| 4000.00 | 0.0000 | 910.9 |
| 4000.00 | 0.1000 | 913.5 |
| 4000.00 | 0.2000 | 916.6 |
| 4000.00 | 0.3000 | 917.1 |
| 4000.00 | 0.4000 | 917.4 |
| 5000.00 | 0.0000 | 912.0 |
| 5000.00 | 0.1000 | 914.7 |
| 5000.00 | 0.2000 | 917.9 |
| 5000.00 | 0.3000 | 918.6 |
| 5000.00 | 0.4000 | 919.2 |
| 5000.00 | 0.5000 | 915.4 |
| 6000.00 | 0.0000 | 913.1 |
| 6000.00 | 0.1000 | 915.9 |
| 6000.00 | 0.2000 | 919.1 |
| 6000.00 | 0.3000 | 920.1 |
| 6000.00 | 0.4000 | 920.9 |
| 6000.00 | 0.5000 | 917.5 |
| 6000.00 | 0.6000 | 909.0 |
| 6000.00 | 0.7000 | 891.8 |
| 7000.00 | 0.0000 | 914.1 |
| 7000.00 | 0.1000 | 917.0 |
| 7000.00 | 0.2000 | 920.4 |
| 7000.00 | 0.3000 | 921.5 |
| 7000.00 | 0.4000 | 922.7 |
| 7000.00 | 0.5000 | 919.6 |
| 7000.00 | 0.6000 | 912.8 |
| 7000.00 | 0.7000 | 895.9 |
| 7000.00 | 0.8000 | 861.5 |
| 8000.00 | 0.0000 | 915.1 |
| 8000.00 | 0.1000 | 918.1 |
| 8000.00 | 0.2000 | 921.7 |
| 8000.00 | 0.3000 | 922.9 |
| 8000.00 | 0.4000 | 924.3 |
| 8000.00 | 0.5000 | 921.6 |
| 8000.00 | 0.6000 | 915.5 |
| 8000.00 | 0.7000 | 899.7 |
| 8000.00 | 0.8000 | 868.2 |
| 8000.00 | 0.9000 | 793.5 |
| 9000.00 | 0.0000 | 916.1 |
| 9000.00 | 0.1000 | 919.2 |
| 9000.00 | 0.2000 | 922.9 |
| 9000.00 | 0.3000 | 924.3 |
| 9000.00 | 0.4000 | 925.9 |
| 9000.00 | 0.5000 | 923.7 |
| 9000.00 | 0.6000 | 918.1 |
| 9000.00 | 0.7000 | 903.5 |
| 9000.00 | 0.8000 | 873.8 |
| 9000.00 | 0.9000 | 808.0 |
| 9000.00 | 0.9500 | 734.6 |
| 10000.00 | 0.0000 | 917.1 |
| 10000.00 | 0.1000 | 920.3 |
| 10000.00 | 0.2000 | 924.1 |
| 10000.00 | 0.3000 | 925.7 |
| 10000.00 | 0.4000 | 927.5 |
| 10000.00 | 0.5000 | 925.6 |
| 10000.00 | 0.6000 | 920.7 |
| 10000.00 | 0.7000 | 907.0 |
| 10000.00 | 0.8000 | 879.5 |
| 10000.00 | 0.9000 | 820.3 |
| 10000.00 | 0.9500 | 759.7 |
Mass density, kg/m3 [ref]
Operational condition: Temperature, K = 313.15 (Liquid)
| Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 1313.00 | 912.6 |
| 2111.00 | 914.2 |
| 4099.00 | 904.3 |
| 4532.00 | 897.7 |
| 6361.00 | 830.4 |
| 7114.00 | 769.1 |
Mass density, kg/m3 [ref]
Operational condition: Temperature, K = 313.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Mass density, kg/m3 - Liquid |
| 1000.00 | 0.0000 | 907.9 |
| 1000.00 | 0.1000 | 910.0 |
| 2000.00 | 0.0000 | 908.9 |
| 2000.00 | 0.1000 | 911.1 |
| 2000.00 | 0.2000 | 913.9 |
| 3000.00 | 0.0000 | 909.7 |
| 3000.00 | 0.1000 | 912.4 |
| 3000.00 | 0.2000 | 915.2 |
| 4000.00 | 0.0000 | 910.9 |
| 4000.00 | 0.1000 | 913.5 |
| 4000.00 | 0.2000 | 916.6 |
| 4000.00 | 0.3000 | 917.1 |
| 4000.00 | 0.4000 | 917.4 |
| 5000.00 | 0.0000 | 912.0 |
| 5000.00 | 0.1000 | 914.7 |
| 5000.00 | 0.2000 | 917.9 |
| 5000.00 | 0.3000 | 918.6 |
| 5000.00 | 0.4000 | 919.2 |
| 5000.00 | 0.5000 | 915.4 |
| 6000.00 | 0.0000 | 913.1 |
| 6000.00 | 0.1000 | 915.9 |
| 6000.00 | 0.2000 | 919.1 |
| 6000.00 | 0.3000 | 920.1 |
| 6000.00 | 0.4000 | 920.9 |
| 6000.00 | 0.5000 | 917.5 |
| 6000.00 | 0.6000 | 909.0 |
| 6000.00 | 0.7000 | 891.8 |
| 7000.00 | 0.0000 | 914.1 |
| 7000.00 | 0.1000 | 917.0 |
| 7000.00 | 0.2000 | 920.4 |
| 7000.00 | 0.3000 | 921.5 |
| 7000.00 | 0.4000 | 922.7 |
| 7000.00 | 0.5000 | 919.6 |
| 7000.00 | 0.6000 | 912.8 |
| 7000.00 | 0.7000 | 895.9 |
| 7000.00 | 0.8000 | 861.5 |
| 8000.00 | 0.0000 | 915.1 |
| 8000.00 | 0.1000 | 918.1 |
| 8000.00 | 0.2000 | 921.7 |
| 8000.00 | 0.3000 | 922.9 |
| 8000.00 | 0.4000 | 924.3 |
| 8000.00 | 0.5000 | 921.6 |
| 8000.00 | 0.6000 | 915.5 |
| 8000.00 | 0.7000 | 899.7 |
| 8000.00 | 0.8000 | 868.2 |
| 8000.00 | 0.9000 | 793.5 |
| 9000.00 | 0.0000 | 916.1 |
| 9000.00 | 0.1000 | 919.2 |
| 9000.00 | 0.2000 | 922.9 |
| 9000.00 | 0.3000 | 924.3 |
| 9000.00 | 0.4000 | 925.9 |
| 9000.00 | 0.5000 | 923.7 |
| 9000.00 | 0.6000 | 918.1 |
| 9000.00 | 0.7000 | 903.5 |
| 9000.00 | 0.8000 | 873.8 |
| 9000.00 | 0.9000 | 808.0 |
| 9000.00 | 0.9500 | 734.6 |
| 10000.00 | 0.0000 | 917.1 |
| 10000.00 | 0.1000 | 920.3 |
| 10000.00 | 0.2000 | 924.1 |
| 10000.00 | 0.3000 | 925.7 |
| 10000.00 | 0.4000 | 927.5 |
| 10000.00 | 0.5000 | 925.6 |
| 10000.00 | 0.6000 | 920.7 |
| 10000.00 | 0.7000 | 907.0 |
| 10000.00 | 0.8000 | 879.5 |
| 10000.00 | 0.9000 | 820.3 |
| 10000.00 | 0.9500 | 759.7 |