- Name
- Diethanolamine
- InChI
- InChI=1S/C4H11NO2/c6-3-1-5-2-4-7/h5-7H,1-4H2
- InChI Key
- ZBCBWPMODOFKDW-UHFFFAOYSA-N
- Formula
- C4H11NO2
- SMILES
- OCCNCCO
- Mol. Weight (g/mol)
- 105.14
- CAS
- 111-42-2
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0999 | 0.2627 |
| 303.15 | 0.2999 | 0.1254 |
| 303.15 | 0.4687 | 0.0635 |
| 303.15 | 0.6712 | 0.0150 |
| 303.15 | 0.8322 | 0.0126 |
| 323.15 | 0.0999 | 0.0731 |
| 323.15 | 0.2999 | 0.0327 |
| 323.15 | 0.4687 | 0.0153 |
| 323.15 | 0.6712 | 0.0095 |
| 323.15 | 0.8322 | 0.0074 |
| 373.15 | 0.0999 | 0.0087 |
| 373.15 | 0.2999 | 0.0066 |
| 373.15 | 0.4687 | 0.0050 |
| 373.15 | 0.6712 | 0.0036 |
| 373.15 | 0.8322 | 0.0030 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0999 | 0.2627 |
| 303.15 | 0.2999 | 0.1254 |
| 303.15 | 0.4687 | 0.0635 |
| 303.15 | 0.6712 | 0.0150 |
| 303.15 | 0.8322 | 0.0126 |
| 323.15 | 0.0999 | 0.0731 |
| 323.15 | 0.2999 | 0.0327 |
| 323.15 | 0.4687 | 0.0153 |
| 323.15 | 0.6712 | 0.0095 |
| 323.15 | 0.8322 | 0.0074 |
| 373.15 | 0.0999 | 0.0087 |
| 373.15 | 0.2999 | 0.0066 |
| 373.15 | 0.4687 | 0.0050 |
| 373.15 | 0.6712 | 0.0036 |
| 373.15 | 0.8322 | 0.0030 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0999 | 1110.0 |
| 303.15 | 0.2999 | 1145.1 |
| 303.15 | 0.4687 | 1171.2 |
| 303.15 | 0.6712 | 1203.0 |
| 303.15 | 0.8322 | 1228.3 |
| 323.15 | 0.0999 | 1094.8 |
| 323.15 | 0.2999 | 1126.7 |
| 323.15 | 0.4687 | 1151.6 |
| 323.15 | 0.6712 | 1182.9 |
| 323.15 | 0.8322 | 1208.2 |
| 373.15 | 0.0999 | 1060.7 |
| 373.15 | 0.2999 | 1089.4 |
| 373.15 | 0.4687 | 1112.0 |
| 373.15 | 0.6712 | 1141.5 |
| 373.15 | 0.8322 | 1166.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0999 | 1110.0 |
| 303.15 | 0.2999 | 1145.1 |
| 303.15 | 0.4687 | 1171.2 |
| 303.15 | 0.6712 | 1203.0 |
| 303.15 | 0.8322 | 1228.3 |
| 323.15 | 0.0999 | 1094.8 |
| 323.15 | 0.2999 | 1126.7 |
| 323.15 | 0.4687 | 1151.6 |
| 323.15 | 0.6712 | 1182.9 |
| 323.15 | 0.8322 | 1208.2 |
| 373.15 | 0.0999 | 1060.7 |
| 373.15 | 0.2999 | 1089.4 |
| 373.15 | 0.4687 | 1112.0 |
| 373.15 | 0.6712 | 1141.5 |
| 373.15 | 0.8322 | 1166.0 |