- Name
- Monoethanolamine
- InChI
- InChI=1S/C2H7NO/c3-1-2-4/h4H,1-3H2
- InChI Key
- HZAXFHJVJLSVMW-UHFFFAOYSA-N
- Formula
- C2H7NO
- SMILES
- NCCO
- Mol. Weight (g/mol)
- 61.08
- CAS
- 141-43-5
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Monoethanolamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.1000 | 0.0140 |
| 303.15 | 0.3369 | 0.0115 |
| 303.15 | 0.5426 | 0.0099 |
| 303.15 | 0.7423 | 0.0095 |
| 303.15 | 0.8999 | 0.0098 |
| 323.15 | 0.1000 | 0.0071 |
| 323.15 | 0.3369 | 0.0062 |
| 323.15 | 0.5426 | 0.0058 |
| 323.15 | 0.7423 | 0.0059 |
| 323.15 | 0.8999 | 0.0062 |
| 373.15 | 0.1000 | 0.0025 |
| 373.15 | 0.3369 | 0.0027 |
| 373.15 | 0.5426 | 0.0028 |
| 373.15 | 0.7423 | 0.0029 |
| 373.15 | 0.8999 | 0.0028 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Monoethanolamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.1000 | 0.0140 |
| 303.15 | 0.3369 | 0.0115 |
| 303.15 | 0.5426 | 0.0099 |
| 303.15 | 0.7423 | 0.0095 |
| 303.15 | 0.8999 | 0.0098 |
| 323.15 | 0.1000 | 0.0071 |
| 323.15 | 0.3369 | 0.0062 |
| 323.15 | 0.5426 | 0.0058 |
| 323.15 | 0.7423 | 0.0059 |
| 323.15 | 0.8999 | 0.0062 |
| 373.15 | 0.1000 | 0.0025 |
| 373.15 | 0.3369 | 0.0027 |
| 373.15 | 0.5426 | 0.0028 |
| 373.15 | 0.7423 | 0.0029 |
| 373.15 | 0.8999 | 0.0028 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.1000 | 1043.5 |
| 303.15 | 0.3369 | 1116.9 |
| 303.15 | 0.5426 | 1170.0 |
| 303.15 | 0.7423 | 1213.4 |
| 303.15 | 0.8999 | 1243.0 |
| 323.15 | 0.1000 | 1026.1 |
| 323.15 | 0.3369 | 1098.9 |
| 323.15 | 0.5426 | 1151.2 |
| 323.15 | 0.7423 | 1194.0 |
| 323.15 | 0.8999 | 1223.3 |
| 373.15 | 0.1000 | 984.0 |
| 373.15 | 0.3369 | 1055.6 |
| 373.15 | 0.5426 | 1106.5 |
| 373.15 | 0.7423 | 1148.6 |
| 373.15 | 0.8999 | 1184.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.1000 | 1043.5 |
| 303.15 | 0.3369 | 1116.9 |
| 303.15 | 0.5426 | 1170.0 |
| 303.15 | 0.7423 | 1213.4 |
| 303.15 | 0.8999 | 1243.0 |
| 323.15 | 0.1000 | 1026.1 |
| 323.15 | 0.3369 | 1098.9 |
| 323.15 | 0.5426 | 1151.2 |
| 323.15 | 0.7423 | 1194.0 |
| 323.15 | 0.8999 | 1223.3 |
| 373.15 | 0.1000 | 984.0 |
| 373.15 | 0.3369 | 1055.6 |
| 373.15 | 0.5426 | 1106.5 |
| 373.15 | 0.7423 | 1148.6 |
| 373.15 | 0.8999 | 1184.0 |