- Name
- Propane, 1,2-dichloro-
- InChI
- InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3
- InChI Key
- KNKRKFALVUDBJE-UHFFFAOYSA-N
- Formula
- C3H6Cl2
- SMILES
- CC(Cl)CCl
- Mol. Weight (g/mol)
- 112.99
- CAS
- 78-87-5
- Name
- Ethanol, 2-(2-butoxyethoxy)-
- InChI
- InChI=1S/C8H18O3/c1-2-3-5-10-7-8-11-6-4-9/h9H,2-8H2,1H3
- InChI Key
- OAYXUHPQHDHDDZ-UHFFFAOYSA-N
- Formula
- C8H18O3
- SMILES
- CCCCOCCOCCO
- Mol. Weight (g/mol)
- 162.23
- CAS
- 112-34-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- ρl - Mass density, kg/m3 (2)
- Excess molar volume, m3/mol (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Propane, 1,2-dichloro- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0660 | -0.1633 |
| 0.0980 | -0.2087 |
| 0.1610 | -0.3080 |
| 0.1910 | -0.3600 |
| 0.2480 | -0.4114 |
| 0.3030 | -0.4491 |
| 0.3550 | -0.4689 |
| 0.4040 | -0.4729 |
| 0.4500 | -0.4621 |
| 0.4950 | -0.4405 |
| 0.5580 | -0.3916 |
| 0.5980 | -0.3566 |
| 0.6540 | -0.2870 |
| 0.7070 | -0.2149 |
| 0.7570 | -0.1436 |
| 0.8030 | -0.0779 |
| 0.8470 | -0.0190 |
| 0.9020 | 0.0350 |
| 0.9530 | 0.0412 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Propane, 1,2-dichloro- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0660 | -0.1633 |
| 0.0980 | -0.2087 |
| 0.1610 | -0.3080 |
| 0.1910 | -0.3600 |
| 0.2480 | -0.4114 |
| 0.3030 | -0.4491 |
| 0.3550 | -0.4689 |
| 0.4040 | -0.4729 |
| 0.4500 | -0.4621 |
| 0.4950 | -0.4405 |
| 0.5580 | -0.3916 |
| 0.5980 | -0.3566 |
| 0.6540 | -0.2870 |
| 0.7070 | -0.2149 |
| 0.7570 | -0.1436 |
| 0.8030 | -0.0779 |
| 0.8470 | -0.0190 |
| 0.9020 | 0.0350 |
| 0.9530 | 0.0412 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Propane, 1,2-dichloro- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0520 | 954.88 |
| 0.1000 | 961.07 |
| 0.1550 | 968.38 |
| 0.1997 | 974.56 |
| 0.2496 | 981.76 |
| 0.3037 | 989.93 |
| 0.3497 | 997.2 |
| 0.4033 | 1006.02 |
| 0.4504 | 1014.14 |
| 0.4998 | 1023.03 |
| 0.5535 | 1033.23 |
| 0.6001 | 1042.57 |
| 0.6494 | 1052.96 |
| 0.7024 | 1064.78 |
| 0.7527 | 1076.67 |
| 0.8024 | 1089.22 |
| 0.8488 | 1101.75 |
| 0.9010 | 1116.84 |
| 0.9479 | 1131.48 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Propane, 1,2-dichloro- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0520 | 954.88 |
| 0.1000 | 961.07 |
| 0.1550 | 968.38 |
| 0.1997 | 974.56 |
| 0.2496 | 981.76 |
| 0.3037 | 989.93 |
| 0.3497 | 997.2 |
| 0.4033 | 1006.02 |
| 0.4504 | 1014.14 |
| 0.4998 | 1023.03 |
| 0.5535 | 1033.23 |
| 0.6001 | 1042.57 |
| 0.6494 | 1052.96 |
| 0.7024 | 1064.78 |
| 0.7527 | 1076.67 |
| 0.8024 | 1089.22 |
| 0.8488 | 1101.75 |
| 0.9010 | 1116.84 |
| 0.9479 | 1131.48 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Propane, 1,2-dichloro- (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0520 | -4.7600e-08 |
| 0.1000 | -9.3400e-08 |
| 0.1550 | -1.2760e-07 |
| 0.1997 | -1.4700e-07 |
| 0.2496 | -1.6920e-07 |
| 0.3037 | -1.8790e-07 |
| 0.3497 | -1.9800e-07 |
| 0.4033 | -1.9970e-07 |
| 0.4504 | -1.9580e-07 |
| 0.4998 | -1.8130e-07 |
| 0.5535 | -1.6500e-07 |
| 0.6001 | -1.4780e-07 |
| 0.6494 | -1.2270e-07 |
| 0.7024 | -9.4500e-08 |
| 0.7527 | -6.2000e-08 |
| 0.8024 | -3.3500e-08 |
| 0.8488 | -1.6800e-08 |
| 0.9010 | 0.0000 |
| 0.9479 | 0.0000 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Propane, 1,2-dichloro- (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0520 | -4.7600e-08 |
| 0.1000 | -9.3400e-08 |
| 0.1550 | -1.2760e-07 |
| 0.1997 | -1.4700e-07 |
| 0.2496 | -1.6920e-07 |
| 0.3037 | -1.8790e-07 |
| 0.3497 | -1.9800e-07 |
| 0.4033 | -1.9970e-07 |
| 0.4504 | -1.9580e-07 |
| 0.4998 | -1.8130e-07 |
| 0.5535 | -1.6500e-07 |
| 0.6001 | -1.4780e-07 |
| 0.6494 | -1.2270e-07 |
| 0.7024 | -9.4500e-08 |
| 0.7527 | -6.2000e-08 |
| 0.8024 | -3.3500e-08 |
| 0.8488 | -1.6800e-08 |
| 0.9010 | 0.0000 |
| 0.9479 | 0.0000 |