- Name
- Ethane, pentafluoro-
- InChI
- InChI=1S/C2HF5/c3-1(4)2(5,6)7/h1H
- InChI Key
- GTLACDSXYULKMZ-UHFFFAOYSA-N
- Formula
- C2HF5
- SMILES
- FC(F)C(F)(F)F
- Mol. Weight (g/mol)
- 120.02
- CAS
- 354-33-6
- Name
- Ethane, 1,1-difluoro-
- InChI
- InChI=1S/C2H4F2/c1-2(3)4/h2H,1H3
- InChI Key
- NPNPZTNLOVBDOC-UHFFFAOYSA-N
- Formula
- C2H4F2
- SMILES
- CC(F)F
- Mol. Weight (g/mol)
- 66.05
- CAS
- 75-37-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (4)
- γ - Surface tension liquid-gas, N/m (2)
- λ - Thermal conductivity, W/m/K (2)
- λ - Thermal conductivity, W/m/K (2)
Viscosity, Pa*s [ref]
Operational condition: Mole fraction = 0.5 (Gas)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Gas | Temperature, K - Gas | Viscosity, Pa*s - Gas |
| 3130.00 | 383.20 | 0.0000 |
| 2780.00 | 363.20 | 0.0000 |
| 2010.00 | 363.20 | 0.0000 |
| 1800.00 | 343.20 | 0.0000 |
| 1090.00 | 343.20 | 0.0000 |
| 990.00 | 323.20 | 0.0000 |
Viscosity, Pa*s [ref]
Operational condition: Mole fraction = 0.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 1200.00 | 294.30 | 0.0002 |
| 1500.00 | 294.30 | 0.0002 |
| 2000.00 | 294.30 | 0.0002 |
| 3000.00 | 294.30 | 0.0002 |
| 4000.00 | 294.30 | 0.0002 |
| 1510.00 | 274.50 | 0.0002 |
| 2000.00 | 274.50 | 0.0002 |
| 2510.00 | 274.50 | 0.0002 |
| 3020.00 | 274.50 | 0.0002 |
| 4010.00 | 274.50 | 0.0002 |
| 1510.00 | 263.10 | 0.0003 |
| 2010.00 | 263.10 | 0.0003 |
| 2510.00 | 263.10 | 0.0003 |
| 3020.00 | 263.10 | 0.0003 |
| 4010.00 | 263.10 | 0.0003 |
| 1020.00 | 252.10 | 0.0003 |
| 2000.00 | 252.10 | 0.0003 |
| 2500.00 | 252.10 | 0.0003 |
| 3000.00 | 252.10 | 0.0003 |
| 4000.00 | 252.10 | 0.0003 |
Viscosity, Pa*s [ref]
Operational condition: Mole fraction = 0.5 (Gas)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Gas | Temperature, K - Gas | Viscosity, Pa*s - Gas |
| 3130.00 | 383.20 | 0.0000 |
| 2780.00 | 363.20 | 0.0000 |
| 2010.00 | 363.20 | 0.0000 |
| 1800.00 | 343.20 | 0.0000 |
| 1090.00 | 343.20 | 0.0000 |
| 990.00 | 323.20 | 0.0000 |
Viscosity, Pa*s [ref]
Operational condition: Mole fraction = 0.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 1200.00 | 294.30 | 0.0002 |
| 1500.00 | 294.30 | 0.0002 |
| 2000.00 | 294.30 | 0.0002 |
| 3000.00 | 294.30 | 0.0002 |
| 4000.00 | 294.30 | 0.0002 |
| 1510.00 | 274.50 | 0.0002 |
| 2000.00 | 274.50 | 0.0002 |
| 2510.00 | 274.50 | 0.0002 |
| 3020.00 | 274.50 | 0.0002 |
| 4010.00 | 274.50 | 0.0002 |
| 1510.00 | 263.10 | 0.0003 |
| 2010.00 | 263.10 | 0.0003 |
| 2510.00 | 263.10 | 0.0003 |
| 3020.00 | 263.10 | 0.0003 |
| 4010.00 | 263.10 | 0.0003 |
| 1020.00 | 252.10 | 0.0003 |
| 2000.00 | 252.10 | 0.0003 |
| 2500.00 | 252.10 | 0.0003 |
| 3000.00 | 252.10 | 0.0003 |
| 4000.00 | 252.10 | 0.0003 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Ethane, pentafluoro- (1) - Liquid | Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 0.0970 | 243.16 | 0.0170 |
| 0.0970 | 248.13 | 0.0162 |
| 0.0970 | 253.55 | 0.0153 |
| 0.0970 | 258.11 | 0.0146 |
| 0.0970 | 263.06 | 0.0139 |
| 0.0970 | 268.12 | 0.0133 |
| 0.0970 | 273.18 | 0.0125 |
| 0.0970 | 278.18 | 0.0118 |
| 0.0970 | 283.13 | 0.0112 |
| 0.0970 | 288.17 | 0.0106 |
| 0.0970 | 293.17 | 0.0098 |
| 0.0970 | 298.10 | 0.0092 |
| 0.0970 | 303.17 | 0.0085 |
| 0.0970 | 308.10 | 0.0079 |
| 0.0970 | 313.16 | 0.0072 |
| 0.0970 | 318.12 | 0.0065 |
| 0.0970 | 323.16 | 0.0058 |
| 0.0970 | 328.11 | 0.0052 |
| 0.2019 | 243.08 | 0.0165 |
| 0.2019 | 248.09 | 0.0158 |
| 0.2019 | 253.12 | 0.0151 |
| 0.2019 | 258.16 | 0.0144 |
| 0.2019 | 263.19 | 0.0135 |
| 0.2019 | 268.17 | 0.0129 |
| 0.2019 | 273.19 | 0.0122 |
| 0.2019 | 278.42 | 0.0114 |
| 0.2019 | 283.15 | 0.0106 |
| 0.2019 | 288.16 | 0.0099 |
| 0.2019 | 293.14 | 0.0094 |
| 0.2019 | 298.08 | 0.0088 |
| 0.2019 | 303.13 | 0.0080 |
| 0.2019 | 308.10 | 0.0074 |
| 0.2019 | 313.11 | 0.0067 |
| 0.2019 | 318.11 | 0.0061 |
| 0.2019 | 323.14 | 0.0054 |
| 0.2019 | 328.10 | 0.0048 |
| 0.2996 | 243.22 | 0.0156 |
| 0.2996 | 248.12 | 0.0150 |
| 0.2996 | 253.13 | 0.0143 |
| 0.2996 | 258.16 | 0.0137 |
| 0.2996 | 263.17 | 0.0130 |
| 0.2996 | 268.18 | 0.0122 |
| 0.2996 | 273.18 | 0.0114 |
| 0.2996 | 278.17 | 0.0106 |
| 0.2996 | 283.17 | 0.0101 |
| 0.2996 | 288.18 | 0.0095 |
| 0.2996 | 293.18 | 0.0087 |
| 0.2996 | 298.11 | 0.0080 |
| 0.2996 | 303.18 | 0.0074 |
| 0.2996 | 308.12 | 0.0067 |
| 0.2996 | 313.19 | 0.0061 |
| 0.2996 | 318.16 | 0.0055 |
| 0.2996 | 323.17 | 0.0050 |
| 0.2996 | 328.16 | 0.0043 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Ethane, pentafluoro- (1) - Liquid | Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 0.0970 | 243.16 | 0.0170 |
| 0.0970 | 248.13 | 0.0162 |
| 0.0970 | 253.55 | 0.0153 |
| 0.0970 | 258.11 | 0.0146 |
| 0.0970 | 263.06 | 0.0139 |
| 0.0970 | 268.12 | 0.0133 |
| 0.0970 | 273.18 | 0.0125 |
| 0.0970 | 278.18 | 0.0118 |
| 0.0970 | 283.13 | 0.0112 |
| 0.0970 | 288.17 | 0.0106 |
| 0.0970 | 293.17 | 0.0098 |
| 0.0970 | 298.10 | 0.0092 |
| 0.0970 | 303.17 | 0.0085 |
| 0.0970 | 308.10 | 0.0079 |
| 0.0970 | 313.16 | 0.0072 |
| 0.0970 | 318.12 | 0.0065 |
| 0.0970 | 323.16 | 0.0058 |
| 0.0970 | 328.11 | 0.0052 |
| 0.2019 | 243.08 | 0.0165 |
| 0.2019 | 248.09 | 0.0158 |
| 0.2019 | 253.12 | 0.0151 |
| 0.2019 | 258.16 | 0.0144 |
| 0.2019 | 263.19 | 0.0135 |
| 0.2019 | 268.17 | 0.0129 |
| 0.2019 | 273.19 | 0.0122 |
| 0.2019 | 278.42 | 0.0114 |
| 0.2019 | 283.15 | 0.0106 |
| 0.2019 | 288.16 | 0.0099 |
| 0.2019 | 293.14 | 0.0094 |
| 0.2019 | 298.08 | 0.0088 |
| 0.2019 | 303.13 | 0.0080 |
| 0.2019 | 308.10 | 0.0074 |
| 0.2019 | 313.11 | 0.0067 |
| 0.2019 | 318.11 | 0.0061 |
| 0.2019 | 323.14 | 0.0054 |
| 0.2019 | 328.10 | 0.0048 |
| 0.2996 | 243.22 | 0.0156 |
| 0.2996 | 248.12 | 0.0150 |
| 0.2996 | 253.13 | 0.0143 |
| 0.2996 | 258.16 | 0.0137 |
| 0.2996 | 263.17 | 0.0130 |
| 0.2996 | 268.18 | 0.0122 |
| 0.2996 | 273.18 | 0.0114 |
| 0.2996 | 278.17 | 0.0106 |
| 0.2996 | 283.17 | 0.0101 |
| 0.2996 | 288.18 | 0.0095 |
| 0.2996 | 293.18 | 0.0087 |
| 0.2996 | 298.11 | 0.0080 |
| 0.2996 | 303.18 | 0.0074 |
| 0.2996 | 308.12 | 0.0067 |
| 0.2996 | 313.19 | 0.0061 |
| 0.2996 | 318.16 | 0.0055 |
| 0.2996 | 323.17 | 0.0050 |
| 0.2996 | 328.16 | 0.0043 |
Thermal conductivity, W/m/K [ref]
Operational condition: Mole fraction = 0.5 (Gas)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Gas | Temperature, K - Gas | Thermal conductivity, W/m/K - Gas |
| 1110.00 | 335.90 | 0.0178 |
| 1220.00 | 353.92 | 0.0193 |
| 1710.00 | 353.81 | 0.0195 |
| 1920.00 | 374.25 | 0.0231 |
| 2760.00 | 374.33 | 0.0237 |
| 3110.00 | 393.94 | 0.0256 |
Thermal conductivity, W/m/K [ref]
Operational condition: Mole fraction = 0.5 (Gas)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Gas | Temperature, K - Gas | Thermal conductivity, W/m/K - Gas |
| 1110.00 | 335.90 | 0.0178 |
| 1220.00 | 353.92 | 0.0193 |
| 1710.00 | 353.81 | 0.0195 |
| 1920.00 | 374.25 | 0.0231 |
| 2760.00 | 374.33 | 0.0237 |
| 3110.00 | 393.94 | 0.0256 |
Thermal conductivity, W/m/K [ref]
Operational condition: Mole fraction = 0.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Thermal conductivity, W/m/K - Liquid |
| 1000.00 | 264.90 | 0.0845 |
| 1000.00 | 284.70 | 0.0799 |
| 2010.00 | 294.83 | 0.0774 |
| 2140.00 | 273.97 | 0.0856 |
| 3030.00 | 294.68 | 0.0789 |
| 3080.00 | 314.10 | 0.0646 |
Thermal conductivity, W/m/K [ref]
Operational condition: Mole fraction = 0.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Thermal conductivity, W/m/K - Liquid |
| 1000.00 | 264.90 | 0.0845 |
| 1000.00 | 284.70 | 0.0799 |
| 2010.00 | 294.83 | 0.0774 |
| 2140.00 | 273.97 | 0.0856 |
| 3030.00 | 294.68 | 0.0789 |
| 3080.00 | 314.10 | 0.0646 |