- Name
- Furfural
- InChI
- InChI=1S/C5H4O2/c6-4-5-2-1-3-7-5/h1-4H
- InChI Key
- HYBBIBNJHNGZAN-UHFFFAOYSA-N
- Formula
- C5H4O2
- SMILES
- O=Cc1ccco1
- Mol. Weight (g/mol)
- 96.08
- CAS
- 98-01-1
- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Temperature, K x Mass fraction (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Furfural (1) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Furfural (1) - Liquid mixture 1 |
| 288.20 | 0.0020 | 0.9789 | 0.1396 | 0.0967 |
| 288.20 | 0.0040 | 0.9797 | 0.1522 | 0.1708 |
| 288.20 | 0.0064 | 0.9797 | 0.1606 | 0.2734 |
| 288.20 | 0.0084 | 0.9810 | 0.1774 | 0.3527 |
| 288.20 | 0.0110 | 0.9808 | 0.1895 | 0.4801 |
| 288.20 | 0.0140 | 0.9820 | 0.2000 | 0.6166 |
| 303.20 | 0.0022 | 0.9854 | 0.0238 | 0.1777 |
| 303.20 | 0.0054 | 0.9814 | 0.0548 | 0.1958 |
| 303.20 | 0.0084 | 0.9799 | 0.0863 | 0.2095 |
| 303.20 | 0.0104 | 0.9785 | 0.1052 | 0.2345 |
| 303.20 | 0.0128 | 0.9852 | 0.1361 | 0.2474 |
| 303.20 | 0.0169 | 0.9824 | 0.1713 | 0.2466 |
| 318.20 | 0.0023 | 0.9856 | 0.2013 | 0.0939 |
| 318.20 | 0.0062 | 0.9832 | 0.2329 | 0.2263 |
| 318.20 | 0.0084 | 0.9819 | 0.2406 | 0.2922 |
| 318.20 | 0.0110 | 0.9795 | 0.2621 | 0.3504 |
| 318.20 | 0.0117 | 0.9800 | 0.2609 | 0.3963 |
| 318.20 | 0.0139 | 0.9787 | 0.2737 | 0.4497 |
| 318.20 | 0.0147 | 0.9797 | 0.2717 | 0.4989 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Furfural (1) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Furfural (1) - Liquid mixture 1 |
| 288.20 | 0.0020 | 0.9789 | 0.1396 | 0.0967 |
| 288.20 | 0.0040 | 0.9797 | 0.1522 | 0.1708 |
| 288.20 | 0.0064 | 0.9797 | 0.1606 | 0.2734 |
| 288.20 | 0.0084 | 0.9810 | 0.1774 | 0.3527 |
| 288.20 | 0.0110 | 0.9808 | 0.1895 | 0.4801 |
| 288.20 | 0.0140 | 0.9820 | 0.2000 | 0.6166 |
| 303.20 | 0.0022 | 0.9854 | 0.0238 | 0.1777 |
| 303.20 | 0.0054 | 0.9814 | 0.0548 | 0.1958 |
| 303.20 | 0.0084 | 0.9799 | 0.0863 | 0.2095 |
| 303.20 | 0.0104 | 0.9785 | 0.1052 | 0.2345 |
| 303.20 | 0.0128 | 0.9852 | 0.1361 | 0.2474 |
| 303.20 | 0.0169 | 0.9824 | 0.1713 | 0.2466 |
| 318.20 | 0.0023 | 0.9856 | 0.2013 | 0.0939 |
| 318.20 | 0.0062 | 0.9832 | 0.2329 | 0.2263 |
| 318.20 | 0.0084 | 0.9819 | 0.2406 | 0.2922 |
| 318.20 | 0.0110 | 0.9795 | 0.2621 | 0.3504 |
| 318.20 | 0.0117 | 0.9800 | 0.2609 | 0.3963 |
| 318.20 | 0.0139 | 0.9787 | 0.2737 | 0.4497 |
| 318.20 | 0.0147 | 0.9797 | 0.2717 | 0.4989 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.20 | 0.0285 | 0.0000 | 1.3747 |
| 288.20 | 0.0292 | 0.1507 | 1.3955 |
| 288.20 | 0.0307 | 0.1777 | 1.399 |
| 288.20 | 0.0326 | 0.2242 | 1.4054 |
| 288.20 | 0.0361 | 0.3151 | 1.4184 |
| 288.20 | 0.0363 | 0.4068 | 1.4318 |
| 288.20 | 0.0419 | 0.5217 | 1.45 |
| 288.20 | 0.0440 | 0.9560 | 1.5203 |
| 288.20 | 0.0447 | 0.8131 | 1.4963 |
| 303.20 | 0.0346 | 0.0000 | 1.3673 |
| 303.20 | 0.0404 | 0.1157 | 1.3826 |
| 303.20 | 0.0480 | 0.2378 | 1.3996 |
| 303.20 | 0.0507 | 0.3586 | 1.4174 |
| 303.20 | 0.0566 | 0.4729 | 1.4346 |
| 303.20 | 0.0574 | 0.5716 | 1.4494 |
| 303.20 | 0.0593 | 0.9407 | 1.5107 |
| 303.20 | 0.0602 | 0.8052 | 1.4873 |
| 303.20 | 0.0603 | 0.7538 | 1.4787 |
| 318.20 | 0.0469 | 0.0000 | 1.3596 |
| 318.20 | 0.0501 | 0.1199 | 1.3756 |
| 318.20 | 0.0528 | 0.1911 | 1.3857 |
| 318.20 | 0.0592 | 0.3150 | 1.4031 |
| 318.20 | 0.0672 | 0.6509 | 1.4545 |
| 318.20 | 0.0684 | 0.7433 | 1.4704 |
| 318.20 | 0.0685 | 0.5372 | 1.4377 |
| 318.20 | 0.0694 | 0.9306 | 1.5024 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.20 | 0.9033 | 0.0523 | 1.347 |
| 288.20 | 0.9091 | 0.0620 | 1.348 |
| 288.20 | 0.9117 | 0.0000 | 1.3404 |
| 288.20 | 0.9118 | 0.0229 | 1.343 |
| 288.20 | 0.9305 | 0.0695 | 1.3464 |
| 303.20 | 0.9082 | 0.0524 | 1.3437 |
| 303.20 | 0.9118 | 0.0295 | 1.3417 |
| 303.20 | 0.9172 | 0.0592 | 1.3444 |
| 303.20 | 0.9180 | 0.0820 | 1.3469 |
| 303.20 | 0.9239 | 0.0000 | 1.3372 |
| 318.20 | 0.9078 | 0.0681 | 1.3434 |
| 318.20 | 0.9095 | 0.0490 | 1.3412 |
| 318.20 | 0.9114 | 0.0385 | 1.3404 |
| 318.20 | 0.9129 | 0.0711 | 1.3437 |
| 318.20 | 0.9154 | 0.0208 | 1.3375 |
| 318.20 | 0.9165 | 0.0835 | 1.3445 |
| 318.20 | 0.9340 | 0.0000 | 1.3349 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.20 | 0.0285 | 0.0000 | 1.3747 |
| 288.20 | 0.0292 | 0.1507 | 1.3955 |
| 288.20 | 0.0307 | 0.1777 | 1.399 |
| 288.20 | 0.0326 | 0.2242 | 1.4054 |
| 288.20 | 0.0361 | 0.3151 | 1.4184 |
| 288.20 | 0.0363 | 0.4068 | 1.4318 |
| 288.20 | 0.0419 | 0.5217 | 1.45 |
| 288.20 | 0.0440 | 0.9560 | 1.5203 |
| 288.20 | 0.0447 | 0.8131 | 1.4963 |
| 303.20 | 0.0346 | 0.0000 | 1.3673 |
| 303.20 | 0.0404 | 0.1157 | 1.3826 |
| 303.20 | 0.0480 | 0.2378 | 1.3996 |
| 303.20 | 0.0507 | 0.3586 | 1.4174 |
| 303.20 | 0.0566 | 0.4729 | 1.4346 |
| 303.20 | 0.0574 | 0.5716 | 1.4494 |
| 303.20 | 0.0593 | 0.9407 | 1.5107 |
| 303.20 | 0.0602 | 0.8052 | 1.4873 |
| 303.20 | 0.0603 | 0.7538 | 1.4787 |
| 318.20 | 0.0469 | 0.0000 | 1.3596 |
| 318.20 | 0.0501 | 0.1199 | 1.3756 |
| 318.20 | 0.0528 | 0.1911 | 1.3857 |
| 318.20 | 0.0592 | 0.3150 | 1.4031 |
| 318.20 | 0.0672 | 0.6509 | 1.4545 |
| 318.20 | 0.0684 | 0.7433 | 1.4704 |
| 318.20 | 0.0685 | 0.5372 | 1.4377 |
| 318.20 | 0.0694 | 0.9306 | 1.5024 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.20 | 0.9033 | 0.0523 | 1.347 |
| 288.20 | 0.9091 | 0.0620 | 1.348 |
| 288.20 | 0.9117 | 0.0000 | 1.3404 |
| 288.20 | 0.9118 | 0.0229 | 1.343 |
| 288.20 | 0.9305 | 0.0695 | 1.3464 |
| 303.20 | 0.9082 | 0.0524 | 1.3437 |
| 303.20 | 0.9118 | 0.0295 | 1.3417 |
| 303.20 | 0.9172 | 0.0592 | 1.3444 |
| 303.20 | 0.9180 | 0.0820 | 1.3469 |
| 303.20 | 0.9239 | 0.0000 | 1.3372 |
| 318.20 | 0.9078 | 0.0681 | 1.3434 |
| 318.20 | 0.9095 | 0.0490 | 1.3412 |
| 318.20 | 0.9114 | 0.0385 | 1.3404 |
| 318.20 | 0.9129 | 0.0711 | 1.3437 |
| 318.20 | 0.9154 | 0.0208 | 1.3375 |
| 318.20 | 0.9165 | 0.0835 | 1.3445 |
| 318.20 | 0.9340 | 0.0000 | 1.3349 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.20 | 0.0152 | 0.0000 | 896.059 |
| 288.20 | 0.0210 | 0.1067 | 920.963 |
| 288.20 | 0.0219 | 0.2483 | 956.222 |
| 288.20 | 0.0302 | 0.3969 | 993.529 |
| 288.20 | 0.0308 | 0.4863 | 1017.406 |
| 288.20 | 0.0354 | 0.5158 | 1025.925 |
| 288.20 | 0.0369 | 0.6279 | 1058.363 |
| 288.20 | 0.0440 | 0.9560 | 1148.681 |
| 303.20 | 0.0199 | 0.0000 | 879.813 |
| 303.20 | 0.0290 | 0.1161 | 907.566 |
| 303.20 | 0.0324 | 0.3484 | 965.924 |
| 303.20 | 0.0357 | 0.2407 | 938.556 |
| 303.20 | 0.0401 | 0.4773 | 1000.678 |
| 303.20 | 0.0439 | 0.5543 | 1022.566 |
| 303.20 | 0.0472 | 0.6735 | 1058.751 |
| 303.20 | 0.0478 | 0.8096 | 1098.063 |
| 303.20 | 0.0593 | 0.9407 | 1141.614 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.20 | 0.9305 | 0.0695 | 1012.248 |
| 288.20 | 0.9319 | 0.0634 | 1011.314 |
| 288.20 | 0.9398 | 0.0439 | 1007.067 |
| 288.20 | 0.9574 | 0.0197 | 1002.896 |
| 288.20 | 0.9745 | 0.0000 | 998.736 |
| 303.20 | 0.9173 | 0.0827 | 1009.532 |
| 303.20 | 0.9264 | 0.0660 | 1006.554 |
| 303.20 | 0.9387 | 0.0500 | 1003.656 |
| 303.20 | 0.9516 | 0.0272 | 999.451 |
| 303.20 | 0.9789 | 0.0000 | 995.046 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.20 | 0.0152 | 0.0000 | 896.059 |
| 288.20 | 0.0210 | 0.1067 | 920.963 |
| 288.20 | 0.0219 | 0.2483 | 956.222 |
| 288.20 | 0.0302 | 0.3969 | 993.529 |
| 288.20 | 0.0308 | 0.4863 | 1017.406 |
| 288.20 | 0.0354 | 0.5158 | 1025.925 |
| 288.20 | 0.0369 | 0.6279 | 1058.363 |
| 288.20 | 0.0440 | 0.9560 | 1148.681 |
| 303.20 | 0.0199 | 0.0000 | 879.813 |
| 303.20 | 0.0290 | 0.1161 | 907.566 |
| 303.20 | 0.0324 | 0.3484 | 965.924 |
| 303.20 | 0.0357 | 0.2407 | 938.556 |
| 303.20 | 0.0401 | 0.4773 | 1000.678 |
| 303.20 | 0.0439 | 0.5543 | 1022.566 |
| 303.20 | 0.0472 | 0.6735 | 1058.751 |
| 303.20 | 0.0478 | 0.8096 | 1098.063 |
| 303.20 | 0.0593 | 0.9407 | 1141.614 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.20 | 0.9305 | 0.0695 | 1012.248 |
| 288.20 | 0.9319 | 0.0634 | 1011.314 |
| 288.20 | 0.9398 | 0.0439 | 1007.067 |
| 288.20 | 0.9574 | 0.0197 | 1002.896 |
| 288.20 | 0.9745 | 0.0000 | 998.736 |
| 303.20 | 0.9173 | 0.0827 | 1009.532 |
| 303.20 | 0.9264 | 0.0660 | 1006.554 |
| 303.20 | 0.9387 | 0.0500 | 1003.656 |
| 303.20 | 0.9516 | 0.0272 | 999.451 |
| 303.20 | 0.9789 | 0.0000 | 995.046 |