- Name
- Furfural
- InChI
- InChI=1S/C5H4O2/c6-4-5-2-1-3-7-5/h1-4H
- InChI Key
- HYBBIBNJHNGZAN-UHFFFAOYSA-N
- Formula
- C5H4O2
- SMILES
- O=Cc1ccco1
- Mol. Weight (g/mol)
- 96.08
- CAS
- 98-01-1
- Name
- n-Propyl acetate
- InChI
- InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3
- InChI Key
- YKYONYBAUNKHLG-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCCOC(C)=O
- Mol. Weight (g/mol)
- 102.13
- CAS
- 109-60-4
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Temperature, K x Mass fraction (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (4)
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Furfural (1) - Liquid mixture 2 | Mass fraction of Furfural (1) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 |
| 288.15 | 0.9948 | 0.0013 | 0.0826 | 0.0956 |
| 288.15 | 0.9935 | 0.0029 | 0.1453 | 0.1080 |
| 288.15 | 0.9914 | 0.0054 | 0.2659 | 0.1298 |
| 288.15 | 0.9894 | 0.0065 | 0.3252 | 0.1390 |
| 288.15 | 0.9896 | 0.0079 | 0.3859 | 0.1538 |
| 288.15 | 0.9881 | 0.0096 | 0.4836 | 0.1693 |
| 288.15 | 0.9857 | 0.0125 | 0.6187 | 0.1948 |
| 303.15 | 0.9949 | 0.0024 | 0.0220 | 0.8369 |
| 303.15 | 0.9900 | 0.0053 | 0.0439 | 0.8292 |
| 303.15 | 0.9898 | 0.0073 | 0.0686 | 0.8307 |
| 303.15 | 0.9868 | 0.0105 | 0.1004 | 0.8168 |
| 303.15 | 0.9843 | 0.0126 | 0.1194 | 0.8250 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Furfural (1) - Liquid mixture 2 | Mass fraction of Furfural (1) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 |
| 288.15 | 0.9948 | 0.0013 | 0.0826 | 0.0956 |
| 288.15 | 0.9935 | 0.0029 | 0.1453 | 0.1080 |
| 288.15 | 0.9914 | 0.0054 | 0.2659 | 0.1298 |
| 288.15 | 0.9894 | 0.0065 | 0.3252 | 0.1390 |
| 288.15 | 0.9896 | 0.0079 | 0.3859 | 0.1538 |
| 288.15 | 0.9881 | 0.0096 | 0.4836 | 0.1693 |
| 288.15 | 0.9857 | 0.0125 | 0.6187 | 0.1948 |
| 303.15 | 0.9949 | 0.0024 | 0.0220 | 0.8369 |
| 303.15 | 0.9900 | 0.0053 | 0.0439 | 0.8292 |
| 303.15 | 0.9898 | 0.0073 | 0.0686 | 0.8307 |
| 303.15 | 0.9868 | 0.0105 | 0.1004 | 0.8168 |
| 303.15 | 0.9843 | 0.0126 | 0.1194 | 0.8250 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.20 | 0.0152 | 0.0000 | 1.3865 |
| 288.20 | 0.0210 | 0.1067 | 1.3988 |
| 288.20 | 0.0219 | 0.2483 | 1.4168 |
| 288.20 | 0.0302 | 0.3969 | 1.4358 |
| 288.20 | 0.0308 | 0.4863 | 1.448 |
| 288.20 | 0.0354 | 0.5158 | 1.4529 |
| 288.20 | 0.0369 | 0.6279 | 1.4696 |
| 288.20 | 0.0440 | 0.9560 | 1.5203 |
| 288.20 | 0.9305 | 0.0695 | 1.3464 |
| 288.20 | 0.9319 | 0.0634 | 1.346 |
| 288.20 | 0.9398 | 0.0439 | 1.3431 |
| 288.20 | 0.9574 | 0.0197 | 1.3396 |
| 288.20 | 0.9745 | 0.0000 | 1.3361 |
| 303.20 | 0.0199 | 0.0000 | 1.379 |
| 303.20 | 0.0290 | 0.1161 | 1.3926 |
| 303.20 | 0.0324 | 0.3484 | 1.4223 |
| 303.20 | 0.0357 | 0.2407 | 1.4078 |
| 303.20 | 0.0401 | 0.4773 | 1.4395 |
| 303.20 | 0.0439 | 0.5543 | 1.4508 |
| 303.20 | 0.0472 | 0.6735 | 1.4691 |
| 303.20 | 0.0478 | 0.8096 | 1.4888 |
| 303.20 | 0.0593 | 0.9407 | 1.5107 |
| 303.20 | 0.9173 | 0.0827 | 1.3469 |
| 303.20 | 0.9264 | 0.0660 | 1.3443 |
| 303.20 | 0.9387 | 0.0500 | 1.3419 |
| 303.20 | 0.9516 | 0.0272 | 1.3383 |
| 303.20 | 0.9789 | 0.0000 | 1.3341 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.20 | 0.0152 | 0.0000 | 1.3865 |
| 288.20 | 0.0210 | 0.1067 | 1.3988 |
| 288.20 | 0.0219 | 0.2483 | 1.4168 |
| 288.20 | 0.0302 | 0.3969 | 1.4358 |
| 288.20 | 0.0308 | 0.4863 | 1.448 |
| 288.20 | 0.0354 | 0.5158 | 1.4529 |
| 288.20 | 0.0369 | 0.6279 | 1.4696 |
| 288.20 | 0.0440 | 0.9560 | 1.5203 |
| 288.20 | 0.9305 | 0.0695 | 1.3464 |
| 288.20 | 0.9319 | 0.0634 | 1.346 |
| 288.20 | 0.9398 | 0.0439 | 1.3431 |
| 288.20 | 0.9574 | 0.0197 | 1.3396 |
| 288.20 | 0.9745 | 0.0000 | 1.3361 |
| 303.20 | 0.0199 | 0.0000 | 1.379 |
| 303.20 | 0.0290 | 0.1161 | 1.3926 |
| 303.20 | 0.0324 | 0.3484 | 1.4223 |
| 303.20 | 0.0357 | 0.2407 | 1.4078 |
| 303.20 | 0.0401 | 0.4773 | 1.4395 |
| 303.20 | 0.0439 | 0.5543 | 1.4508 |
| 303.20 | 0.0472 | 0.6735 | 1.4691 |
| 303.20 | 0.0478 | 0.8096 | 1.4888 |
| 303.20 | 0.0593 | 0.9407 | 1.5107 |
| 303.20 | 0.9173 | 0.0827 | 1.3469 |
| 303.20 | 0.9264 | 0.0660 | 1.3443 |
| 303.20 | 0.9387 | 0.0500 | 1.3419 |
| 303.20 | 0.9516 | 0.0272 | 1.3383 |
| 303.20 | 0.9789 | 0.0000 | 1.3341 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.20 | 0.0285 | 0.0000 | 899.502 |
| 288.20 | 0.0292 | 0.1507 | 946.612 |
| 288.20 | 0.0307 | 0.1777 | 952.815 |
| 288.20 | 0.0326 | 0.2242 | 964.484 |
| 288.20 | 0.0361 | 0.3151 | 987.156 |
| 288.20 | 0.0363 | 0.4068 | 1009.909 |
| 288.20 | 0.0419 | 0.5217 | 1040.541 |
| 288.20 | 0.0440 | 0.9560 | 1148.681 |
| 288.20 | 0.0447 | 0.8131 | 1117.183 |
| 303.20 | 0.0346 | 0.0000 | 894.344 |
| 303.20 | 0.0404 | 0.1157 | 922.128 |
| 303.20 | 0.0480 | 0.2378 | 952.284 |
| 303.20 | 0.0507 | 0.3586 | 983.393 |
| 303.20 | 0.0566 | 0.4729 | 1012.984 |
| 303.20 | 0.0574 | 0.5716 | 1038.846 |
| 303.20 | 0.0593 | 0.9407 | 1141.614 |
| 303.20 | 0.0602 | 0.8052 | 1103.02 |
| 303.20 | 0.0603 | 0.7538 | 1088.482 |
| 318.20 | 0.0469 | 0.0000 | 877.241 |
| 318.20 | 0.0501 | 0.1199 | 906.505 |
| 318.20 | 0.0528 | 0.1911 | 924.199 |
| 318.20 | 0.0592 | 0.3150 | 955.738 |
| 318.20 | 0.0672 | 0.6509 | 1044.601 |
| 318.20 | 0.0684 | 0.7433 | 1070.977 |
| 318.20 | 0.0685 | 0.5372 | 1016.342 |
| 318.20 | 0.0694 | 0.9306 | 1123.957 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.20 | 0.9033 | 0.0523 | 1009.103 |
| 288.20 | 0.9091 | 0.0620 | 1010.863 |
| 288.20 | 0.9117 | 0.0000 | 999.568 |
| 288.20 | 0.9118 | 0.0229 | 1003.794 |
| 288.20 | 0.9305 | 0.0695 | 1012.248 |
| 303.20 | 0.9082 | 0.0524 | 1004.041 |
| 303.20 | 0.9118 | 0.0295 | 999.733 |
| 303.20 | 0.9172 | 0.0592 | 1005.406 |
| 303.20 | 0.9180 | 0.0820 | 1009.532 |
| 303.20 | 0.9239 | 0.0000 | 994.64 |
| 318.20 | 0.9078 | 0.0681 | 1000.109 |
| 318.20 | 0.9095 | 0.0490 | 996.397 |
| 318.20 | 0.9114 | 0.0385 | 994.591 |
| 318.20 | 0.9129 | 0.0711 | 1001.002 |
| 318.20 | 0.9154 | 0.0208 | 991.739 |
| 318.20 | 0.9165 | 0.0835 | 1003.294 |
| 318.20 | 0.9340 | 0.0000 | 988.405 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.20 | 0.0285 | 0.0000 | 899.502 |
| 288.20 | 0.0292 | 0.1507 | 946.612 |
| 288.20 | 0.0307 | 0.1777 | 952.815 |
| 288.20 | 0.0326 | 0.2242 | 964.484 |
| 288.20 | 0.0361 | 0.3151 | 987.156 |
| 288.20 | 0.0363 | 0.4068 | 1009.909 |
| 288.20 | 0.0419 | 0.5217 | 1040.541 |
| 288.20 | 0.0440 | 0.9560 | 1148.681 |
| 288.20 | 0.0447 | 0.8131 | 1117.183 |
| 303.20 | 0.0346 | 0.0000 | 894.344 |
| 303.20 | 0.0404 | 0.1157 | 922.128 |
| 303.20 | 0.0480 | 0.2378 | 952.284 |
| 303.20 | 0.0507 | 0.3586 | 983.393 |
| 303.20 | 0.0566 | 0.4729 | 1012.984 |
| 303.20 | 0.0574 | 0.5716 | 1038.846 |
| 303.20 | 0.0593 | 0.9407 | 1141.614 |
| 303.20 | 0.0602 | 0.8052 | 1103.02 |
| 303.20 | 0.0603 | 0.7538 | 1088.482 |
| 318.20 | 0.0469 | 0.0000 | 877.241 |
| 318.20 | 0.0501 | 0.1199 | 906.505 |
| 318.20 | 0.0528 | 0.1911 | 924.199 |
| 318.20 | 0.0592 | 0.3150 | 955.738 |
| 318.20 | 0.0672 | 0.6509 | 1044.601 |
| 318.20 | 0.0684 | 0.7433 | 1070.977 |
| 318.20 | 0.0685 | 0.5372 | 1016.342 |
| 318.20 | 0.0694 | 0.9306 | 1123.957 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Furfural (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.20 | 0.9033 | 0.0523 | 1009.103 |
| 288.20 | 0.9091 | 0.0620 | 1010.863 |
| 288.20 | 0.9117 | 0.0000 | 999.568 |
| 288.20 | 0.9118 | 0.0229 | 1003.794 |
| 288.20 | 0.9305 | 0.0695 | 1012.248 |
| 303.20 | 0.9082 | 0.0524 | 1004.041 |
| 303.20 | 0.9118 | 0.0295 | 999.733 |
| 303.20 | 0.9172 | 0.0592 | 1005.406 |
| 303.20 | 0.9180 | 0.0820 | 1009.532 |
| 303.20 | 0.9239 | 0.0000 | 994.64 |
| 318.20 | 0.9078 | 0.0681 | 1000.109 |
| 318.20 | 0.9095 | 0.0490 | 996.397 |
| 318.20 | 0.9114 | 0.0385 | 994.591 |
| 318.20 | 0.9129 | 0.0711 | 1001.002 |
| 318.20 | 0.9154 | 0.0208 | 991.739 |
| 318.20 | 0.9165 | 0.0835 | 1003.294 |
| 318.20 | 0.9340 | 0.0000 | 988.405 |