- Name
- 1-Butanamine, N-butyl-
- InChI
- InChI=1S/C8H19N/c1-3-5-7-9-8-6-4-2/h9H,3-8H2,1-2H3
- InChI Key
- JQVDAXLFBXTEQA-UHFFFAOYSA-N
- Formula
- C8H19N
- SMILES
- CCCCNCCCC
- Mol. Weight (g/mol)
- 129.24
- CAS
- 111-92-2
- Name
- 2-Heptanone
- InChI
- InChI=1S/C7H14O/c1-3-4-5-6-7(2)8/h3-6H2,1-2H3
- InChI Key
- CATSNJVOTSVZJV-UHFFFAOYSA-N
- Formula
- C7H14O
- SMILES
- CCCCCC(C)=O
- Mol. Weight (g/mol)
- 114.19
- CAS
- 110-43-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- Excess molar volume, m3/mol (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of 1-Butanamine, N-butyl- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1114 | 0.0860 |
| 0.2189 | 0.1640 |
| 0.3057 | 0.2170 |
| 0.4038 | 0.2540 |
| 0.5087 | 0.2780 |
| 0.5962 | 0.2780 |
| 0.7053 | 0.2560 |
| 0.8017 | 0.2080 |
| 0.8891 | 0.1380 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of 1-Butanamine, N-butyl- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1114 | 0.0860 |
| 0.2189 | 0.1640 |
| 0.3057 | 0.2170 |
| 0.4038 | 0.2540 |
| 0.5087 | 0.2780 |
| 0.5962 | 0.2780 |
| 0.7053 | 0.2560 |
| 0.8017 | 0.2080 |
| 0.8891 | 0.1380 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Heptanone (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0640 | 762.405 |
| 293.15 | 0.1633 | 767.21 |
| 293.15 | 0.2061 | 769.239 |
| 293.15 | 0.2606 | 772.046 |
| 293.15 | 0.4493 | 781.952 |
| 293.15 | 0.5094 | 785.255 |
| 293.15 | 0.6440 | 792.949 |
| 293.15 | 0.7511 | 799.387 |
| 293.15 | 0.9018 | 808.899 |
| 298.15 | 0.0624 | 758.343 |
| 298.15 | 0.1107 | 760.603 |
| 298.15 | 0.2097 | 765.511 |
| 298.15 | 0.3613 | 773.119 |
| 298.15 | 0.4049 | 775.426 |
| 298.15 | 0.4499 | 777.849 |
| 298.15 | 0.5496 | 783.354 |
| 298.15 | 0.6482 | 789.026 |
| 298.15 | 0.7509 | 795.166 |
| 298.15 | 0.7987 | 798.112 |
| 298.15 | 0.8986 | 804.449 |
| 298.15 | 0.9488 | 807.773 |
| 303.15 | 0.1122 | 756.507 |
| 303.15 | 0.1605 | 758.79 |
| 303.15 | 0.2587 | 763.614 |
| 303.15 | 0.3597 | 768.787 |
| 303.15 | 0.4096 | 771.421 |
| 303.15 | 0.4986 | 776.259 |
| 303.15 | 0.6478 | 784.736 |
| 303.15 | 0.7470 | 790.673 |
| 303.15 | 0.7997 | 793.928 |
| 303.15 | 0.8520 | 797.226 |
| 303.15 | 0.8984 | 800.193 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Heptanone (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0640 | 762.405 |
| 293.15 | 0.1633 | 767.21 |
| 293.15 | 0.2061 | 769.239 |
| 293.15 | 0.2606 | 772.046 |
| 293.15 | 0.4493 | 781.952 |
| 293.15 | 0.5094 | 785.255 |
| 293.15 | 0.6440 | 792.949 |
| 293.15 | 0.7511 | 799.387 |
| 293.15 | 0.9018 | 808.899 |
| 298.15 | 0.0624 | 758.343 |
| 298.15 | 0.1107 | 760.603 |
| 298.15 | 0.2097 | 765.511 |
| 298.15 | 0.3613 | 773.119 |
| 298.15 | 0.4049 | 775.426 |
| 298.15 | 0.4499 | 777.849 |
| 298.15 | 0.5496 | 783.354 |
| 298.15 | 0.6482 | 789.026 |
| 298.15 | 0.7509 | 795.166 |
| 298.15 | 0.7987 | 798.112 |
| 298.15 | 0.8986 | 804.449 |
| 298.15 | 0.9488 | 807.773 |
| 303.15 | 0.1122 | 756.507 |
| 303.15 | 0.1605 | 758.79 |
| 303.15 | 0.2587 | 763.614 |
| 303.15 | 0.3597 | 768.787 |
| 303.15 | 0.4096 | 771.421 |
| 303.15 | 0.4986 | 776.259 |
| 303.15 | 0.6478 | 784.736 |
| 303.15 | 0.7470 | 790.673 |
| 303.15 | 0.7997 | 793.928 |
| 303.15 | 0.8520 | 797.226 |
| 303.15 | 0.8984 | 800.193 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Heptanone (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0640 | 1261.7 |
| 293.15 | 0.1633 | 1262.99 |
| 293.15 | 0.2061 | 1263.42 |
| 293.15 | 0.2606 | 1264.49 |
| 293.15 | 0.4493 | 1267.85 |
| 293.15 | 0.5094 | 1269.08 |
| 293.15 | 0.6440 | 1272.07 |
| 293.15 | 0.7511 | 1274.73 |
| 293.15 | 0.9018 | 1278.8 |
| 298.15 | 0.0624 | 1241.68 |
| 298.15 | 0.1107 | 1242.21 |
| 298.15 | 0.2097 | 1243.84 |
| 298.15 | 0.3613 | 1246.27 |
| 298.15 | 0.4049 | 1247.12 |
| 298.15 | 0.4499 | 1248.03 |
| 298.15 | 0.5496 | 1250.18 |
| 298.15 | 0.6482 | 1252.46 |
| 298.15 | 0.7509 | 1255.09 |
| 298.15 | 0.7987 | 1256.41 |
| 298.15 | 0.8986 | 1259.29 |
| 298.15 | 0.9488 | 1260.98 |
| 303.15 | 0.1122 | 1223.27 |
| 303.15 | 0.1605 | 1223.89 |
| 303.15 | 0.2587 | 1225.34 |
| 303.15 | 0.3597 | 1227.23 |
| 303.15 | 0.4096 | 1228.21 |
| 303.15 | 0.4986 | 1230.13 |
| 303.15 | 0.6478 | 1233.67 |
| 303.15 | 0.7470 | 1236.32 |
| 303.15 | 0.7997 | 1237.86 |
| 303.15 | 0.8520 | 1239.39 |
| 303.15 | 0.8984 | 1240.8 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Heptanone (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0640 | 1261.7 |
| 293.15 | 0.1633 | 1262.99 |
| 293.15 | 0.2061 | 1263.42 |
| 293.15 | 0.2606 | 1264.49 |
| 293.15 | 0.4493 | 1267.85 |
| 293.15 | 0.5094 | 1269.08 |
| 293.15 | 0.6440 | 1272.07 |
| 293.15 | 0.7511 | 1274.73 |
| 293.15 | 0.9018 | 1278.8 |
| 298.15 | 0.0624 | 1241.68 |
| 298.15 | 0.1107 | 1242.21 |
| 298.15 | 0.2097 | 1243.84 |
| 298.15 | 0.3613 | 1246.27 |
| 298.15 | 0.4049 | 1247.12 |
| 298.15 | 0.4499 | 1248.03 |
| 298.15 | 0.5496 | 1250.18 |
| 298.15 | 0.6482 | 1252.46 |
| 298.15 | 0.7509 | 1255.09 |
| 298.15 | 0.7987 | 1256.41 |
| 298.15 | 0.8986 | 1259.29 |
| 298.15 | 0.9488 | 1260.98 |
| 303.15 | 0.1122 | 1223.27 |
| 303.15 | 0.1605 | 1223.89 |
| 303.15 | 0.2587 | 1225.34 |
| 303.15 | 0.3597 | 1227.23 |
| 303.15 | 0.4096 | 1228.21 |
| 303.15 | 0.4986 | 1230.13 |
| 303.15 | 0.6478 | 1233.67 |
| 303.15 | 0.7470 | 1236.32 |
| 303.15 | 0.7997 | 1237.86 |
| 303.15 | 0.8520 | 1239.39 |
| 303.15 | 0.8984 | 1240.8 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Heptanone (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 293.15 | 0.0640 | 1.0400e-08 |
| 293.15 | 0.1633 | 1.7500e-08 |
| 293.15 | 0.2061 | 1.7600e-08 |
| 293.15 | 0.2606 | 1.6400e-08 |
| 293.15 | 0.4493 | 1.0200e-08 |
| 293.15 | 0.5094 | 0.0000 |
| 293.15 | 0.6440 | 0.0000 |
| 293.15 | 0.7511 | -0.0000 |
| 293.15 | 0.9018 | -0.0000 |
| 298.15 | 0.0624 | 2.0200e-08 |
| 298.15 | 0.1107 | 2.4100e-08 |
| 298.15 | 0.2097 | 2.5300e-08 |
| 298.15 | 0.3613 | 1.6800e-08 |
| 298.15 | 0.4049 | 1.4100e-08 |
| 298.15 | 0.4499 | 1.1400e-08 |
| 298.15 | 0.5496 | 0.0000 |
| 298.15 | 0.6482 | 0.0000 |
| 298.15 | 0.7509 | -0.0000 |
| 298.15 | 0.7987 | -0.0000 |
| 298.15 | 0.8986 | -0.0000 |
| 298.15 | 0.9488 | -0.0000 |
| 303.15 | 0.1122 | 2.6800e-08 |
| 303.15 | 0.1605 | 3.2400e-08 |
| 303.15 | 0.2587 | 3.2900e-08 |
| 303.15 | 0.3597 | 2.7300e-08 |
| 303.15 | 0.4096 | 2.4000e-08 |
| 303.15 | 0.4986 | 1.5800e-08 |
| 303.15 | 0.6478 | 0.0000 |
| 303.15 | 0.7470 | -0.0000 |
| 303.15 | 0.7997 | -1.0500e-08 |
| 303.15 | 0.8520 | -1.5000e-08 |
| 303.15 | 0.8984 | -1.6300e-08 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Heptanone (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 293.15 | 0.0640 | 1.0400e-08 |
| 293.15 | 0.1633 | 1.7500e-08 |
| 293.15 | 0.2061 | 1.7600e-08 |
| 293.15 | 0.2606 | 1.6400e-08 |
| 293.15 | 0.4493 | 1.0200e-08 |
| 293.15 | 0.5094 | 0.0000 |
| 293.15 | 0.6440 | 0.0000 |
| 293.15 | 0.7511 | -0.0000 |
| 293.15 | 0.9018 | -0.0000 |
| 298.15 | 0.0624 | 2.0200e-08 |
| 298.15 | 0.1107 | 2.4100e-08 |
| 298.15 | 0.2097 | 2.5300e-08 |
| 298.15 | 0.3613 | 1.6800e-08 |
| 298.15 | 0.4049 | 1.4100e-08 |
| 298.15 | 0.4499 | 1.1400e-08 |
| 298.15 | 0.5496 | 0.0000 |
| 298.15 | 0.6482 | 0.0000 |
| 298.15 | 0.7509 | -0.0000 |
| 298.15 | 0.7987 | -0.0000 |
| 298.15 | 0.8986 | -0.0000 |
| 298.15 | 0.9488 | -0.0000 |
| 303.15 | 0.1122 | 2.6800e-08 |
| 303.15 | 0.1605 | 3.2400e-08 |
| 303.15 | 0.2587 | 3.2900e-08 |
| 303.15 | 0.3597 | 2.7300e-08 |
| 303.15 | 0.4096 | 2.4000e-08 |
| 303.15 | 0.4986 | 1.5800e-08 |
| 303.15 | 0.6478 | 0.0000 |
| 303.15 | 0.7470 | -0.0000 |
| 303.15 | 0.7997 | -1.0500e-08 |
| 303.15 | 0.8520 | -1.5000e-08 |
| 303.15 | 0.8984 | -1.6300e-08 |
Sources
- Thermodynamics of ketone + amine mixtures. Part IX. Excess molar enthalpies at 298.15K for dipropylamine, or dibutylamine + 2-alkanone systems and modeling of linear or aromatic amine + 2-alkanone mixtures in terms of DISQUAC and ERAS
- Thermodynamics of (ketone + amine) mixtures. Part VI. Volumetric and speed of sound data at (293.15, 298.15, and 303.15) K for (2-heptanone + dipropylamine, +dibutylamine, or +triethylamine) systems