- Name
- Methane, nitro-
- InChI
- InChI=1S/CH3NO2/c1-2(3)4/h1H3
- InChI Key
- LYGJENNIWJXYER-UHFFFAOYSA-N
- Formula
- CH3NO2
- SMILES
- C[N+](=O)[O-]
- Mol. Weight (g/mol)
- 61.04
- CAS
- 75-52-5
- Name
- Ethane, 1,1,2,2-tetrachloro-
- InChI
- InChI=1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H
- InChI Key
- QPFMBZIOSGYJDE-UHFFFAOYSA-N
- Formula
- C2H2Cl4
- SMILES
- ClC(Cl)C(Cl)Cl
- Mol. Weight (g/mol)
- 167.85
- CAS
- 79-34-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,2,2-tetrachloro- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3795 |
| 298.15 | 0.0711 | 1.3939 |
| 298.15 | 0.1888 | 1.4144 |
| 298.15 | 0.2563 | 1.4248 |
| 298.15 | 0.3464 | 1.4368 |
| 298.15 | 0.4341 | 1.4472 |
| 298.15 | 0.5431 | 1.4585 |
| 298.15 | 0.6654 | 1.4694 |
| 298.15 | 0.8211 | 1.4809 |
| 298.15 | 0.9285 | 1.4877 |
| 298.15 | 1.0000 | 1.4917 |
| 308.15 | 0.0000 | 1.3747 |
| 308.15 | 0.0711 | 1.3893 |
| 308.15 | 0.1888 | 1.4099 |
| 308.15 | 0.2563 | 1.4203 |
| 308.15 | 0.3464 | 1.4322 |
| 308.15 | 0.4341 | 1.4425 |
| 308.15 | 0.5431 | 1.4537 |
| 308.15 | 0.6654 | 1.4645 |
| 308.15 | 0.8211 | 1.4759 |
| 308.15 | 0.9285 | 1.4826 |
| 308.15 | 1.0000 | 1.4865 |
| 318.15 | 0.0000 | 1.37 |
| 318.15 | 0.0711 | 1.3848 |
| 318.15 | 0.1888 | 1.4058 |
| 318.15 | 0.2563 | 1.4162 |
| 318.15 | 0.3464 | 1.4281 |
| 318.15 | 0.4341 | 1.4381 |
| 318.15 | 0.5431 | 1.4491 |
| 318.15 | 0.6654 | 1.4596 |
| 318.15 | 0.8211 | 1.4709 |
| 318.15 | 0.9285 | 1.4775 |
| 318.15 | 1.0000 | 1.4814 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,2,2-tetrachloro- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3795 |
| 298.15 | 0.0711 | 1.3939 |
| 298.15 | 0.1888 | 1.4144 |
| 298.15 | 0.2563 | 1.4248 |
| 298.15 | 0.3464 | 1.4368 |
| 298.15 | 0.4341 | 1.4472 |
| 298.15 | 0.5431 | 1.4585 |
| 298.15 | 0.6654 | 1.4694 |
| 298.15 | 0.8211 | 1.4809 |
| 298.15 | 0.9285 | 1.4877 |
| 298.15 | 1.0000 | 1.4917 |
| 308.15 | 0.0000 | 1.3747 |
| 308.15 | 0.0711 | 1.3893 |
| 308.15 | 0.1888 | 1.4099 |
| 308.15 | 0.2563 | 1.4203 |
| 308.15 | 0.3464 | 1.4322 |
| 308.15 | 0.4341 | 1.4425 |
| 308.15 | 0.5431 | 1.4537 |
| 308.15 | 0.6654 | 1.4645 |
| 308.15 | 0.8211 | 1.4759 |
| 308.15 | 0.9285 | 1.4826 |
| 308.15 | 1.0000 | 1.4865 |
| 318.15 | 0.0000 | 1.37 |
| 318.15 | 0.0711 | 1.3848 |
| 318.15 | 0.1888 | 1.4058 |
| 318.15 | 0.2563 | 1.4162 |
| 318.15 | 0.3464 | 1.4281 |
| 318.15 | 0.4341 | 1.4381 |
| 318.15 | 0.5431 | 1.4491 |
| 318.15 | 0.6654 | 1.4596 |
| 318.15 | 0.8211 | 1.4709 |
| 318.15 | 0.9285 | 1.4775 |
| 318.15 | 1.0000 | 1.4814 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,2,2-tetrachloro- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1130.86 |
| 298.15 | 0.0711 | 1191.08 |
| 298.15 | 0.1888 | 1275.68 |
| 298.15 | 0.2563 | 1318.0 |
| 298.15 | 0.3464 | 1366.65 |
| 298.15 | 0.4341 | 1408.57 |
| 298.15 | 0.5431 | 1454.03 |
| 298.15 | 0.6654 | 1497.84 |
| 298.15 | 0.8211 | 1544.6 |
| 298.15 | 0.9285 | 1571.92 |
| 298.15 | 1.0000 | 1588.23 |
| 308.15 | 0.0000 | 1117.24 |
| 308.15 | 0.0711 | 1177.12 |
| 308.15 | 0.1888 | 1261.26 |
| 308.15 | 0.2563 | 1303.41 |
| 308.15 | 0.3464 | 1351.85 |
| 308.15 | 0.4341 | 1393.61 |
| 308.15 | 0.5431 | 1438.91 |
| 308.15 | 0.6654 | 1482.56 |
| 308.15 | 0.8211 | 1529.17 |
| 308.15 | 0.9285 | 1556.4 |
| 308.15 | 1.0000 | 1572.66 |
| 318.15 | 0.0000 | 1103.5 |
| 318.15 | 0.0711 | 1163.03 |
| 318.15 | 0.1888 | 1246.76 |
| 318.15 | 0.2563 | 1288.69 |
| 318.15 | 0.3464 | 1336.94 |
| 318.15 | 0.4341 | 1378.54 |
| 318.15 | 0.5431 | 1423.68 |
| 318.15 | 0.6654 | 1467.2 |
| 318.15 | 0.8211 | 1513.67 |
| 318.15 | 0.9285 | 1540.82 |
| 318.15 | 1.0000 | 1557.04 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,2,2-tetrachloro- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1130.86 |
| 298.15 | 0.0711 | 1191.08 |
| 298.15 | 0.1888 | 1275.68 |
| 298.15 | 0.2563 | 1318.0 |
| 298.15 | 0.3464 | 1366.65 |
| 298.15 | 0.4341 | 1408.57 |
| 298.15 | 0.5431 | 1454.03 |
| 298.15 | 0.6654 | 1497.84 |
| 298.15 | 0.8211 | 1544.6 |
| 298.15 | 0.9285 | 1571.92 |
| 298.15 | 1.0000 | 1588.23 |
| 308.15 | 0.0000 | 1117.24 |
| 308.15 | 0.0711 | 1177.12 |
| 308.15 | 0.1888 | 1261.26 |
| 308.15 | 0.2563 | 1303.41 |
| 308.15 | 0.3464 | 1351.85 |
| 308.15 | 0.4341 | 1393.61 |
| 308.15 | 0.5431 | 1438.91 |
| 308.15 | 0.6654 | 1482.56 |
| 308.15 | 0.8211 | 1529.17 |
| 308.15 | 0.9285 | 1556.4 |
| 308.15 | 1.0000 | 1572.66 |
| 318.15 | 0.0000 | 1103.5 |
| 318.15 | 0.0711 | 1163.03 |
| 318.15 | 0.1888 | 1246.76 |
| 318.15 | 0.2563 | 1288.69 |
| 318.15 | 0.3464 | 1336.94 |
| 318.15 | 0.4341 | 1378.54 |
| 318.15 | 0.5431 | 1423.68 |
| 318.15 | 0.6654 | 1467.2 |
| 318.15 | 0.8211 | 1513.67 |
| 318.15 | 0.9285 | 1540.82 |
| 318.15 | 1.0000 | 1557.04 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,2,2-tetrachloro- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.16 |
| 298.15 | 0.0711 | 1293.13 |
| 298.15 | 0.1888 | 1257.72 |
| 298.15 | 0.2563 | 1241.8 |
| 298.15 | 0.3464 | 1224.14 |
| 298.15 | 0.4341 | 1209.84 |
| 298.15 | 0.5431 | 1194.83 |
| 298.15 | 0.6654 | 1180.73 |
| 298.15 | 0.8211 | 1165.31 |
| 298.15 | 0.9285 | 1156.21 |
| 298.15 | 1.0000 | 1150.61 |
| 308.15 | 0.0000 | 1281.75 |
| 308.15 | 0.0711 | 1254.8 |
| 308.15 | 0.1888 | 1220.83 |
| 308.15 | 0.2563 | 1205.79 |
| 308.15 | 0.3464 | 1189.13 |
| 308.15 | 0.4341 | 1175.43 |
| 308.15 | 0.5431 | 1161.13 |
| 308.15 | 0.6654 | 1147.59 |
| 308.15 | 0.8211 | 1133.0 |
| 308.15 | 0.9285 | 1124.17 |
| 308.15 | 1.0000 | 1118.66 |
| 318.15 | 0.0000 | 1242.47 |
| 318.15 | 0.0711 | 1216.59 |
| 318.15 | 0.1888 | 1184.54 |
| 318.15 | 0.2563 | 1169.96 |
| 318.15 | 0.3464 | 1154.16 |
| 318.15 | 0.4341 | 1141.14 |
| 318.15 | 0.5431 | 1127.57 |
| 318.15 | 0.6654 | 1114.72 |
| 318.15 | 0.8211 | 1100.8 |
| 318.15 | 0.9285 | 1092.32 |
| 318.15 | 1.0000 | 1087.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,2,2-tetrachloro- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.16 |
| 298.15 | 0.0711 | 1293.13 |
| 298.15 | 0.1888 | 1257.72 |
| 298.15 | 0.2563 | 1241.8 |
| 298.15 | 0.3464 | 1224.14 |
| 298.15 | 0.4341 | 1209.84 |
| 298.15 | 0.5431 | 1194.83 |
| 298.15 | 0.6654 | 1180.73 |
| 298.15 | 0.8211 | 1165.31 |
| 298.15 | 0.9285 | 1156.21 |
| 298.15 | 1.0000 | 1150.61 |
| 308.15 | 0.0000 | 1281.75 |
| 308.15 | 0.0711 | 1254.8 |
| 308.15 | 0.1888 | 1220.83 |
| 308.15 | 0.2563 | 1205.79 |
| 308.15 | 0.3464 | 1189.13 |
| 308.15 | 0.4341 | 1175.43 |
| 308.15 | 0.5431 | 1161.13 |
| 308.15 | 0.6654 | 1147.59 |
| 308.15 | 0.8211 | 1133.0 |
| 308.15 | 0.9285 | 1124.17 |
| 308.15 | 1.0000 | 1118.66 |
| 318.15 | 0.0000 | 1242.47 |
| 318.15 | 0.0711 | 1216.59 |
| 318.15 | 0.1888 | 1184.54 |
| 318.15 | 0.2563 | 1169.96 |
| 318.15 | 0.3464 | 1154.16 |
| 318.15 | 0.4341 | 1141.14 |
| 318.15 | 0.5431 | 1127.57 |
| 318.15 | 0.6654 | 1114.72 |
| 318.15 | 0.8211 | 1100.8 |
| 318.15 | 0.9285 | 1092.32 |
| 318.15 | 1.0000 | 1087.0 |
Sources
- Speeds of sound, isentropic compressibilities and refractive indices for some binary mixtures of nitromethane with chloroalkane at temperatures from 298.15 to 318.15 K. Comparison with theories
- Volumetric Study for the Binary Nitromethane with Chloroalkane Mixtures at Temperatures in the Range (298.15 to 318.15) K