- Name
- Ethane, 1,1,1-trichloro-
- InChI
- InChI=1S/C2H3Cl3/c1-2(3,4)5/h1H3
- InChI Key
- UOCLXMDMGBRAIB-UHFFFAOYSA-N
- Formula
- C2H3Cl3
- SMILES
- CC(Cl)(Cl)Cl
- Mol. Weight (g/mol)
- 133.40
- CAS
- 71-55-6
- Name
- Methane, nitro-
- InChI
- InChI=1S/CH3NO2/c1-2(3)4/h1H3
- InChI Key
- LYGJENNIWJXYER-UHFFFAOYSA-N
- Formula
- CH3NO2
- SMILES
- C[N+](=O)[O-]
- Mol. Weight (g/mol)
- 61.04
- CAS
- 75-52-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,1-trichloro- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3795 |
| 298.15 | 0.0921 | 1.3878 |
| 298.15 | 0.1727 | 1.3943 |
| 298.15 | 0.2614 | 1.4006 |
| 298.15 | 0.3951 | 1.4089 |
| 298.15 | 0.4862 | 1.414 |
| 298.15 | 0.5904 | 1.419 |
| 298.15 | 0.7066 | 1.4241 |
| 298.15 | 0.8358 | 1.4292 |
| 298.15 | 0.9012 | 1.4316 |
| 298.15 | 1.0000 | 1.4349 |
| 308.15 | 0.0000 | 1.3747 |
| 308.15 | 0.0921 | 1.3823 |
| 308.15 | 0.1727 | 1.3881 |
| 308.15 | 0.2614 | 1.3944 |
| 308.15 | 0.3951 | 1.4027 |
| 308.15 | 0.4862 | 1.4077 |
| 308.15 | 0.5904 | 1.413 |
| 308.15 | 0.7066 | 1.4183 |
| 308.15 | 0.8358 | 1.4234 |
| 308.15 | 0.9012 | 1.4258 |
| 308.15 | 1.0000 | 1.4291 |
| 318.15 | 0.0000 | 1.37 |
| 318.15 | 0.0921 | 1.377 |
| 318.15 | 0.1727 | 1.3824 |
| 318.15 | 0.2614 | 1.3887 |
| 318.15 | 0.3951 | 1.3969 |
| 318.15 | 0.4862 | 1.4021 |
| 318.15 | 0.5904 | 1.4073 |
| 318.15 | 0.7066 | 1.4125 |
| 318.15 | 0.8358 | 1.4175 |
| 318.15 | 0.9012 | 1.4199 |
| 318.15 | 1.0000 | 1.4231 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,1-trichloro- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3795 |
| 298.15 | 0.0921 | 1.3878 |
| 298.15 | 0.1727 | 1.3943 |
| 298.15 | 0.2614 | 1.4006 |
| 298.15 | 0.3951 | 1.4089 |
| 298.15 | 0.4862 | 1.414 |
| 298.15 | 0.5904 | 1.419 |
| 298.15 | 0.7066 | 1.4241 |
| 298.15 | 0.8358 | 1.4292 |
| 298.15 | 0.9012 | 1.4316 |
| 298.15 | 1.0000 | 1.4349 |
| 308.15 | 0.0000 | 1.3747 |
| 308.15 | 0.0921 | 1.3823 |
| 308.15 | 0.1727 | 1.3881 |
| 308.15 | 0.2614 | 1.3944 |
| 308.15 | 0.3951 | 1.4027 |
| 308.15 | 0.4862 | 1.4077 |
| 308.15 | 0.5904 | 1.413 |
| 308.15 | 0.7066 | 1.4183 |
| 308.15 | 0.8358 | 1.4234 |
| 308.15 | 0.9012 | 1.4258 |
| 308.15 | 1.0000 | 1.4291 |
| 318.15 | 0.0000 | 1.37 |
| 318.15 | 0.0921 | 1.377 |
| 318.15 | 0.1727 | 1.3824 |
| 318.15 | 0.2614 | 1.3887 |
| 318.15 | 0.3951 | 1.3969 |
| 318.15 | 0.4862 | 1.4021 |
| 318.15 | 0.5904 | 1.4073 |
| 318.15 | 0.7066 | 1.4125 |
| 318.15 | 0.8358 | 1.4175 |
| 318.15 | 0.9012 | 1.4199 |
| 318.15 | 1.0000 | 1.4231 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,1-trichloro- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1130.91 |
| 298.15 | 0.0921 | 1161.87 |
| 298.15 | 0.1727 | 1185.48 |
| 298.15 | 0.2614 | 1208.35 |
| 298.15 | 0.3951 | 1238.06 |
| 298.15 | 0.4862 | 1255.6 |
| 298.15 | 0.5904 | 1273.47 |
| 298.15 | 0.7066 | 1291.18 |
| 298.15 | 0.8358 | 1308.67 |
| 298.15 | 0.9012 | 1316.72 |
| 298.15 | 1.0000 | 1328.24 |
| 308.15 | 0.0000 | 1117.29 |
| 308.15 | 0.0921 | 1147.77 |
| 308.15 | 0.1727 | 1170.98 |
| 308.15 | 0.2614 | 1193.5 |
| 308.15 | 0.3951 | 1222.71 |
| 308.15 | 0.4862 | 1239.96 |
| 308.15 | 0.5904 | 1257.52 |
| 308.15 | 0.7066 | 1274.93 |
| 308.15 | 0.8358 | 1292.14 |
| 308.15 | 0.9012 | 1300.08 |
| 308.15 | 1.0000 | 1311.45 |
| 318.15 | 0.0000 | 1103.55 |
| 318.15 | 0.0921 | 1133.54 |
| 318.15 | 0.1727 | 1156.35 |
| 318.15 | 0.2614 | 1178.49 |
| 318.15 | 0.3951 | 1207.19 |
| 318.15 | 0.4862 | 1224.13 |
| 318.15 | 0.5904 | 1241.39 |
| 318.15 | 0.7066 | 1258.49 |
| 318.15 | 0.8358 | 1275.42 |
| 318.15 | 0.9012 | 1283.24 |
| 318.15 | 1.0000 | 1294.47 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,1-trichloro- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1130.91 |
| 298.15 | 0.0921 | 1161.87 |
| 298.15 | 0.1727 | 1185.48 |
| 298.15 | 0.2614 | 1208.35 |
| 298.15 | 0.3951 | 1238.06 |
| 298.15 | 0.4862 | 1255.6 |
| 298.15 | 0.5904 | 1273.47 |
| 298.15 | 0.7066 | 1291.18 |
| 298.15 | 0.8358 | 1308.67 |
| 298.15 | 0.9012 | 1316.72 |
| 298.15 | 1.0000 | 1328.24 |
| 308.15 | 0.0000 | 1117.29 |
| 308.15 | 0.0921 | 1147.77 |
| 308.15 | 0.1727 | 1170.98 |
| 308.15 | 0.2614 | 1193.5 |
| 308.15 | 0.3951 | 1222.71 |
| 308.15 | 0.4862 | 1239.96 |
| 308.15 | 0.5904 | 1257.52 |
| 308.15 | 0.7066 | 1274.93 |
| 308.15 | 0.8358 | 1292.14 |
| 308.15 | 0.9012 | 1300.08 |
| 308.15 | 1.0000 | 1311.45 |
| 318.15 | 0.0000 | 1103.55 |
| 318.15 | 0.0921 | 1133.54 |
| 318.15 | 0.1727 | 1156.35 |
| 318.15 | 0.2614 | 1178.49 |
| 318.15 | 0.3951 | 1207.19 |
| 318.15 | 0.4862 | 1224.13 |
| 318.15 | 0.5904 | 1241.39 |
| 318.15 | 0.7066 | 1258.49 |
| 318.15 | 0.8358 | 1275.42 |
| 318.15 | 0.9012 | 1283.24 |
| 318.15 | 1.0000 | 1294.47 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,1-trichloro- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.62 |
| 298.15 | 0.0921 | 1258.59 |
| 298.15 | 0.1727 | 1211.55 |
| 298.15 | 0.2614 | 1166.33 |
| 298.15 | 0.3951 | 1109.82 |
| 298.15 | 0.4862 | 1079.35 |
| 298.15 | 0.5904 | 1048.74 |
| 298.15 | 0.7066 | 1019.26 |
| 298.15 | 0.8358 | 992.76 |
| 298.15 | 0.9012 | 980.43 |
| 298.15 | 1.0000 | 962.94 |
| 308.15 | 0.0000 | 1281.9 |
| 308.15 | 0.0921 | 1219.9 |
| 308.15 | 0.1727 | 1173.74 |
| 308.15 | 0.2614 | 1129.14 |
| 308.15 | 0.3951 | 1073.5 |
| 308.15 | 0.4862 | 1043.37 |
| 308.15 | 0.5904 | 1013.22 |
| 308.15 | 0.7066 | 984.72 |
| 308.15 | 0.8358 | 957.84 |
| 308.15 | 0.9012 | 945.74 |
| 308.15 | 1.0000 | 928.68 |
| 318.15 | 0.0000 | 1242.49 |
| 318.15 | 0.0921 | 1181.42 |
| 318.15 | 0.1727 | 1135.96 |
| 318.15 | 0.2614 | 1092.1 |
| 318.15 | 0.3951 | 1037.3 |
| 318.15 | 0.4862 | 1007.6 |
| 318.15 | 0.5904 | 977.89 |
| 318.15 | 0.7066 | 949.76 |
| 318.15 | 0.8358 | 923.21 |
| 318.15 | 0.9012 | 911.39 |
| 318.15 | 1.0000 | 894.71 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,1-trichloro- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.62 |
| 298.15 | 0.0921 | 1258.59 |
| 298.15 | 0.1727 | 1211.55 |
| 298.15 | 0.2614 | 1166.33 |
| 298.15 | 0.3951 | 1109.82 |
| 298.15 | 0.4862 | 1079.35 |
| 298.15 | 0.5904 | 1048.74 |
| 298.15 | 0.7066 | 1019.26 |
| 298.15 | 0.8358 | 992.76 |
| 298.15 | 0.9012 | 980.43 |
| 298.15 | 1.0000 | 962.94 |
| 308.15 | 0.0000 | 1281.9 |
| 308.15 | 0.0921 | 1219.9 |
| 308.15 | 0.1727 | 1173.74 |
| 308.15 | 0.2614 | 1129.14 |
| 308.15 | 0.3951 | 1073.5 |
| 308.15 | 0.4862 | 1043.37 |
| 308.15 | 0.5904 | 1013.22 |
| 308.15 | 0.7066 | 984.72 |
| 308.15 | 0.8358 | 957.84 |
| 308.15 | 0.9012 | 945.74 |
| 308.15 | 1.0000 | 928.68 |
| 318.15 | 0.0000 | 1242.49 |
| 318.15 | 0.0921 | 1181.42 |
| 318.15 | 0.1727 | 1135.96 |
| 318.15 | 0.2614 | 1092.1 |
| 318.15 | 0.3951 | 1037.3 |
| 318.15 | 0.4862 | 1007.6 |
| 318.15 | 0.5904 | 977.89 |
| 318.15 | 0.7066 | 949.76 |
| 318.15 | 0.8358 | 923.21 |
| 318.15 | 0.9012 | 911.39 |
| 318.15 | 1.0000 | 894.71 |
Sources
- Speeds of sound, isentropic compressibilities and refractive indices for some binary mixtures of nitromethane with chloroalkane at temperatures from 298.15 to 318.15 K. Comparison with theories
- Volumetric Study for the Binary Nitromethane with Chloroalkane Mixtures at Temperatures in the Range (298.15 to 318.15) K