- Name
- Butane, 1-chloro-
- InChI
- InChI=1S/C4H9Cl/c1-2-3-4-5/h2-4H2,1H3
- InChI Key
- VFWCMGCRMGJXDK-UHFFFAOYSA-N
- Formula
- C4H9Cl
- SMILES
- CCCCCl
- Mol. Weight (g/mol)
- 92.57
- CAS
- 109-69-3
- Name
- Methane, nitro-
- InChI
- InChI=1S/CH3NO2/c1-2(3)4/h1H3
- InChI Key
- LYGJENNIWJXYER-UHFFFAOYSA-N
- Formula
- CH3NO2
- SMILES
- C[N+](=O)[O-]
- Mol. Weight (g/mol)
- 61.04
- CAS
- 75-52-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butane, 1-chloro- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3792 |
| 298.15 | 0.1107 | 1.3819 |
| 298.15 | 0.2174 | 1.3844 |
| 298.15 | 0.3236 | 1.3869 |
| 298.15 | 0.3932 | 1.3884 |
| 298.15 | 0.4856 | 1.3903 |
| 298.15 | 0.5569 | 1.3918 |
| 298.15 | 0.6626 | 1.3938 |
| 298.15 | 0.7722 | 1.3958 |
| 298.15 | 0.8646 | 1.3973 |
| 298.15 | 1.0000 | 1.3995 |
| 308.15 | 0.0000 | 1.3745 |
| 308.15 | 0.1107 | 1.377 |
| 308.15 | 0.2174 | 1.3794 |
| 308.15 | 0.3236 | 1.3817 |
| 308.15 | 0.3932 | 1.3832 |
| 308.15 | 0.4856 | 1.3851 |
| 308.15 | 0.5569 | 1.3866 |
| 308.15 | 0.6626 | 1.3885 |
| 308.15 | 0.7722 | 1.3904 |
| 308.15 | 0.8646 | 1.392 |
| 308.15 | 1.0000 | 1.3941 |
| 318.15 | 0.0000 | 1.3695 |
| 318.15 | 0.1107 | 1.3718 |
| 318.15 | 0.2174 | 1.3741 |
| 318.15 | 0.3236 | 1.3763 |
| 318.15 | 0.3932 | 1.3777 |
| 318.15 | 0.4856 | 1.3796 |
| 318.15 | 0.5569 | 1.381 |
| 318.15 | 0.6626 | 1.383 |
| 318.15 | 0.7722 | 1.3848 |
| 318.15 | 0.8646 | 1.3863 |
| 318.15 | 1.0000 | 1.3885 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butane, 1-chloro- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3792 |
| 298.15 | 0.1107 | 1.3819 |
| 298.15 | 0.2174 | 1.3844 |
| 298.15 | 0.3236 | 1.3869 |
| 298.15 | 0.3932 | 1.3884 |
| 298.15 | 0.4856 | 1.3903 |
| 298.15 | 0.5569 | 1.3918 |
| 298.15 | 0.6626 | 1.3938 |
| 298.15 | 0.7722 | 1.3958 |
| 298.15 | 0.8646 | 1.3973 |
| 298.15 | 1.0000 | 1.3995 |
| 308.15 | 0.0000 | 1.3745 |
| 308.15 | 0.1107 | 1.377 |
| 308.15 | 0.2174 | 1.3794 |
| 308.15 | 0.3236 | 1.3817 |
| 308.15 | 0.3932 | 1.3832 |
| 308.15 | 0.4856 | 1.3851 |
| 308.15 | 0.5569 | 1.3866 |
| 308.15 | 0.6626 | 1.3885 |
| 308.15 | 0.7722 | 1.3904 |
| 308.15 | 0.8646 | 1.392 |
| 308.15 | 1.0000 | 1.3941 |
| 318.15 | 0.0000 | 1.3695 |
| 318.15 | 0.1107 | 1.3718 |
| 318.15 | 0.2174 | 1.3741 |
| 318.15 | 0.3236 | 1.3763 |
| 318.15 | 0.3932 | 1.3777 |
| 318.15 | 0.4856 | 1.3796 |
| 318.15 | 0.5569 | 1.381 |
| 318.15 | 0.6626 | 1.383 |
| 318.15 | 0.7722 | 1.3848 |
| 318.15 | 0.8646 | 1.3863 |
| 318.15 | 1.0000 | 1.3885 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butane, 1-chloro- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1130.76 |
| 298.15 | 0.1107 | 1080.18 |
| 298.15 | 0.2174 | 1040.11 |
| 298.15 | 0.3236 | 1007.02 |
| 298.15 | 0.3932 | 987.92 |
| 298.15 | 0.4856 | 965.38 |
| 298.15 | 0.5569 | 949.92 |
| 298.15 | 0.6626 | 929.96 |
| 298.15 | 0.7722 | 911.75 |
| 298.15 | 0.8646 | 898.07 |
| 298.15 | 1.0000 | 881.17 |
| 308.15 | 0.0000 | 1117.14 |
| 308.15 | 0.1107 | 1067.0 |
| 308.15 | 0.2174 | 1027.27 |
| 308.15 | 0.3236 | 994.47 |
| 308.15 | 0.3932 | 975.54 |
| 308.15 | 0.4856 | 953.21 |
| 308.15 | 0.5569 | 937.92 |
| 308.15 | 0.6626 | 918.09 |
| 308.15 | 0.7722 | 900.15 |
| 308.15 | 0.8646 | 886.65 |
| 308.15 | 1.0000 | 870.0 |
| 318.15 | 0.0000 | 1103.39 |
| 318.15 | 0.1107 | 1053.7 |
| 318.15 | 0.2174 | 1014.29 |
| 318.15 | 0.3236 | 982.09 |
| 318.15 | 0.3932 | 963.01 |
| 318.15 | 0.4856 | 940.87 |
| 318.15 | 0.5569 | 925.76 |
| 318.15 | 0.6626 | 906.2 |
| 318.15 | 0.7722 | 888.4 |
| 318.15 | 0.8646 | 875.07 |
| 318.15 | 1.0000 | 858.67 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butane, 1-chloro- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1130.76 |
| 298.15 | 0.1107 | 1080.18 |
| 298.15 | 0.2174 | 1040.11 |
| 298.15 | 0.3236 | 1007.02 |
| 298.15 | 0.3932 | 987.92 |
| 298.15 | 0.4856 | 965.38 |
| 298.15 | 0.5569 | 949.92 |
| 298.15 | 0.6626 | 929.96 |
| 298.15 | 0.7722 | 911.75 |
| 298.15 | 0.8646 | 898.07 |
| 298.15 | 1.0000 | 881.17 |
| 308.15 | 0.0000 | 1117.14 |
| 308.15 | 0.1107 | 1067.0 |
| 308.15 | 0.2174 | 1027.27 |
| 308.15 | 0.3236 | 994.47 |
| 308.15 | 0.3932 | 975.54 |
| 308.15 | 0.4856 | 953.21 |
| 308.15 | 0.5569 | 937.92 |
| 308.15 | 0.6626 | 918.09 |
| 308.15 | 0.7722 | 900.15 |
| 308.15 | 0.8646 | 886.65 |
| 308.15 | 1.0000 | 870.0 |
| 318.15 | 0.0000 | 1103.39 |
| 318.15 | 0.1107 | 1053.7 |
| 318.15 | 0.2174 | 1014.29 |
| 318.15 | 0.3236 | 982.09 |
| 318.15 | 0.3932 | 963.01 |
| 318.15 | 0.4856 | 940.87 |
| 318.15 | 0.5569 | 925.76 |
| 318.15 | 0.6626 | 906.2 |
| 318.15 | 0.7722 | 888.4 |
| 318.15 | 0.8646 | 875.07 |
| 318.15 | 1.0000 | 858.67 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butane, 1-chloro- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.5 |
| 298.15 | 0.1107 | 1273.68 |
| 298.15 | 0.2174 | 1236.48 |
| 298.15 | 0.3236 | 1207.58 |
| 298.15 | 0.3932 | 1191.93 |
| 298.15 | 0.4856 | 1174.47 |
| 298.15 | 0.5569 | 1163.48 |
| 298.15 | 0.6626 | 1149.34 |
| 298.15 | 0.7722 | 1137.56 |
| 298.15 | 0.8646 | 1129.09 |
| 298.15 | 1.0000 | 1119.0 |
| 308.15 | 0.0000 | 1282.12 |
| 308.15 | 0.1107 | 1234.3 |
| 308.15 | 0.2174 | 1197.1 |
| 308.15 | 0.3236 | 1168.1 |
| 308.15 | 0.3932 | 1152.3 |
| 308.15 | 0.4856 | 1134.7 |
| 308.15 | 0.5569 | 1123.2 |
| 308.15 | 0.6626 | 1109.1 |
| 308.15 | 0.7722 | 1096.8 |
| 308.15 | 0.8646 | 1088.3 |
| 308.15 | 1.0000 | 1078.01 |
| 318.15 | 0.0000 | 1242.76 |
| 318.15 | 0.1107 | 1195.0 |
| 318.15 | 0.2174 | 1157.8 |
| 318.15 | 0.3236 | 1128.9 |
| 318.15 | 0.3932 | 1112.8 |
| 318.15 | 0.4856 | 1094.9 |
| 318.15 | 0.5569 | 1083.1 |
| 318.15 | 0.6626 | 1068.9 |
| 318.15 | 0.7722 | 1056.6 |
| 318.15 | 0.8646 | 1047.8 |
| 318.15 | 1.0000 | 1037.26 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Butane, 1-chloro- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.5 |
| 298.15 | 0.1107 | 1273.68 |
| 298.15 | 0.2174 | 1236.48 |
| 298.15 | 0.3236 | 1207.58 |
| 298.15 | 0.3932 | 1191.93 |
| 298.15 | 0.4856 | 1174.47 |
| 298.15 | 0.5569 | 1163.48 |
| 298.15 | 0.6626 | 1149.34 |
| 298.15 | 0.7722 | 1137.56 |
| 298.15 | 0.8646 | 1129.09 |
| 298.15 | 1.0000 | 1119.0 |
| 308.15 | 0.0000 | 1282.12 |
| 308.15 | 0.1107 | 1234.3 |
| 308.15 | 0.2174 | 1197.1 |
| 308.15 | 0.3236 | 1168.1 |
| 308.15 | 0.3932 | 1152.3 |
| 308.15 | 0.4856 | 1134.7 |
| 308.15 | 0.5569 | 1123.2 |
| 308.15 | 0.6626 | 1109.1 |
| 308.15 | 0.7722 | 1096.8 |
| 308.15 | 0.8646 | 1088.3 |
| 308.15 | 1.0000 | 1078.01 |
| 318.15 | 0.0000 | 1242.76 |
| 318.15 | 0.1107 | 1195.0 |
| 318.15 | 0.2174 | 1157.8 |
| 318.15 | 0.3236 | 1128.9 |
| 318.15 | 0.3932 | 1112.8 |
| 318.15 | 0.4856 | 1094.9 |
| 318.15 | 0.5569 | 1083.1 |
| 318.15 | 0.6626 | 1068.9 |
| 318.15 | 0.7722 | 1056.6 |
| 318.15 | 0.8646 | 1047.8 |
| 318.15 | 1.0000 | 1037.26 |
Sources
- Speeds of sound, isentropic compressibilities and refractive indices for some binary mixtures of nitromethane with chloroalkane at temperatures from 298.15 to 318.15 K. Comparison with theories
- Volumetric Study for the Binary Nitromethane with Chloroalkane Mixtures at Temperatures in the Range (298.15 to 318.15) K