- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Ethanol, 2-methoxy-
- InChI
- InChI=1S/C3H8O2/c1-5-3-2-4/h4H,2-3H2,1H3
- InChI Key
- XNWFRZJHXBZDAG-UHFFFAOYSA-N
- Formula
- C3H8O2
- SMILES
- COCCO
- Mol. Weight (g/mol)
- 76.09
- CAS
- 109-86-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Activity coefficient (2)
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
Activity coefficient of p-Xylene (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of p-Xylene (1) - Liquid | Activity coefficient of p-Xylene (1) - Liquid |
| 298.00 | 238.00 | 0.0000 | 5.2 |
Activity coefficient of p-Xylene (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of p-Xylene (1) - Liquid | Activity coefficient of p-Xylene (1) - Liquid |
| 298.00 | 238.00 | 0.0000 | 5.2 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0528 | 0.0006 |
| 298.15 | 0.1469 | 0.0007 |
| 298.15 | 0.2507 | 0.0007 |
| 298.15 | 0.3484 | 0.0007 |
| 298.15 | 0.4499 | 0.0008 |
| 298.15 | 0.4999 | 0.0008 |
| 298.15 | 0.5542 | 0.0009 |
| 298.15 | 0.6493 | 0.0010 |
| 298.15 | 0.7508 | 0.0011 |
| 298.15 | 0.8478 | 0.0013 |
| 298.15 | 0.9556 | 0.0015 |
| 308.15 | 0.0528 | 0.0005 |
| 308.15 | 0.1469 | 0.0006 |
| 308.15 | 0.2507 | 0.0006 |
| 308.15 | 0.3484 | 0.0006 |
| 308.15 | 0.4499 | 0.0007 |
| 308.15 | 0.4999 | 0.0007 |
| 308.15 | 0.5542 | 0.0008 |
| 308.15 | 0.6493 | 0.0008 |
| 308.15 | 0.7508 | 0.0009 |
| 308.15 | 0.8478 | 0.0010 |
| 308.15 | 0.9556 | 0.0012 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0528 | 0.0006 |
| 298.15 | 0.1469 | 0.0007 |
| 298.15 | 0.2507 | 0.0007 |
| 298.15 | 0.3484 | 0.0007 |
| 298.15 | 0.4499 | 0.0008 |
| 298.15 | 0.4999 | 0.0008 |
| 298.15 | 0.5542 | 0.0009 |
| 298.15 | 0.6493 | 0.0010 |
| 298.15 | 0.7508 | 0.0011 |
| 298.15 | 0.8478 | 0.0013 |
| 298.15 | 0.9556 | 0.0015 |
| 308.15 | 0.0528 | 0.0005 |
| 308.15 | 0.1469 | 0.0006 |
| 308.15 | 0.2507 | 0.0006 |
| 308.15 | 0.3484 | 0.0006 |
| 308.15 | 0.4499 | 0.0007 |
| 308.15 | 0.4999 | 0.0007 |
| 308.15 | 0.5542 | 0.0008 |
| 308.15 | 0.6493 | 0.0008 |
| 308.15 | 0.7508 | 0.0009 |
| 308.15 | 0.8478 | 0.0010 |
| 308.15 | 0.9556 | 0.0012 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0499 | 1.4069 |
| 0.0999 | 1.4136 |
| 0.1999 | 1.4253 |
| 0.3000 | 1.4367 |
| 0.3999 | 1.4462 |
| 0.5001 | 1.4557 |
| 0.6000 | 1.4641 |
| 0.6999 | 1.4717 |
| 0.7999 | 1.4793 |
| 0.8999 | 1.4862 |
| 0.9499 | 1.4895 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0499 | 1.4069 |
| 0.0999 | 1.4136 |
| 0.1999 | 1.4253 |
| 0.3000 | 1.4367 |
| 0.3999 | 1.4462 |
| 0.5001 | 1.4557 |
| 0.6000 | 1.4641 |
| 0.6999 | 1.4717 |
| 0.7999 | 1.4793 |
| 0.8999 | 1.4862 |
| 0.9499 | 1.4895 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0499 | 952.02 |
| 0.0999 | 944.39 |
| 0.1999 | 930.07 |
| 0.3000 | 917.28 |
| 0.3999 | 905.75 |
| 0.5001 | 895.38 |
| 0.6000 | 885.92 |
| 0.6999 | 877.19 |
| 0.7999 | 869.23 |
| 0.8999 | 862.2 |
| 0.9499 | 859.28 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0528 | 859.41 |
| 298.15 | 0.1469 | 865.14 |
| 298.15 | 0.2507 | 872.58 |
| 298.15 | 0.3484 | 880.62 |
| 298.15 | 0.4499 | 890.02 |
| 298.15 | 0.4999 | 895.04 |
| 298.15 | 0.5542 | 900.79 |
| 298.15 | 0.6493 | 911.61 |
| 298.15 | 0.7508 | 924.23 |
| 298.15 | 0.8478 | 937.37 |
| 298.15 | 0.9556 | 953.27 |
| 303.15 | 0.0528 | 854.99 |
| 303.15 | 0.1469 | 860.67 |
| 303.15 | 0.2507 | 868.04 |
| 303.15 | 0.3484 | 876.02 |
| 303.15 | 0.4499 | 885.38 |
| 303.15 | 0.4999 | 890.38 |
| 303.15 | 0.5542 | 896.12 |
| 303.15 | 0.6493 | 906.92 |
| 303.15 | 0.7508 | 919.53 |
| 303.15 | 0.8478 | 932.67 |
| 303.15 | 0.9556 | 948.59 |
| 308.15 | 0.0528 | 850.64 |
| 308.15 | 0.1469 | 856.36 |
| 308.15 | 0.2507 | 863.8 |
| 308.15 | 0.3484 | 871.86 |
| 308.15 | 0.4499 | 881.33 |
| 308.15 | 0.4999 | 886.41 |
| 308.15 | 0.5542 | 892.23 |
| 308.15 | 0.6493 | 903.22 |
| 308.15 | 0.7508 | 916.11 |
| 308.15 | 0.8478 | 929.64 |
| 308.15 | 0.9556 | 946.21 |
| 313.15 | 0.0528 | 846.26 |
| 313.15 | 0.1469 | 851.72 |
| 313.15 | 0.2507 | 858.87 |
| 313.15 | 0.3484 | 866.67 |
| 313.15 | 0.4499 | 875.86 |
| 313.15 | 0.4999 | 880.79 |
| 313.15 | 0.5542 | 886.45 |
| 313.15 | 0.6493 | 897.16 |
| 313.15 | 0.7508 | 909.74 |
| 313.15 | 0.8478 | 922.96 |
| 313.15 | 0.9556 | 939.16 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0499 | 952.02 |
| 0.0999 | 944.39 |
| 0.1999 | 930.07 |
| 0.3000 | 917.28 |
| 0.3999 | 905.75 |
| 0.5001 | 895.38 |
| 0.6000 | 885.92 |
| 0.6999 | 877.19 |
| 0.7999 | 869.23 |
| 0.8999 | 862.2 |
| 0.9499 | 859.28 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0528 | 859.41 |
| 298.15 | 0.1469 | 865.14 |
| 298.15 | 0.2507 | 872.58 |
| 298.15 | 0.3484 | 880.62 |
| 298.15 | 0.4499 | 890.02 |
| 298.15 | 0.4999 | 895.04 |
| 298.15 | 0.5542 | 900.79 |
| 298.15 | 0.6493 | 911.61 |
| 298.15 | 0.7508 | 924.23 |
| 298.15 | 0.8478 | 937.37 |
| 298.15 | 0.9556 | 953.27 |
| 303.15 | 0.0528 | 854.99 |
| 303.15 | 0.1469 | 860.67 |
| 303.15 | 0.2507 | 868.04 |
| 303.15 | 0.3484 | 876.02 |
| 303.15 | 0.4499 | 885.38 |
| 303.15 | 0.4999 | 890.38 |
| 303.15 | 0.5542 | 896.12 |
| 303.15 | 0.6493 | 906.92 |
| 303.15 | 0.7508 | 919.53 |
| 303.15 | 0.8478 | 932.67 |
| 303.15 | 0.9556 | 948.59 |
| 308.15 | 0.0528 | 850.64 |
| 308.15 | 0.1469 | 856.36 |
| 308.15 | 0.2507 | 863.8 |
| 308.15 | 0.3484 | 871.86 |
| 308.15 | 0.4499 | 881.33 |
| 308.15 | 0.4999 | 886.41 |
| 308.15 | 0.5542 | 892.23 |
| 308.15 | 0.6493 | 903.22 |
| 308.15 | 0.7508 | 916.11 |
| 308.15 | 0.8478 | 929.64 |
| 308.15 | 0.9556 | 946.21 |
| 313.15 | 0.0528 | 846.26 |
| 313.15 | 0.1469 | 851.72 |
| 313.15 | 0.2507 | 858.87 |
| 313.15 | 0.3484 | 866.67 |
| 313.15 | 0.4499 | 875.86 |
| 313.15 | 0.4999 | 880.79 |
| 313.15 | 0.5542 | 886.45 |
| 313.15 | 0.6493 | 897.16 |
| 313.15 | 0.7508 | 909.74 |
| 313.15 | 0.8478 | 922.96 |
| 313.15 | 0.9556 | 939.16 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0528 | 1306.0 |
| 298.15 | 0.1469 | 1303.0 |
| 298.15 | 0.2507 | 1302.0 |
| 298.15 | 0.3484 | 1302.0 |
| 298.15 | 0.4499 | 1304.0 |
| 298.15 | 0.4999 | 1305.0 |
| 298.15 | 0.5542 | 1306.0 |
| 298.15 | 0.6493 | 1310.0 |
| 298.15 | 0.7508 | 1315.0 |
| 298.15 | 0.8478 | 1323.0 |
| 298.15 | 0.9556 | 1333.0 |
| 308.15 | 0.0528 | 1273.0 |
| 308.15 | 0.1469 | 1270.0 |
| 308.15 | 0.2507 | 1268.0 |
| 308.15 | 0.3484 | 1269.0 |
| 308.15 | 0.4499 | 1270.0 |
| 308.15 | 0.4999 | 1272.0 |
| 308.15 | 0.5542 | 1273.0 |
| 308.15 | 0.6493 | 1278.0 |
| 308.15 | 0.7508 | 1285.0 |
| 308.15 | 0.8478 | 1297.0 |
| 308.15 | 0.9556 | 1317.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0528 | 1306.0 |
| 298.15 | 0.1469 | 1303.0 |
| 298.15 | 0.2507 | 1302.0 |
| 298.15 | 0.3484 | 1302.0 |
| 298.15 | 0.4499 | 1304.0 |
| 298.15 | 0.4999 | 1305.0 |
| 298.15 | 0.5542 | 1306.0 |
| 298.15 | 0.6493 | 1310.0 |
| 298.15 | 0.7508 | 1315.0 |
| 298.15 | 0.8478 | 1323.0 |
| 298.15 | 0.9556 | 1333.0 |
| 308.15 | 0.0528 | 1273.0 |
| 308.15 | 0.1469 | 1270.0 |
| 308.15 | 0.2507 | 1268.0 |
| 308.15 | 0.3484 | 1269.0 |
| 308.15 | 0.4499 | 1270.0 |
| 308.15 | 0.4999 | 1272.0 |
| 308.15 | 0.5542 | 1273.0 |
| 308.15 | 0.6493 | 1278.0 |
| 308.15 | 0.7508 | 1285.0 |
| 308.15 | 0.8478 | 1297.0 |
| 308.15 | 0.9556 | 1317.0 |
Sources
- Liquid liquid equilibria in the ternary systems {hexadecane + BTX aromatics + 2-methoxyethanol or acetonitrile} at 298.15 K
- Thermodynamics of solvation in propylene glycol and methyl cellosolve
- Densities, Excess Molar Volumes, Viscosities, Speeds of Sound, Excess Isentropic Compressibilities, and Relative Permittivities for CmH2m+1(OCH2CH2)nOH (m ) 1 or 2 or 4 andn ) 1) + Benzene, + Toluene, + (o-, m-, and p-) Xylenes, + Ethylbenzene, and + Cyclohexane