- Name
- Acetaminophen
- InChI
- InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)
- InChI Key
- RZVAJINKPMORJF-UHFFFAOYSA-N
- Formula
- C8H9NO2
- SMILES
- CC(=O)Nc1ccc(O)cc1
- Mol. Weight (g/mol)
- 151.16
- CAS
- 103-90-2
- Name
- Ethanol
- InChI
- InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3
- InChI Key
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N
- Formula
- C2H6O
- SMILES
- CCO
- Mol. Weight (g/mol)
- 46.07
- CAS
- 64-17-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Acetaminophen (1) [ref]
Operational condition: Pressure, kPa = 125 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (1) - Liquid |
|---|---|
| 295.15 | 0.0549 |
| 305.35 | 0.0662 |
| 314.15 | 0.0737 |
| 322.15 | 0.0898 |
| 332.95 | 0.1157 |
| 341.25 | 0.1405 |
| 350.05 | 0.1797 |
| 360.15 | 0.2156 |
Mole fraction of Acetaminophen (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (1) - Liquid |
|---|---|
| 293.15 | 0.0542 |
| 303.15 | 0.0628 |
| 313.15 | 0.0737 |
| 323.15 | 0.0898 |
| 333.15 | 0.1157 |
| 343.15 | 0.1405 |
Mole fraction of Acetaminophen (1) [ref]
Operational condition: Pressure, kPa = 125 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (1) - Liquid |
|---|---|
| 295.15 | 0.0549 |
| 305.35 | 0.0662 |
| 314.15 | 0.0737 |
| 322.15 | 0.0898 |
| 332.95 | 0.1157 |
| 341.25 | 0.1405 |
| 350.05 | 0.1797 |
| 360.15 | 0.2156 |
Mole fraction of Acetaminophen (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (1) - Liquid |
|---|---|
| 293.15 | 0.0542 |
| 303.15 | 0.0628 |
| 313.15 | 0.0737 |
| 323.15 | 0.0898 |
| 333.15 | 0.1157 |
| 343.15 | 0.1405 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Acetaminophen (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0444 | 284.49 |
| 0.0471 | 288.38 |
| 0.0508 | 293.54 |
| 0.0539 | 295.69 |
| 0.0603 | 302.06 |
| 0.0634 | 304.30 |
| 0.0687 | 309.05 |
| 0.0737 | 313.41 |
| 0.0773 | 315.66 |
| 0.0831 | 318.74 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Acetaminophen (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0444 | 284.49 |
| 0.0471 | 288.38 |
| 0.0508 | 293.54 |
| 0.0539 | 295.69 |
| 0.0603 | 302.06 |
| 0.0634 | 304.30 |
| 0.0687 | 309.05 |
| 0.0737 | 313.41 |
| 0.0773 | 315.66 |
| 0.0831 | 318.74 |