- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Acetaminophen
- InChI
- InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)
- InChI Key
- RZVAJINKPMORJF-UHFFFAOYSA-N
- Formula
- C8H9NO2
- SMILES
- CC(=O)Nc1ccc(O)cc1
- Mol. Weight (g/mol)
- 151.16
- CAS
- 103-90-2
Datasets
Mole fraction of Acetaminophen (2) [ref]
Operational condition: Pressure, kPa = 125 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (2) - Liquid |
|---|---|
| 293.65 | 0.0415 |
| 304.05 | 0.0509 |
| 313.05 | 0.0604 |
| 320.25 | 0.0696 |
| 325.35 | 0.0787 |
| 330.25 | 0.0876 |
| 336.15 | 0.1049 |
| 343.45 | 0.1215 |
| 353.05 | 0.1518 |
| 348.15 | 0.1364 |
| 356.15 | 0.1593 |
Mole fraction of Acetaminophen (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (2) - Liquid |
|---|---|
| 293.15 | 0.0415 |
| 303.15 | 0.0509 |
| 313.15 | 0.0618 |
| 323.15 | 0.0749 |
| 333.15 | 0.0944 |
| 343.15 | 0.1165 |
Mole fraction of Acetaminophen (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (2) - Liquid |
|---|---|
| 293.15 | 0.0415 |
| 303.15 | 0.0509 |
Mole fraction of Acetaminophen (2) [ref]
Operational condition: Pressure, kPa = 125 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (2) - Liquid |
|---|---|
| 293.65 | 0.0415 |
| 304.05 | 0.0509 |
| 313.05 | 0.0604 |
| 320.25 | 0.0696 |
| 325.35 | 0.0787 |
| 330.25 | 0.0876 |
| 336.15 | 0.1049 |
| 343.45 | 0.1215 |
| 353.05 | 0.1518 |
| 348.15 | 0.1364 |
| 356.15 | 0.1593 |
Mole fraction of Acetaminophen (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (2) - Liquid |
|---|---|
| 293.15 | 0.0415 |
| 303.15 | 0.0509 |
| 313.15 | 0.0618 |
| 323.15 | 0.0749 |
| 333.15 | 0.0944 |
| 343.15 | 0.1165 |
Mole fraction of Acetaminophen (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetaminophen (2) - Liquid |
|---|---|
| 293.15 | 0.0415 |
| 303.15 | 0.0509 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Acetaminophen (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0256 | 273.50 |
| 0.0372 | 289.99 |
| 0.0473 | 302.50 |
| 0.0583 | 311.90 |
| 0.0695 | 321.14 |
| 0.0790 | 326.40 |
| 0.0868 | 330.95 |
| 0.0982 | 336.51 |
| 0.1069 | 340.69 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Acetaminophen (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0256 | 273.50 |
| 0.0372 | 289.99 |
| 0.0473 | 302.50 |
| 0.0583 | 311.90 |
| 0.0695 | 321.14 |
| 0.0790 | 326.40 |
| 0.0868 | 330.95 |
| 0.0982 | 336.51 |
| 0.1069 | 340.69 |
Sources
- Determination and prediction of solubilities of active pharmaceutical ingredients in selected organic solvents
- Pressurized-Synthetic Methodology for Solubility Determination at Elevated Temperatures with Application to Paracetamol in Pure Solvents
- Solubility Measurement and Thermodynamic Modeling of N-(4-Methylphenyl-Z-3-chloro-2-(phenylthio)propenamide in 12 Pure Solvents at Temperatures Ranging from 278.15 to 318.15 K