- Name
- Acetonitrile
- InChI
- InChI=1S/C2H3N/c1-2-3/h1H3
- InChI Key
- WEVYAHXRMPXWCK-UHFFFAOYSA-N
- Formula
- C2H3N
- SMILES
- CC#N
- Mol. Weight (g/mol)
- 41.05
- CAS
- 75-05-8
- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
- Tboil - Boiling temperature at pressure P, K (4)
- Vapor Liquid Equilibrium at Constant Pressure (2)
- Vapor Liquid Equilibrium at Constant Temperature
Mole fraction of Isopropyl Alcohol (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Isopropyl Alcohol (2) - Liquid | Mole fraction of Isopropyl Alcohol (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0530 | 0.1020 |
| 0.0960 | 0.1720 |
| 0.1930 | 0.2810 |
| 0.2980 | 0.3660 |
| 0.3990 | 0.4270 |
| 0.4490 | 0.4550 |
| 0.5010 | 0.4810 |
| 0.5760 | 0.5300 |
| 0.6090 | 0.5390 |
| 0.7080 | 0.6010 |
| 0.8100 | 0.6880 |
| 0.9000 | 0.7930 |
| 0.9650 | 0.8780 |
| 1.0000 | 1.0000 |
Mole fraction of Isopropyl Alcohol (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Isopropyl Alcohol (2) - Liquid | Mole fraction of Isopropyl Alcohol (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0530 | 0.1020 |
| 0.0960 | 0.1720 |
| 0.1930 | 0.2810 |
| 0.2980 | 0.3660 |
| 0.3990 | 0.4270 |
| 0.4490 | 0.4550 |
| 0.5010 | 0.4810 |
| 0.5760 | 0.5300 |
| 0.6090 | 0.5390 |
| 0.7080 | 0.6010 |
| 0.8100 | 0.6880 |
| 0.9000 | 0.7930 |
| 0.9650 | 0.8780 |
| 1.0000 | 1.0000 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0024 |
| 293.15 | 0.0496 | 0.0020 |
| 293.15 | 0.0906 | 0.0017 |
| 293.15 | 0.1529 | 0.0014 |
| 293.15 | 0.2022 | 0.0012 |
| 293.15 | 0.2783 | 0.0010 |
| 293.15 | 0.3678 | 0.0008 |
| 293.15 | 0.4768 | 0.0007 |
| 293.15 | 0.6132 | 0.0005 |
| 293.15 | 0.7714 | 0.0004 |
| 293.15 | 0.9207 | 0.0004 |
| 293.15 | 1.0000 | 0.0004 |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.0496 | 0.0017 |
| 298.15 | 0.0906 | 0.0015 |
| 298.15 | 0.1529 | 0.0012 |
| 298.15 | 0.2022 | 0.0010 |
| 298.15 | 0.2783 | 0.0009 |
| 298.15 | 0.3678 | 0.0007 |
| 298.15 | 0.4768 | 0.0006 |
| 298.15 | 0.6132 | 0.0005 |
| 298.15 | 0.7714 | 0.0004 |
| 298.15 | 0.9207 | 0.0003 |
| 298.15 | 1.0000 | 0.0003 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.0496 | 0.0015 |
| 303.15 | 0.0906 | 0.0013 |
| 303.15 | 0.1529 | 0.0011 |
| 303.15 | 0.2022 | 0.0009 |
| 303.15 | 0.2783 | 0.0008 |
| 303.15 | 0.3678 | 0.0007 |
| 303.15 | 0.4768 | 0.0005 |
| 303.15 | 0.6132 | 0.0004 |
| 303.15 | 0.7714 | 0.0004 |
| 303.15 | 0.9207 | 0.0003 |
| 303.15 | 1.0000 | 0.0003 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.0496 | 0.0013 |
| 308.15 | 0.0906 | 0.0011 |
| 308.15 | 0.1529 | 0.0010 |
| 308.15 | 0.2022 | 0.0008 |
| 308.15 | 0.2783 | 0.0007 |
| 308.15 | 0.3678 | 0.0006 |
| 308.15 | 0.4768 | 0.0005 |
| 308.15 | 0.6132 | 0.0004 |
| 308.15 | 0.7714 | 0.0003 |
| 308.15 | 0.9207 | 0.0003 |
| 308.15 | 1.0000 | 0.0003 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0024 |
| 293.15 | 0.0496 | 0.0020 |
| 293.15 | 0.0906 | 0.0017 |
| 293.15 | 0.1529 | 0.0014 |
| 293.15 | 0.2022 | 0.0012 |
| 293.15 | 0.2783 | 0.0010 |
| 293.15 | 0.3678 | 0.0008 |
| 293.15 | 0.4768 | 0.0007 |
| 293.15 | 0.6132 | 0.0005 |
| 293.15 | 0.7714 | 0.0004 |
| 293.15 | 0.9207 | 0.0004 |
| 293.15 | 1.0000 | 0.0004 |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.0496 | 0.0017 |
| 298.15 | 0.0906 | 0.0015 |
| 298.15 | 0.1529 | 0.0012 |
| 298.15 | 0.2022 | 0.0010 |
| 298.15 | 0.2783 | 0.0009 |
| 298.15 | 0.3678 | 0.0007 |
| 298.15 | 0.4768 | 0.0006 |
| 298.15 | 0.6132 | 0.0005 |
| 298.15 | 0.7714 | 0.0004 |
| 298.15 | 0.9207 | 0.0003 |
| 298.15 | 1.0000 | 0.0003 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.0496 | 0.0015 |
| 303.15 | 0.0906 | 0.0013 |
| 303.15 | 0.1529 | 0.0011 |
| 303.15 | 0.2022 | 0.0009 |
| 303.15 | 0.2783 | 0.0008 |
| 303.15 | 0.3678 | 0.0007 |
| 303.15 | 0.4768 | 0.0005 |
| 303.15 | 0.6132 | 0.0004 |
| 303.15 | 0.7714 | 0.0004 |
| 303.15 | 0.9207 | 0.0003 |
| 303.15 | 1.0000 | 0.0003 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.0496 | 0.0013 |
| 308.15 | 0.0906 | 0.0011 |
| 308.15 | 0.1529 | 0.0010 |
| 308.15 | 0.2022 | 0.0008 |
| 308.15 | 0.2783 | 0.0007 |
| 308.15 | 0.3678 | 0.0006 |
| 308.15 | 0.4768 | 0.0005 |
| 308.15 | 0.6132 | 0.0004 |
| 308.15 | 0.7714 | 0.0003 |
| 308.15 | 0.9207 | 0.0003 |
| 308.15 | 1.0000 | 0.0003 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.3766 |
| 293.15 | 0.0496 | 1.3757 |
| 293.15 | 0.0906 | 1.3751 |
| 293.15 | 0.1529 | 1.3737 |
| 293.15 | 0.2022 | 1.3726 |
| 293.15 | 0.2783 | 1.3705 |
| 293.15 | 0.3678 | 1.3677 |
| 293.15 | 0.4768 | 1.364 |
| 293.15 | 0.6132 | 1.359 |
| 293.15 | 0.7714 | 1.3528 |
| 293.15 | 0.9207 | 1.3469 |
| 293.15 | 1.0000 | 1.3436 |
| 298.15 | 0.0000 | 1.3745 |
| 298.15 | 0.0496 | 1.3733 |
| 298.15 | 0.0906 | 1.3724 |
| 298.15 | 0.1529 | 1.3713 |
| 298.15 | 0.2022 | 1.3702 |
| 298.15 | 0.2783 | 1.3687 |
| 298.15 | 0.3678 | 1.3667 |
| 298.15 | 0.4768 | 1.3635 |
| 298.15 | 0.6132 | 1.3591 |
| 298.15 | 0.7714 | 1.3528 |
| 298.15 | 0.9207 | 1.3452 |
| 298.15 | 1.0000 | 1.3411 |
| 303.15 | 0.0000 | 1.3724 |
| 303.15 | 0.0496 | 1.3715 |
| 303.15 | 0.0906 | 1.3707 |
| 303.15 | 0.1529 | 1.3694 |
| 303.15 | 0.2022 | 1.3684 |
| 303.15 | 0.2783 | 1.3666 |
| 303.15 | 0.3678 | 1.3641 |
| 303.15 | 0.4768 | 1.3608 |
| 303.15 | 0.6132 | 1.3561 |
| 303.15 | 0.7714 | 1.35 |
| 303.15 | 0.9207 | 1.3433 |
| 303.15 | 1.0000 | 1.339 |
| 308.15 | 0.0000 | 1.3703 |
| 308.15 | 0.0496 | 1.3694 |
| 308.15 | 0.0906 | 1.3687 |
| 308.15 | 0.1529 | 1.3679 |
| 308.15 | 0.2022 | 1.367 |
| 308.15 | 0.2783 | 1.3657 |
| 308.15 | 0.3678 | 1.3637 |
| 308.15 | 0.4768 | 1.3605 |
| 308.15 | 0.6132 | 1.3557 |
| 308.15 | 0.7714 | 1.3491 |
| 308.15 | 0.9207 | 1.3417 |
| 308.15 | 1.0000 | 1.3371 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.3766 |
| 293.15 | 0.0496 | 1.3757 |
| 293.15 | 0.0906 | 1.3751 |
| 293.15 | 0.1529 | 1.3737 |
| 293.15 | 0.2022 | 1.3726 |
| 293.15 | 0.2783 | 1.3705 |
| 293.15 | 0.3678 | 1.3677 |
| 293.15 | 0.4768 | 1.364 |
| 293.15 | 0.6132 | 1.359 |
| 293.15 | 0.7714 | 1.3528 |
| 293.15 | 0.9207 | 1.3469 |
| 293.15 | 1.0000 | 1.3436 |
| 298.15 | 0.0000 | 1.3745 |
| 298.15 | 0.0496 | 1.3733 |
| 298.15 | 0.0906 | 1.3724 |
| 298.15 | 0.1529 | 1.3713 |
| 298.15 | 0.2022 | 1.3702 |
| 298.15 | 0.2783 | 1.3687 |
| 298.15 | 0.3678 | 1.3667 |
| 298.15 | 0.4768 | 1.3635 |
| 298.15 | 0.6132 | 1.3591 |
| 298.15 | 0.7714 | 1.3528 |
| 298.15 | 0.9207 | 1.3452 |
| 298.15 | 1.0000 | 1.3411 |
| 303.15 | 0.0000 | 1.3724 |
| 303.15 | 0.0496 | 1.3715 |
| 303.15 | 0.0906 | 1.3707 |
| 303.15 | 0.1529 | 1.3694 |
| 303.15 | 0.2022 | 1.3684 |
| 303.15 | 0.2783 | 1.3666 |
| 303.15 | 0.3678 | 1.3641 |
| 303.15 | 0.4768 | 1.3608 |
| 303.15 | 0.6132 | 1.3561 |
| 303.15 | 0.7714 | 1.35 |
| 303.15 | 0.9207 | 1.3433 |
| 303.15 | 1.0000 | 1.339 |
| 308.15 | 0.0000 | 1.3703 |
| 308.15 | 0.0496 | 1.3694 |
| 308.15 | 0.0906 | 1.3687 |
| 308.15 | 0.1529 | 1.3679 |
| 308.15 | 0.2022 | 1.367 |
| 308.15 | 0.2783 | 1.3657 |
| 308.15 | 0.3678 | 1.3637 |
| 308.15 | 0.4768 | 1.3605 |
| 308.15 | 0.6132 | 1.3557 |
| 308.15 | 0.7714 | 1.3491 |
| 308.15 | 0.9207 | 1.3417 |
| 308.15 | 1.0000 | 1.3371 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 785.19 |
| 293.15 | 0.0496 | 784.97 |
| 293.15 | 0.0906 | 784.72 |
| 293.15 | 0.1529 | 784.31 |
| 293.15 | 0.2022 | 783.9 |
| 293.15 | 0.2783 | 783.36 |
| 293.15 | 0.3678 | 782.71 |
| 293.15 | 0.4768 | 782.02 |
| 293.15 | 0.6132 | 781.53 |
| 293.15 | 0.7714 | 781.13 |
| 293.15 | 0.9207 | 781.26 |
| 293.15 | 1.0000 | 782.04 |
| 298.15 | 0.0000 | 780.98 |
| 298.15 | 0.0496 | 780.76 |
| 298.15 | 0.0906 | 780.3 |
| 298.15 | 0.1529 | 779.7 |
| 298.15 | 0.2022 | 779.7 |
| 298.15 | 0.2783 | 779.2 |
| 298.15 | 0.3678 | 777.65 |
| 298.15 | 0.4768 | 778.79 |
| 298.15 | 0.6132 | 776.2 |
| 298.15 | 0.7714 | 775.79 |
| 298.15 | 0.9207 | 775.95 |
| 298.15 | 1.0000 | 776.64 |
| 303.15 | 0.0000 | 776.71 |
| 303.15 | 0.0496 | 776.32 |
| 303.15 | 0.0906 | 775.84 |
| 303.15 | 0.1529 | 775.13 |
| 303.15 | 0.2022 | 774.54 |
| 303.15 | 0.2783 | 773.97 |
| 303.15 | 0.3678 | 772.88 |
| 303.15 | 0.4768 | 771.84 |
| 303.15 | 0.6132 | 771.13 |
| 303.15 | 0.7714 | 770.52 |
| 303.15 | 0.9207 | 770.59 |
| 303.15 | 1.0000 | 771.21 |
| 308.15 | 0.0000 | 772.36 |
| 308.15 | 0.0496 | 771.86 |
| 308.15 | 0.0906 | 771.31 |
| 308.15 | 0.1529 | 770.57 |
| 308.15 | 0.2022 | 769.92 |
| 308.15 | 0.2783 | 768.98 |
| 308.15 | 0.3678 | 767.8 |
| 308.15 | 0.4768 | 766.44 |
| 308.15 | 0.6132 | 765.75 |
| 308.15 | 0.7714 | 765.26 |
| 308.15 | 0.9207 | 765.18 |
| 308.15 | 1.0000 | 765.75 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 785.19 |
| 293.15 | 0.0496 | 784.97 |
| 293.15 | 0.0906 | 784.72 |
| 293.15 | 0.1529 | 784.31 |
| 293.15 | 0.2022 | 783.9 |
| 293.15 | 0.2783 | 783.36 |
| 293.15 | 0.3678 | 782.71 |
| 293.15 | 0.4768 | 782.02 |
| 293.15 | 0.6132 | 781.53 |
| 293.15 | 0.7714 | 781.13 |
| 293.15 | 0.9207 | 781.26 |
| 293.15 | 1.0000 | 782.04 |
| 298.15 | 0.0000 | 780.98 |
| 298.15 | 0.0496 | 780.76 |
| 298.15 | 0.0906 | 780.3 |
| 298.15 | 0.1529 | 779.7 |
| 298.15 | 0.2022 | 779.7 |
| 298.15 | 0.2783 | 779.2 |
| 298.15 | 0.3678 | 777.65 |
| 298.15 | 0.4768 | 778.79 |
| 298.15 | 0.6132 | 776.2 |
| 298.15 | 0.7714 | 775.79 |
| 298.15 | 0.9207 | 775.95 |
| 298.15 | 1.0000 | 776.64 |
| 303.15 | 0.0000 | 776.71 |
| 303.15 | 0.0496 | 776.32 |
| 303.15 | 0.0906 | 775.84 |
| 303.15 | 0.1529 | 775.13 |
| 303.15 | 0.2022 | 774.54 |
| 303.15 | 0.2783 | 773.97 |
| 303.15 | 0.3678 | 772.88 |
| 303.15 | 0.4768 | 771.84 |
| 303.15 | 0.6132 | 771.13 |
| 303.15 | 0.7714 | 770.52 |
| 303.15 | 0.9207 | 770.59 |
| 303.15 | 1.0000 | 771.21 |
| 308.15 | 0.0000 | 772.36 |
| 308.15 | 0.0496 | 771.86 |
| 308.15 | 0.0906 | 771.31 |
| 308.15 | 0.1529 | 770.57 |
| 308.15 | 0.2022 | 769.92 |
| 308.15 | 0.2783 | 768.98 |
| 308.15 | 0.3678 | 767.8 |
| 308.15 | 0.4768 | 766.44 |
| 308.15 | 0.6132 | 765.75 |
| 308.15 | 0.7714 | 765.26 |
| 308.15 | 0.9207 | 765.18 |
| 308.15 | 1.0000 | 765.75 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetonitrile (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.2001 | 0.0210 |
| 0.3621 | 0.0215 |
| 0.4885 | 0.0221 |
| 0.5398 | 0.0224 |
| 0.6001 | 0.0229 |
| 0.7000 | 0.0238 |
| 0.8001 | 0.0249 |
| 0.8984 | 0.0262 |
| 0.9579 | 0.0271 |
| 0.9701 | 0.0273 |
| 0.9851 | 0.0276 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetonitrile (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.2001 | 0.0210 |
| 0.3621 | 0.0215 |
| 0.4885 | 0.0221 |
| 0.5398 | 0.0224 |
| 0.6001 | 0.0229 |
| 0.7000 | 0.0238 |
| 0.8001 | 0.0249 |
| 0.8984 | 0.0262 |
| 0.9579 | 0.0271 |
| 0.9701 | 0.0273 |
| 0.9851 | 0.0276 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Isopropyl Alcohol (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 354.59 |
| 0.0530 | 352.60 |
| 0.0960 | 351.52 |
| 0.1930 | 349.83 |
| 0.2980 | 349.00 |
| 0.3990 | 348.48 |
| 0.4490 | 348.40 |
| 0.5010 | 348.43 |
| 0.5760 | 348.63 |
| 0.6090 | 348.75 |
| 0.7080 | 349.29 |
| 0.8100 | 350.42 |
| 0.9000 | 352.14 |
| 0.9650 | 353.03 |
| 1.0000 | 355.49 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.5 (Liquid)
| Mole fraction of Acetonitrile (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 354.05 |
| 0.0525 | 353.15 |
| 0.1392 | 352.05 |
| 0.2444 | 351.25 |
| 0.3264 | 350.85 |
| 0.3928 | 350.55 |
| 0.4471 | 350.45 |
| 0.5310 | 350.35 |
| 0.6859 | 350.45 |
| 0.7238 | 350.55 |
| 0.7663 | 350.75 |
| 0.8137 | 350.95 |
| 0.8676 | 351.25 |
| 0.9290 | 351.75 |
| 0.9670 | 352.15 |
| 1.0000 | 352.15 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Isopropyl Alcohol (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 354.59 |
| 0.0530 | 352.60 |
| 0.0960 | 351.52 |
| 0.1930 | 349.83 |
| 0.2980 | 349.00 |
| 0.3990 | 348.48 |
| 0.4490 | 348.40 |
| 0.5010 | 348.43 |
| 0.5760 | 348.63 |
| 0.6090 | 348.75 |
| 0.7080 | 349.29 |
| 0.8100 | 350.42 |
| 0.9000 | 352.14 |
| 0.9650 | 353.03 |
| 1.0000 | 355.49 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.5 (Liquid)
| Mole fraction of Acetonitrile (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 354.05 |
| 0.0525 | 353.15 |
| 0.1392 | 352.05 |
| 0.2444 | 351.25 |
| 0.3264 | 350.85 |
| 0.3928 | 350.55 |
| 0.4471 | 350.45 |
| 0.5310 | 350.35 |
| 0.6859 | 350.45 |
| 0.7238 | 350.55 |
| 0.7663 | 350.75 |
| 0.8137 | 350.95 |
| 0.8676 | 351.25 |
| 0.9290 | 351.75 |
| 0.9670 | 352.15 |
| 1.0000 | 352.15 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Acetonitrile (1) - Liquid | y1[mol/mol] of Acetonitrile (1) - Vapour |
| 355.45 | 0.0000 | 0.0000 |
| 354.75 | 0.0510 | 0.0900 |
| 354.05 | 0.0840 | 0.1410 |
| 352.3 | 0.1980 | 0.2920 |
| 351.5 | 0.2550 | 0.3570 |
| 350.75 | 0.3120 | 0.4160 |
| 349.95 | 0.3860 | 0.4850 |
| 349.35 | 0.4540 | 0.5480 |
| 348.85 | 0.5310 | 0.5960 |
| 348.65 | 0.6050 | 0.6410 |
| 348.6 | 0.6750 | 0.6750 |
| 348.65 | 0.7040 | 0.6910 |
| 349.0 | 0.8120 | 0.7500 |
| 349.25 | 0.8540 | 0.7710 |
| 349.85 | 0.9120 | 0.8000 |
| 351.45 | 0.9630 | 0.8610 |
| 354.75 | 1.0000 | 1.0000 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.3 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Acetonitrile (1) - Liquid | y1[mol/mol] of Acetonitrile (1) - Vapour |
| 355.4 | 0.0000 | 0.0000 |
| 353.38 | 0.0600 | 0.1330 |
| 352.05 | 0.1110 | 0.2140 |
| 351.37 | 0.1500 | 0.2570 |
| 350.47 | 0.2040 | 0.3180 |
| 349.87 | 0.2600 | 0.3660 |
| 349.37 | 0.3180 | 0.4080 |
| 349.24 | 0.3490 | 0.4190 |
| 349.06 | 0.3870 | 0.4520 |
| 348.87 | 0.4510 | 0.4820 |
| 348.8 | 0.4960 | 0.5150 |
| 348.79 | 0.5470 | 0.5450 |
| 348.9 | 0.6160 | 0.5810 |
| 349.01 | 0.6500 | 0.6000 |
| 349.45 | 0.7300 | 0.6610 |
| 349.81 | 0.7720 | 0.6940 |
| 350.17 | 0.8050 | 0.7240 |
| 350.86 | 0.8540 | 0.7730 |
| 351.78 | 0.9070 | 0.8420 |
| 352.86 | 0.9470 | 0.9020 |
| 354.7 | 1.0000 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 323.15 (VLE)
| Fixed | Measured | |
|---|---|---|
| P [kPa] - VLE | x1[mol/mol] of Acetonitrile (1) - Liquid | y1[mol/mol] of Acetonitrile (1) - Vapour |
| 28.078 | 0.0470 | 0.1820 |
| 32.344 | 0.1270 | 0.3360 |
| 33.731 | 0.1640 | 0.3720 |
| 35.357 | 0.2200 | 0.4300 |
| 35.85 | 0.2360 | 0.4460 |
| 36.984 | 0.3010 | 0.4840 |
| 38.504 | 0.4310 | 0.5500 |
| 39.303 | 0.5460 | 0.6020 |
| 39.543 | 0.6370 | 0.6420 |
| 39.143 | 0.7630 | 0.7150 |
| 38.05 | 0.8640 | 0.7970 |
| 37.57 | 0.9000 | 0.8340 |
| 36.477 | 0.9320 | 0.8770 |
| 35.97 | 0.9480 | 0.9030 |
| 34.304 | 0.9870 | 0.9740 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Effect of imidazolium-based ionic liquid on vapor-liquid equilibria of 2-propanol + acetonitrile binary system at 101.3 kPa
- (Vapor + liquid) equilibrium of the binary mixtures formed by acetonitrile with selected compounds at 95.5 kPa
- Densities, viscosities, excess molar volumes, and refractive indices of acetonitrile and 2-alkanols binary mixtures at different temperatures: Experimental results and application of the Prigogine Flory Patterson theory
- Experimental Data and Correlation of Surface Tensions of the Binary and Ternary Systems of Water + Acetonitrile + 2-Propanol at 298.15 K and Atmospheric Pressure