- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (8)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
- P [kPa] x T [K] x x1[mol/mol] x x2[mol/mol] x y1[mol/mol] x y2[mol/mol]
- Vapor Liquid Equilibrium at Constant Pressure
Mole fraction of Water (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Mole fraction of Water (3) - Liquid |
| 303.15 | 0.0770 | 0.0500 |
| 303.15 | 0.0930 | 0.0740 |
| 303.15 | 0.1050 | 0.1000 |
| 303.15 | 0.1080 | 0.1100 |
| 303.15 | 0.1110 | 0.1190 |
| 303.15 | 0.1170 | 0.1360 |
| 303.15 | 0.1210 | 0.1480 |
| 303.15 | 0.1250 | 0.1620 |
| 303.15 | 0.1280 | 0.1730 |
| 303.15 | 0.1410 | 0.2400 |
| 303.15 | 0.1440 | 0.2940 |
| 303.15 | 0.1440 | 0.3370 |
| 303.15 | 0.1400 | 0.3770 |
| 303.15 | 0.1310 | 0.4470 |
| 313.15 | 0.1210 | 0.1630 |
| 313.15 | 0.1300 | 0.2150 |
| 313.15 | 0.1390 | 0.3210 |
| 313.15 | 0.1290 | 0.4130 |
| 313.15 | 0.1210 | 0.4480 |
| 313.15 | 0.0950 | 0.5440 |
| 313.15 | 0.0740 | 0.6150 |
| 313.15 | 0.0540 | 0.6830 |
| 313.15 | 0.0920 | 0.0970 |
| 313.15 | 0.1070 | 0.1180 |
| 313.15 | 0.1100 | 0.1270 |
| 313.15 | 0.1440 | 0.1390 |
| 313.15 | 0.1190 | 0.1550 |
| 313.15 | 0.1230 | 0.1660 |
| 313.15 | 0.1260 | 0.1840 |
| 313.15 | 0.1380 | 0.2590 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Acetic acid (1) - Liquid mixture 1 | Mole fraction of Ethyl Acetate (2) - Liquid mixture 1 | Mole fraction of Acetic acid (1) - Liquid mixture 2 | Mole fraction of Ethyl Acetate (2) - Liquid mixture 2 |
| 303.15 | 0.0000 | 0.0320 | 0.0000 | 0.8580 |
| 313.15 | 0.0270 | 0.0230 | 0.0870 | 0.5040 |
| 313.15 | 0.0360 | 0.0310 | 0.1030 | 0.4540 |
| 313.15 | 0.0430 | 0.0320 | 0.1150 | 0.3810 |
| 313.15 | 0.0520 | 0.0380 | 0.1230 | 0.3190 |
| 313.15 | 0.0820 | 0.0860 | 0.1050 | 0.1700 |
| 303.15 | 0.0140 | 0.0290 | 0.0160 | 0.8150 |
| 303.15 | 0.0250 | 0.0320 | 0.0390 | 0.7690 |
| 303.15 | 0.0370 | 0.0350 | 0.0660 | 0.6970 |
| 303.15 | 0.0570 | 0.0430 | 0.0990 | 0.5920 |
| 303.15 | 0.0690 | 0.0490 | 0.1290 | 0.4700 |
| 313.15 | 0.0000 | 0.0170 | 0.0000 | 0.8380 |
| 313.15 | 0.0220 | 0.0200 | 0.0630 | 0.6310 |
| 313.15 | 0.0200 | 0.0220 | 0.0750 | 0.5720 |
Mole fraction of Water (3) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Ethyl Acetate (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.8733 | 0.1267 |
| 293.20 | 0.6120 | 0.3005 |
| 293.20 | 0.4479 | 0.4178 |
| 293.20 | 0.3280 | 0.5246 |
| 293.20 | 0.2523 | 0.6013 |
| 293.20 | 0.2276 | 0.6307 |
| 293.20 | 0.2215 | 0.6360 |
| 293.20 | 0.1525 | 0.7231 |
| 293.20 | 0.1342 | 0.7465 |
| 293.20 | 0.1197 | 0.7672 |
| 293.20 | 0.0819 | 0.8201 |
| 293.20 | 0.0536 | 0.8667 |
| 293.20 | 0.0344 | 0.9091 |
| 293.20 | 0.0283 | 0.9286 |
| 293.20 | 0.0243 | 0.9479 |
| 293.20 | 0.0211 | 0.9639 |
| 293.20 | 0.0172 | 0.9828 |
| 313.20 | 0.8170 | 0.1830 |
| 313.20 | 0.5826 | 0.3295 |
| 313.20 | 0.4251 | 0.4489 |
| 313.20 | 0.3138 | 0.5465 |
| 313.20 | 0.2294 | 0.6350 |
| 313.20 | 0.1636 | 0.7142 |
| 313.20 | 0.1203 | 0.7706 |
| 313.20 | 0.0872 | 0.8151 |
| 313.20 | 0.0527 | 0.8703 |
| 313.20 | 0.0338 | 0.9107 |
| 313.20 | 0.0234 | 0.9476 |
| 313.20 | 0.0163 | 0.9837 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (1) - Liquid mixture 2 | Mole fraction of Acetic acid (1) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9631 | 0.0192 | 0.0495 | 0.2103 |
| 293.20 | 0.9542 | 0.0248 | 0.0779 | 0.2653 |
| 293.20 | 0.9433 | 0.0315 | 0.1064 | 0.3336 |
| 293.20 | 0.9216 | 0.0444 | 0.1304 | 0.4140 |
| 293.20 | 0.8831 | 0.0653 | 0.1471 | 0.5332 |
| 293.20 | 0.8693 | 0.0722 | 0.1477 | 0.5639 |
| 313.20 | 0.9709 | 0.0140 | 0.0389 | 0.2409 |
| 313.20 | 0.9543 | 0.0247 | 0.0741 | 0.3068 |
| 313.20 | 0.9311 | 0.0388 | 0.1068 | 0.3868 |
| 313.20 | 0.9096 | 0.0512 | 0.1298 | 0.4726 |
| 313.20 | 0.8870 | 0.0632 | 0.1391 | 0.5424 |
| 313.20 | 0.8634 | 0.0749 | 0.1402 | 0.6114 |
Mole fraction of Water (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Mole fraction of Water (3) - Liquid |
| 303.15 | 0.0770 | 0.0500 |
| 303.15 | 0.0930 | 0.0740 |
| 303.15 | 0.1050 | 0.1000 |
| 303.15 | 0.1080 | 0.1100 |
| 303.15 | 0.1110 | 0.1190 |
| 303.15 | 0.1170 | 0.1360 |
| 303.15 | 0.1210 | 0.1480 |
| 303.15 | 0.1250 | 0.1620 |
| 303.15 | 0.1280 | 0.1730 |
| 303.15 | 0.1410 | 0.2400 |
| 303.15 | 0.1440 | 0.2940 |
| 303.15 | 0.1440 | 0.3370 |
| 303.15 | 0.1400 | 0.3770 |
| 303.15 | 0.1310 | 0.4470 |
| 313.15 | 0.1210 | 0.1630 |
| 313.15 | 0.1300 | 0.2150 |
| 313.15 | 0.1390 | 0.3210 |
| 313.15 | 0.1290 | 0.4130 |
| 313.15 | 0.1210 | 0.4480 |
| 313.15 | 0.0950 | 0.5440 |
| 313.15 | 0.0740 | 0.6150 |
| 313.15 | 0.0540 | 0.6830 |
| 313.15 | 0.0920 | 0.0970 |
| 313.15 | 0.1070 | 0.1180 |
| 313.15 | 0.1100 | 0.1270 |
| 313.15 | 0.1440 | 0.1390 |
| 313.15 | 0.1190 | 0.1550 |
| 313.15 | 0.1230 | 0.1660 |
| 313.15 | 0.1260 | 0.1840 |
| 313.15 | 0.1380 | 0.2590 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Acetic acid (1) - Liquid mixture 1 | Mole fraction of Ethyl Acetate (2) - Liquid mixture 1 | Mole fraction of Acetic acid (1) - Liquid mixture 2 | Mole fraction of Ethyl Acetate (2) - Liquid mixture 2 |
| 303.15 | 0.0000 | 0.0320 | 0.0000 | 0.8580 |
| 313.15 | 0.0270 | 0.0230 | 0.0870 | 0.5040 |
| 313.15 | 0.0360 | 0.0310 | 0.1030 | 0.4540 |
| 313.15 | 0.0430 | 0.0320 | 0.1150 | 0.3810 |
| 313.15 | 0.0520 | 0.0380 | 0.1230 | 0.3190 |
| 313.15 | 0.0820 | 0.0860 | 0.1050 | 0.1700 |
| 303.15 | 0.0140 | 0.0290 | 0.0160 | 0.8150 |
| 303.15 | 0.0250 | 0.0320 | 0.0390 | 0.7690 |
| 303.15 | 0.0370 | 0.0350 | 0.0660 | 0.6970 |
| 303.15 | 0.0570 | 0.0430 | 0.0990 | 0.5920 |
| 303.15 | 0.0690 | 0.0490 | 0.1290 | 0.4700 |
| 313.15 | 0.0000 | 0.0170 | 0.0000 | 0.8380 |
| 313.15 | 0.0220 | 0.0200 | 0.0630 | 0.6310 |
| 313.15 | 0.0200 | 0.0220 | 0.0750 | 0.5720 |
Mole fraction of Water (3) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Ethyl Acetate (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.8733 | 0.1267 |
| 293.20 | 0.6120 | 0.3005 |
| 293.20 | 0.4479 | 0.4178 |
| 293.20 | 0.3280 | 0.5246 |
| 293.20 | 0.2523 | 0.6013 |
| 293.20 | 0.2276 | 0.6307 |
| 293.20 | 0.2215 | 0.6360 |
| 293.20 | 0.1525 | 0.7231 |
| 293.20 | 0.1342 | 0.7465 |
| 293.20 | 0.1197 | 0.7672 |
| 293.20 | 0.0819 | 0.8201 |
| 293.20 | 0.0536 | 0.8667 |
| 293.20 | 0.0344 | 0.9091 |
| 293.20 | 0.0283 | 0.9286 |
| 293.20 | 0.0243 | 0.9479 |
| 293.20 | 0.0211 | 0.9639 |
| 293.20 | 0.0172 | 0.9828 |
| 313.20 | 0.8170 | 0.1830 |
| 313.20 | 0.5826 | 0.3295 |
| 313.20 | 0.4251 | 0.4489 |
| 313.20 | 0.3138 | 0.5465 |
| 313.20 | 0.2294 | 0.6350 |
| 313.20 | 0.1636 | 0.7142 |
| 313.20 | 0.1203 | 0.7706 |
| 313.20 | 0.0872 | 0.8151 |
| 313.20 | 0.0527 | 0.8703 |
| 313.20 | 0.0338 | 0.9107 |
| 313.20 | 0.0234 | 0.9476 |
| 313.20 | 0.0163 | 0.9837 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (1) - Liquid mixture 2 | Mole fraction of Acetic acid (1) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9631 | 0.0192 | 0.0495 | 0.2103 |
| 293.20 | 0.9542 | 0.0248 | 0.0779 | 0.2653 |
| 293.20 | 0.9433 | 0.0315 | 0.1064 | 0.3336 |
| 293.20 | 0.9216 | 0.0444 | 0.1304 | 0.4140 |
| 293.20 | 0.8831 | 0.0653 | 0.1471 | 0.5332 |
| 293.20 | 0.8693 | 0.0722 | 0.1477 | 0.5639 |
| 313.20 | 0.9709 | 0.0140 | 0.0389 | 0.2409 |
| 313.20 | 0.9543 | 0.0247 | 0.0741 | 0.3068 |
| 313.20 | 0.9311 | 0.0388 | 0.1068 | 0.3868 |
| 313.20 | 0.9096 | 0.0512 | 0.1298 | 0.4726 |
| 313.20 | 0.8870 | 0.0632 | 0.1391 | 0.5424 |
| 313.20 | 0.8634 | 0.0749 | 0.1402 | 0.6114 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.1267 | 0.8733 | 1.3725 |
| 293.20 | 0.3005 | 0.6120 | 1.3733 |
| 293.20 | 0.4178 | 0.4479 | 1.3735 |
| 293.20 | 0.5246 | 0.3280 | 1.3726 |
| 293.20 | 0.6013 | 0.2523 | 1.3713 |
| 293.20 | 0.6307 | 0.2276 | 1.3706 |
| 293.20 | 0.6360 | 0.2215 | 1.3703 |
| 293.20 | 0.7231 | 0.1525 | 1.3667 |
| 293.20 | 0.7465 | 0.1342 | 1.3664 |
| 293.20 | 0.7672 | 0.1197 | 1.365 |
| 293.20 | 0.8201 | 0.0819 | 1.3618 |
| 293.20 | 0.8667 | 0.0536 | 1.3571 |
| 293.20 | 0.9091 | 0.0344 | 1.3523 |
| 293.20 | 0.9286 | 0.0283 | 1.3494 |
| 293.20 | 0.9479 | 0.0243 | 1.3461 |
| 293.20 | 0.9639 | 0.0211 | 1.3431 |
| 293.20 | 0.9828 | 0.0172 | 1.3387 |
| 313.20 | 0.1830 | 0.8170 | 1.3623 |
| 313.20 | 0.3295 | 0.5826 | 1.3637 |
| 313.20 | 0.4489 | 0.4251 | 1.3644 |
| 313.20 | 0.5465 | 0.3138 | 1.3635 |
| 313.20 | 0.6350 | 0.2294 | 1.3623 |
| 313.20 | 0.7142 | 0.1636 | 1.3593 |
| 313.20 | 0.7706 | 0.1203 | 1.3575 |
| 313.20 | 0.8151 | 0.0872 | 1.3556 |
| 313.20 | 0.8703 | 0.0527 | 1.3511 |
| 313.20 | 0.9107 | 0.0338 | 1.3454 |
| 313.20 | 0.9476 | 0.0234 | 1.34 |
| 313.20 | 0.9837 | 0.0163 | 1.334 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Acetic acid (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.2103 | 0.0495 | 1.373 |
| 293.20 | 0.2653 | 0.0779 | 1.3732 |
| 293.20 | 0.3336 | 0.1064 | 1.3735 |
| 293.20 | 0.4140 | 0.1304 | 1.3735 |
| 293.20 | 0.5332 | 0.1471 | 1.3727 |
| 293.20 | 0.5639 | 0.1477 | 1.3722 |
| 293.20 | 0.9631 | 0.0192 | 1.3429 |
| 293.20 | 0.9542 | 0.0248 | 1.3449 |
| 293.20 | 0.9433 | 0.0315 | 1.3472 |
| 293.20 | 0.9216 | 0.0444 | 1.3507 |
| 293.20 | 0.8831 | 0.0653 | 1.3559 |
| 293.20 | 0.8693 | 0.0722 | 1.3574 |
| 313.20 | 0.2409 | 0.0389 | 1.3629 |
| 313.20 | 0.3068 | 0.0741 | 1.3635 |
| 313.20 | 0.3868 | 0.1068 | 1.364 |
| 313.20 | 0.4726 | 0.1298 | 1.3642 |
| 313.20 | 0.5424 | 0.1391 | 1.364 |
| 313.20 | 0.6114 | 0.1402 | 1.3633 |
| 313.20 | 0.9709 | 0.0140 | 1.3363 |
| 313.20 | 0.9543 | 0.0247 | 1.3393 |
| 313.20 | 0.9311 | 0.0388 | 1.343 |
| 313.20 | 0.9096 | 0.0512 | 1.3462 |
| 313.20 | 0.8870 | 0.0632 | 1.3491 |
| 313.20 | 0.8634 | 0.0749 | 1.3516 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.1267 | 0.8733 | 1.3725 |
| 293.20 | 0.3005 | 0.6120 | 1.3733 |
| 293.20 | 0.4178 | 0.4479 | 1.3735 |
| 293.20 | 0.5246 | 0.3280 | 1.3726 |
| 293.20 | 0.6013 | 0.2523 | 1.3713 |
| 293.20 | 0.6307 | 0.2276 | 1.3706 |
| 293.20 | 0.6360 | 0.2215 | 1.3703 |
| 293.20 | 0.7231 | 0.1525 | 1.3667 |
| 293.20 | 0.7465 | 0.1342 | 1.3664 |
| 293.20 | 0.7672 | 0.1197 | 1.365 |
| 293.20 | 0.8201 | 0.0819 | 1.3618 |
| 293.20 | 0.8667 | 0.0536 | 1.3571 |
| 293.20 | 0.9091 | 0.0344 | 1.3523 |
| 293.20 | 0.9286 | 0.0283 | 1.3494 |
| 293.20 | 0.9479 | 0.0243 | 1.3461 |
| 293.20 | 0.9639 | 0.0211 | 1.3431 |
| 293.20 | 0.9828 | 0.0172 | 1.3387 |
| 313.20 | 0.1830 | 0.8170 | 1.3623 |
| 313.20 | 0.3295 | 0.5826 | 1.3637 |
| 313.20 | 0.4489 | 0.4251 | 1.3644 |
| 313.20 | 0.5465 | 0.3138 | 1.3635 |
| 313.20 | 0.6350 | 0.2294 | 1.3623 |
| 313.20 | 0.7142 | 0.1636 | 1.3593 |
| 313.20 | 0.7706 | 0.1203 | 1.3575 |
| 313.20 | 0.8151 | 0.0872 | 1.3556 |
| 313.20 | 0.8703 | 0.0527 | 1.3511 |
| 313.20 | 0.9107 | 0.0338 | 1.3454 |
| 313.20 | 0.9476 | 0.0234 | 1.34 |
| 313.20 | 0.9837 | 0.0163 | 1.334 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Acetic acid (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.2103 | 0.0495 | 1.373 |
| 293.20 | 0.2653 | 0.0779 | 1.3732 |
| 293.20 | 0.3336 | 0.1064 | 1.3735 |
| 293.20 | 0.4140 | 0.1304 | 1.3735 |
| 293.20 | 0.5332 | 0.1471 | 1.3727 |
| 293.20 | 0.5639 | 0.1477 | 1.3722 |
| 293.20 | 0.9631 | 0.0192 | 1.3429 |
| 293.20 | 0.9542 | 0.0248 | 1.3449 |
| 293.20 | 0.9433 | 0.0315 | 1.3472 |
| 293.20 | 0.9216 | 0.0444 | 1.3507 |
| 293.20 | 0.8831 | 0.0653 | 1.3559 |
| 293.20 | 0.8693 | 0.0722 | 1.3574 |
| 313.20 | 0.2409 | 0.0389 | 1.3629 |
| 313.20 | 0.3068 | 0.0741 | 1.3635 |
| 313.20 | 0.3868 | 0.1068 | 1.364 |
| 313.20 | 0.4726 | 0.1298 | 1.3642 |
| 313.20 | 0.5424 | 0.1391 | 1.364 |
| 313.20 | 0.6114 | 0.1402 | 1.3633 |
| 313.20 | 0.9709 | 0.0140 | 1.3363 |
| 313.20 | 0.9543 | 0.0247 | 1.3393 |
| 313.20 | 0.9311 | 0.0388 | 1.343 |
| 313.20 | 0.9096 | 0.0512 | 1.3462 |
| 313.20 | 0.8870 | 0.0632 | 1.3491 |
| 313.20 | 0.8634 | 0.0749 | 1.3516 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.20 | 0.1267 | 0.8733 | 905.4 |
| 293.20 | 0.3005 | 0.6120 | 927.226 |
| 293.20 | 0.4178 | 0.4479 | 946.068 |
| 293.20 | 0.5246 | 0.3280 | 962.385 |
| 293.20 | 0.6013 | 0.2523 | 974.039 |
| 293.20 | 0.6307 | 0.2276 | 978.341 |
| 293.20 | 0.6360 | 0.2215 | 979.285 |
| 293.20 | 0.7231 | 0.1525 | 991.268 |
| 293.20 | 0.7465 | 0.1342 | 994.951 |
| 293.20 | 0.7672 | 0.1197 | 998.014 |
| 293.20 | 0.8201 | 0.0819 | 1006.744 |
| 293.20 | 0.8667 | 0.0536 | 1012.818 |
| 293.20 | 0.9091 | 0.0344 | 1013.628 |
| 293.20 | 0.9286 | 0.0283 | 1011.736 |
| 293.20 | 0.9479 | 0.0243 | 1007.658 |
| 293.20 | 0.9639 | 0.0211 | 1003.991 |
| 293.20 | 0.9828 | 0.0172 | 998.227 |
| 313.20 | 0.1830 | 0.8170 | 882.844 |
| 313.20 | 0.3295 | 0.5826 | 905.931 |
| 313.20 | 0.4489 | 0.4251 | 925.4 |
| 313.20 | 0.5465 | 0.3138 | 941.744 |
| 313.20 | 0.6350 | 0.2294 | 954.991 |
| 313.20 | 0.7142 | 0.1636 | 964.554 |
| 313.20 | 0.7706 | 0.1203 | 981.824 |
| 313.20 | 0.8151 | 0.0872 | 986.692 |
| 313.20 | 0.8703 | 0.0527 | 998.031 |
| 313.20 | 0.9107 | 0.0338 | 1001.131 |
| 313.20 | 0.9476 | 0.0234 | 998.323 |
| 313.20 | 0.9837 | 0.0163 | 990.48 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Acetic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.20 | 0.2103 | 0.0495 | 916.042 |
| 293.20 | 0.2653 | 0.0779 | 923.405 |
| 293.20 | 0.3336 | 0.1064 | 933.164 |
| 293.20 | 0.4140 | 0.1304 | 944.95 |
| 293.20 | 0.5332 | 0.1471 | 963.307 |
| 293.20 | 0.5639 | 0.1477 | 968.047 |
| 293.20 | 0.9631 | 0.0192 | 1003.709 |
| 293.20 | 0.9542 | 0.0248 | 1006.805 |
| 293.20 | 0.9433 | 0.0315 | 1010.09 |
| 293.20 | 0.9216 | 0.0444 | 1012.674 |
| 293.20 | 0.8831 | 0.0653 | 1013.666 |
| 293.20 | 0.8693 | 0.0722 | 1012.835 |
| 313.20 | 0.2409 | 0.0389 | 891.909 |
| 313.20 | 0.3068 | 0.0741 | 901.727 |
| 313.20 | 0.3868 | 0.1068 | 914.144 |
| 313.20 | 0.4726 | 0.1298 | 928.17 |
| 313.20 | 0.5424 | 0.1391 | 940.202 |
| 313.20 | 0.6114 | 0.1402 | 952.564 |
| 313.20 | 0.9709 | 0.0140 | 994.187 |
| 313.20 | 0.9543 | 0.0247 | 997.238 |
| 313.20 | 0.9311 | 0.0388 | 999.364 |
| 313.20 | 0.9096 | 0.0512 | 1000.39 |
| 313.20 | 0.8870 | 0.0632 | 999.67 |
| 313.20 | 0.8634 | 0.0749 | 997.201 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.20 | 0.1267 | 0.8733 | 905.4 |
| 293.20 | 0.3005 | 0.6120 | 927.226 |
| 293.20 | 0.4178 | 0.4479 | 946.068 |
| 293.20 | 0.5246 | 0.3280 | 962.385 |
| 293.20 | 0.6013 | 0.2523 | 974.039 |
| 293.20 | 0.6307 | 0.2276 | 978.341 |
| 293.20 | 0.6360 | 0.2215 | 979.285 |
| 293.20 | 0.7231 | 0.1525 | 991.268 |
| 293.20 | 0.7465 | 0.1342 | 994.951 |
| 293.20 | 0.7672 | 0.1197 | 998.014 |
| 293.20 | 0.8201 | 0.0819 | 1006.744 |
| 293.20 | 0.8667 | 0.0536 | 1012.818 |
| 293.20 | 0.9091 | 0.0344 | 1013.628 |
| 293.20 | 0.9286 | 0.0283 | 1011.736 |
| 293.20 | 0.9479 | 0.0243 | 1007.658 |
| 293.20 | 0.9639 | 0.0211 | 1003.991 |
| 293.20 | 0.9828 | 0.0172 | 998.227 |
| 313.20 | 0.1830 | 0.8170 | 882.844 |
| 313.20 | 0.3295 | 0.5826 | 905.931 |
| 313.20 | 0.4489 | 0.4251 | 925.4 |
| 313.20 | 0.5465 | 0.3138 | 941.744 |
| 313.20 | 0.6350 | 0.2294 | 954.991 |
| 313.20 | 0.7142 | 0.1636 | 964.554 |
| 313.20 | 0.7706 | 0.1203 | 981.824 |
| 313.20 | 0.8151 | 0.0872 | 986.692 |
| 313.20 | 0.8703 | 0.0527 | 998.031 |
| 313.20 | 0.9107 | 0.0338 | 1001.131 |
| 313.20 | 0.9476 | 0.0234 | 998.323 |
| 313.20 | 0.9837 | 0.0163 | 990.48 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Acetic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.20 | 0.2103 | 0.0495 | 916.042 |
| 293.20 | 0.2653 | 0.0779 | 923.405 |
| 293.20 | 0.3336 | 0.1064 | 933.164 |
| 293.20 | 0.4140 | 0.1304 | 944.95 |
| 293.20 | 0.5332 | 0.1471 | 963.307 |
| 293.20 | 0.5639 | 0.1477 | 968.047 |
| 293.20 | 0.9631 | 0.0192 | 1003.709 |
| 293.20 | 0.9542 | 0.0248 | 1006.805 |
| 293.20 | 0.9433 | 0.0315 | 1010.09 |
| 293.20 | 0.9216 | 0.0444 | 1012.674 |
| 293.20 | 0.8831 | 0.0653 | 1013.666 |
| 293.20 | 0.8693 | 0.0722 | 1012.835 |
| 313.20 | 0.2409 | 0.0389 | 891.909 |
| 313.20 | 0.3068 | 0.0741 | 901.727 |
| 313.20 | 0.3868 | 0.1068 | 914.144 |
| 313.20 | 0.4726 | 0.1298 | 928.17 |
| 313.20 | 0.5424 | 0.1391 | 940.202 |
| 313.20 | 0.6114 | 0.1402 | 952.564 |
| 313.20 | 0.9709 | 0.0140 | 994.187 |
| 313.20 | 0.9543 | 0.0247 | 997.238 |
| 313.20 | 0.9311 | 0.0388 | 999.364 |
| 313.20 | 0.9096 | 0.0512 | 1000.39 |
| 313.20 | 0.8870 | 0.0632 | 999.67 |
| 313.20 | 0.8634 | 0.0749 | 997.201 |
P [kPa] x T [K] x x1[mol/mol] x x2[mol/mol] x y1[mol/mol] x y2[mol/mol] [ref]
| Fixed | Measured | ||||
|---|---|---|---|---|---|
| P [kPa] - VLE | T [K] - VLE | x1[mol/mol] of Water (3) - Liquid | x2[mol/mol] of Acetic acid (1) - Liquid | y1[mol/mol] of Water (3) - Vapour | y2[mol/mol] of Acetic acid (1) - Vapour |
| 98.992 | 366.95 | 0.4530 | 0.4640 | 0.4820 | 0.2140 |
| 100.125 | 371.65 | 0.0816 | 0.7200 | 0.1470 | 0.4050 |
| 100.658 | 368.15 | 0.0724 | 0.6400 | 0.1310 | 0.3040 |
| 99.325 | 366.25 | 0.0650 | 0.6150 | 0.1200 | 0.2740 |
| 98.125 | 363.25 | 0.0550 | 0.5500 | 0.1000 | 0.2190 |
| 97.992 | 362.05 | 0.0477 | 0.5150 | 0.0900 | 0.1900 |
| 98.392 | 360.15 | 0.0410 | 0.4500 | 0.0790 | 0.1510 |
| 101.192 | 359.05 | 0.0346 | 0.3960 | 0.0692 | 0.1140 |
| 100.325 | 356.85 | 0.0260 | 0.3270 | 0.0541 | 0.0825 |
| 100.325 | 355.35 | 0.0229 | 0.2650 | 0.0467 | 0.0631 |
| 100.658 | 354.65 | 0.0163 | 0.2260 | 0.0393 | 0.0471 |
| 100.525 | 353.85 | 0.0140 | 0.1930 | 0.0372 | 0.0361 |
| 97.325 | 352.25 | 0.0116 | 0.1620 | 0.0322 | 0.0322 |
| 100.992 | 373.25 | 0.1340 | 0.7220 | 0.2100 | 0.4480 |
| 100.925 | 366.65 | 0.1919 | 0.5990 | 0.2700 | 0.2630 |
| 100.392 | 362.55 | 0.1490 | 0.5330 | 0.2100 | 0.2120 |
| 101.192 | 374.45 | 0.3500 | 0.6080 | 0.4500 | 0.3800 |
| 100.525 | 367.95 | 0.3330 | 0.5530 | 0.3900 | 0.2760 |
| 100.458 | 363.9 | 0.2900 | 0.5160 | 0.3350 | 0.2060 |
| 100.658 | 361.45 | 0.2580 | 0.4850 | 0.3030 | 0.1630 |
| 100.392 | 359.95 | 0.2310 | 0.4670 | 0.2800 | 0.1420 |
| 99.059 | 356.15 | 0.1960 | 0.3020 | 0.2490 | 0.0921 |
| 97.925 | 354.35 | 0.1595 | 0.3470 | 0.2200 | 0.0720 |
| 99.525 | 354.05 | 0.1340 | 0.3120 | 0.2020 | 0.0600 |
| 97.992 | 352.05 | 0.0930 | 0.2470 | 0.1670 | 0.0404 |
| 97.925 | 351.15 | 0.0659 | 0.1930 | 0.1395 | 0.0300 |
| 101.925 | 350.95 | 0.0454 | 0.1530 | 0.1095 | 0.0219 |
| 101.858 | 371.35 | 0.5750 | 0.3940 | 0.6070 | 0.2310 |
| 101.725 | 366.15 | 0.5320 | 0.3920 | 0.5090 | 0.1660 |
| 100.992 | 369.6 | 0.1120 | 0.6650 | 0.1790 | 0.3560 |
| 100.658 | 366.3 | 0.0938 | 0.6060 | 0.1530 | 0.2860 |
| 99.992 | 364.35 | 0.0830 | 0.5700 | 0.1400 | 0.2370 |
| 99.992 | 363.85 | 0.0739 | 0.5575 | 0.1300 | 0.2240 |
| 98.725 | 359.95 | 0.1400 | 0.4940 | 0.1990 | 0.1640 |
| 98.725 | 359.25 | 0.1220 | 0.4600 | 0.1820 | 0.1550 |
| 98.459 | 357.5 | 0.0986 | 0.4100 | 0.1570 | 0.1170 |
| 98.459 | 357.05 | 0.0835 | 0.3920 | 0.1410 | 0.1080 |
| 97.859 | 355.25 | 0.0625 | 0.3320 | 0.1190 | 0.0746 |
| 97.992 | 354.35 | 0.0500 | 0.2890 | 0.1000 | 0.0615 |
| 99.325 | 353.15 | 0.0343 | 0.2110 | 0.0784 | 0.0394 |
| 99.125 | 352.05 | 0.0240 | 0.1570 | 0.0649 | 0.0236 |
| 99.925 | 372.85 | 0.2340 | 0.6790 | 0.3270 | 0.4000 |
| 99.992 | 369.75 | 0.2120 | 0.6400 | 0.2910 | 0.3410 |
| 101.725 | 360.95 | 0.4840 | 0.3720 | 0.4300 | 0.1130 |
| 100.392 | 355.25 | 0.3980 | 0.3250 | 0.3600 | 0.0693 |
| 100.725 | 351.95 | 0.3090 | 0.2660 | 0.3200 | 0.0435 |
| 100.725 | 350.55 | 0.2455 | 0.2280 | 0.2820 | 0.0272 |
| 99.992 | 349.15 | 0.1700 | 0.1720 | 0.2420 | 0.0245 |
| 99.992 | 348.75 | 0.1255 | 0.1315 | 0.2080 | 0.0205 |
| 100.592 | 348.85 | 0.0870 | 0.1110 | 0.1625 | 0.0169 |
| 100.845 | 376.4 | 0.1260 | 0.7650 | 0.2080 | 0.5170 |
| 100.845 | 365.35 | 0.7761 | 0.1950 | 0.6100 | 0.0890 |
| 99.725 | 372.95 | 0.2798 | 0.6360 | 0.3735 | 0.3740 |
| 99.725 | 357.15 | 0.7225 | 0.1990 | 0.4360 | 0.0550 |
| 101.512 | 371.15 | 0.4898 | 0.4620 | 0.5455 | 0.2600 |
| 102.165 | 351.95 | 0.6475 | 0.1815 | 0.3460 | 0.0310 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| Fixed | Measured | |||
|---|---|---|---|---|
| T [K] - VLE | x1[mol/mol] of Water (3) - Liquid | x2[mol/mol] of Acetic acid (1) - Liquid | y1[mol/mol] of Water (3) - Vapour | y2[mol/mol] of Acetic acid (1) - Vapour |
| 350.15 | 0.2166 | 0.1524 | 0.1512 | 0.1000 |
| 349.15 | 0.4594 | 0.2186 | 0.7846 | 0.0220 |
| 357.15 | 0.4153 | 0.2361 | 0.5876 | 0.0556 |
| 347.65 | 0.1100 | 0.2914 | 0.2413 | 0.2693 |
| 346.15 | 0.1770 | 0.1370 | 0.6000 | 0.0000 |
| 344.15 | 0.1095 | 0.1733 | 0.3806 | 0.0629 |
| 348.15 | 0.2596 | 0.1854 | 0.6183 | 0.0063 |
| 344.15 | 0.3443 | 0.1231 | 0.3867 | 0.0762 |
| 346.15 | 0.0277 | 0.1351 | 0.7000 | 0.0000 |
| 357.15 | 0.0143 | 0.1493 | 0.0541 | 0.0893 |
| 356.15 | 0.3798 | 0.1378 | 0.3171 | 0.0988 |
| 342.15 | 0.3468 | 0.1169 | 0.8000 | 0.0000 |
| 369.15 | 0.9023 | 0.0108 | 0.4271 | 0.0073 |
| 370.15 | 0.8070 | 0.1818 | 0.3797 | 0.0928 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Solubility, liquid-liquid equilibrium and critical states for the quaternary system acetic acid-ethanol-ethyl acetate-water at 303.15 K and 313.15 K
- Liquid-liquid equilibrium data for ternary systems of water + acetic acid + acetate esters at 293.2 K and 303.2 K and ~ 95 kPa