- Name
- 1-Butanol, 3-methyl-, acetate
- InChI
- InChI=1S/C7H14O2/c1-6(2)4-5-9-7(3)8/h6H,4-5H2,1-3H3
- InChI Key
- MLFHJEHSLIIPHL-UHFFFAOYSA-N
- Formula
- C7H14O2
- SMILES
- CC(=O)OCCC(C)C
- Mol. Weight (g/mol)
- 130.18
- CAS
- 123-92-2
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Water (3) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of 1-Butanol, 3-methyl-, acetate (1) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9502 | 0.0498 |
| 293.20 | 0.6921 | 0.1381 |
| 293.20 | 0.4830 | 0.2480 |
| 293.20 | 0.3857 | 0.3055 |
| 293.20 | 0.3116 | 0.3623 |
| 293.20 | 0.2563 | 0.4090 |
| 293.20 | 0.1915 | 0.4700 |
| 293.20 | 0.1513 | 0.5196 |
| 293.20 | 0.1105 | 0.5774 |
| 293.20 | 0.0656 | 0.6426 |
| 293.20 | 0.0164 | 0.7574 |
| 293.20 | 0.0089 | 0.7977 |
| 293.20 | 0.0046 | 0.8438 |
| 293.20 | 0.0023 | 0.8888 |
| 293.20 | 0.0016 | 0.9205 |
| 293.20 | 0.0006 | 0.9577 |
| 293.20 | 0.0005 | 0.9995 |
| 313.20 | 0.9100 | 0.0900 |
| 313.20 | 0.6539 | 0.1817 |
| 313.20 | 0.5115 | 0.2558 |
| 313.20 | 0.3514 | 0.3484 |
| 313.20 | 0.1832 | 0.4979 |
| 313.20 | 0.1429 | 0.5443 |
| 313.20 | 0.0537 | 0.6717 |
| 313.20 | 0.0169 | 0.7661 |
| 313.20 | 0.0093 | 0.8022 |
| 313.20 | 0.0048 | 0.8446 |
| 313.20 | 0.0017 | 0.9027 |
| 313.20 | 0.0011 | 0.9319 |
| 313.20 | 0.0012 | 0.9636 |
| 313.20 | 0.0006 | 0.9994 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9118 | 0.0872 | 0.1137 | 0.1116 |
| 293.20 | 0.8825 | 0.1139 | 0.1796 | 0.1614 |
| 293.20 | 0.8561 | 0.1374 | 0.2261 | 0.2039 |
| 293.20 | 0.8329 | 0.1574 | 0.2711 | 0.2552 |
| 293.20 | 0.8122 | 0.1747 | 0.3025 | 0.3029 |
| 313.20 | 0.9270 | 0.0728 | 0.1220 | 0.1607 |
| 313.20 | 0.8966 | 0.1013 | 0.1677 | 0.1958 |
| 313.20 | 0.8668 | 0.1285 | 0.2071 | 0.2309 |
| 313.20 | 0.8319 | 0.1589 | 0.2528 | 0.2807 |
| 313.20 | 0.8024 | 0.1833 | 0.2849 | 0.3268 |
Mole fraction of Water (3) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of 1-Butanol, 3-methyl-, acetate (1) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9502 | 0.0498 |
| 293.20 | 0.6921 | 0.1381 |
| 293.20 | 0.4830 | 0.2480 |
| 293.20 | 0.3857 | 0.3055 |
| 293.20 | 0.3116 | 0.3623 |
| 293.20 | 0.2563 | 0.4090 |
| 293.20 | 0.1915 | 0.4700 |
| 293.20 | 0.1513 | 0.5196 |
| 293.20 | 0.1105 | 0.5774 |
| 293.20 | 0.0656 | 0.6426 |
| 293.20 | 0.0164 | 0.7574 |
| 293.20 | 0.0089 | 0.7977 |
| 293.20 | 0.0046 | 0.8438 |
| 293.20 | 0.0023 | 0.8888 |
| 293.20 | 0.0016 | 0.9205 |
| 293.20 | 0.0006 | 0.9577 |
| 293.20 | 0.0005 | 0.9995 |
| 313.20 | 0.9100 | 0.0900 |
| 313.20 | 0.6539 | 0.1817 |
| 313.20 | 0.5115 | 0.2558 |
| 313.20 | 0.3514 | 0.3484 |
| 313.20 | 0.1832 | 0.4979 |
| 313.20 | 0.1429 | 0.5443 |
| 313.20 | 0.0537 | 0.6717 |
| 313.20 | 0.0169 | 0.7661 |
| 313.20 | 0.0093 | 0.8022 |
| 313.20 | 0.0048 | 0.8446 |
| 313.20 | 0.0017 | 0.9027 |
| 313.20 | 0.0011 | 0.9319 |
| 313.20 | 0.0012 | 0.9636 |
| 313.20 | 0.0006 | 0.9994 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9118 | 0.0872 | 0.1137 | 0.1116 |
| 293.20 | 0.8825 | 0.1139 | 0.1796 | 0.1614 |
| 293.20 | 0.8561 | 0.1374 | 0.2261 | 0.2039 |
| 293.20 | 0.8329 | 0.1574 | 0.2711 | 0.2552 |
| 293.20 | 0.8122 | 0.1747 | 0.3025 | 0.3029 |
| 313.20 | 0.9270 | 0.0728 | 0.1220 | 0.1607 |
| 313.20 | 0.8966 | 0.1013 | 0.1677 | 0.1958 |
| 313.20 | 0.8668 | 0.1285 | 0.2071 | 0.2309 |
| 313.20 | 0.8319 | 0.1589 | 0.2528 | 0.2807 |
| 313.20 | 0.8024 | 0.1833 | 0.2849 | 0.3268 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of 1-Butanol, 3-methyl-, acetate (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.0498 | 0.9502 | 1.4004 |
| 293.20 | 0.1381 | 0.6921 | 1.3977 |
| 293.20 | 0.2480 | 0.4830 | 1.3948 |
| 293.20 | 0.3055 | 0.3857 | 1.3927 |
| 293.20 | 0.3623 | 0.3116 | 1.3905 |
| 293.20 | 0.4090 | 0.2563 | 1.3888 |
| 293.20 | 0.4700 | 0.1915 | 1.373 |
| 293.20 | 0.5196 | 0.1513 | 1.3746 |
| 293.20 | 0.5774 | 0.1105 | 1.3772 |
| 293.20 | 0.6426 | 0.0656 | 1.3773 |
| 293.20 | 0.7574 | 0.0164 | 1.3687 |
| 293.20 | 0.7977 | 0.0089 | 1.3643 |
| 293.20 | 0.8438 | 0.0046 | 1.3594 |
| 293.20 | 0.8888 | 0.0023 | 1.353 |
| 293.20 | 0.9205 | 0.0016 | 1.3492 |
| 293.20 | 0.9577 | 0.0006 | 1.3424 |
| 293.20 | 0.9995 | 0.0005 | 1.3332 |
| 313.20 | 0.0900 | 0.9100 | 1.3909 |
| 313.20 | 0.1817 | 0.6539 | 1.3883 |
| 313.20 | 0.2558 | 0.5115 | 1.3867 |
| 313.20 | 0.3484 | 0.3514 | 1.3834 |
| 313.20 | 0.4979 | 0.1832 | 1.3706 |
| 313.20 | 0.5443 | 0.1429 | 1.374 |
| 313.20 | 0.6717 | 0.0537 | 1.3676 |
| 313.20 | 0.7661 | 0.0169 | 1.3613 |
| 313.20 | 0.8022 | 0.0093 | 1.3581 |
| 313.20 | 0.8446 | 0.0048 | 1.354 |
| 313.20 | 0.9027 | 0.0017 | 1.3472 |
| 313.20 | 0.9319 | 0.0011 | 1.3431 |
| 313.20 | 0.9636 | 0.0012 | 1.3375 |
| 313.20 | 0.9994 | 0.0006 | 1.3306 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Acetic acid (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.1116 | 0.1137 | 1.3983 |
| 293.20 | 0.1614 | 0.1796 | 1.3972 |
| 293.20 | 0.2039 | 0.2261 | 1.3958 |
| 293.20 | 0.2552 | 0.2711 | 1.3942 |
| 293.20 | 0.3029 | 0.3025 | 1.3926 |
| 293.20 | 0.9118 | 0.0872 | 1.3468 |
| 293.20 | 0.8825 | 0.1139 | 1.3514 |
| 293.20 | 0.8561 | 0.1374 | 1.3559 |
| 293.20 | 0.8329 | 0.1574 | 1.3602 |
| 293.20 | 0.8122 | 0.1747 | 1.3636 |
| 313.20 | 0.1607 | 0.1220 | 1.3891 |
| 313.20 | 0.1958 | 0.1677 | 1.388 |
| 313.20 | 0.2309 | 0.2071 | 1.3868 |
| 313.20 | 0.2807 | 0.2528 | 1.3851 |
| 313.20 | 0.3268 | 0.2849 | 1.3836 |
| 313.20 | 0.9270 | 0.0728 | 1.3425 |
| 313.20 | 0.8966 | 0.1013 | 1.347 |
| 313.20 | 0.8668 | 0.1285 | 1.351 |
| 313.20 | 0.8319 | 0.1589 | 1.3554 |
| 313.20 | 0.8024 | 0.1833 | 1.3586 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of 1-Butanol, 3-methyl-, acetate (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.0498 | 0.9502 | 1.4004 |
| 293.20 | 0.1381 | 0.6921 | 1.3977 |
| 293.20 | 0.2480 | 0.4830 | 1.3948 |
| 293.20 | 0.3055 | 0.3857 | 1.3927 |
| 293.20 | 0.3623 | 0.3116 | 1.3905 |
| 293.20 | 0.4090 | 0.2563 | 1.3888 |
| 293.20 | 0.4700 | 0.1915 | 1.373 |
| 293.20 | 0.5196 | 0.1513 | 1.3746 |
| 293.20 | 0.5774 | 0.1105 | 1.3772 |
| 293.20 | 0.6426 | 0.0656 | 1.3773 |
| 293.20 | 0.7574 | 0.0164 | 1.3687 |
| 293.20 | 0.7977 | 0.0089 | 1.3643 |
| 293.20 | 0.8438 | 0.0046 | 1.3594 |
| 293.20 | 0.8888 | 0.0023 | 1.353 |
| 293.20 | 0.9205 | 0.0016 | 1.3492 |
| 293.20 | 0.9577 | 0.0006 | 1.3424 |
| 293.20 | 0.9995 | 0.0005 | 1.3332 |
| 313.20 | 0.0900 | 0.9100 | 1.3909 |
| 313.20 | 0.1817 | 0.6539 | 1.3883 |
| 313.20 | 0.2558 | 0.5115 | 1.3867 |
| 313.20 | 0.3484 | 0.3514 | 1.3834 |
| 313.20 | 0.4979 | 0.1832 | 1.3706 |
| 313.20 | 0.5443 | 0.1429 | 1.374 |
| 313.20 | 0.6717 | 0.0537 | 1.3676 |
| 313.20 | 0.7661 | 0.0169 | 1.3613 |
| 313.20 | 0.8022 | 0.0093 | 1.3581 |
| 313.20 | 0.8446 | 0.0048 | 1.354 |
| 313.20 | 0.9027 | 0.0017 | 1.3472 |
| 313.20 | 0.9319 | 0.0011 | 1.3431 |
| 313.20 | 0.9636 | 0.0012 | 1.3375 |
| 313.20 | 0.9994 | 0.0006 | 1.3306 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Acetic acid (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.1116 | 0.1137 | 1.3983 |
| 293.20 | 0.1614 | 0.1796 | 1.3972 |
| 293.20 | 0.2039 | 0.2261 | 1.3958 |
| 293.20 | 0.2552 | 0.2711 | 1.3942 |
| 293.20 | 0.3029 | 0.3025 | 1.3926 |
| 293.20 | 0.9118 | 0.0872 | 1.3468 |
| 293.20 | 0.8825 | 0.1139 | 1.3514 |
| 293.20 | 0.8561 | 0.1374 | 1.3559 |
| 293.20 | 0.8329 | 0.1574 | 1.3602 |
| 293.20 | 0.8122 | 0.1747 | 1.3636 |
| 313.20 | 0.1607 | 0.1220 | 1.3891 |
| 313.20 | 0.1958 | 0.1677 | 1.388 |
| 313.20 | 0.2309 | 0.2071 | 1.3868 |
| 313.20 | 0.2807 | 0.2528 | 1.3851 |
| 313.20 | 0.3268 | 0.2849 | 1.3836 |
| 313.20 | 0.9270 | 0.0728 | 1.3425 |
| 313.20 | 0.8966 | 0.1013 | 1.347 |
| 313.20 | 0.8668 | 0.1285 | 1.351 |
| 313.20 | 0.8319 | 0.1589 | 1.3554 |
| 313.20 | 0.8024 | 0.1833 | 1.3586 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of 1-Butanol, 3-methyl-, acetate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.20 | 0.0498 | 0.9502 | 873.507 |
| 293.20 | 0.1381 | 0.6921 | 891.71 |
| 293.20 | 0.2480 | 0.4830 | 912.158 |
| 293.20 | 0.3055 | 0.3857 | 925.652 |
| 293.20 | 0.3623 | 0.3116 | 937.585 |
| 293.20 | 0.4090 | 0.2563 | 951.949 |
| 293.20 | 0.4700 | 0.1915 | 965.379 |
| 293.20 | 0.5196 | 0.1513 | 980.629 |
| 293.20 | 0.5774 | 0.1105 | 992.748 |
| 293.20 | 0.6426 | 0.0656 | 1011.921 |
| 293.20 | 0.7574 | 0.0164 | 1041.7 |
| 293.20 | 0.7977 | 0.0089 | 1044.59 |
| 293.20 | 0.8438 | 0.0046 | 1042.428 |
| 293.20 | 0.8888 | 0.0023 | 1034.089 |
| 293.20 | 0.9205 | 0.0016 | 1027.238 |
| 293.20 | 0.9577 | 0.0006 | 1016.059 |
| 293.20 | 0.9995 | 0.0005 | 997.832 |
| 313.20 | 0.0900 | 0.9100 | 856.076 |
| 313.20 | 0.1817 | 0.6539 | 873.128 |
| 313.20 | 0.2558 | 0.5115 | 886.38 |
| 313.20 | 0.3484 | 0.3514 | 909.265 |
| 313.20 | 0.4979 | 0.1832 | 945.04 |
| 313.20 | 0.5443 | 0.1429 | 956.008 |
| 313.20 | 0.6717 | 0.0537 | 998.414 |
| 313.20 | 0.7661 | 0.0169 | 1024.202 |
| 313.20 | 0.8022 | 0.0093 | 1027.439 |
| 313.20 | 0.8446 | 0.0048 | 1026.959 |
| 313.20 | 0.9027 | 0.0017 | 1019.936 |
| 313.20 | 0.9319 | 0.0011 | 1014.055 |
| 313.20 | 0.9636 | 0.0012 | 1004.841 |
| 313.20 | 0.9994 | 0.0006 | 992.175 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Acetic acid (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.20 | 0.1116 | 0.1137 | 885.374 |
| 293.20 | 0.1614 | 0.1796 | 895.644 |
| 293.20 | 0.2039 | 0.2261 | 904.995 |
| 293.20 | 0.2552 | 0.2711 | 916.33 |
| 293.20 | 0.3029 | 0.3025 | 927.122 |
| 293.20 | 0.9118 | 0.0872 | 1023.803 |
| 293.20 | 0.8825 | 0.1139 | 1031.625 |
| 293.20 | 0.8561 | 0.1374 | 1038.05 |
| 293.20 | 0.8329 | 0.1574 | 1042.855 |
| 293.20 | 0.8122 | 0.1747 | 1044.344 |
| 313.20 | 0.1607 | 0.1220 | 868.293 |
| 313.20 | 0.1958 | 0.1677 | 876.733 |
| 313.20 | 0.2309 | 0.2071 | 885.049 |
| 313.20 | 0.2807 | 0.2528 | 897.252 |
| 313.20 | 0.3268 | 0.2849 | 909.336 |
| 313.20 | 0.9270 | 0.0728 | 1012.848 |
| 313.20 | 0.8966 | 0.1013 | 1019.703 |
| 313.20 | 0.8668 | 0.1285 | 1023.951 |
| 313.20 | 0.8319 | 0.1589 | 1027.298 |
| 313.20 | 0.8024 | 0.1833 | 1026.986 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of 1-Butanol, 3-methyl-, acetate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.20 | 0.0498 | 0.9502 | 873.507 |
| 293.20 | 0.1381 | 0.6921 | 891.71 |
| 293.20 | 0.2480 | 0.4830 | 912.158 |
| 293.20 | 0.3055 | 0.3857 | 925.652 |
| 293.20 | 0.3623 | 0.3116 | 937.585 |
| 293.20 | 0.4090 | 0.2563 | 951.949 |
| 293.20 | 0.4700 | 0.1915 | 965.379 |
| 293.20 | 0.5196 | 0.1513 | 980.629 |
| 293.20 | 0.5774 | 0.1105 | 992.748 |
| 293.20 | 0.6426 | 0.0656 | 1011.921 |
| 293.20 | 0.7574 | 0.0164 | 1041.7 |
| 293.20 | 0.7977 | 0.0089 | 1044.59 |
| 293.20 | 0.8438 | 0.0046 | 1042.428 |
| 293.20 | 0.8888 | 0.0023 | 1034.089 |
| 293.20 | 0.9205 | 0.0016 | 1027.238 |
| 293.20 | 0.9577 | 0.0006 | 1016.059 |
| 293.20 | 0.9995 | 0.0005 | 997.832 |
| 313.20 | 0.0900 | 0.9100 | 856.076 |
| 313.20 | 0.1817 | 0.6539 | 873.128 |
| 313.20 | 0.2558 | 0.5115 | 886.38 |
| 313.20 | 0.3484 | 0.3514 | 909.265 |
| 313.20 | 0.4979 | 0.1832 | 945.04 |
| 313.20 | 0.5443 | 0.1429 | 956.008 |
| 313.20 | 0.6717 | 0.0537 | 998.414 |
| 313.20 | 0.7661 | 0.0169 | 1024.202 |
| 313.20 | 0.8022 | 0.0093 | 1027.439 |
| 313.20 | 0.8446 | 0.0048 | 1026.959 |
| 313.20 | 0.9027 | 0.0017 | 1019.936 |
| 313.20 | 0.9319 | 0.0011 | 1014.055 |
| 313.20 | 0.9636 | 0.0012 | 1004.841 |
| 313.20 | 0.9994 | 0.0006 | 992.175 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (3) - Liquid | Mole fraction of Acetic acid (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.20 | 0.1116 | 0.1137 | 885.374 |
| 293.20 | 0.1614 | 0.1796 | 895.644 |
| 293.20 | 0.2039 | 0.2261 | 904.995 |
| 293.20 | 0.2552 | 0.2711 | 916.33 |
| 293.20 | 0.3029 | 0.3025 | 927.122 |
| 293.20 | 0.9118 | 0.0872 | 1023.803 |
| 293.20 | 0.8825 | 0.1139 | 1031.625 |
| 293.20 | 0.8561 | 0.1374 | 1038.05 |
| 293.20 | 0.8329 | 0.1574 | 1042.855 |
| 293.20 | 0.8122 | 0.1747 | 1044.344 |
| 313.20 | 0.1607 | 0.1220 | 868.293 |
| 313.20 | 0.1958 | 0.1677 | 876.733 |
| 313.20 | 0.2309 | 0.2071 | 885.049 |
| 313.20 | 0.2807 | 0.2528 | 897.252 |
| 313.20 | 0.3268 | 0.2849 | 909.336 |
| 313.20 | 0.9270 | 0.0728 | 1012.848 |
| 313.20 | 0.8966 | 0.1013 | 1019.703 |
| 313.20 | 0.8668 | 0.1285 | 1023.951 |
| 313.20 | 0.8319 | 0.1589 | 1027.298 |
| 313.20 | 0.8024 | 0.1833 | 1026.986 |