- Name
- 2-Butanone
- InChI
- InChI=1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3
- InChI Key
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- CCC(C)=O
- Mol. Weight (g/mol)
- 72.11
- CAS
- 78-93-3
- Name
- Cyclohexane
- InChI
- InChI=1S/C6H12/c1-2-4-6-5-3-1/h1-6H2
- InChI Key
- XDTMQSROBMDMFD-UHFFFAOYSA-N
- Formula
- C6H12
- SMILES
- C1CCCCC1
- Mol. Weight (g/mol)
- 84.16
- CAS
- 110-82-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (6)
- csound,fluid - Speed of Sound, m/s (4)
- Vapor or sublimation pressure, kPa (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0004 |
| 293.15 | 0.0479 | 0.0004 |
| 293.15 | 0.0956 | 0.0004 |
| 293.15 | 0.1983 | 0.0004 |
| 293.15 | 0.3046 | 0.0005 |
| 293.15 | 0.4002 | 0.0005 |
| 293.15 | 0.5028 | 0.0005 |
| 293.15 | 0.6056 | 0.0006 |
| 293.15 | 0.7030 | 0.0006 |
| 293.15 | 0.8048 | 0.0007 |
| 293.15 | 0.9029 | 0.0008 |
| 293.15 | 0.9515 | 0.0009 |
| 293.15 | 1.0000 | 0.0010 |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.0479 | 0.0004 |
| 298.15 | 0.0956 | 0.0004 |
| 298.15 | 0.1983 | 0.0004 |
| 298.15 | 0.3046 | 0.0004 |
| 298.15 | 0.4002 | 0.0005 |
| 298.15 | 0.5028 | 0.0005 |
| 298.15 | 0.6056 | 0.0005 |
| 298.15 | 0.7030 | 0.0006 |
| 298.15 | 0.8048 | 0.0007 |
| 298.15 | 0.9029 | 0.0008 |
| 298.15 | 0.9515 | 0.0008 |
| 298.15 | 1.0000 | 0.0009 |
| 303.15 | 0.0000 | 0.0004 |
| 303.15 | 0.0479 | 0.0004 |
| 303.15 | 0.0956 | 0.0004 |
| 303.15 | 0.1983 | 0.0004 |
| 303.15 | 0.3046 | 0.0004 |
| 303.15 | 0.4002 | 0.0004 |
| 303.15 | 0.5028 | 0.0005 |
| 303.15 | 0.6056 | 0.0005 |
| 303.15 | 0.7030 | 0.0006 |
| 303.15 | 0.8048 | 0.0006 |
| 303.15 | 0.9029 | 0.0007 |
| 303.15 | 0.9515 | 0.0008 |
| 303.15 | 1.0000 | 0.0008 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0004 |
| 293.15 | 0.0479 | 0.0004 |
| 293.15 | 0.0956 | 0.0004 |
| 293.15 | 0.1983 | 0.0004 |
| 293.15 | 0.3046 | 0.0005 |
| 293.15 | 0.4002 | 0.0005 |
| 293.15 | 0.5028 | 0.0005 |
| 293.15 | 0.6056 | 0.0006 |
| 293.15 | 0.7030 | 0.0006 |
| 293.15 | 0.8048 | 0.0007 |
| 293.15 | 0.9029 | 0.0008 |
| 293.15 | 0.9515 | 0.0009 |
| 293.15 | 1.0000 | 0.0010 |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.0479 | 0.0004 |
| 298.15 | 0.0956 | 0.0004 |
| 298.15 | 0.1983 | 0.0004 |
| 298.15 | 0.3046 | 0.0004 |
| 298.15 | 0.4002 | 0.0005 |
| 298.15 | 0.5028 | 0.0005 |
| 298.15 | 0.6056 | 0.0005 |
| 298.15 | 0.7030 | 0.0006 |
| 298.15 | 0.8048 | 0.0007 |
| 298.15 | 0.9029 | 0.0008 |
| 298.15 | 0.9515 | 0.0008 |
| 298.15 | 1.0000 | 0.0009 |
| 303.15 | 0.0000 | 0.0004 |
| 303.15 | 0.0479 | 0.0004 |
| 303.15 | 0.0956 | 0.0004 |
| 303.15 | 0.1983 | 0.0004 |
| 303.15 | 0.3046 | 0.0004 |
| 303.15 | 0.4002 | 0.0004 |
| 303.15 | 0.5028 | 0.0005 |
| 303.15 | 0.6056 | 0.0005 |
| 303.15 | 0.7030 | 0.0006 |
| 303.15 | 0.8048 | 0.0006 |
| 303.15 | 0.9029 | 0.0007 |
| 303.15 | 0.9515 | 0.0008 |
| 303.15 | 1.0000 | 0.0008 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.3788 |
| 293.15 | 0.0472 | 1.3808 |
| 293.15 | 0.0979 | 1.3829 |
| 293.15 | 0.1986 | 1.3871 |
| 293.15 | 0.2973 | 1.3914 |
| 293.15 | 0.3975 | 1.3959 |
| 293.15 | 0.4970 | 1.4005 |
| 293.15 | 0.6045 | 1.4058 |
| 293.15 | 0.6922 | 1.4101 |
| 293.15 | 0.7984 | 1.4153 |
| 293.15 | 0.8978 | 1.4204 |
| 293.15 | 0.9476 | 1.4232 |
| 293.15 | 1.0000 | 1.4263 |
| 298.15 | 0.0000 | 1.3762 |
| 298.15 | 0.0472 | 1.3781 |
| 298.15 | 0.0979 | 1.3802 |
| 298.15 | 0.1986 | 1.3844 |
| 298.15 | 0.2973 | 1.3886 |
| 298.15 | 0.3975 | 1.3929 |
| 298.15 | 0.4970 | 1.3977 |
| 298.15 | 0.6045 | 1.4026 |
| 298.15 | 0.6922 | 1.4072 |
| 298.15 | 0.7984 | 1.4125 |
| 298.15 | 0.8978 | 1.4177 |
| 298.15 | 0.9476 | 1.4204 |
| 298.15 | 1.0000 | 1.4235 |
| 303.15 | 0.0000 | 1.3736 |
| 303.15 | 0.0472 | 1.3754 |
| 303.15 | 0.0979 | 1.3775 |
| 303.15 | 0.1986 | 1.3816 |
| 303.15 | 0.2973 | 1.3859 |
| 303.15 | 0.3975 | 1.3903 |
| 303.15 | 0.4970 | 1.3949 |
| 303.15 | 0.6045 | 1.4001 |
| 303.15 | 0.6922 | 1.4044 |
| 303.15 | 0.7984 | 1.4097 |
| 303.15 | 0.8978 | 1.4147 |
| 303.15 | 0.9476 | 1.4175 |
| 303.15 | 1.0000 | 1.4207 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.3788 |
| 293.15 | 0.0472 | 1.3808 |
| 293.15 | 0.0979 | 1.3829 |
| 293.15 | 0.1986 | 1.3871 |
| 293.15 | 0.2973 | 1.3914 |
| 293.15 | 0.3975 | 1.3959 |
| 293.15 | 0.4970 | 1.4005 |
| 293.15 | 0.6045 | 1.4058 |
| 293.15 | 0.6922 | 1.4101 |
| 293.15 | 0.7984 | 1.4153 |
| 293.15 | 0.8978 | 1.4204 |
| 293.15 | 0.9476 | 1.4232 |
| 293.15 | 1.0000 | 1.4263 |
| 298.15 | 0.0000 | 1.3762 |
| 298.15 | 0.0472 | 1.3781 |
| 298.15 | 0.0979 | 1.3802 |
| 298.15 | 0.1986 | 1.3844 |
| 298.15 | 0.2973 | 1.3886 |
| 298.15 | 0.3975 | 1.3929 |
| 298.15 | 0.4970 | 1.3977 |
| 298.15 | 0.6045 | 1.4026 |
| 298.15 | 0.6922 | 1.4072 |
| 298.15 | 0.7984 | 1.4125 |
| 298.15 | 0.8978 | 1.4177 |
| 298.15 | 0.9476 | 1.4204 |
| 298.15 | 1.0000 | 1.4235 |
| 303.15 | 0.0000 | 1.3736 |
| 303.15 | 0.0472 | 1.3754 |
| 303.15 | 0.0979 | 1.3775 |
| 303.15 | 0.1986 | 1.3816 |
| 303.15 | 0.2973 | 1.3859 |
| 303.15 | 0.3975 | 1.3903 |
| 303.15 | 0.4970 | 1.3949 |
| 303.15 | 0.6045 | 1.4001 |
| 303.15 | 0.6922 | 1.4044 |
| 303.15 | 0.7984 | 1.4097 |
| 303.15 | 0.8978 | 1.4147 |
| 303.15 | 0.9476 | 1.4175 |
| 303.15 | 1.0000 | 1.4207 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 805.6 |
| 293.15 | 0.0472 | 802.6 |
| 293.15 | 0.0979 | 799.8 |
| 293.15 | 0.1986 | 794.7 |
| 293.15 | 0.2973 | 790.3 |
| 293.15 | 0.3975 | 786.6 |
| 293.15 | 0.4970 | 783.7 |
| 293.15 | 0.6045 | 781.0 |
| 293.15 | 0.6922 | 779.5 |
| 293.15 | 0.7984 | 778.2 |
| 293.15 | 0.8978 | 777.8 |
| 293.15 | 0.9476 | 778.0 |
| 293.15 | 1.0000 | 778.4 |
| 298.15 | 0.0000 | 799.7 |
| 298.15 | 0.0472 | 796.4 |
| 298.15 | 0.0979 | 793.7 |
| 298.15 | 0.1986 | 788.8 |
| 298.15 | 0.2973 | 784.8 |
| 298.15 | 0.3975 | 781.4 |
| 298.15 | 0.4970 | 778.4 |
| 298.15 | 0.6045 | 776.1 |
| 298.15 | 0.6922 | 774.6 |
| 298.15 | 0.7984 | 773.4 |
| 298.15 | 0.8978 | 773.1 |
| 298.15 | 0.9476 | 773.2 |
| 298.15 | 1.0000 | 773.8 |
| 303.15 | 0.0000 | 794.9 |
| 303.15 | 0.0472 | 791.5 |
| 303.15 | 0.0979 | 788.8 |
| 303.15 | 0.1986 | 784.0 |
| 303.15 | 0.2973 | 779.9 |
| 303.15 | 0.3975 | 776.4 |
| 303.15 | 0.4970 | 773.5 |
| 303.15 | 0.6045 | 771.1 |
| 303.15 | 0.6922 | 769.6 |
| 303.15 | 0.7984 | 768.5 |
| 303.15 | 0.8978 | 768.2 |
| 303.15 | 0.9476 | 768.5 |
| 303.15 | 1.0000 | 769.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 804.95 |
| 293.15 | 0.0479 | 802.06 |
| 293.15 | 0.0956 | 799.43 |
| 293.15 | 0.1983 | 794.32 |
| 293.15 | 0.3046 | 789.89 |
| 293.15 | 0.4002 | 786.39 |
| 293.15 | 0.5028 | 783.42 |
| 293.15 | 0.6056 | 781.01 |
| 293.15 | 0.7030 | 779.32 |
| 293.15 | 0.8048 | 778.18 |
| 293.15 | 0.9029 | 777.83 |
| 293.15 | 0.9515 | 778.02 |
| 293.15 | 1.0000 | 778.62 |
| 298.15 | 0.0000 | 799.74 |
| 298.15 | 0.0479 | 796.86 |
| 298.15 | 0.0956 | 794.25 |
| 298.15 | 0.1983 | 789.19 |
| 298.15 | 0.3046 | 784.78 |
| 298.15 | 0.4002 | 781.34 |
| 298.15 | 0.5028 | 778.41 |
| 298.15 | 0.6056 | 776.06 |
| 298.15 | 0.7030 | 774.42 |
| 298.15 | 0.8048 | 773.34 |
| 298.15 | 0.9029 | 773.06 |
| 298.15 | 0.9515 | 773.27 |
| 298.15 | 1.0000 | 773.92 |
| 303.15 | 0.0000 | 794.48 |
| 303.15 | 0.0479 | 791.62 |
| 303.15 | 0.0956 | 789.03 |
| 303.15 | 0.1983 | 784.01 |
| 303.15 | 0.3046 | 779.65 |
| 303.15 | 0.4002 | 776.24 |
| 303.15 | 0.5028 | 773.37 |
| 303.15 | 0.6056 | 771.06 |
| 303.15 | 0.7030 | 769.48 |
| 303.15 | 0.8048 | 768.46 |
| 303.15 | 0.9029 | 768.26 |
| 303.15 | 0.9515 | 768.51 |
| 303.15 | 1.0000 | 769.19 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 768.9 |
| 303.15 | 0.1066 | 768.0 |
| 303.15 | 0.2093 | 768.3 |
| 303.15 | 0.3084 | 769.5 |
| 303.15 | 0.4042 | 771.3 |
| 303.15 | 0.5064 | 773.6 |
| 303.15 | 0.6055 | 776.2 |
| 303.15 | 0.7007 | 779.8 |
| 303.15 | 0.8015 | 784.0 |
| 303.15 | 0.9070 | 789.6 |
| 303.15 | 1.0000 | 794.6 |
| 313.15 | 0.0000 | 759.2 |
| 313.15 | 0.1066 | 758.3 |
| 313.15 | 0.2093 | 757.4 |
| 313.15 | 0.3084 | 758.2 |
| 313.15 | 0.4042 | 759.9 |
| 313.15 | 0.5064 | 762.4 |
| 313.15 | 0.6055 | 765.1 |
| 313.15 | 0.7007 | 769.2 |
| 313.15 | 0.8015 | 772.7 |
| 313.15 | 0.9070 | 777.8 |
| 313.15 | 1.0000 | 784.0 |
| 323.15 | 0.0000 | 748.7 |
| 323.15 | 0.1066 | 747.4 |
| 323.15 | 0.2093 | 746.5 |
| 323.15 | 0.3084 | 747.3 |
| 323.15 | 0.4042 | 749.2 |
| 323.15 | 0.5064 | 751.3 |
| 323.15 | 0.6055 | 754.4 |
| 323.15 | 0.7007 | 757.8 |
| 323.15 | 0.8015 | 761.7 |
| 323.15 | 0.9070 | 767.2 |
| 323.15 | 1.0000 | 773.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 805.6 |
| 293.15 | 0.0472 | 802.6 |
| 293.15 | 0.0979 | 799.8 |
| 293.15 | 0.1986 | 794.7 |
| 293.15 | 0.2973 | 790.3 |
| 293.15 | 0.3975 | 786.6 |
| 293.15 | 0.4970 | 783.7 |
| 293.15 | 0.6045 | 781.0 |
| 293.15 | 0.6922 | 779.5 |
| 293.15 | 0.7984 | 778.2 |
| 293.15 | 0.8978 | 777.8 |
| 293.15 | 0.9476 | 778.0 |
| 293.15 | 1.0000 | 778.4 |
| 298.15 | 0.0000 | 799.7 |
| 298.15 | 0.0472 | 796.4 |
| 298.15 | 0.0979 | 793.7 |
| 298.15 | 0.1986 | 788.8 |
| 298.15 | 0.2973 | 784.8 |
| 298.15 | 0.3975 | 781.4 |
| 298.15 | 0.4970 | 778.4 |
| 298.15 | 0.6045 | 776.1 |
| 298.15 | 0.6922 | 774.6 |
| 298.15 | 0.7984 | 773.4 |
| 298.15 | 0.8978 | 773.1 |
| 298.15 | 0.9476 | 773.2 |
| 298.15 | 1.0000 | 773.8 |
| 303.15 | 0.0000 | 794.9 |
| 303.15 | 0.0472 | 791.5 |
| 303.15 | 0.0979 | 788.8 |
| 303.15 | 0.1986 | 784.0 |
| 303.15 | 0.2973 | 779.9 |
| 303.15 | 0.3975 | 776.4 |
| 303.15 | 0.4970 | 773.5 |
| 303.15 | 0.6045 | 771.1 |
| 303.15 | 0.6922 | 769.6 |
| 303.15 | 0.7984 | 768.5 |
| 303.15 | 0.8978 | 768.2 |
| 303.15 | 0.9476 | 768.5 |
| 303.15 | 1.0000 | 769.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 804.95 |
| 293.15 | 0.0479 | 802.06 |
| 293.15 | 0.0956 | 799.43 |
| 293.15 | 0.1983 | 794.32 |
| 293.15 | 0.3046 | 789.89 |
| 293.15 | 0.4002 | 786.39 |
| 293.15 | 0.5028 | 783.42 |
| 293.15 | 0.6056 | 781.01 |
| 293.15 | 0.7030 | 779.32 |
| 293.15 | 0.8048 | 778.18 |
| 293.15 | 0.9029 | 777.83 |
| 293.15 | 0.9515 | 778.02 |
| 293.15 | 1.0000 | 778.62 |
| 298.15 | 0.0000 | 799.74 |
| 298.15 | 0.0479 | 796.86 |
| 298.15 | 0.0956 | 794.25 |
| 298.15 | 0.1983 | 789.19 |
| 298.15 | 0.3046 | 784.78 |
| 298.15 | 0.4002 | 781.34 |
| 298.15 | 0.5028 | 778.41 |
| 298.15 | 0.6056 | 776.06 |
| 298.15 | 0.7030 | 774.42 |
| 298.15 | 0.8048 | 773.34 |
| 298.15 | 0.9029 | 773.06 |
| 298.15 | 0.9515 | 773.27 |
| 298.15 | 1.0000 | 773.92 |
| 303.15 | 0.0000 | 794.48 |
| 303.15 | 0.0479 | 791.62 |
| 303.15 | 0.0956 | 789.03 |
| 303.15 | 0.1983 | 784.01 |
| 303.15 | 0.3046 | 779.65 |
| 303.15 | 0.4002 | 776.24 |
| 303.15 | 0.5028 | 773.37 |
| 303.15 | 0.6056 | 771.06 |
| 303.15 | 0.7030 | 769.48 |
| 303.15 | 0.8048 | 768.46 |
| 303.15 | 0.9029 | 768.26 |
| 303.15 | 0.9515 | 768.51 |
| 303.15 | 1.0000 | 769.19 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 768.9 |
| 303.15 | 0.1066 | 768.0 |
| 303.15 | 0.2093 | 768.3 |
| 303.15 | 0.3084 | 769.5 |
| 303.15 | 0.4042 | 771.3 |
| 303.15 | 0.5064 | 773.6 |
| 303.15 | 0.6055 | 776.2 |
| 303.15 | 0.7007 | 779.8 |
| 303.15 | 0.8015 | 784.0 |
| 303.15 | 0.9070 | 789.6 |
| 303.15 | 1.0000 | 794.6 |
| 313.15 | 0.0000 | 759.2 |
| 313.15 | 0.1066 | 758.3 |
| 313.15 | 0.2093 | 757.4 |
| 313.15 | 0.3084 | 758.2 |
| 313.15 | 0.4042 | 759.9 |
| 313.15 | 0.5064 | 762.4 |
| 313.15 | 0.6055 | 765.1 |
| 313.15 | 0.7007 | 769.2 |
| 313.15 | 0.8015 | 772.7 |
| 313.15 | 0.9070 | 777.8 |
| 313.15 | 1.0000 | 784.0 |
| 323.15 | 0.0000 | 748.7 |
| 323.15 | 0.1066 | 747.4 |
| 323.15 | 0.2093 | 746.5 |
| 323.15 | 0.3084 | 747.3 |
| 323.15 | 0.4042 | 749.2 |
| 323.15 | 0.5064 | 751.3 |
| 323.15 | 0.6055 | 754.4 |
| 323.15 | 0.7007 | 757.8 |
| 323.15 | 0.8015 | 761.7 |
| 323.15 | 0.9070 | 767.2 |
| 323.15 | 1.0000 | 773.3 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1212.0 |
| 293.15 | 0.0472 | 1212.0 |
| 293.15 | 0.0979 | 1213.0 |
| 293.15 | 0.1986 | 1212.0 |
| 293.15 | 0.2973 | 1212.0 |
| 293.15 | 0.3975 | 1216.0 |
| 293.15 | 0.4970 | 1221.0 |
| 293.15 | 0.6045 | 1229.0 |
| 293.15 | 0.6922 | 1236.0 |
| 293.15 | 0.7984 | 1248.0 |
| 293.15 | 0.8978 | 1261.0 |
| 293.15 | 0.9476 | 1269.0 |
| 293.15 | 1.0000 | 1279.0 |
| 298.15 | 0.0000 | 1192.0 |
| 298.15 | 0.0472 | 1190.0 |
| 298.15 | 0.0979 | 1190.0 |
| 298.15 | 0.1986 | 1190.0 |
| 298.15 | 0.2973 | 1190.0 |
| 298.15 | 0.3975 | 1192.0 |
| 298.15 | 0.4970 | 1198.0 |
| 298.15 | 0.6045 | 1204.0 |
| 298.15 | 0.6922 | 1212.0 |
| 298.15 | 0.7984 | 1222.0 |
| 298.15 | 0.8978 | 1236.0 |
| 298.15 | 0.9476 | 1244.0 |
| 298.15 | 1.0000 | 1256.0 |
| 303.15 | 0.0000 | 1163.0 |
| 303.15 | 0.0472 | 1159.0 |
| 303.15 | 0.0979 | 1159.0 |
| 303.15 | 0.1986 | 1158.0 |
| 303.15 | 0.2973 | 1158.0 |
| 303.15 | 0.3975 | 1161.0 |
| 303.15 | 0.4970 | 1166.0 |
| 303.15 | 0.6045 | 1172.0 |
| 303.15 | 0.6922 | 1179.0 |
| 303.15 | 0.7984 | 1188.0 |
| 303.15 | 0.8978 | 1200.0 |
| 303.15 | 0.9476 | 1207.0 |
| 303.15 | 1.0000 | 1219.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1213.0 |
| 293.15 | 0.0479 | 1212.0 |
| 293.15 | 0.0956 | 1211.0 |
| 293.15 | 0.1983 | 1210.0 |
| 293.15 | 0.3046 | 1212.0 |
| 293.15 | 0.4002 | 1215.0 |
| 293.15 | 0.5028 | 1221.0 |
| 293.15 | 0.6056 | 1229.0 |
| 293.15 | 0.7030 | 1238.0 |
| 293.15 | 0.8048 | 1249.0 |
| 293.15 | 0.9029 | 1262.0 |
| 293.15 | 0.9515 | 1270.0 |
| 293.15 | 1.0000 | 1279.0 |
| 298.15 | 0.0000 | 1192.0 |
| 298.15 | 0.0479 | 1190.0 |
| 298.15 | 0.0956 | 1189.0 |
| 298.15 | 0.1983 | 1188.0 |
| 298.15 | 0.3046 | 1190.0 |
| 298.15 | 0.4002 | 1193.0 |
| 298.15 | 0.5028 | 1198.0 |
| 298.15 | 0.6056 | 1205.0 |
| 298.15 | 0.7030 | 1214.0 |
| 298.15 | 0.8048 | 1225.0 |
| 298.15 | 0.9029 | 1238.0 |
| 298.15 | 0.9515 | 1245.0 |
| 298.15 | 1.0000 | 1254.0 |
| 303.15 | 0.0000 | 1171.0 |
| 303.15 | 0.0479 | 1169.0 |
| 303.15 | 0.0956 | 1167.0 |
| 303.15 | 0.1983 | 1166.0 |
| 303.15 | 0.3046 | 1168.0 |
| 303.15 | 0.4002 | 1170.0 |
| 303.15 | 0.5028 | 1175.0 |
| 303.15 | 0.6056 | 1182.0 |
| 303.15 | 0.7030 | 1190.0 |
| 303.15 | 0.8048 | 1201.0 |
| 303.15 | 0.9029 | 1213.0 |
| 303.15 | 0.9515 | 1221.0 |
| 303.15 | 1.0000 | 1230.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1212.0 |
| 293.15 | 0.0472 | 1212.0 |
| 293.15 | 0.0979 | 1213.0 |
| 293.15 | 0.1986 | 1212.0 |
| 293.15 | 0.2973 | 1212.0 |
| 293.15 | 0.3975 | 1216.0 |
| 293.15 | 0.4970 | 1221.0 |
| 293.15 | 0.6045 | 1229.0 |
| 293.15 | 0.6922 | 1236.0 |
| 293.15 | 0.7984 | 1248.0 |
| 293.15 | 0.8978 | 1261.0 |
| 293.15 | 0.9476 | 1269.0 |
| 293.15 | 1.0000 | 1279.0 |
| 298.15 | 0.0000 | 1192.0 |
| 298.15 | 0.0472 | 1190.0 |
| 298.15 | 0.0979 | 1190.0 |
| 298.15 | 0.1986 | 1190.0 |
| 298.15 | 0.2973 | 1190.0 |
| 298.15 | 0.3975 | 1192.0 |
| 298.15 | 0.4970 | 1198.0 |
| 298.15 | 0.6045 | 1204.0 |
| 298.15 | 0.6922 | 1212.0 |
| 298.15 | 0.7984 | 1222.0 |
| 298.15 | 0.8978 | 1236.0 |
| 298.15 | 0.9476 | 1244.0 |
| 298.15 | 1.0000 | 1256.0 |
| 303.15 | 0.0000 | 1163.0 |
| 303.15 | 0.0472 | 1159.0 |
| 303.15 | 0.0979 | 1159.0 |
| 303.15 | 0.1986 | 1158.0 |
| 303.15 | 0.2973 | 1158.0 |
| 303.15 | 0.3975 | 1161.0 |
| 303.15 | 0.4970 | 1166.0 |
| 303.15 | 0.6045 | 1172.0 |
| 303.15 | 0.6922 | 1179.0 |
| 303.15 | 0.7984 | 1188.0 |
| 303.15 | 0.8978 | 1200.0 |
| 303.15 | 0.9476 | 1207.0 |
| 303.15 | 1.0000 | 1219.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1213.0 |
| 293.15 | 0.0479 | 1212.0 |
| 293.15 | 0.0956 | 1211.0 |
| 293.15 | 0.1983 | 1210.0 |
| 293.15 | 0.3046 | 1212.0 |
| 293.15 | 0.4002 | 1215.0 |
| 293.15 | 0.5028 | 1221.0 |
| 293.15 | 0.6056 | 1229.0 |
| 293.15 | 0.7030 | 1238.0 |
| 293.15 | 0.8048 | 1249.0 |
| 293.15 | 0.9029 | 1262.0 |
| 293.15 | 0.9515 | 1270.0 |
| 293.15 | 1.0000 | 1279.0 |
| 298.15 | 0.0000 | 1192.0 |
| 298.15 | 0.0479 | 1190.0 |
| 298.15 | 0.0956 | 1189.0 |
| 298.15 | 0.1983 | 1188.0 |
| 298.15 | 0.3046 | 1190.0 |
| 298.15 | 0.4002 | 1193.0 |
| 298.15 | 0.5028 | 1198.0 |
| 298.15 | 0.6056 | 1205.0 |
| 298.15 | 0.7030 | 1214.0 |
| 298.15 | 0.8048 | 1225.0 |
| 298.15 | 0.9029 | 1238.0 |
| 298.15 | 0.9515 | 1245.0 |
| 298.15 | 1.0000 | 1254.0 |
| 303.15 | 0.0000 | 1171.0 |
| 303.15 | 0.0479 | 1169.0 |
| 303.15 | 0.0956 | 1167.0 |
| 303.15 | 0.1983 | 1166.0 |
| 303.15 | 0.3046 | 1168.0 |
| 303.15 | 0.4002 | 1170.0 |
| 303.15 | 0.5028 | 1175.0 |
| 303.15 | 0.6056 | 1182.0 |
| 303.15 | 0.7030 | 1190.0 |
| 303.15 | 0.8048 | 1201.0 |
| 303.15 | 0.9029 | 1213.0 |
| 303.15 | 0.9515 | 1221.0 |
| 303.15 | 1.0000 | 1230.0 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Mole fraction of 2-Butanone (1) - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 303.20 | 0.0000 | 16.10 |
| 303.20 | 0.0820 | 19.90 |
| 303.10 | 0.0940 | 20.10 |
| 303.20 | 0.0980 | 20.20 |
| 303.20 | 0.1410 | 20.90 |
| 303.20 | 0.1520 | 21.00 |
| 303.20 | 0.1520 | 21.00 |
| 303.10 | 0.1600 | 21.10 |
| 303.20 | 0.2590 | 21.80 |
| 303.20 | 0.2810 | 21.90 |
| 303.20 | 0.2870 | 21.90 |
| 303.20 | 0.3950 | 22.10 |
| 303.10 | 0.4030 | 22.20 |
| 303.20 | 0.5300 | 22.10 |
| 303.20 | 0.6160 | 21.90 |
| 303.20 | 0.6240 | 21.80 |
| 303.20 | 0.7400 | 21.10 |
| 303.20 | 0.7530 | 20.90 |
| 303.20 | 0.8160 | 20.20 |
| 303.20 | 0.8370 | 19.80 |
| 303.20 | 0.9120 | 18.30 |
| 303.20 | 0.9170 | 18.10 |
| 303.20 | 0.9240 | 17.90 |
| 303.20 | 1.0000 | 15.10 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Mole fraction of 2-Butanone (1) - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 303.20 | 0.0000 | 16.10 |
| 303.20 | 0.0820 | 19.90 |
| 303.10 | 0.0940 | 20.10 |
| 303.20 | 0.0980 | 20.20 |
| 303.20 | 0.1410 | 20.90 |
| 303.20 | 0.1520 | 21.00 |
| 303.20 | 0.1520 | 21.00 |
| 303.10 | 0.1600 | 21.10 |
| 303.20 | 0.2590 | 21.80 |
| 303.20 | 0.2810 | 21.90 |
| 303.20 | 0.2870 | 21.90 |
| 303.20 | 0.3950 | 22.10 |
| 303.10 | 0.4030 | 22.20 |
| 303.20 | 0.5300 | 22.10 |
| 303.20 | 0.6160 | 21.90 |
| 303.20 | 0.6240 | 21.80 |
| 303.20 | 0.7400 | 21.10 |
| 303.20 | 0.7530 | 20.90 |
| 303.20 | 0.8160 | 20.20 |
| 303.20 | 0.8370 | 19.80 |
| 303.20 | 0.9120 | 18.30 |
| 303.20 | 0.9170 | 18.10 |
| 303.20 | 0.9240 | 17.90 |
| 303.20 | 1.0000 | 15.10 |
Sources
- Quaternary isothermal vapor-liquid equilibrium of the model biofuel 2-butanone + n-heptane + tetrahydrofuran + cyclohexane using Raman spectroscopic characterization
- Measurement and correlation of (liquid + liquid) equilibrium of the azeotrope (cyclohexane + 2-butanone) with different ionic liquids at T = 298.15 K
- Dynamic Viscosities of the Binary Systems Cyclohexane and Cyclopentane with Acetone, Butanone, or 2-Pentanone at Three Temperatures T ) (293.15, 298.15, and 303.15) K
- Volumetric Behavior of the Binary Mixtures of Methyl Ethyl Ketone with n-Hexane, Cyclohexane, and Benzene at T ) (303.15, 313.15, and 323.15) K