- Name
- 1-Butanol
- InChI
- InChI=1S/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3
- InChI Key
- LRHPLDYGYMQRHN-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CCCCO
- Mol. Weight (g/mol)
- 74.12
- CAS
- 71-36-3
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (12)
- n0 - Refractive index (Na D-line) (6)
- ρl - Mass density, kg/m3 (6)
- csound,fluid - Speed of Sound, m/s (6)
- Tc - Critical temperature, K (2)
Mole fraction [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid mixture 2)
- Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mole fraction of 1-Butanol (1) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of 1-Butanol (1) - Liquid mixture 2 |
| 0.0170 | 0.0000 | 0.0000 | 0.4760 |
| 0.0170 | 0.0090 | 0.0170 | 0.4140 |
| 0.0230 | 0.0190 | 0.0430 | 0.3560 |
| 0.0290 | 0.0290 | 0.0640 | 0.2940 |
| 0.0370 | 0.0320 | 0.0700 | 0.2730 |
| 0.0460 | 0.0400 | 0.0780 | 0.2250 |
| 0.0600 | 0.0480 | 0.0790 | 0.1810 |
Mole fraction in LLG critical state of Acetic acid (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 1-Butanol (1) - Liquid | Temperature, K - Liquid | Mole fraction in LLG critical state of Acetic acid (2) - Liquid |
| 0.1090 | 308.15 | 0.0630 |
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.5064 | 0.0000 |
| 293.20 | 0.5362 | 0.0278 |
| 293.20 | 0.5603 | 0.0497 |
| 293.20 | 0.6285 | 0.0739 |
| 293.20 | 0.7013 | 0.0823 |
| 293.20 | 0.7896 | 0.0748 |
| 293.20 | 0.8379 | 0.0661 |
| 293.20 | 0.8954 | 0.0528 |
| 293.20 | 0.9280 | 0.0396 |
| 293.20 | 0.9547 | 0.0218 |
| 293.20 | 0.9798 | 0.0000 |
| 313.20 | 0.5304 | 0.0000 |
| 313.20 | 0.5697 | 0.0307 |
| 313.20 | 0.5925 | 0.0463 |
| 313.20 | 0.6593 | 0.0692 |
| 313.20 | 0.7296 | 0.0745 |
| 313.20 | 0.7663 | 0.0720 |
| 313.20 | 0.8009 | 0.0668 |
| 313.20 | 0.8741 | 0.0538 |
| 313.20 | 0.9267 | 0.0387 |
| 313.20 | 0.9478 | 0.0273 |
| 313.20 | 0.9648 | 0.0154 |
| 313.20 | 0.9829 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9625 | 0.0158 | 0.0542 | 0.5705 |
| 293.20 | 0.9485 | 0.0259 | 0.0698 | 0.6076 |
| 293.20 | 0.9337 | 0.0351 | 0.0786 | 0.6519 |
| 313.20 | 0.9701 | 0.0115 | 0.0236 | 0.5572 |
| 313.20 | 0.9650 | 0.0151 | 0.0463 | 0.5921 |
| 313.20 | 0.9551 | 0.0216 | 0.0715 | 0.6855 |
| 313.20 | 0.9395 | 0.0306 | 0.0731 | 0.7199 |
Mole fraction of Acetic acid (2) [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid mixture 1)
- Temperature, K = 318.15 (Liquid mixture 1)
| Mole fraction of 1-Butanol (1) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
|---|---|
| 0.4210 | 0.0280 |
| 0.4120 | 0.0340 |
| 0.3850 | 0.0440 |
| 0.3520 | 0.0550 |
| 0.3150 | 0.0650 |
| 0.2860 | 0.0710 |
| 0.2580 | 0.0720 |
| 0.2410 | 0.0740 |
| 0.2160 | 0.0760 |
| 0.1800 | 0.0740 |
| 0.1630 | 0.0720 |
| 0.1440 | 0.0690 |
| 0.1190 | 0.0640 |
| 0.1190 | 0.0640 |
| 0.1030 | 0.0600 |
| 0.0880 | 0.0570 |
| 0.0770 | 0.0550 |
Mole fraction [ref]
Operational conditions:
- Temperature, K = 318.15 (Liquid mixture 1)
- Pressure, kPa = 101.3 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of 1-Butanol (1) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of 1-Butanol (1) - Liquid mixture 1 |
| 0.0080 | 0.0230 | 0.0250 | 0.4180 |
| 0.0180 | 0.0330 | 0.0560 | 0.3230 |
| 0.0270 | 0.0470 | 0.0650 | 0.2630 |
Mole fraction [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid mixture 2)
- Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mole fraction of 1-Butanol (1) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of 1-Butanol (1) - Liquid mixture 2 |
| 0.0170 | 0.0000 | 0.0000 | 0.4760 |
| 0.0170 | 0.0090 | 0.0170 | 0.4140 |
| 0.0230 | 0.0190 | 0.0430 | 0.3560 |
| 0.0290 | 0.0290 | 0.0640 | 0.2940 |
| 0.0370 | 0.0320 | 0.0700 | 0.2730 |
| 0.0460 | 0.0400 | 0.0780 | 0.2250 |
| 0.0600 | 0.0480 | 0.0790 | 0.1810 |
Mole fraction in LLG critical state of Acetic acid (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 1-Butanol (1) - Liquid | Temperature, K - Liquid | Mole fraction in LLG critical state of Acetic acid (2) - Liquid |
| 0.1090 | 308.15 | 0.0630 |
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.5064 | 0.0000 |
| 293.20 | 0.5362 | 0.0278 |
| 293.20 | 0.5603 | 0.0497 |
| 293.20 | 0.6285 | 0.0739 |
| 293.20 | 0.7013 | 0.0823 |
| 293.20 | 0.7896 | 0.0748 |
| 293.20 | 0.8379 | 0.0661 |
| 293.20 | 0.8954 | 0.0528 |
| 293.20 | 0.9280 | 0.0396 |
| 293.20 | 0.9547 | 0.0218 |
| 293.20 | 0.9798 | 0.0000 |
| 313.20 | 0.5304 | 0.0000 |
| 313.20 | 0.5697 | 0.0307 |
| 313.20 | 0.5925 | 0.0463 |
| 313.20 | 0.6593 | 0.0692 |
| 313.20 | 0.7296 | 0.0745 |
| 313.20 | 0.7663 | 0.0720 |
| 313.20 | 0.8009 | 0.0668 |
| 313.20 | 0.8741 | 0.0538 |
| 313.20 | 0.9267 | 0.0387 |
| 313.20 | 0.9478 | 0.0273 |
| 313.20 | 0.9648 | 0.0154 |
| 313.20 | 0.9829 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9625 | 0.0158 | 0.0542 | 0.5705 |
| 293.20 | 0.9485 | 0.0259 | 0.0698 | 0.6076 |
| 293.20 | 0.9337 | 0.0351 | 0.0786 | 0.6519 |
| 313.20 | 0.9701 | 0.0115 | 0.0236 | 0.5572 |
| 313.20 | 0.9650 | 0.0151 | 0.0463 | 0.5921 |
| 313.20 | 0.9551 | 0.0216 | 0.0715 | 0.6855 |
| 313.20 | 0.9395 | 0.0306 | 0.0731 | 0.7199 |
Mole fraction of Acetic acid (2) [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid mixture 1)
- Temperature, K = 318.15 (Liquid mixture 1)
| Mole fraction of 1-Butanol (1) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
|---|---|
| 0.4210 | 0.0280 |
| 0.4120 | 0.0340 |
| 0.3850 | 0.0440 |
| 0.3520 | 0.0550 |
| 0.3150 | 0.0650 |
| 0.2860 | 0.0710 |
| 0.2580 | 0.0720 |
| 0.2410 | 0.0740 |
| 0.2160 | 0.0760 |
| 0.1800 | 0.0740 |
| 0.1630 | 0.0720 |
| 0.1440 | 0.0690 |
| 0.1190 | 0.0640 |
| 0.1190 | 0.0640 |
| 0.1030 | 0.0600 |
| 0.0880 | 0.0570 |
| 0.0770 | 0.0550 |
Mole fraction [ref]
Operational conditions:
- Temperature, K = 318.15 (Liquid mixture 1)
- Pressure, kPa = 101.3 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of 1-Butanol (1) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of 1-Butanol (1) - Liquid mixture 1 |
| 0.0080 | 0.0230 | 0.0250 | 0.4180 |
| 0.0180 | 0.0330 | 0.0560 | 0.3230 |
| 0.0270 | 0.0470 | 0.0650 | 0.2630 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.5064 | 1.3907 |
| 293.20 | 0.5362 | 1.3889 |
| 293.20 | 0.5603 | 1.3907 |
| 293.20 | 0.6285 | 1.3833 |
| 293.20 | 0.7013 | 1.3784 |
| 293.20 | 0.7896 | 1.3637 |
| 293.20 | 0.8379 | 1.3654 |
| 293.20 | 0.8954 | 1.3575 |
| 293.20 | 0.9280 | 1.3515 |
| 293.20 | 0.9547 | 1.3462 |
| 293.20 | 0.9798 | 1.3413 |
| 313.20 | 0.5304 | 1.3824 |
| 313.20 | 0.5697 | 1.3805 |
| 313.20 | 0.5925 | 1.3792 |
| 313.20 | 0.6593 | 1.3756 |
| 313.20 | 0.7296 | 1.3492 |
| 313.20 | 0.7663 | 1.3539 |
| 313.20 | 0.8009 | 1.3513 |
| 313.20 | 0.8741 | 1.3525 |
| 313.20 | 0.9267 | 1.3471 |
| 313.20 | 0.9478 | 1.3435 |
| 313.20 | 0.9648 | 1.3396 |
| 313.20 | 0.9829 | 1.3366 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.5705 | 1.3872 |
| 293.20 | 0.6076 | 1.3849 |
| 293.20 | 0.6519 | 1.382 |
| 313.20 | 0.5572 | 1.3808 |
| 313.20 | 0.5921 | 1.3793 |
| 313.20 | 0.6855 | 1.3434 |
| 313.20 | 0.7199 | 1.3467 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9625 | 1.3449 |
| 293.20 | 0.9485 | 1.3473 |
| 293.20 | 0.9337 | 1.3502 |
| 313.20 | 0.9701 | 1.3387 |
| 313.20 | 0.9650 | 1.3404 |
| 313.20 | 0.9551 | 1.3427 |
| 313.20 | 0.9395 | 1.3456 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.5064 | 1.3907 |
| 293.20 | 0.5362 | 1.3889 |
| 293.20 | 0.5603 | 1.3907 |
| 293.20 | 0.6285 | 1.3833 |
| 293.20 | 0.7013 | 1.3784 |
| 293.20 | 0.7896 | 1.3637 |
| 293.20 | 0.8379 | 1.3654 |
| 293.20 | 0.8954 | 1.3575 |
| 293.20 | 0.9280 | 1.3515 |
| 293.20 | 0.9547 | 1.3462 |
| 293.20 | 0.9798 | 1.3413 |
| 313.20 | 0.5304 | 1.3824 |
| 313.20 | 0.5697 | 1.3805 |
| 313.20 | 0.5925 | 1.3792 |
| 313.20 | 0.6593 | 1.3756 |
| 313.20 | 0.7296 | 1.3492 |
| 313.20 | 0.7663 | 1.3539 |
| 313.20 | 0.8009 | 1.3513 |
| 313.20 | 0.8741 | 1.3525 |
| 313.20 | 0.9267 | 1.3471 |
| 313.20 | 0.9478 | 1.3435 |
| 313.20 | 0.9648 | 1.3396 |
| 313.20 | 0.9829 | 1.3366 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.5705 | 1.3872 |
| 293.20 | 0.6076 | 1.3849 |
| 293.20 | 0.6519 | 1.382 |
| 313.20 | 0.5572 | 1.3808 |
| 313.20 | 0.5921 | 1.3793 |
| 313.20 | 0.6855 | 1.3434 |
| 313.20 | 0.7199 | 1.3467 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9625 | 1.3449 |
| 293.20 | 0.9485 | 1.3473 |
| 293.20 | 0.9337 | 1.3502 |
| 313.20 | 0.9701 | 1.3387 |
| 313.20 | 0.9650 | 1.3404 |
| 313.20 | 0.9551 | 1.3427 |
| 313.20 | 0.9395 | 1.3456 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.5064 | 846.409 |
| 293.20 | 0.5362 | 857.712 |
| 293.20 | 0.5603 | 862.217 |
| 293.20 | 0.6285 | 892.724 |
| 293.20 | 0.7013 | 916.132 |
| 293.20 | 0.7896 | 943.915 |
| 293.20 | 0.8379 | 960.824 |
| 293.20 | 0.8954 | 984.207 |
| 293.20 | 0.9280 | 993.68 |
| 293.20 | 0.9547 | 994.076 |
| 293.20 | 0.9798 | 987.014 |
| 313.20 | 0.5304 | 833.784 |
| 313.20 | 0.5697 | 848.984 |
| 313.20 | 0.5925 | 858.013 |
| 313.20 | 0.6593 | 882.34 |
| 313.20 | 0.7296 | 904.503 |
| 313.20 | 0.7663 | 917.44 |
| 313.20 | 0.8009 | 917.315 |
| 313.20 | 0.8741 | 954.638 |
| 313.20 | 0.9267 | 980.205 |
| 313.20 | 0.9478 | 984.892 |
| 313.20 | 0.9648 | 984.937 |
| 313.20 | 0.9829 | 981.412 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.5705 | 869.833 |
| 293.20 | 0.6076 | 883.627 |
| 293.20 | 0.6519 | 899.498 |
| 313.20 | 0.5572 | 844.584 |
| 313.20 | 0.5921 | 856.962 |
| 313.20 | 0.6855 | 872.064 |
| 313.20 | 0.7199 | 890.5 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9625 | 992.709 |
| 293.20 | 0.9485 | 994.732 |
| 293.20 | 0.9337 | 994.738 |
| 313.20 | 0.9701 | 982.487 |
| 313.20 | 0.9650 | 984.773 |
| 313.20 | 0.9551 | 985.513 |
| 313.20 | 0.9395 | 983.895 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.5064 | 846.409 |
| 293.20 | 0.5362 | 857.712 |
| 293.20 | 0.5603 | 862.217 |
| 293.20 | 0.6285 | 892.724 |
| 293.20 | 0.7013 | 916.132 |
| 293.20 | 0.7896 | 943.915 |
| 293.20 | 0.8379 | 960.824 |
| 293.20 | 0.8954 | 984.207 |
| 293.20 | 0.9280 | 993.68 |
| 293.20 | 0.9547 | 994.076 |
| 293.20 | 0.9798 | 987.014 |
| 313.20 | 0.5304 | 833.784 |
| 313.20 | 0.5697 | 848.984 |
| 313.20 | 0.5925 | 858.013 |
| 313.20 | 0.6593 | 882.34 |
| 313.20 | 0.7296 | 904.503 |
| 313.20 | 0.7663 | 917.44 |
| 313.20 | 0.8009 | 917.315 |
| 313.20 | 0.8741 | 954.638 |
| 313.20 | 0.9267 | 980.205 |
| 313.20 | 0.9478 | 984.892 |
| 313.20 | 0.9648 | 984.937 |
| 313.20 | 0.9829 | 981.412 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.5705 | 869.833 |
| 293.20 | 0.6076 | 883.627 |
| 293.20 | 0.6519 | 899.498 |
| 313.20 | 0.5572 | 844.584 |
| 313.20 | 0.5921 | 856.962 |
| 313.20 | 0.6855 | 872.064 |
| 313.20 | 0.7199 | 890.5 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9625 | 992.709 |
| 293.20 | 0.9485 | 994.732 |
| 293.20 | 0.9337 | 994.738 |
| 313.20 | 0.9701 | 982.487 |
| 313.20 | 0.9650 | 984.773 |
| 313.20 | 0.9551 | 985.513 |
| 313.20 | 0.9395 | 983.895 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.5064 | 1314.68 |
| 293.20 | 0.5362 | 1320.64 |
| 293.20 | 0.5603 | 1323.52 |
| 293.20 | 0.6285 | 1343.3 |
| 293.20 | 0.7013 | 1367.28 |
| 293.20 | 0.7896 | 1406.91 |
| 293.20 | 0.8379 | 1438.88 |
| 293.20 | 0.8954 | 1494.77 |
| 293.20 | 0.9280 | 1528.52 |
| 293.20 | 0.9547 | 1547.22 |
| 293.20 | 0.9798 | 1549.53 |
| 313.20 | 0.5304 | 1259.34 |
| 313.20 | 0.5697 | 1269.46 |
| 313.20 | 0.5925 | 1274.68 |
| 313.20 | 0.6593 | 1298.19 |
| 313.20 | 0.7296 | 1323.76 |
| 313.20 | 0.7663 | 1340.98 |
| 313.20 | 0.8009 | 1341.48 |
| 313.20 | 0.8741 | 1462.55 |
| 313.20 | 0.9267 | 1516.1 |
| 313.20 | 0.9478 | 1540.35 |
| 313.20 | 0.9648 | 1555.5 |
| 313.20 | 0.9829 | 1562.51 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.5705 | 1326.44 |
| 293.20 | 0.6076 | 1335.71 |
| 293.20 | 0.6519 | 1349.08 |
| 313.20 | 0.5572 | 1263.86 |
| 313.20 | 0.5921 | 1273.46 |
| 313.20 | 0.6855 | 1286.22 |
| 313.20 | 0.7199 | 1299.55 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9625 | 1549.23 |
| 293.20 | 0.9485 | 1544.26 |
| 293.20 | 0.9337 | 1534.02 |
| 313.20 | 0.9701 | 1558.46 |
| 313.20 | 0.9650 | 1554.23 |
| 313.20 | 0.9551 | 1544.16 |
| 313.20 | 0.9395 | 1527.23 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.5064 | 1314.68 |
| 293.20 | 0.5362 | 1320.64 |
| 293.20 | 0.5603 | 1323.52 |
| 293.20 | 0.6285 | 1343.3 |
| 293.20 | 0.7013 | 1367.28 |
| 293.20 | 0.7896 | 1406.91 |
| 293.20 | 0.8379 | 1438.88 |
| 293.20 | 0.8954 | 1494.77 |
| 293.20 | 0.9280 | 1528.52 |
| 293.20 | 0.9547 | 1547.22 |
| 293.20 | 0.9798 | 1549.53 |
| 313.20 | 0.5304 | 1259.34 |
| 313.20 | 0.5697 | 1269.46 |
| 313.20 | 0.5925 | 1274.68 |
| 313.20 | 0.6593 | 1298.19 |
| 313.20 | 0.7296 | 1323.76 |
| 313.20 | 0.7663 | 1340.98 |
| 313.20 | 0.8009 | 1341.48 |
| 313.20 | 0.8741 | 1462.55 |
| 313.20 | 0.9267 | 1516.1 |
| 313.20 | 0.9478 | 1540.35 |
| 313.20 | 0.9648 | 1555.5 |
| 313.20 | 0.9829 | 1562.51 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.5705 | 1326.44 |
| 293.20 | 0.6076 | 1335.71 |
| 293.20 | 0.6519 | 1349.08 |
| 313.20 | 0.5572 | 1263.86 |
| 313.20 | 0.5921 | 1273.46 |
| 313.20 | 0.6855 | 1286.22 |
| 313.20 | 0.7199 | 1299.55 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9625 | 1549.23 |
| 293.20 | 0.9485 | 1544.26 |
| 293.20 | 0.9337 | 1534.02 |
| 313.20 | 0.9701 | 1558.46 |
| 313.20 | 0.9650 | 1554.23 |
| 313.20 | 0.9551 | 1544.16 |
| 313.20 | 0.9395 | 1527.23 |
Critical temperature, K [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Acetic acid (2) - Liquid | Mole fraction of 1-Butanol (1) - Liquid | Critical temperature, K - Liquid |
| 0.0630 | 0.1000 | 318.15 |
Critical temperature, K [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Acetic acid (2) - Liquid | Mole fraction of 1-Butanol (1) - Liquid | Critical temperature, K - Liquid |
| 0.0630 | 0.1000 | 318.15 |
Sources
- Liquid-liquid equilibrium and critical states for the system acetic acid + n-butanol + n-butyl acetate + water at 308.15 K
- Liquid-liquid equilibrium data and thermophysical properties for ternary systems composed of water, acetic acid and different solvents
- Quaternary liquid-liquid equilibrium, solubility and critical states: Acetic acid - n-butanol - n-butyl acetate - water at 318.15 K and atmospheric pressure