- Name
- 4-Heptanone, 2,6-dimethyl-
- InChI
- InChI=1S/C9H18O/c1-7(2)5-9(10)6-8(3)4/h7-8H,5-6H2,1-4H3
- InChI Key
- PTTPXKJBFFKCEK-UHFFFAOYSA-N
- Formula
- C9H18O
- SMILES
- CC(C)CC(=O)CC(C)C
- Mol. Weight (g/mol)
- 142.24
- CAS
- 108-83-8
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (4)
- n0 - Refractive index (Na D-line) (6)
- ρl - Mass density, kg/m3 (6)
- csound,fluid - Speed of Sound, m/s (6)
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.0148 | 0.0000 |
| 293.20 | 0.1494 | 0.2782 |
| 293.20 | 0.2434 | 0.3855 |
| 293.20 | 0.2937 | 0.4204 |
| 293.20 | 0.3416 | 0.4367 |
| 293.20 | 0.3894 | 0.4339 |
| 293.20 | 0.4563 | 0.4210 |
| 293.20 | 0.4848 | 0.4209 |
| 293.20 | 0.5085 | 0.4147 |
| 293.20 | 0.5334 | 0.4035 |
| 293.20 | 0.6115 | 0.3638 |
| 293.20 | 0.6726 | 0.3153 |
| 293.20 | 0.7343 | 0.2593 |
| 293.20 | 0.7611 | 0.2343 |
| 293.20 | 0.8041 | 0.1937 |
| 293.20 | 0.8414 | 0.1573 |
| 293.20 | 0.8907 | 0.1086 |
| 293.20 | 0.9163 | 0.0832 |
| 293.20 | 0.9438 | 0.0559 |
| 293.20 | 0.9700 | 0.0297 |
| 293.20 | 0.9998 | 0.0000 |
| 313.20 | 0.0277 | 0.0000 |
| 313.20 | 0.1022 | 0.1667 |
| 313.20 | 0.1794 | 0.2718 |
| 313.20 | 0.2169 | 0.3391 |
| 313.20 | 0.2475 | 0.3739 |
| 313.20 | 0.3105 | 0.4128 |
| 313.20 | 0.3570 | 0.4254 |
| 313.20 | 0.3938 | 0.4308 |
| 313.20 | 0.4635 | 0.4159 |
| 313.20 | 0.5252 | 0.4010 |
| 313.20 | 0.6102 | 0.3606 |
| 313.20 | 0.6669 | 0.3184 |
| 313.20 | 0.7355 | 0.2579 |
| 313.20 | 0.8049 | 0.1925 |
| 313.20 | 0.8468 | 0.1519 |
| 313.20 | 0.8926 | 0.1065 |
| 313.20 | 0.9167 | 0.0828 |
| 313.20 | 0.9426 | 0.0571 |
| 313.20 | 0.9706 | 0.0291 |
| 313.20 | 0.9997 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.9336 | 0.0650 | 0.0665 | 0.1247 |
| 293.20 | 0.8763 | 0.1200 | 0.0806 | 0.1532 |
| 293.20 | 0.8266 | 0.1687 | 0.1056 | 0.1998 |
| 293.20 | 0.7770 | 0.2169 | 0.1468 | 0.2666 |
| 293.20 | 0.7324 | 0.2589 | 0.1830 | 0.3153 |
| 293.20 | 0.6866 | 0.2997 | 0.2426 | 0.3768 |
| 313.20 | 0.9477 | 0.0488 | 0.0710 | 0.1019 |
| 313.20 | 0.8922 | 0.1031 | 0.1009 | 0.1621 |
| 313.20 | 0.8347 | 0.1606 | 0.1308 | 0.2155 |
| 313.20 | 0.7824 | 0.2122 | 0.1620 | 0.2642 |
| 313.20 | 0.7265 | 0.2649 | 0.2045 | 0.3196 |
| 313.20 | 0.6706 | 0.3134 | 0.2475 | 0.3634 |
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.0148 | 0.0000 |
| 293.20 | 0.1494 | 0.2782 |
| 293.20 | 0.2434 | 0.3855 |
| 293.20 | 0.2937 | 0.4204 |
| 293.20 | 0.3416 | 0.4367 |
| 293.20 | 0.3894 | 0.4339 |
| 293.20 | 0.4563 | 0.4210 |
| 293.20 | 0.4848 | 0.4209 |
| 293.20 | 0.5085 | 0.4147 |
| 293.20 | 0.5334 | 0.4035 |
| 293.20 | 0.6115 | 0.3638 |
| 293.20 | 0.6726 | 0.3153 |
| 293.20 | 0.7343 | 0.2593 |
| 293.20 | 0.7611 | 0.2343 |
| 293.20 | 0.8041 | 0.1937 |
| 293.20 | 0.8414 | 0.1573 |
| 293.20 | 0.8907 | 0.1086 |
| 293.20 | 0.9163 | 0.0832 |
| 293.20 | 0.9438 | 0.0559 |
| 293.20 | 0.9700 | 0.0297 |
| 293.20 | 0.9998 | 0.0000 |
| 313.20 | 0.0277 | 0.0000 |
| 313.20 | 0.1022 | 0.1667 |
| 313.20 | 0.1794 | 0.2718 |
| 313.20 | 0.2169 | 0.3391 |
| 313.20 | 0.2475 | 0.3739 |
| 313.20 | 0.3105 | 0.4128 |
| 313.20 | 0.3570 | 0.4254 |
| 313.20 | 0.3938 | 0.4308 |
| 313.20 | 0.4635 | 0.4159 |
| 313.20 | 0.5252 | 0.4010 |
| 313.20 | 0.6102 | 0.3606 |
| 313.20 | 0.6669 | 0.3184 |
| 313.20 | 0.7355 | 0.2579 |
| 313.20 | 0.8049 | 0.1925 |
| 313.20 | 0.8468 | 0.1519 |
| 313.20 | 0.8926 | 0.1065 |
| 313.20 | 0.9167 | 0.0828 |
| 313.20 | 0.9426 | 0.0571 |
| 313.20 | 0.9706 | 0.0291 |
| 313.20 | 0.9997 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.9336 | 0.0650 | 0.0665 | 0.1247 |
| 293.20 | 0.8763 | 0.1200 | 0.0806 | 0.1532 |
| 293.20 | 0.8266 | 0.1687 | 0.1056 | 0.1998 |
| 293.20 | 0.7770 | 0.2169 | 0.1468 | 0.2666 |
| 293.20 | 0.7324 | 0.2589 | 0.1830 | 0.3153 |
| 293.20 | 0.6866 | 0.2997 | 0.2426 | 0.3768 |
| 313.20 | 0.9477 | 0.0488 | 0.0710 | 0.1019 |
| 313.20 | 0.8922 | 0.1031 | 0.1009 | 0.1621 |
| 313.20 | 0.8347 | 0.1606 | 0.1308 | 0.2155 |
| 313.20 | 0.7824 | 0.2122 | 0.1620 | 0.2642 |
| 313.20 | 0.7265 | 0.2649 | 0.2045 | 0.3196 |
| 313.20 | 0.6706 | 0.3134 | 0.2475 | 0.3634 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0148 | 1.4139 |
| 293.20 | 0.1494 | 1.408 |
| 293.20 | 0.2434 | 1.3721 |
| 293.20 | 0.2937 | 1.3765 |
| 293.20 | 0.3416 | 1.3753 |
| 293.20 | 0.3894 | 1.3813 |
| 293.20 | 0.4563 | 1.3816 |
| 293.20 | 0.4848 | 1.3815 |
| 293.20 | 0.5085 | 1.3809 |
| 293.20 | 0.5334 | 1.383 |
| 293.20 | 0.6115 | 1.3761 |
| 293.20 | 0.6726 | 1.373 |
| 293.20 | 0.7343 | 1.3691 |
| 293.20 | 0.7611 | 1.3676 |
| 293.20 | 0.8041 | 1.3632 |
| 293.20 | 0.8414 | 1.3594 |
| 293.20 | 0.8907 | 1.3533 |
| 293.20 | 0.9163 | 1.3495 |
| 293.20 | 0.9438 | 1.3449 |
| 293.20 | 0.9700 | 1.3397 |
| 293.20 | 0.9998 | 1.3331 |
| 313.20 | 0.0277 | 1.405 |
| 313.20 | 0.1022 | 1.4021 |
| 313.20 | 0.1794 | 1.3992 |
| 313.20 | 0.2169 | 1.3961 |
| 313.20 | 0.2475 | 1.3851 |
| 313.20 | 0.3105 | 1.3839 |
| 313.20 | 0.3570 | 1.3787 |
| 313.20 | 0.3938 | 1.3746 |
| 313.20 | 0.4635 | 1.3775 |
| 313.20 | 0.5252 | 1.3774 |
| 313.20 | 0.6102 | 1.3711 |
| 313.20 | 0.6669 | 1.3673 |
| 313.20 | 0.7355 | 1.3628 |
| 313.20 | 0.8049 | 1.3574 |
| 313.20 | 0.8468 | 1.3534 |
| 313.20 | 0.8926 | 1.3483 |
| 313.20 | 0.9167 | 1.3452 |
| 313.20 | 0.9426 | 1.3413 |
| 313.20 | 0.9706 | 1.3366 |
| 313.20 | 0.9997 | 1.3306 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0665 | 1.4143 |
| 293.20 | 0.0806 | 1.4109 |
| 293.20 | 0.1056 | 1.4093 |
| 293.20 | 0.1468 | 1.4071 |
| 293.20 | 0.1830 | 1.3927 |
| 293.20 | 0.2426 | 1.3829 |
| 313.20 | 0.0710 | 1.4036 |
| 313.20 | 0.1009 | 1.402 |
| 313.20 | 0.1308 | 1.4003 |
| 313.20 | 0.1620 | 1.3986 |
| 313.20 | 0.2045 | 1.3962 |
| 313.20 | 0.2475 | 1.3938 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9336 | 1.3453 |
| 293.20 | 0.8763 | 1.3537 |
| 293.20 | 0.8266 | 1.3599 |
| 293.20 | 0.7770 | 1.3653 |
| 293.20 | 0.7324 | 1.3698 |
| 293.20 | 0.6866 | 1.3732 |
| 313.20 | 0.9477 | 1.3413 |
| 313.20 | 0.8922 | 1.3489 |
| 313.20 | 0.8347 | 1.3546 |
| 313.20 | 0.7824 | 1.359 |
| 313.20 | 0.7265 | 1.3633 |
| 313.20 | 0.6706 | 1.367 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0148 | 1.4139 |
| 293.20 | 0.1494 | 1.408 |
| 293.20 | 0.2434 | 1.3721 |
| 293.20 | 0.2937 | 1.3765 |
| 293.20 | 0.3416 | 1.3753 |
| 293.20 | 0.3894 | 1.3813 |
| 293.20 | 0.4563 | 1.3816 |
| 293.20 | 0.4848 | 1.3815 |
| 293.20 | 0.5085 | 1.3809 |
| 293.20 | 0.5334 | 1.383 |
| 293.20 | 0.6115 | 1.3761 |
| 293.20 | 0.6726 | 1.373 |
| 293.20 | 0.7343 | 1.3691 |
| 293.20 | 0.7611 | 1.3676 |
| 293.20 | 0.8041 | 1.3632 |
| 293.20 | 0.8414 | 1.3594 |
| 293.20 | 0.8907 | 1.3533 |
| 293.20 | 0.9163 | 1.3495 |
| 293.20 | 0.9438 | 1.3449 |
| 293.20 | 0.9700 | 1.3397 |
| 293.20 | 0.9998 | 1.3331 |
| 313.20 | 0.0277 | 1.405 |
| 313.20 | 0.1022 | 1.4021 |
| 313.20 | 0.1794 | 1.3992 |
| 313.20 | 0.2169 | 1.3961 |
| 313.20 | 0.2475 | 1.3851 |
| 313.20 | 0.3105 | 1.3839 |
| 313.20 | 0.3570 | 1.3787 |
| 313.20 | 0.3938 | 1.3746 |
| 313.20 | 0.4635 | 1.3775 |
| 313.20 | 0.5252 | 1.3774 |
| 313.20 | 0.6102 | 1.3711 |
| 313.20 | 0.6669 | 1.3673 |
| 313.20 | 0.7355 | 1.3628 |
| 313.20 | 0.8049 | 1.3574 |
| 313.20 | 0.8468 | 1.3534 |
| 313.20 | 0.8926 | 1.3483 |
| 313.20 | 0.9167 | 1.3452 |
| 313.20 | 0.9426 | 1.3413 |
| 313.20 | 0.9706 | 1.3366 |
| 313.20 | 0.9997 | 1.3306 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0665 | 1.4143 |
| 293.20 | 0.0806 | 1.4109 |
| 293.20 | 0.1056 | 1.4093 |
| 293.20 | 0.1468 | 1.4071 |
| 293.20 | 0.1830 | 1.3927 |
| 293.20 | 0.2426 | 1.3829 |
| 313.20 | 0.0710 | 1.4036 |
| 313.20 | 0.1009 | 1.402 |
| 313.20 | 0.1308 | 1.4003 |
| 313.20 | 0.1620 | 1.3986 |
| 313.20 | 0.2045 | 1.3962 |
| 313.20 | 0.2475 | 1.3938 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9336 | 1.3453 |
| 293.20 | 0.8763 | 1.3537 |
| 293.20 | 0.8266 | 1.3599 |
| 293.20 | 0.7770 | 1.3653 |
| 293.20 | 0.7324 | 1.3698 |
| 293.20 | 0.6866 | 1.3732 |
| 313.20 | 0.9477 | 1.3413 |
| 313.20 | 0.8922 | 1.3489 |
| 313.20 | 0.8347 | 1.3546 |
| 313.20 | 0.7824 | 1.359 |
| 313.20 | 0.7265 | 1.3633 |
| 313.20 | 0.6706 | 1.367 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0148 | 809.017 |
| 293.20 | 0.1494 | 846.156 |
| 293.20 | 0.2434 | 878.416 |
| 293.20 | 0.2937 | 898.501 |
| 293.20 | 0.3416 | 918.124 |
| 293.20 | 0.3894 | 933.5 |
| 293.20 | 0.4563 | 938.985 |
| 293.20 | 0.4848 | 978.641 |
| 293.20 | 0.5085 | 990.43 |
| 293.20 | 0.5334 | 997.474 |
| 293.20 | 0.6115 | 1033.458 |
| 293.20 | 0.6726 | 1046.645 |
| 293.20 | 0.7343 | 1050.619 |
| 293.20 | 0.7611 | 1050.853 |
| 293.20 | 0.8041 | 1049.334 |
| 293.20 | 0.8414 | 1045.099 |
| 293.20 | 0.8907 | 1036.182 |
| 293.20 | 0.9163 | 1029.672 |
| 293.20 | 0.9438 | 1021.215 |
| 293.20 | 0.9700 | 1011.317 |
| 293.20 | 0.9998 | 998.196 |
| 313.20 | 0.0277 | 792.715 |
| 313.20 | 0.1022 | 811.055 |
| 313.20 | 0.1794 | 829.654 |
| 313.20 | 0.2169 | 845.9 |
| 313.20 | 0.2475 | 858.18 |
| 313.20 | 0.3105 | 882.06 |
| 313.20 | 0.3570 | 898.919 |
| 313.20 | 0.3938 | 912.394 |
| 313.20 | 0.4635 | 922.804 |
| 313.20 | 0.5252 | 966.45 |
| 313.20 | 0.6102 | 1009.449 |
| 313.20 | 0.6669 | 1024.844 |
| 313.20 | 0.7355 | 1032.761 |
| 313.20 | 0.8049 | 1033.02 |
| 313.20 | 0.8468 | 1029.583 |
| 313.20 | 0.8926 | 1022.973 |
| 313.20 | 0.9167 | 1018.104 |
| 313.20 | 0.9426 | 1011.468 |
| 313.20 | 0.9706 | 1003.207 |
| 313.20 | 0.9997 | 992.231 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0665 | 819.522 |
| 293.20 | 0.0806 | 828.076 |
| 293.20 | 0.1056 | 838.445 |
| 293.20 | 0.1468 | 851.13 |
| 293.20 | 0.1830 | 864.145 |
| 293.20 | 0.2426 | 884.17 |
| 313.20 | 0.0710 | 801.872 |
| 313.20 | 0.1009 | 811.259 |
| 313.20 | 0.1308 | 821.059 |
| 313.20 | 0.1620 | 831.447 |
| 313.20 | 0.2045 | 845.797 |
| 313.20 | 0.2475 | 861.594 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9336 | 1021.728 |
| 293.20 | 0.8763 | 1036.563 |
| 293.20 | 0.8266 | 1045.501 |
| 293.20 | 0.7770 | 1050.348 |
| 293.20 | 0.7324 | 1050.282 |
| 293.20 | 0.6866 | 1045.752 |
| 313.20 | 0.9477 | 1011.493 |
| 313.20 | 0.8922 | 1023.617 |
| 313.20 | 0.8347 | 1030.623 |
| 313.20 | 0.7824 | 1033.214 |
| 313.20 | 0.7265 | 1030.038 |
| 313.20 | 0.6706 | 1024.763 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0148 | 809.017 |
| 293.20 | 0.1494 | 846.156 |
| 293.20 | 0.2434 | 878.416 |
| 293.20 | 0.2937 | 898.501 |
| 293.20 | 0.3416 | 918.124 |
| 293.20 | 0.3894 | 933.5 |
| 293.20 | 0.4563 | 938.985 |
| 293.20 | 0.4848 | 978.641 |
| 293.20 | 0.5085 | 990.43 |
| 293.20 | 0.5334 | 997.474 |
| 293.20 | 0.6115 | 1033.458 |
| 293.20 | 0.6726 | 1046.645 |
| 293.20 | 0.7343 | 1050.619 |
| 293.20 | 0.7611 | 1050.853 |
| 293.20 | 0.8041 | 1049.334 |
| 293.20 | 0.8414 | 1045.099 |
| 293.20 | 0.8907 | 1036.182 |
| 293.20 | 0.9163 | 1029.672 |
| 293.20 | 0.9438 | 1021.215 |
| 293.20 | 0.9700 | 1011.317 |
| 293.20 | 0.9998 | 998.196 |
| 313.20 | 0.0277 | 792.715 |
| 313.20 | 0.1022 | 811.055 |
| 313.20 | 0.1794 | 829.654 |
| 313.20 | 0.2169 | 845.9 |
| 313.20 | 0.2475 | 858.18 |
| 313.20 | 0.3105 | 882.06 |
| 313.20 | 0.3570 | 898.919 |
| 313.20 | 0.3938 | 912.394 |
| 313.20 | 0.4635 | 922.804 |
| 313.20 | 0.5252 | 966.45 |
| 313.20 | 0.6102 | 1009.449 |
| 313.20 | 0.6669 | 1024.844 |
| 313.20 | 0.7355 | 1032.761 |
| 313.20 | 0.8049 | 1033.02 |
| 313.20 | 0.8468 | 1029.583 |
| 313.20 | 0.8926 | 1022.973 |
| 313.20 | 0.9167 | 1018.104 |
| 313.20 | 0.9426 | 1011.468 |
| 313.20 | 0.9706 | 1003.207 |
| 313.20 | 0.9997 | 992.231 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0665 | 819.522 |
| 293.20 | 0.0806 | 828.076 |
| 293.20 | 0.1056 | 838.445 |
| 293.20 | 0.1468 | 851.13 |
| 293.20 | 0.1830 | 864.145 |
| 293.20 | 0.2426 | 884.17 |
| 313.20 | 0.0710 | 801.872 |
| 313.20 | 0.1009 | 811.259 |
| 313.20 | 0.1308 | 821.059 |
| 313.20 | 0.1620 | 831.447 |
| 313.20 | 0.2045 | 845.797 |
| 313.20 | 0.2475 | 861.594 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9336 | 1021.728 |
| 293.20 | 0.8763 | 1036.563 |
| 293.20 | 0.8266 | 1045.501 |
| 293.20 | 0.7770 | 1050.348 |
| 293.20 | 0.7324 | 1050.282 |
| 293.20 | 0.6866 | 1045.752 |
| 313.20 | 0.9477 | 1011.493 |
| 313.20 | 0.8922 | 1023.617 |
| 313.20 | 0.8347 | 1030.623 |
| 313.20 | 0.7824 | 1033.214 |
| 313.20 | 0.7265 | 1030.038 |
| 313.20 | 0.6706 | 1024.763 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0148 | 1245.51 |
| 293.20 | 0.1494 | 1245.19 |
| 293.20 | 0.2434 | 1250.23 |
| 293.20 | 0.2937 | 1256.44 |
| 293.20 | 0.3416 | 1264.98 |
| 293.20 | 0.3894 | 1272.81 |
| 293.20 | 0.4563 | 1299.19 |
| 293.20 | 0.4848 | 1320.74 |
| 293.20 | 0.5085 | 1331.47 |
| 293.20 | 0.5334 | 1336.02 |
| 293.20 | 0.6115 | 1394.52 |
| 293.20 | 0.6726 | 1435.6 |
| 293.20 | 0.7343 | 1471.26 |
| 293.20 | 0.7611 | 1485.8 |
| 293.20 | 0.8041 | 1507.54 |
| 293.20 | 0.8414 | 1523.0 |
| 293.20 | 0.8907 | 1535.93 |
| 293.20 | 0.9163 | 1536.86 |
| 293.20 | 0.9438 | 1530.79 |
| 293.20 | 0.9700 | 1515.37 |
| 293.20 | 0.9998 | 1483.2 |
| 313.20 | 0.0277 | 1169.52 |
| 313.20 | 0.1022 | 1169.92 |
| 313.20 | 0.1794 | 1172.04 |
| 313.20 | 0.2169 | 1174.97 |
| 313.20 | 0.2475 | 1178.05 |
| 313.20 | 0.3105 | 1187.7 |
| 313.20 | 0.3570 | 1195.83 |
| 313.20 | 0.3938 | 1199.79 |
| 313.20 | 0.4635 | 1213.07 |
| 313.20 | 0.5252 | 1282.0 |
| 313.20 | 0.6102 | 1335.8 |
| 313.20 | 0.6669 | 1379.35 |
| 313.20 | 0.7355 | 1429.4 |
| 313.20 | 0.8049 | 1476.76 |
| 313.20 | 0.8468 | 1503.01 |
| 313.20 | 0.8926 | 1526.86 |
| 313.20 | 0.9167 | 1535.85 |
| 313.20 | 0.9426 | 1541.5 |
| 313.20 | 0.9706 | 1540.69 |
| 313.20 | 0.9997 | 1529.23 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0665 | 1247.56 |
| 293.20 | 0.0806 | 1245.1 |
| 293.20 | 0.1056 | 1244.98 |
| 293.20 | 0.1468 | 1247.97 |
| 293.20 | 0.1830 | 1246.85 |
| 293.20 | 0.2426 | 1250.95 |
| 313.20 | 0.0710 | 1170.33 |
| 313.20 | 0.1009 | 1169.94 |
| 313.20 | 0.1308 | 1169.84 |
| 313.20 | 0.1620 | 1170.67 |
| 313.20 | 0.2045 | 1173.29 |
| 313.20 | 0.2475 | 1176.99 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9336 | 1531.62 |
| 293.20 | 0.8763 | 1535.87 |
| 293.20 | 0.8266 | 1521.86 |
| 293.20 | 0.7770 | 1497.0 |
| 293.20 | 0.7324 | 1469.18 |
| 293.20 | 0.6866 | 1437.51 |
| 313.20 | 0.9477 | 1541.74 |
| 313.20 | 0.8922 | 1525.28 |
| 313.20 | 0.8347 | 1496.72 |
| 313.20 | 0.7824 | 1465.26 |
| 313.20 | 0.7265 | 1424.78 |
| 313.20 | 0.6706 | 1383.93 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0148 | 1245.51 |
| 293.20 | 0.1494 | 1245.19 |
| 293.20 | 0.2434 | 1250.23 |
| 293.20 | 0.2937 | 1256.44 |
| 293.20 | 0.3416 | 1264.98 |
| 293.20 | 0.3894 | 1272.81 |
| 293.20 | 0.4563 | 1299.19 |
| 293.20 | 0.4848 | 1320.74 |
| 293.20 | 0.5085 | 1331.47 |
| 293.20 | 0.5334 | 1336.02 |
| 293.20 | 0.6115 | 1394.52 |
| 293.20 | 0.6726 | 1435.6 |
| 293.20 | 0.7343 | 1471.26 |
| 293.20 | 0.7611 | 1485.8 |
| 293.20 | 0.8041 | 1507.54 |
| 293.20 | 0.8414 | 1523.0 |
| 293.20 | 0.8907 | 1535.93 |
| 293.20 | 0.9163 | 1536.86 |
| 293.20 | 0.9438 | 1530.79 |
| 293.20 | 0.9700 | 1515.37 |
| 293.20 | 0.9998 | 1483.2 |
| 313.20 | 0.0277 | 1169.52 |
| 313.20 | 0.1022 | 1169.92 |
| 313.20 | 0.1794 | 1172.04 |
| 313.20 | 0.2169 | 1174.97 |
| 313.20 | 0.2475 | 1178.05 |
| 313.20 | 0.3105 | 1187.7 |
| 313.20 | 0.3570 | 1195.83 |
| 313.20 | 0.3938 | 1199.79 |
| 313.20 | 0.4635 | 1213.07 |
| 313.20 | 0.5252 | 1282.0 |
| 313.20 | 0.6102 | 1335.8 |
| 313.20 | 0.6669 | 1379.35 |
| 313.20 | 0.7355 | 1429.4 |
| 313.20 | 0.8049 | 1476.76 |
| 313.20 | 0.8468 | 1503.01 |
| 313.20 | 0.8926 | 1526.86 |
| 313.20 | 0.9167 | 1535.85 |
| 313.20 | 0.9426 | 1541.5 |
| 313.20 | 0.9706 | 1540.69 |
| 313.20 | 0.9997 | 1529.23 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0665 | 1247.56 |
| 293.20 | 0.0806 | 1245.1 |
| 293.20 | 0.1056 | 1244.98 |
| 293.20 | 0.1468 | 1247.97 |
| 293.20 | 0.1830 | 1246.85 |
| 293.20 | 0.2426 | 1250.95 |
| 313.20 | 0.0710 | 1170.33 |
| 313.20 | 0.1009 | 1169.94 |
| 313.20 | 0.1308 | 1169.84 |
| 313.20 | 0.1620 | 1170.67 |
| 313.20 | 0.2045 | 1173.29 |
| 313.20 | 0.2475 | 1176.99 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9336 | 1531.62 |
| 293.20 | 0.8763 | 1535.87 |
| 293.20 | 0.8266 | 1521.86 |
| 293.20 | 0.7770 | 1497.0 |
| 293.20 | 0.7324 | 1469.18 |
| 293.20 | 0.6866 | 1437.51 |
| 313.20 | 0.9477 | 1541.74 |
| 313.20 | 0.8922 | 1525.28 |
| 313.20 | 0.8347 | 1496.72 |
| 313.20 | 0.7824 | 1465.26 |
| 313.20 | 0.7265 | 1424.78 |
| 313.20 | 0.6706 | 1383.93 |