- Name
- 1-Butanol, 3-methyl-, propanoate
- InChI
- InChI=1S/C8H16O2/c1-4-8(9)10-6-5-7(2)3/h7H,4-6H2,1-3H3
- InChI Key
- XAOGXQMKWQFZEM-UHFFFAOYSA-N
- Formula
- C8H16O2
- SMILES
- CCC(=O)OCCC(C)C
- Mol. Weight (g/mol)
- 144.21
- CAS
- 105-68-0
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (4)
- n0 - Refractive index (Na D-line) (6)
- ρl - Mass density, kg/m3 (6)
- csound,fluid - Speed of Sound, m/s (6)
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.0142 | 0.0000 |
| 293.20 | 0.1616 | 0.2785 |
| 293.20 | 0.2528 | 0.3717 |
| 293.20 | 0.3047 | 0.4131 |
| 293.20 | 0.3577 | 0.4249 |
| 293.20 | 0.4027 | 0.4239 |
| 293.20 | 0.4384 | 0.4188 |
| 293.20 | 0.4840 | 0.4086 |
| 293.20 | 0.5202 | 0.3979 |
| 293.20 | 0.5707 | 0.3791 |
| 293.20 | 0.6050 | 0.3606 |
| 293.20 | 0.6332 | 0.3420 |
| 293.20 | 0.6881 | 0.2992 |
| 293.20 | 0.7305 | 0.2618 |
| 293.20 | 0.7674 | 0.2281 |
| 293.20 | 0.8039 | 0.1935 |
| 293.20 | 0.8464 | 0.1522 |
| 293.20 | 0.8931 | 0.1062 |
| 293.20 | 0.9165 | 0.0831 |
| 293.20 | 0.9415 | 0.0580 |
| 293.20 | 0.9607 | 0.0390 |
| 293.20 | 0.9998 | 0.0000 |
| 313.20 | 0.0490 | 0.0000 |
| 313.20 | 0.1870 | 0.2730 |
| 313.20 | 0.2636 | 0.3666 |
| 313.20 | 0.3308 | 0.3990 |
| 313.20 | 0.3857 | 0.4065 |
| 313.20 | 0.4265 | 0.4071 |
| 313.20 | 0.4599 | 0.4017 |
| 313.20 | 0.5061 | 0.3904 |
| 313.20 | 0.5389 | 0.3825 |
| 313.20 | 0.6008 | 0.3573 |
| 313.20 | 0.6352 | 0.3366 |
| 313.20 | 0.6725 | 0.3093 |
| 313.20 | 0.7374 | 0.2545 |
| 313.20 | 0.7663 | 0.2281 |
| 313.20 | 0.8020 | 0.1947 |
| 313.20 | 0.8462 | 0.1522 |
| 313.20 | 0.8984 | 0.1008 |
| 313.20 | 0.9165 | 0.0829 |
| 313.20 | 0.9409 | 0.0586 |
| 313.20 | 0.9696 | 0.0299 |
| 313.20 | 0.9997 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9488 | 0.0509 | 0.0975 | 0.0565 |
| 293.20 | 0.8959 | 0.1023 | 0.1654 | 0.0917 |
| 293.20 | 0.8388 | 0.1583 | 0.2276 | 0.1288 |
| 293.20 | 0.7827 | 0.2123 | 0.2850 | 0.1696 |
| 293.20 | 0.7327 | 0.2583 | 0.3358 | 0.2143 |
| 293.20 | 0.6735 | 0.3084 | 0.3786 | 0.2644 |
| 313.20 | 0.9499 | 0.0498 | 0.0853 | 0.0829 |
| 313.20 | 0.9003 | 0.0967 | 0.1482 | 0.1144 |
| 313.20 | 0.8470 | 0.1481 | 0.2073 | 0.1483 |
| 313.20 | 0.7983 | 0.1947 | 0.2567 | 0.1811 |
| 313.20 | 0.7505 | 0.2390 | 0.3046 | 0.2191 |
| 313.20 | 0.6987 | 0.2840 | 0.3512 | 0.2664 |
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.0142 | 0.0000 |
| 293.20 | 0.1616 | 0.2785 |
| 293.20 | 0.2528 | 0.3717 |
| 293.20 | 0.3047 | 0.4131 |
| 293.20 | 0.3577 | 0.4249 |
| 293.20 | 0.4027 | 0.4239 |
| 293.20 | 0.4384 | 0.4188 |
| 293.20 | 0.4840 | 0.4086 |
| 293.20 | 0.5202 | 0.3979 |
| 293.20 | 0.5707 | 0.3791 |
| 293.20 | 0.6050 | 0.3606 |
| 293.20 | 0.6332 | 0.3420 |
| 293.20 | 0.6881 | 0.2992 |
| 293.20 | 0.7305 | 0.2618 |
| 293.20 | 0.7674 | 0.2281 |
| 293.20 | 0.8039 | 0.1935 |
| 293.20 | 0.8464 | 0.1522 |
| 293.20 | 0.8931 | 0.1062 |
| 293.20 | 0.9165 | 0.0831 |
| 293.20 | 0.9415 | 0.0580 |
| 293.20 | 0.9607 | 0.0390 |
| 293.20 | 0.9998 | 0.0000 |
| 313.20 | 0.0490 | 0.0000 |
| 313.20 | 0.1870 | 0.2730 |
| 313.20 | 0.2636 | 0.3666 |
| 313.20 | 0.3308 | 0.3990 |
| 313.20 | 0.3857 | 0.4065 |
| 313.20 | 0.4265 | 0.4071 |
| 313.20 | 0.4599 | 0.4017 |
| 313.20 | 0.5061 | 0.3904 |
| 313.20 | 0.5389 | 0.3825 |
| 313.20 | 0.6008 | 0.3573 |
| 313.20 | 0.6352 | 0.3366 |
| 313.20 | 0.6725 | 0.3093 |
| 313.20 | 0.7374 | 0.2545 |
| 313.20 | 0.7663 | 0.2281 |
| 313.20 | 0.8020 | 0.1947 |
| 313.20 | 0.8462 | 0.1522 |
| 313.20 | 0.8984 | 0.1008 |
| 313.20 | 0.9165 | 0.0829 |
| 313.20 | 0.9409 | 0.0586 |
| 313.20 | 0.9696 | 0.0299 |
| 313.20 | 0.9997 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9488 | 0.0509 | 0.0975 | 0.0565 |
| 293.20 | 0.8959 | 0.1023 | 0.1654 | 0.0917 |
| 293.20 | 0.8388 | 0.1583 | 0.2276 | 0.1288 |
| 293.20 | 0.7827 | 0.2123 | 0.2850 | 0.1696 |
| 293.20 | 0.7327 | 0.2583 | 0.3358 | 0.2143 |
| 293.20 | 0.6735 | 0.3084 | 0.3786 | 0.2644 |
| 313.20 | 0.9499 | 0.0498 | 0.0853 | 0.0829 |
| 313.20 | 0.9003 | 0.0967 | 0.1482 | 0.1144 |
| 313.20 | 0.8470 | 0.1481 | 0.2073 | 0.1483 |
| 313.20 | 0.7983 | 0.1947 | 0.2567 | 0.1811 |
| 313.20 | 0.7505 | 0.2390 | 0.3046 | 0.2191 |
| 313.20 | 0.6987 | 0.2840 | 0.3512 | 0.2664 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0142 | 1.406 |
| 293.20 | 0.1616 | 1.4003 |
| 293.20 | 0.2528 | 1.3962 |
| 293.20 | 0.3047 | 1.3933 |
| 293.20 | 0.3577 | 1.391 |
| 293.20 | 0.4027 | 1.3889 |
| 293.20 | 0.4384 | 1.3877 |
| 293.20 | 0.4840 | 1.3822 |
| 293.20 | 0.5202 | 1.3807 |
| 293.20 | 0.5707 | 1.3793 |
| 293.20 | 0.6050 | 1.3772 |
| 293.20 | 0.6332 | 1.3753 |
| 293.20 | 0.6881 | 1.3718 |
| 293.20 | 0.7305 | 1.3693 |
| 293.20 | 0.7674 | 1.3661 |
| 293.20 | 0.8039 | 1.3629 |
| 293.20 | 0.8464 | 1.3585 |
| 293.20 | 0.8931 | 1.3528 |
| 293.20 | 0.9165 | 1.3494 |
| 293.20 | 0.9415 | 1.3452 |
| 293.20 | 0.9607 | 1.3416 |
| 293.20 | 0.9998 | 1.333 |
| 313.20 | 0.0490 | 1.3966 |
| 313.20 | 0.1870 | 1.391 |
| 313.20 | 0.2636 | 1.3873 |
| 313.20 | 0.3308 | 1.3843 |
| 313.20 | 0.3857 | 1.3805 |
| 313.20 | 0.4265 | 1.3743 |
| 313.20 | 0.4599 | 1.3724 |
| 313.20 | 0.5061 | 1.3727 |
| 313.20 | 0.5389 | 1.3726 |
| 313.20 | 0.6008 | 1.3705 |
| 313.20 | 0.6352 | 1.3686 |
| 313.20 | 0.6725 | 1.3664 |
| 313.20 | 0.7374 | 1.3622 |
| 313.20 | 0.7663 | 1.3602 |
| 313.20 | 0.8020 | 1.3574 |
| 313.20 | 0.8462 | 1.3534 |
| 313.20 | 0.8984 | 1.3475 |
| 313.20 | 0.9165 | 1.3451 |
| 313.20 | 0.9409 | 1.3415 |
| 313.20 | 0.9696 | 1.3365 |
| 313.20 | 0.9997 | 1.3305 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0565 | 1.4047 |
| 293.20 | 0.0917 | 1.4031 |
| 293.20 | 0.1288 | 1.4014 |
| 293.20 | 0.1696 | 1.3996 |
| 293.20 | 0.2143 | 1.3973 |
| 293.20 | 0.2644 | 1.3953 |
| 313.20 | 0.0829 | 1.3954 |
| 313.20 | 0.1144 | 1.3939 |
| 313.20 | 0.1483 | 1.3923 |
| 313.20 | 0.1811 | 1.3908 |
| 313.20 | 0.2191 | 1.3891 |
| 313.20 | 0.2664 | 1.3869 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9488 | 1.3449 |
| 293.20 | 0.8959 | 1.353 |
| 293.20 | 0.8388 | 1.3593 |
| 293.20 | 0.7827 | 1.3644 |
| 293.20 | 0.7327 | 1.3684 |
| 293.20 | 0.6735 | 1.3729 |
| 313.20 | 0.9499 | 1.3404 |
| 313.20 | 0.9003 | 1.3475 |
| 313.20 | 0.8470 | 1.3532 |
| 313.20 | 0.7983 | 1.3575 |
| 313.20 | 0.7505 | 1.3612 |
| 313.20 | 0.6987 | 1.3647 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0142 | 1.406 |
| 293.20 | 0.1616 | 1.4003 |
| 293.20 | 0.2528 | 1.3962 |
| 293.20 | 0.3047 | 1.3933 |
| 293.20 | 0.3577 | 1.391 |
| 293.20 | 0.4027 | 1.3889 |
| 293.20 | 0.4384 | 1.3877 |
| 293.20 | 0.4840 | 1.3822 |
| 293.20 | 0.5202 | 1.3807 |
| 293.20 | 0.5707 | 1.3793 |
| 293.20 | 0.6050 | 1.3772 |
| 293.20 | 0.6332 | 1.3753 |
| 293.20 | 0.6881 | 1.3718 |
| 293.20 | 0.7305 | 1.3693 |
| 293.20 | 0.7674 | 1.3661 |
| 293.20 | 0.8039 | 1.3629 |
| 293.20 | 0.8464 | 1.3585 |
| 293.20 | 0.8931 | 1.3528 |
| 293.20 | 0.9165 | 1.3494 |
| 293.20 | 0.9415 | 1.3452 |
| 293.20 | 0.9607 | 1.3416 |
| 293.20 | 0.9998 | 1.333 |
| 313.20 | 0.0490 | 1.3966 |
| 313.20 | 0.1870 | 1.391 |
| 313.20 | 0.2636 | 1.3873 |
| 313.20 | 0.3308 | 1.3843 |
| 313.20 | 0.3857 | 1.3805 |
| 313.20 | 0.4265 | 1.3743 |
| 313.20 | 0.4599 | 1.3724 |
| 313.20 | 0.5061 | 1.3727 |
| 313.20 | 0.5389 | 1.3726 |
| 313.20 | 0.6008 | 1.3705 |
| 313.20 | 0.6352 | 1.3686 |
| 313.20 | 0.6725 | 1.3664 |
| 313.20 | 0.7374 | 1.3622 |
| 313.20 | 0.7663 | 1.3602 |
| 313.20 | 0.8020 | 1.3574 |
| 313.20 | 0.8462 | 1.3534 |
| 313.20 | 0.8984 | 1.3475 |
| 313.20 | 0.9165 | 1.3451 |
| 313.20 | 0.9409 | 1.3415 |
| 313.20 | 0.9696 | 1.3365 |
| 313.20 | 0.9997 | 1.3305 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0565 | 1.4047 |
| 293.20 | 0.0917 | 1.4031 |
| 293.20 | 0.1288 | 1.4014 |
| 293.20 | 0.1696 | 1.3996 |
| 293.20 | 0.2143 | 1.3973 |
| 293.20 | 0.2644 | 1.3953 |
| 313.20 | 0.0829 | 1.3954 |
| 313.20 | 0.1144 | 1.3939 |
| 313.20 | 0.1483 | 1.3923 |
| 313.20 | 0.1811 | 1.3908 |
| 313.20 | 0.2191 | 1.3891 |
| 313.20 | 0.2664 | 1.3869 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9488 | 1.3449 |
| 293.20 | 0.8959 | 1.353 |
| 293.20 | 0.8388 | 1.3593 |
| 293.20 | 0.7827 | 1.3644 |
| 293.20 | 0.7327 | 1.3684 |
| 293.20 | 0.6735 | 1.3729 |
| 313.20 | 0.9499 | 1.3404 |
| 313.20 | 0.9003 | 1.3475 |
| 313.20 | 0.8470 | 1.3532 |
| 313.20 | 0.7983 | 1.3575 |
| 313.20 | 0.7505 | 1.3612 |
| 313.20 | 0.6987 | 1.3647 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0142 | 868.09 |
| 293.20 | 0.1616 | 898.06 |
| 293.20 | 0.2528 | 921.25 |
| 293.20 | 0.3047 | 939.32 |
| 293.20 | 0.3577 | 954.35 |
| 293.20 | 0.4027 | 967.08 |
| 293.20 | 0.4384 | 978.1 |
| 293.20 | 0.4840 | 995.81 |
| 293.20 | 0.5202 | 1012.53 |
| 293.20 | 0.5707 | 1023.95 |
| 293.20 | 0.6050 | 1033.85 |
| 293.20 | 0.6332 | 1040.8 |
| 293.20 | 0.6881 | 1049.22 |
| 293.20 | 0.7305 | 1051.64 |
| 293.20 | 0.7674 | 1051.71 |
| 293.20 | 0.8039 | 1049.56 |
| 293.20 | 0.8464 | 1044.49 |
| 293.20 | 0.8931 | 1035.56 |
| 293.20 | 0.9165 | 1029.51 |
| 293.20 | 0.9415 | 1021.9 |
| 293.20 | 0.9607 | 1014.93 |
| 293.20 | 0.9998 | 998.14 |
| 313.20 | 0.0490 | 849.614 |
| 313.20 | 0.1870 | 879.428 |
| 313.20 | 0.2636 | 904.457 |
| 313.20 | 0.3308 | 921.136 |
| 313.20 | 0.3857 | 935.961 |
| 313.20 | 0.4265 | 948.689 |
| 313.20 | 0.4599 | 949.838 |
| 313.20 | 0.5061 | 955.634 |
| 313.20 | 0.5389 | 982.837 |
| 313.20 | 0.6008 | 1010.803 |
| 313.20 | 0.6352 | 1018.365 |
| 313.20 | 0.6725 | 1026.344 |
| 313.20 | 0.7374 | 1033.394 |
| 313.20 | 0.7663 | 1034.077 |
| 313.20 | 0.8020 | 1033.252 |
| 313.20 | 0.8462 | 1029.81 |
| 313.20 | 0.8984 | 1021.865 |
| 313.20 | 0.9165 | 1018.097 |
| 313.20 | 0.9409 | 1012.002 |
| 313.20 | 0.9696 | 1003.247 |
| 313.20 | 0.9997 | 992.093 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0565 | 875.461 |
| 293.20 | 0.0917 | 883.251 |
| 293.20 | 0.1288 | 891.791 |
| 293.20 | 0.1696 | 901.748 |
| 293.20 | 0.2143 | 912.265 |
| 293.20 | 0.2644 | 926.917 |
| 313.20 | 0.0829 | 856.219 |
| 313.20 | 0.1144 | 863.655 |
| 313.20 | 0.1483 | 871.926 |
| 313.20 | 0.1811 | 880.328 |
| 313.20 | 0.2191 | 890.564 |
| 313.20 | 0.2664 | 903.642 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9488 | 1021.362 |
| 293.20 | 0.8959 | 1035.823 |
| 293.20 | 0.8388 | 1045.417 |
| 293.20 | 0.7827 | 1050.33 |
| 293.20 | 0.7327 | 1051.97 |
| 293.20 | 0.6735 | 1047.472 |
| 313.20 | 0.9499 | 1008.859 |
| 313.20 | 0.9003 | 1020.805 |
| 313.20 | 0.8470 | 1029.592 |
| 313.20 | 0.7983 | 1033.312 |
| 313.20 | 0.7505 | 1033.786 |
| 313.20 | 0.6987 | 1030.149 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0142 | 868.09 |
| 293.20 | 0.1616 | 898.06 |
| 293.20 | 0.2528 | 921.25 |
| 293.20 | 0.3047 | 939.32 |
| 293.20 | 0.3577 | 954.35 |
| 293.20 | 0.4027 | 967.08 |
| 293.20 | 0.4384 | 978.1 |
| 293.20 | 0.4840 | 995.81 |
| 293.20 | 0.5202 | 1012.53 |
| 293.20 | 0.5707 | 1023.95 |
| 293.20 | 0.6050 | 1033.85 |
| 293.20 | 0.6332 | 1040.8 |
| 293.20 | 0.6881 | 1049.22 |
| 293.20 | 0.7305 | 1051.64 |
| 293.20 | 0.7674 | 1051.71 |
| 293.20 | 0.8039 | 1049.56 |
| 293.20 | 0.8464 | 1044.49 |
| 293.20 | 0.8931 | 1035.56 |
| 293.20 | 0.9165 | 1029.51 |
| 293.20 | 0.9415 | 1021.9 |
| 293.20 | 0.9607 | 1014.93 |
| 293.20 | 0.9998 | 998.14 |
| 313.20 | 0.0490 | 849.614 |
| 313.20 | 0.1870 | 879.428 |
| 313.20 | 0.2636 | 904.457 |
| 313.20 | 0.3308 | 921.136 |
| 313.20 | 0.3857 | 935.961 |
| 313.20 | 0.4265 | 948.689 |
| 313.20 | 0.4599 | 949.838 |
| 313.20 | 0.5061 | 955.634 |
| 313.20 | 0.5389 | 982.837 |
| 313.20 | 0.6008 | 1010.803 |
| 313.20 | 0.6352 | 1018.365 |
| 313.20 | 0.6725 | 1026.344 |
| 313.20 | 0.7374 | 1033.394 |
| 313.20 | 0.7663 | 1034.077 |
| 313.20 | 0.8020 | 1033.252 |
| 313.20 | 0.8462 | 1029.81 |
| 313.20 | 0.8984 | 1021.865 |
| 313.20 | 0.9165 | 1018.097 |
| 313.20 | 0.9409 | 1012.002 |
| 313.20 | 0.9696 | 1003.247 |
| 313.20 | 0.9997 | 992.093 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0565 | 875.461 |
| 293.20 | 0.0917 | 883.251 |
| 293.20 | 0.1288 | 891.791 |
| 293.20 | 0.1696 | 901.748 |
| 293.20 | 0.2143 | 912.265 |
| 293.20 | 0.2644 | 926.917 |
| 313.20 | 0.0829 | 856.219 |
| 313.20 | 0.1144 | 863.655 |
| 313.20 | 0.1483 | 871.926 |
| 313.20 | 0.1811 | 880.328 |
| 313.20 | 0.2191 | 890.564 |
| 313.20 | 0.2664 | 903.642 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9488 | 1021.362 |
| 293.20 | 0.8959 | 1035.823 |
| 293.20 | 0.8388 | 1045.417 |
| 293.20 | 0.7827 | 1050.33 |
| 293.20 | 0.7327 | 1051.97 |
| 293.20 | 0.6735 | 1047.472 |
| 313.20 | 0.9499 | 1008.859 |
| 313.20 | 0.9003 | 1020.805 |
| 313.20 | 0.8470 | 1029.592 |
| 313.20 | 0.7983 | 1033.312 |
| 313.20 | 0.7505 | 1033.786 |
| 313.20 | 0.6987 | 1030.149 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0142 | 1225.6 |
| 293.20 | 0.1616 | 1226.24 |
| 293.20 | 0.2528 | 1232.97 |
| 293.20 | 0.3047 | 1241.76 |
| 293.20 | 0.3577 | 1253.46 |
| 293.20 | 0.4027 | 1262.83 |
| 293.20 | 0.4384 | 1277.39 |
| 293.20 | 0.4840 | 1284.73 |
| 293.20 | 0.5202 | 1332.85 |
| 293.20 | 0.5707 | 1353.14 |
| 293.20 | 0.6050 | 1378.58 |
| 293.20 | 0.6332 | 1401.96 |
| 293.20 | 0.6881 | 1438.2 |
| 293.20 | 0.7305 | 1465.08 |
| 293.20 | 0.7674 | 1486.78 |
| 293.20 | 0.8039 | 1505.75 |
| 293.20 | 0.8464 | 1523.97 |
| 293.20 | 0.8931 | 1535.6 |
| 293.20 | 0.9165 | 1536.32 |
| 293.20 | 0.9415 | 1531.35 |
| 293.20 | 0.9607 | 1521.8 |
| 293.20 | 0.9998 | 1484.03 |
| 313.20 | 0.0490 | 1148.57 |
| 313.20 | 0.1870 | 1152.26 |
| 313.20 | 0.2636 | 1161.7 |
| 313.20 | 0.3308 | 1173.24 |
| 313.20 | 0.3857 | 1179.79 |
| 313.20 | 0.4265 | 1192.44 |
| 313.20 | 0.4599 | 1199.72 |
| 313.20 | 0.5061 | 1202.63 |
| 313.20 | 0.5389 | 1285.05 |
| 313.20 | 0.6008 | 1320.78 |
| 313.20 | 0.6352 | 1342.92 |
| 313.20 | 0.6725 | 1374.74 |
| 313.20 | 0.7374 | 1426.5 |
| 313.20 | 0.7663 | 1448.36 |
| 313.20 | 0.8020 | 1473.13 |
| 313.20 | 0.8462 | 1501.51 |
| 313.20 | 0.8984 | 1528.71 |
| 313.20 | 0.9165 | 1535.46 |
| 313.20 | 0.9409 | 1540.98 |
| 313.20 | 0.9696 | 1540.39 |
| 313.20 | 0.9997 | 1529.34 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0565 | 1225.76 |
| 293.20 | 0.0917 | 1225.44 |
| 293.20 | 0.1288 | 1225.79 |
| 293.20 | 0.1696 | 1227.17 |
| 293.20 | 0.2143 | 1229.47 |
| 293.20 | 0.2644 | 1234.05 |
| 313.20 | 0.0829 | 1148.76 |
| 313.20 | 0.1144 | 1149.25 |
| 313.20 | 0.1483 | 1150.41 |
| 313.20 | 0.1811 | 1152.31 |
| 313.20 | 0.2191 | 1155.73 |
| 313.20 | 0.2664 | 1161.89 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9488 | 1530.69 |
| 293.20 | 0.8959 | 1535.87 |
| 293.20 | 0.8388 | 1521.88 |
| 293.20 | 0.7827 | 1498.11 |
| 293.20 | 0.7327 | 1470.29 |
| 293.20 | 0.6735 | 1433.74 |
| 313.20 | 0.9499 | 1541.62 |
| 313.20 | 0.9003 | 1529.27 |
| 313.20 | 0.8470 | 1502.92 |
| 313.20 | 0.7983 | 1472.97 |
| 313.20 | 0.7505 | 1438.93 |
| 313.20 | 0.6987 | 1396.89 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0142 | 1225.6 |
| 293.20 | 0.1616 | 1226.24 |
| 293.20 | 0.2528 | 1232.97 |
| 293.20 | 0.3047 | 1241.76 |
| 293.20 | 0.3577 | 1253.46 |
| 293.20 | 0.4027 | 1262.83 |
| 293.20 | 0.4384 | 1277.39 |
| 293.20 | 0.4840 | 1284.73 |
| 293.20 | 0.5202 | 1332.85 |
| 293.20 | 0.5707 | 1353.14 |
| 293.20 | 0.6050 | 1378.58 |
| 293.20 | 0.6332 | 1401.96 |
| 293.20 | 0.6881 | 1438.2 |
| 293.20 | 0.7305 | 1465.08 |
| 293.20 | 0.7674 | 1486.78 |
| 293.20 | 0.8039 | 1505.75 |
| 293.20 | 0.8464 | 1523.97 |
| 293.20 | 0.8931 | 1535.6 |
| 293.20 | 0.9165 | 1536.32 |
| 293.20 | 0.9415 | 1531.35 |
| 293.20 | 0.9607 | 1521.8 |
| 293.20 | 0.9998 | 1484.03 |
| 313.20 | 0.0490 | 1148.57 |
| 313.20 | 0.1870 | 1152.26 |
| 313.20 | 0.2636 | 1161.7 |
| 313.20 | 0.3308 | 1173.24 |
| 313.20 | 0.3857 | 1179.79 |
| 313.20 | 0.4265 | 1192.44 |
| 313.20 | 0.4599 | 1199.72 |
| 313.20 | 0.5061 | 1202.63 |
| 313.20 | 0.5389 | 1285.05 |
| 313.20 | 0.6008 | 1320.78 |
| 313.20 | 0.6352 | 1342.92 |
| 313.20 | 0.6725 | 1374.74 |
| 313.20 | 0.7374 | 1426.5 |
| 313.20 | 0.7663 | 1448.36 |
| 313.20 | 0.8020 | 1473.13 |
| 313.20 | 0.8462 | 1501.51 |
| 313.20 | 0.8984 | 1528.71 |
| 313.20 | 0.9165 | 1535.46 |
| 313.20 | 0.9409 | 1540.98 |
| 313.20 | 0.9696 | 1540.39 |
| 313.20 | 0.9997 | 1529.34 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0565 | 1225.76 |
| 293.20 | 0.0917 | 1225.44 |
| 293.20 | 0.1288 | 1225.79 |
| 293.20 | 0.1696 | 1227.17 |
| 293.20 | 0.2143 | 1229.47 |
| 293.20 | 0.2644 | 1234.05 |
| 313.20 | 0.0829 | 1148.76 |
| 313.20 | 0.1144 | 1149.25 |
| 313.20 | 0.1483 | 1150.41 |
| 313.20 | 0.1811 | 1152.31 |
| 313.20 | 0.2191 | 1155.73 |
| 313.20 | 0.2664 | 1161.89 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9488 | 1530.69 |
| 293.20 | 0.8959 | 1535.87 |
| 293.20 | 0.8388 | 1521.88 |
| 293.20 | 0.7827 | 1498.11 |
| 293.20 | 0.7327 | 1470.29 |
| 293.20 | 0.6735 | 1433.74 |
| 313.20 | 0.9499 | 1541.62 |
| 313.20 | 0.9003 | 1529.27 |
| 313.20 | 0.8470 | 1502.92 |
| 313.20 | 0.7983 | 1472.97 |
| 313.20 | 0.7505 | 1438.93 |
| 313.20 | 0.6987 | 1396.89 |