- Name
- Formamide, N,N-dimethyl-
- InChI
- InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3
- InChI Key
- ZMXDDKWLCZADIW-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CN(C)C=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 68-12-2
- Name
- 1-Propanamine, N-propyl-
- InChI
- InChI=1S/C6H15N/c1-3-5-7-6-4-2/h7H,3-6H2,1-2H3
- InChI Key
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N
- Formula
- C6H15N
- SMILES
- CCCNCCC
- Mol. Weight (g/mol)
- 101.19
- CAS
- 142-84-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0358 | 0.0880 |
| 0.1002 | 0.2410 |
| 0.1512 | 0.3510 |
| 0.1984 | 0.4460 |
| 0.2504 | 0.5290 |
| 0.3016 | 0.5950 |
| 0.3483 | 0.6570 |
| 0.4005 | 0.6950 |
| 0.4495 | 0.7370 |
| 0.5005 | 0.7480 |
| 0.5505 | 0.7530 |
| 0.6012 | 0.7430 |
| 0.6587 | 0.7080 |
| 0.6997 | 0.6730 |
| 0.7518 | 0.6130 |
| 0.7983 | 0.5420 |
| 0.8485 | 0.4410 |
| 0.8991 | 0.3180 |
| 0.9504 | 0.1700 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0358 | 0.0880 |
| 0.1002 | 0.2410 |
| 0.1512 | 0.3510 |
| 0.1984 | 0.4460 |
| 0.2504 | 0.5290 |
| 0.3016 | 0.5950 |
| 0.3483 | 0.6570 |
| 0.4005 | 0.6950 |
| 0.4495 | 0.7370 |
| 0.5005 | 0.7480 |
| 0.5505 | 0.7530 |
| 0.6012 | 0.7430 |
| 0.6587 | 0.7080 |
| 0.6997 | 0.6730 |
| 0.7518 | 0.6130 |
| 0.7983 | 0.5420 |
| 0.8485 | 0.4410 |
| 0.8991 | 0.3180 |
| 0.9504 | 0.1700 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0600 | 1.4054 |
| 293.15 | 0.1556 | 1.4072 |
| 293.15 | 0.2614 | 1.4095 |
| 293.15 | 0.3463 | 1.4114 |
| 293.15 | 0.3985 | 1.4127 |
| 293.15 | 0.4554 | 1.414 |
| 293.15 | 0.5487 | 1.4164 |
| 293.15 | 0.6018 | 1.4179 |
| 293.15 | 0.7033 | 1.4208 |
| 293.15 | 0.8216 | 1.4244 |
| 293.15 | 0.8844 | 1.4265 |
| 293.15 | 0.9486 | 1.4288 |
| 298.15 | 0.0626 | 1.4026 |
| 298.15 | 0.1083 | 1.4036 |
| 298.15 | 0.1544 | 1.4044 |
| 298.15 | 0.2541 | 1.4066 |
| 298.15 | 0.3148 | 1.408 |
| 298.15 | 0.3609 | 1.4091 |
| 298.15 | 0.4077 | 1.4102 |
| 298.15 | 0.4966 | 1.4125 |
| 298.15 | 0.6527 | 1.4167 |
| 298.15 | 0.7477 | 1.4196 |
| 298.15 | 0.8063 | 1.4215 |
| 298.15 | 0.9020 | 1.4248 |
| 298.15 | 0.9482 | 1.4264 |
| 303.15 | 0.0453 | 1.3997 |
| 303.15 | 0.1034 | 1.4009 |
| 303.15 | 0.1963 | 1.4029 |
| 303.15 | 0.2582 | 1.4042 |
| 303.15 | 0.3559 | 1.4065 |
| 303.15 | 0.4099 | 1.4078 |
| 303.15 | 0.6016 | 1.4129 |
| 303.15 | 0.7502 | 1.4175 |
| 303.15 | 0.8498 | 1.4207 |
| 303.15 | 0.9000 | 1.4225 |
| 303.15 | 0.9498 | 1.4242 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0600 | 1.4054 |
| 293.15 | 0.1556 | 1.4072 |
| 293.15 | 0.2614 | 1.4095 |
| 293.15 | 0.3463 | 1.4114 |
| 293.15 | 0.3985 | 1.4127 |
| 293.15 | 0.4554 | 1.414 |
| 293.15 | 0.5487 | 1.4164 |
| 293.15 | 0.6018 | 1.4179 |
| 293.15 | 0.7033 | 1.4208 |
| 293.15 | 0.8216 | 1.4244 |
| 293.15 | 0.8844 | 1.4265 |
| 293.15 | 0.9486 | 1.4288 |
| 298.15 | 0.0626 | 1.4026 |
| 298.15 | 0.1083 | 1.4036 |
| 298.15 | 0.1544 | 1.4044 |
| 298.15 | 0.2541 | 1.4066 |
| 298.15 | 0.3148 | 1.408 |
| 298.15 | 0.3609 | 1.4091 |
| 298.15 | 0.4077 | 1.4102 |
| 298.15 | 0.4966 | 1.4125 |
| 298.15 | 0.6527 | 1.4167 |
| 298.15 | 0.7477 | 1.4196 |
| 298.15 | 0.8063 | 1.4215 |
| 298.15 | 0.9020 | 1.4248 |
| 298.15 | 0.9482 | 1.4264 |
| 303.15 | 0.0453 | 1.3997 |
| 303.15 | 0.1034 | 1.4009 |
| 303.15 | 0.1963 | 1.4029 |
| 303.15 | 0.2582 | 1.4042 |
| 303.15 | 0.3559 | 1.4065 |
| 303.15 | 0.4099 | 1.4078 |
| 303.15 | 0.6016 | 1.4129 |
| 303.15 | 0.7502 | 1.4175 |
| 303.15 | 0.8498 | 1.4207 |
| 303.15 | 0.9000 | 1.4225 |
| 303.15 | 0.9498 | 1.4242 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0600 | 745.894 |
| 293.15 | 0.1071 | 752.141 |
| 293.15 | 0.1560 | 758.933 |
| 293.15 | 0.1975 | 764.87 |
| 293.15 | 0.2490 | 772.54 |
| 293.15 | 0.3099 | 782.194 |
| 293.15 | 0.3463 | 788.151 |
| 293.15 | 0.3985 | 797.199 |
| 293.15 | 0.4480 | 806.192 |
| 298.15 | 0.0626 | 741.577 |
| 298.15 | 0.1083 | 747.697 |
| 298.15 | 0.1544 | 754.025 |
| 298.15 | 0.2541 | 768.732 |
| 298.15 | 0.3148 | 778.293 |
| 298.15 | 0.3609 | 786.012 |
| 298.15 | 0.4077 | 794.223 |
| 298.15 | 0.4966 | 810.8 |
| 303.15 | 0.0453 | 734.885 |
| 303.15 | 0.1034 | 742.55 |
| 303.15 | 0.1963 | 755.529 |
| 303.15 | 0.2582 | 764.775 |
| 303.15 | 0.3559 | 780.614 |
| 303.15 | 0.4099 | 790.03 |
| 303.15 | 0.4565 | 798.539 |
| 293.15 | 0.4974 | 815.656 |
| 293.15 | 0.5487 | 825.989 |
| 293.15 | 0.6562 | 849.651 |
| 293.15 | 0.7514 | 873.097 |
| 293.15 | 0.8216 | 892.212 |
| 293.15 | 0.8501 | 900.523 |
| 293.15 | 0.9025 | 916.508 |
| 293.15 | 0.9486 | 931.283 |
| 298.15 | 0.5386 | 819.199 |
| 298.15 | 0.6082 | 833.997 |
| 298.15 | 0.6527 | 844.084 |
| 298.15 | 0.7477 | 867.448 |
| 298.15 | 0.8063 | 883.226 |
| 298.15 | 0.9020 | 911.457 |
| 298.15 | 0.9482 | 926.367 |
| 303.15 | 0.5415 | 815.193 |
| 303.15 | 0.6016 | 827.909 |
| 303.15 | 0.6517 | 839.209 |
| 303.15 | 0.7502 | 863.388 |
| 303.15 | 0.8498 | 890.941 |
| 303.15 | 0.9000 | 906.165 |
| 303.15 | 0.9498 | 922.203 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0600 | 745.894 |
| 293.15 | 0.1071 | 752.141 |
| 293.15 | 0.1560 | 758.933 |
| 293.15 | 0.1975 | 764.87 |
| 293.15 | 0.2490 | 772.54 |
| 293.15 | 0.3099 | 782.194 |
| 293.15 | 0.3463 | 788.151 |
| 293.15 | 0.3985 | 797.199 |
| 293.15 | 0.4480 | 806.192 |
| 298.15 | 0.0626 | 741.577 |
| 298.15 | 0.1083 | 747.697 |
| 298.15 | 0.1544 | 754.025 |
| 298.15 | 0.2541 | 768.732 |
| 298.15 | 0.3148 | 778.293 |
| 298.15 | 0.3609 | 786.012 |
| 298.15 | 0.4077 | 794.223 |
| 298.15 | 0.4966 | 810.8 |
| 303.15 | 0.0453 | 734.885 |
| 303.15 | 0.1034 | 742.55 |
| 303.15 | 0.1963 | 755.529 |
| 303.15 | 0.2582 | 764.775 |
| 303.15 | 0.3559 | 780.614 |
| 303.15 | 0.4099 | 790.03 |
| 303.15 | 0.4565 | 798.539 |
| 293.15 | 0.4974 | 815.656 |
| 293.15 | 0.5487 | 825.989 |
| 293.15 | 0.6562 | 849.651 |
| 293.15 | 0.7514 | 873.097 |
| 293.15 | 0.8216 | 892.212 |
| 293.15 | 0.8501 | 900.523 |
| 293.15 | 0.9025 | 916.508 |
| 293.15 | 0.9486 | 931.283 |
| 298.15 | 0.5386 | 819.199 |
| 298.15 | 0.6082 | 833.997 |
| 298.15 | 0.6527 | 844.084 |
| 298.15 | 0.7477 | 867.448 |
| 298.15 | 0.8063 | 883.226 |
| 298.15 | 0.9020 | 911.457 |
| 298.15 | 0.9482 | 926.367 |
| 303.15 | 0.5415 | 815.193 |
| 303.15 | 0.6016 | 827.909 |
| 303.15 | 0.6517 | 839.209 |
| 303.15 | 0.7502 | 863.388 |
| 303.15 | 0.8498 | 890.941 |
| 303.15 | 0.9000 | 906.165 |
| 303.15 | 0.9498 | 922.203 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0600 | 1218.2 |
| 293.15 | 0.1071 | 1225.0 |
| 293.15 | 0.1560 | 1232.9 |
| 293.15 | 0.1975 | 1239.3 |
| 293.15 | 0.2490 | 1248.1 |
| 293.15 | 0.3099 | 1259.4 |
| 293.15 | 0.3463 | 1266.2 |
| 293.15 | 0.3985 | 1276.9 |
| 293.15 | 0.4480 | 1287.6 |
| 298.15 | 0.0626 | 1196.9 |
| 298.15 | 0.1083 | 1204.0 |
| 298.15 | 0.1544 | 1211.2 |
| 298.15 | 0.2541 | 1228.1 |
| 298.15 | 0.3148 | 1239.3 |
| 298.15 | 0.3609 | 1248.3 |
| 298.15 | 0.4077 | 1258.2 |
| 298.15 | 0.4966 | 1278.5 |
| 303.15 | 0.0453 | 1174.0 |
| 303.15 | 0.1034 | 1183.0 |
| 303.15 | 0.1963 | 1198.0 |
| 303.15 | 0.2582 | 1208.8 |
| 303.15 | 0.3559 | 1227.6 |
| 303.15 | 0.4099 | 1239.0 |
| 303.15 | 0.4565 | 1249.4 |
| 293.15 | 0.4974 | 1299.2 |
| 293.15 | 0.5487 | 1312.0 |
| 293.15 | 0.6562 | 1342.1 |
| 293.15 | 0.7514 | 1373.4 |
| 293.15 | 0.8216 | 1399.8 |
| 293.15 | 0.8501 | 1411.2 |
| 293.15 | 0.9025 | 1433.3 |
| 293.15 | 0.9486 | 1453.4 |
| 298.15 | 0.5386 | 1288.9 |
| 298.15 | 0.6082 | 1307.9 |
| 298.15 | 0.6527 | 1321.1 |
| 298.15 | 0.7477 | 1352.4 |
| 298.15 | 0.8063 | 1374.0 |
| 298.15 | 0.9020 | 1413.1 |
| 298.15 | 0.9482 | 1433.5 |
| 303.15 | 0.5415 | 1270.3 |
| 303.15 | 0.6016 | 1286.6 |
| 303.15 | 0.6517 | 1301.4 |
| 303.15 | 0.7502 | 1334.0 |
| 303.15 | 0.8498 | 1372.0 |
| 303.15 | 0.9000 | 1393.2 |
| 303.15 | 0.9498 | 1415.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0600 | 1218.2 |
| 293.15 | 0.1071 | 1225.0 |
| 293.15 | 0.1560 | 1232.9 |
| 293.15 | 0.1975 | 1239.3 |
| 293.15 | 0.2490 | 1248.1 |
| 293.15 | 0.3099 | 1259.4 |
| 293.15 | 0.3463 | 1266.2 |
| 293.15 | 0.3985 | 1276.9 |
| 293.15 | 0.4480 | 1287.6 |
| 298.15 | 0.0626 | 1196.9 |
| 298.15 | 0.1083 | 1204.0 |
| 298.15 | 0.1544 | 1211.2 |
| 298.15 | 0.2541 | 1228.1 |
| 298.15 | 0.3148 | 1239.3 |
| 298.15 | 0.3609 | 1248.3 |
| 298.15 | 0.4077 | 1258.2 |
| 298.15 | 0.4966 | 1278.5 |
| 303.15 | 0.0453 | 1174.0 |
| 303.15 | 0.1034 | 1183.0 |
| 303.15 | 0.1963 | 1198.0 |
| 303.15 | 0.2582 | 1208.8 |
| 303.15 | 0.3559 | 1227.6 |
| 303.15 | 0.4099 | 1239.0 |
| 303.15 | 0.4565 | 1249.4 |
| 293.15 | 0.4974 | 1299.2 |
| 293.15 | 0.5487 | 1312.0 |
| 293.15 | 0.6562 | 1342.1 |
| 293.15 | 0.7514 | 1373.4 |
| 293.15 | 0.8216 | 1399.8 |
| 293.15 | 0.8501 | 1411.2 |
| 293.15 | 0.9025 | 1433.3 |
| 293.15 | 0.9486 | 1453.4 |
| 298.15 | 0.5386 | 1288.9 |
| 298.15 | 0.6082 | 1307.9 |
| 298.15 | 0.6527 | 1321.1 |
| 298.15 | 0.7477 | 1352.4 |
| 298.15 | 0.8063 | 1374.0 |
| 298.15 | 0.9020 | 1413.1 |
| 298.15 | 0.9482 | 1433.5 |
| 303.15 | 0.5415 | 1270.3 |
| 303.15 | 0.6016 | 1286.6 |
| 303.15 | 0.6517 | 1301.4 |
| 303.15 | 0.7502 | 1334.0 |
| 303.15 | 0.8498 | 1372.0 |
| 303.15 | 0.9000 | 1393.2 |
| 303.15 | 0.9498 | 1415.2 |
Sources
- Thermodynamics of amide + amine mixtures. 5. Excess molar enthalpies of N,N-dimethylformamide or N,N-dimethylacetamide + N-propylpropan-1-amine, + N-butylbutan-1-amine, + butan-1-amine, or + hexan-1-amine systems at 298.15 K. Application of the ERAS model
- Thermodynamics of amide + amine mixtures. 1. Volumetric, speed of sound, and refractive index data for N,Ndimethylformamide + N-propylpropan-1-amine, + N-butylbutan-1-amine, + butan-1-amine, or + hexan-1-amine systems at several temperatures