- Name
- Cytidine
- InChI
- InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1
- InChI Key
- UHDGCWIWMRVCDJ-XVFCMESISA-N
- Formula
- C9H13N3O5
- SMILES
- Nc1ccn(C2OC(CO)C(O)C2O)c(=O)n1
- Mol. Weight (g/mol)
- 243.22
- CAS
- 65-46-3
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Molality, mol/kg (2)
- η - Viscosity, Pa*s (2)
- Apparent molar heat capacity, J/K/mol (4)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (4)
Molality, mol/kg [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg - Liquid |
| 298.39 | 101.30 | 0.8020 |
Molality, mol/kg [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg - Liquid |
| 298.39 | 101.30 | 0.8020 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Cytidine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0103 | 0.0011 |
| 288.15 | 0.0213 | 0.0011 |
| 288.15 | 0.0312 | 0.0012 |
| 288.15 | 0.0383 | 0.0012 |
| 288.15 | 0.0418 | 0.0012 |
| 288.15 | 0.0436 | 0.0012 |
| 298.15 | 0.0103 | 0.0009 |
| 298.15 | 0.0213 | 0.0009 |
| 298.15 | 0.0312 | 0.0009 |
| 298.15 | 0.0383 | 0.0009 |
| 298.15 | 0.0418 | 0.0009 |
| 298.15 | 0.0436 | 0.0009 |
| 308.15 | 0.0103 | 0.0007 |
| 308.15 | 0.0213 | 0.0007 |
| 308.15 | 0.0312 | 0.0007 |
| 308.15 | 0.0383 | 0.0007 |
| 308.15 | 0.0418 | 0.0007 |
| 308.15 | 0.0436 | 0.0007 |
| 318.15 | 0.0103 | 0.0006 |
| 318.15 | 0.0213 | 0.0006 |
| 318.15 | 0.0312 | 0.0006 |
| 318.15 | 0.0383 | 0.0006 |
| 318.15 | 0.0418 | 0.0006 |
| 318.15 | 0.0436 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Cytidine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0103 | 0.0011 |
| 288.15 | 0.0213 | 0.0011 |
| 288.15 | 0.0312 | 0.0012 |
| 288.15 | 0.0383 | 0.0012 |
| 288.15 | 0.0418 | 0.0012 |
| 288.15 | 0.0436 | 0.0012 |
| 298.15 | 0.0103 | 0.0009 |
| 298.15 | 0.0213 | 0.0009 |
| 298.15 | 0.0312 | 0.0009 |
| 298.15 | 0.0383 | 0.0009 |
| 298.15 | 0.0418 | 0.0009 |
| 298.15 | 0.0436 | 0.0009 |
| 308.15 | 0.0103 | 0.0007 |
| 308.15 | 0.0213 | 0.0007 |
| 308.15 | 0.0312 | 0.0007 |
| 308.15 | 0.0383 | 0.0007 |
| 308.15 | 0.0418 | 0.0007 |
| 308.15 | 0.0436 | 0.0007 |
| 318.15 | 0.0103 | 0.0006 |
| 318.15 | 0.0213 | 0.0006 |
| 318.15 | 0.0312 | 0.0006 |
| 318.15 | 0.0383 | 0.0006 |
| 318.15 | 0.0418 | 0.0006 |
| 318.15 | 0.0436 | 0.0006 |
Apparent molar heat capacity, J/K/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Cytidine (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
|---|---|
| 0.0360 | 400.6 |
| 0.0469 | 402.7 |
| 0.0549 | 402.1 |
| 0.0618 | 403.6 |
| 0.0768 | 403.7 |
| 0.0916 | 403.6 |
| 0.1066 | 408.5 |
| 0.1221 | 409.7 |
| 0.1368 | 409.2 |
| 0.1555 | 411.9 |
| 0.1666 | 412.3 |
| 0.1802 | 414.7 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.04 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
- Final molality of solute, mol/kg = 0.0003916 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | 0.3600 |
| 298.15 | 0.3530 |
| 308.15 | 0.3240 |
| 318.15 | 0.3000 |
Apparent molar heat capacity, J/K/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Cytidine (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
|---|---|
| 0.0360 | 400.6 |
| 0.0469 | 402.7 |
| 0.0549 | 402.1 |
| 0.0618 | 403.6 |
| 0.0768 | 403.7 |
| 0.0916 | 403.6 |
| 0.1066 | 408.5 |
| 0.1221 | 409.7 |
| 0.1368 | 409.2 |
| 0.1555 | 411.9 |
| 0.1666 | 412.3 |
| 0.1802 | 414.7 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.04 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
- Final molality of solute, mol/kg = 0.0003916 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | 0.3600 |
| 298.15 | 0.3530 |
| 308.15 | 0.3240 |
| 318.15 | 0.3000 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Cytidine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0249 | 1001.365 |
| 288.15 | 0.0388 | 1002.627 |
| 288.15 | 0.0482 | 1003.474 |
| 288.15 | 0.0676 | 1005.207 |
| 288.15 | 0.0808 | 1006.383 |
| 288.15 | 0.0931 | 1007.485 |
| 288.15 | 0.1088 | 1008.869 |
| 288.15 | 0.1199 | 1009.838 |
| 288.15 | 0.1364 | 1011.283 |
| 288.15 | 0.1506 | 1012.521 |
| 288.15 | 0.1649 | 1013.759 |
| 298.15 | 0.0250 | 999.277 |
| 298.15 | 0.0310 | 999.805 |
| 298.15 | 0.0348 | 1000.141 |
| 298.15 | 0.0360 | 1000.254 |
| 298.15 | 0.0419 | 1000.774 |
| 298.15 | 0.0450 | 1001.047 |
| 298.15 | 0.0469 | 1001.217 |
| 298.15 | 0.0529 | 1001.741 |
| 298.15 | 0.0549 | 1001.92 |
| 298.15 | 0.0618 | 1002.529 |
| 298.15 | 0.0640 | 1002.717 |
| 298.15 | 0.0745 | 1003.639 |
| 298.15 | 0.0768 | 1003.839 |
| 298.15 | 0.0851 | 1004.569 |
| 298.15 | 0.0896 | 1004.958 |
| 298.15 | 0.0916 | 1005.131 |
| 298.15 | 0.1047 | 1006.267 |
| 298.15 | 0.1066 | 1006.439 |
| 298.15 | 0.1134 | 1007.023 |
| 298.15 | 0.1221 | 1007.775 |
| 298.15 | 0.1296 | 1008.413 |
| 298.15 | 0.1368 | 1009.033 |
| 298.15 | 0.1401 | 1009.324 |
| 298.15 | 0.1510 | 1010.252 |
| 298.15 | 0.1555 | 1010.636 |
| 298.15 | 0.1596 | 1010.987 |
| 298.15 | 0.1666 | 1011.587 |
| 298.15 | 0.1802 | 1012.74 |
| 298.15 | 0.1820 | 1012.897 |
| 298.15 | 0.1997 | 1014.377 |
| 303.15 | 0.0249 | 997.856 |
| 303.15 | 0.0380 | 999.006 |
| 303.15 | 0.0510 | 1000.134 |
| 303.15 | 0.0547 | 1000.464 |
| 303.15 | 0.0660 | 1001.452 |
| 303.15 | 0.0772 | 1002.416 |
| 303.15 | 0.0900 | 1003.534 |
| 303.15 | 0.1049 | 1004.814 |
| 303.15 | 0.1201 | 1006.113 |
| 303.15 | 0.1348 | 1007.376 |
| 303.15 | 0.1498 | 1008.65 |
| 313.15 | 0.0259 | 994.479 |
| 313.15 | 0.0380 | 995.525 |
| 313.15 | 0.0494 | 996.513 |
| 313.15 | 0.0602 | 997.437 |
| 313.15 | 0.0702 | 998.296 |
| 313.15 | 0.0772 | 998.896 |
| 313.15 | 0.0984 | 1000.704 |
| 313.15 | 0.1097 | 1001.664 |
| 313.15 | 0.1212 | 1002.631 |
| 313.15 | 0.1232 | 1002.803 |
| 313.15 | 0.1409 | 1004.298 |
| 313.15 | 0.1559 | 1005.55 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Cytidine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0185 | 1000.807 |
| 288.15 | 0.0360 | 1002.382 |
| 288.15 | 0.0557 | 1004.146 |
| 288.15 | 0.0565 | 1004.216 |
| 288.15 | 0.0911 | 1007.262 |
| 288.15 | 0.1064 | 1008.602 |
| 298.15 | 0.0185 | 998.697 |
| 298.15 | 0.0360 | 1000.244 |
| 298.15 | 0.0557 | 1001.977 |
| 298.15 | 0.0565 | 1002.046 |
| 298.15 | 0.0911 | 1005.041 |
| 298.15 | 0.1064 | 1006.359 |
| 308.15 | 0.0185 | 995.667 |
| 308.15 | 0.0360 | 997.172 |
| 308.15 | 0.0557 | 998.849 |
| 308.15 | 0.0565 | 998.913 |
| 308.15 | 0.0911 | 1001.807 |
| 308.15 | 0.1064 | 1003.078 |
| 318.15 | 0.0185 | 991.836 |
| 318.15 | 0.0360 | 993.324 |
| 318.15 | 0.0557 | 994.979 |
| 318.15 | 0.0565 | 995.046 |
| 318.15 | 0.0911 | 997.885 |
| 318.15 | 0.1064 | 999.135 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Cytidine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0249 | 1001.365 |
| 288.15 | 0.0388 | 1002.627 |
| 288.15 | 0.0482 | 1003.474 |
| 288.15 | 0.0676 | 1005.207 |
| 288.15 | 0.0808 | 1006.383 |
| 288.15 | 0.0931 | 1007.485 |
| 288.15 | 0.1088 | 1008.869 |
| 288.15 | 0.1199 | 1009.838 |
| 288.15 | 0.1364 | 1011.283 |
| 288.15 | 0.1506 | 1012.521 |
| 288.15 | 0.1649 | 1013.759 |
| 298.15 | 0.0250 | 999.277 |
| 298.15 | 0.0310 | 999.805 |
| 298.15 | 0.0348 | 1000.141 |
| 298.15 | 0.0360 | 1000.254 |
| 298.15 | 0.0419 | 1000.774 |
| 298.15 | 0.0450 | 1001.047 |
| 298.15 | 0.0469 | 1001.217 |
| 298.15 | 0.0529 | 1001.741 |
| 298.15 | 0.0549 | 1001.92 |
| 298.15 | 0.0618 | 1002.529 |
| 298.15 | 0.0640 | 1002.717 |
| 298.15 | 0.0745 | 1003.639 |
| 298.15 | 0.0768 | 1003.839 |
| 298.15 | 0.0851 | 1004.569 |
| 298.15 | 0.0896 | 1004.958 |
| 298.15 | 0.0916 | 1005.131 |
| 298.15 | 0.1047 | 1006.267 |
| 298.15 | 0.1066 | 1006.439 |
| 298.15 | 0.1134 | 1007.023 |
| 298.15 | 0.1221 | 1007.775 |
| 298.15 | 0.1296 | 1008.413 |
| 298.15 | 0.1368 | 1009.033 |
| 298.15 | 0.1401 | 1009.324 |
| 298.15 | 0.1510 | 1010.252 |
| 298.15 | 0.1555 | 1010.636 |
| 298.15 | 0.1596 | 1010.987 |
| 298.15 | 0.1666 | 1011.587 |
| 298.15 | 0.1802 | 1012.74 |
| 298.15 | 0.1820 | 1012.897 |
| 298.15 | 0.1997 | 1014.377 |
| 303.15 | 0.0249 | 997.856 |
| 303.15 | 0.0380 | 999.006 |
| 303.15 | 0.0510 | 1000.134 |
| 303.15 | 0.0547 | 1000.464 |
| 303.15 | 0.0660 | 1001.452 |
| 303.15 | 0.0772 | 1002.416 |
| 303.15 | 0.0900 | 1003.534 |
| 303.15 | 0.1049 | 1004.814 |
| 303.15 | 0.1201 | 1006.113 |
| 303.15 | 0.1348 | 1007.376 |
| 303.15 | 0.1498 | 1008.65 |
| 313.15 | 0.0259 | 994.479 |
| 313.15 | 0.0380 | 995.525 |
| 313.15 | 0.0494 | 996.513 |
| 313.15 | 0.0602 | 997.437 |
| 313.15 | 0.0702 | 998.296 |
| 313.15 | 0.0772 | 998.896 |
| 313.15 | 0.0984 | 1000.704 |
| 313.15 | 0.1097 | 1001.664 |
| 313.15 | 0.1212 | 1002.631 |
| 313.15 | 0.1232 | 1002.803 |
| 313.15 | 0.1409 | 1004.298 |
| 313.15 | 0.1559 | 1005.55 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Cytidine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0185 | 1000.807 |
| 288.15 | 0.0360 | 1002.382 |
| 288.15 | 0.0557 | 1004.146 |
| 288.15 | 0.0565 | 1004.216 |
| 288.15 | 0.0911 | 1007.262 |
| 288.15 | 0.1064 | 1008.602 |
| 298.15 | 0.0185 | 998.697 |
| 298.15 | 0.0360 | 1000.244 |
| 298.15 | 0.0557 | 1001.977 |
| 298.15 | 0.0565 | 1002.046 |
| 298.15 | 0.0911 | 1005.041 |
| 298.15 | 0.1064 | 1006.359 |
| 308.15 | 0.0185 | 995.667 |
| 308.15 | 0.0360 | 997.172 |
| 308.15 | 0.0557 | 998.849 |
| 308.15 | 0.0565 | 998.913 |
| 308.15 | 0.0911 | 1001.807 |
| 308.15 | 0.1064 | 1003.078 |
| 318.15 | 0.0185 | 991.836 |
| 318.15 | 0.0360 | 993.324 |
| 318.15 | 0.0557 | 994.979 |
| 318.15 | 0.0565 | 995.046 |
| 318.15 | 0.0911 | 997.885 |
| 318.15 | 0.1064 | 999.135 |
Speed of sound, m/s [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Molality, mol/kg of Cytidine (1) - Liquid | Speed of sound, m/s - Liquid |
| 10000.00 | 0.0996 | 1520.66 |
| 10000.00 | 0.0800 | 1519.23 |
| 10000.00 | 0.0700 | 1518.5 |
| 10000.00 | 0.0603 | 1517.8 |
| 10000.00 | 0.0500 | 1517.04 |
| 10000.00 | 0.0420 | 1516.43 |
| 10000.00 | 0.0340 | 1515.84 |
| 10000.00 | 0.0261 | 1515.26 |
| 20000.00 | 0.0996 | 1537.43 |
| 20000.00 | 0.0800 | 1536.02 |
| 20000.00 | 0.0700 | 1535.3 |
| 20000.00 | 0.0603 | 1534.59 |
| 20000.00 | 0.0500 | 1533.8 |
| 20000.00 | 0.0420 | 1533.22 |
| 20000.00 | 0.0340 | 1532.61 |
| 20000.00 | 0.0261 | 1532.01 |
| 40000.00 | 0.0996 | 1571.05 |
| 40000.00 | 0.0800 | 1569.66 |
| 40000.00 | 0.0700 | 1568.95 |
| 40000.00 | 0.0603 | 1568.2 |
| 40000.00 | 0.0500 | 1567.4 |
| 40000.00 | 0.0420 | 1566.82 |
| 40000.00 | 0.0340 | 1566.2 |
| 40000.00 | 0.0261 | 1565.62 |
| 60000.00 | 0.0996 | 1604.56 |
| 60000.00 | 0.0800 | 1603.14 |
| 60000.00 | 0.0700 | 1602.37 |
| 60000.00 | 0.0603 | 1601.69 |
| 60000.00 | 0.0500 | 1600.87 |
| 60000.00 | 0.0420 | 1600.3 |
| 60000.00 | 0.0340 | 1599.68 |
| 60000.00 | 0.0261 | 1599.08 |
| 80000.00 | 0.0996 | 1637.86 |
| 80000.00 | 0.0800 | 1636.47 |
| 80000.00 | 0.0700 | 1635.75 |
| 80000.00 | 0.0603 | 1635.01 |
| 80000.00 | 0.0500 | 1634.24 |
| 80000.00 | 0.0420 | 1633.63 |
| 80000.00 | 0.0340 | 1633.04 |
| 80000.00 | 0.0261 | 1632.42 |
| 100000.00 | 0.0996 | 1670.94 |
| 100000.00 | 0.0800 | 1669.52 |
| 100000.00 | 0.0700 | 1668.8 |
| 100000.00 | 0.0603 | 1668.09 |
| 100000.00 | 0.0500 | 1667.39 |
| 100000.00 | 0.0420 | 1666.77 |
| 100000.00 | 0.0340 | 1666.21 |
| 100000.00 | 0.0261 | 1665.62 |
| 120000.00 | 0.0996 | 1703.65 |
| 120000.00 | 0.0800 | 1702.33 |
| 120000.00 | 0.0700 | 1701.61 |
| 120000.00 | 0.0603 | 1700.93 |
| 120000.00 | 0.0500 | 1700.15 |
| 120000.00 | 0.0420 | 1699.55 |
| 120000.00 | 0.0340 | 1699.0 |
| 120000.00 | 0.0261 | 1698.4 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Cytidine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0130 | 1497.667 |
| 0.0148 | 1497.807 |
| 0.0199 | 1498.185 |
| 0.0242 | 1498.508 |
| 0.0271 | 1498.717 |
| 0.0309 | 1498.997 |
| 0.0370 | 1499.449 |
| 0.0430 | 1499.888 |
| 0.0498 | 1500.385 |
| 0.0635 | 1501.39 |
| 0.0764 | 1502.327 |
| 0.0890 | 1503.232 |
| 0.1022 | 1504.191 |
| 0.1155 | 1505.132 |
| 0.1274 | 1505.981 |
Speed of sound, m/s [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Molality, mol/kg of Cytidine (1) - Liquid | Speed of sound, m/s - Liquid |
| 10000.00 | 0.0996 | 1520.66 |
| 10000.00 | 0.0800 | 1519.23 |
| 10000.00 | 0.0700 | 1518.5 |
| 10000.00 | 0.0603 | 1517.8 |
| 10000.00 | 0.0500 | 1517.04 |
| 10000.00 | 0.0420 | 1516.43 |
| 10000.00 | 0.0340 | 1515.84 |
| 10000.00 | 0.0261 | 1515.26 |
| 20000.00 | 0.0996 | 1537.43 |
| 20000.00 | 0.0800 | 1536.02 |
| 20000.00 | 0.0700 | 1535.3 |
| 20000.00 | 0.0603 | 1534.59 |
| 20000.00 | 0.0500 | 1533.8 |
| 20000.00 | 0.0420 | 1533.22 |
| 20000.00 | 0.0340 | 1532.61 |
| 20000.00 | 0.0261 | 1532.01 |
| 40000.00 | 0.0996 | 1571.05 |
| 40000.00 | 0.0800 | 1569.66 |
| 40000.00 | 0.0700 | 1568.95 |
| 40000.00 | 0.0603 | 1568.2 |
| 40000.00 | 0.0500 | 1567.4 |
| 40000.00 | 0.0420 | 1566.82 |
| 40000.00 | 0.0340 | 1566.2 |
| 40000.00 | 0.0261 | 1565.62 |
| 60000.00 | 0.0996 | 1604.56 |
| 60000.00 | 0.0800 | 1603.14 |
| 60000.00 | 0.0700 | 1602.37 |
| 60000.00 | 0.0603 | 1601.69 |
| 60000.00 | 0.0500 | 1600.87 |
| 60000.00 | 0.0420 | 1600.3 |
| 60000.00 | 0.0340 | 1599.68 |
| 60000.00 | 0.0261 | 1599.08 |
| 80000.00 | 0.0996 | 1637.86 |
| 80000.00 | 0.0800 | 1636.47 |
| 80000.00 | 0.0700 | 1635.75 |
| 80000.00 | 0.0603 | 1635.01 |
| 80000.00 | 0.0500 | 1634.24 |
| 80000.00 | 0.0420 | 1633.63 |
| 80000.00 | 0.0340 | 1633.04 |
| 80000.00 | 0.0261 | 1632.42 |
| 100000.00 | 0.0996 | 1670.94 |
| 100000.00 | 0.0800 | 1669.52 |
| 100000.00 | 0.0700 | 1668.8 |
| 100000.00 | 0.0603 | 1668.09 |
| 100000.00 | 0.0500 | 1667.39 |
| 100000.00 | 0.0420 | 1666.77 |
| 100000.00 | 0.0340 | 1666.21 |
| 100000.00 | 0.0261 | 1665.62 |
| 120000.00 | 0.0996 | 1703.65 |
| 120000.00 | 0.0800 | 1702.33 |
| 120000.00 | 0.0700 | 1701.61 |
| 120000.00 | 0.0603 | 1700.93 |
| 120000.00 | 0.0500 | 1700.15 |
| 120000.00 | 0.0420 | 1699.55 |
| 120000.00 | 0.0340 | 1699.0 |
| 120000.00 | 0.0261 | 1698.4 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Cytidine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0130 | 1497.667 |
| 0.0148 | 1497.807 |
| 0.0199 | 1498.185 |
| 0.0242 | 1498.508 |
| 0.0271 | 1498.717 |
| 0.0309 | 1498.997 |
| 0.0370 | 1499.449 |
| 0.0430 | 1499.888 |
| 0.0498 | 1500.385 |
| 0.0635 | 1501.39 |
| 0.0764 | 1502.327 |
| 0.0890 | 1503.232 |
| 0.1022 | 1504.191 |
| 0.1155 | 1505.132 |
| 0.1274 | 1505.981 |
Sources
- Saturation molalities and standard molar enthalpies of solution of cytidine(cr), hypoxanthine(cr), thymidine(cr), thymine(cr), uridine(cr), and xanthine(cr) in H2O(l)
- The partial molar volumes at T = (288.15 to 313.15) K, and the partial molar heat capacities and expansions at T = 298.15 K of cytidine, uridine, and adenosine in aqueous solution
- Volumetric properties of the nucleosides adenosine, cytidine, and uridine in aqueous solution at T=298.15K and P=(10 to120)MPa
- Volumetric studies on nucleic acid bases and nucleosides in aqueous guanidine hydrochloride solutions at T = (288.15 to 318.15) K and at atmospheric pressure
- Solvation behavior of some nucleic acid bases and nucleosides in water and in aqueous guanidine hydrochloride solutions: Viscometric, calorimetric and spectroscopic approach
- Partial Molar Isentropic and Isothermal Compressions of the Nucleosides Adenosine, Cytidine, and Uridine in Aqueous Solution at 298.15 K