- Name
- Dibutyl phthalate
- InChI
- InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
- InChI Key
- DOIRQSBPFJWKBE-UHFFFAOYSA-N
- Formula
- C16H22O4
- SMILES
- CCCCOC(=O)c1ccccc1C(=O)OCCCC
- Mol. Weight (g/mol)
- 278.34
- CAS
- 84-74-2
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Dibutyl phthalate (1) - Liquid mixture 2 | Mass fraction of Acetic acid (2) - Liquid mixture 2 | Mass fraction of Dibutyl phthalate (1) - Liquid mixture 1 | Mass fraction of Acetic acid (2) - Liquid mixture 1 |
| 298.20 | 0.9672 | 0.0164 | 0.0016 | 0.1021 |
| 298.20 | 0.9588 | 0.0206 | 0.0008 | 0.1775 |
| 298.20 | 0.9348 | 0.0326 | 0.0006 | 0.2620 |
| 298.20 | 0.9080 | 0.0460 | 0.0013 | 0.3349 |
| 298.20 | 0.8354 | 0.0823 | 0.0055 | 0.4660 |
| 308.20 | 0.9784 | 0.0108 | 0.0002 | 0.1104 |
| 308.20 | 0.9594 | 0.0203 | 0.0005 | 0.1875 |
| 308.20 | 0.9304 | 0.0348 | 0.0010 | 0.2655 |
| 308.20 | 0.8986 | 0.0507 | 0.0024 | 0.3528 |
| 308.20 | 0.8720 | 0.0640 | 0.0032 | 0.4167 |
| 318.20 | 0.9784 | 0.0108 | 0.0001 | 0.0880 |
| 318.20 | 0.9566 | 0.0217 | 0.0002 | 0.1730 |
| 318.20 | 0.9354 | 0.0323 | 0.0004 | 0.2438 |
| 318.20 | 0.9054 | 0.0473 | 0.0014 | 0.3242 |
| 318.20 | 0.8740 | 0.0630 | 0.0016 | 0.3948 |
Mass fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Acetic acid (2) - Liquid mixture 1 |
| 298.20 | 0.0229 | 0.1494 |
| 298.20 | 0.0410 | 0.2435 |
| 298.20 | 0.0541 | 0.2705 |
| 298.20 | 0.0793 | 0.4076 |
| 298.20 | 0.1110 | 0.4601 |
| 298.20 | 0.1450 | 0.5229 |
| 298.20 | 0.1805 | 0.5804 |
| 298.20 | 0.2144 | 0.6335 |
| 298.20 | 0.2818 | 0.6476 |
| 298.20 | 0.2868 | 0.6473 |
| 298.20 | 0.3733 | 0.6039 |
| 298.20 | 0.4820 | 0.5096 |
| 308.20 | 0.0264 | 0.1487 |
| 308.20 | 0.0407 | 0.2329 |
| 308.20 | 0.0448 | 0.2434 |
| 308.20 | 0.0772 | 0.3711 |
| 308.20 | 0.1082 | 0.4610 |
| 308.20 | 0.1178 | 0.4547 |
| 308.20 | 0.1488 | 0.5238 |
| 308.20 | 0.1823 | 0.5803 |
| 308.20 | 0.2315 | 0.6256 |
| 308.20 | 0.2325 | 0.6233 |
| 308.20 | 0.2834 | 0.6442 |
| 308.20 | 0.3885 | 0.5898 |
| 318.20 | 0.0303 | 0.1512 |
| 318.20 | 0.0466 | 0.2421 |
| 318.20 | 0.0687 | 0.3314 |
| 318.20 | 0.0768 | 0.5500 |
| 318.20 | 0.1003 | 0.4064 |
| 318.20 | 0.1602 | 0.5153 |
| 318.20 | 0.2015 | 0.5890 |
| 318.20 | 0.2039 | 0.4837 |
| 318.20 | 0.2426 | 0.6173 |
| 318.20 | 0.2429 | 0.6159 |
| 318.20 | 0.3095 | 0.6250 |
| 318.20 | 0.3105 | 0.6243 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Dibutyl phthalate (1) - Liquid mixture 2 | Mass fraction of Acetic acid (2) - Liquid mixture 2 | Mass fraction of Dibutyl phthalate (1) - Liquid mixture 1 | Mass fraction of Acetic acid (2) - Liquid mixture 1 |
| 298.20 | 0.9672 | 0.0164 | 0.0016 | 0.1021 |
| 298.20 | 0.9588 | 0.0206 | 0.0008 | 0.1775 |
| 298.20 | 0.9348 | 0.0326 | 0.0006 | 0.2620 |
| 298.20 | 0.9080 | 0.0460 | 0.0013 | 0.3349 |
| 298.20 | 0.8354 | 0.0823 | 0.0055 | 0.4660 |
| 308.20 | 0.9784 | 0.0108 | 0.0002 | 0.1104 |
| 308.20 | 0.9594 | 0.0203 | 0.0005 | 0.1875 |
| 308.20 | 0.9304 | 0.0348 | 0.0010 | 0.2655 |
| 308.20 | 0.8986 | 0.0507 | 0.0024 | 0.3528 |
| 308.20 | 0.8720 | 0.0640 | 0.0032 | 0.4167 |
| 318.20 | 0.9784 | 0.0108 | 0.0001 | 0.0880 |
| 318.20 | 0.9566 | 0.0217 | 0.0002 | 0.1730 |
| 318.20 | 0.9354 | 0.0323 | 0.0004 | 0.2438 |
| 318.20 | 0.9054 | 0.0473 | 0.0014 | 0.3242 |
| 318.20 | 0.8740 | 0.0630 | 0.0016 | 0.3948 |
Mass fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Acetic acid (2) - Liquid mixture 1 |
| 298.20 | 0.0229 | 0.1494 |
| 298.20 | 0.0410 | 0.2435 |
| 298.20 | 0.0541 | 0.2705 |
| 298.20 | 0.0793 | 0.4076 |
| 298.20 | 0.1110 | 0.4601 |
| 298.20 | 0.1450 | 0.5229 |
| 298.20 | 0.1805 | 0.5804 |
| 298.20 | 0.2144 | 0.6335 |
| 298.20 | 0.2818 | 0.6476 |
| 298.20 | 0.2868 | 0.6473 |
| 298.20 | 0.3733 | 0.6039 |
| 298.20 | 0.4820 | 0.5096 |
| 308.20 | 0.0264 | 0.1487 |
| 308.20 | 0.0407 | 0.2329 |
| 308.20 | 0.0448 | 0.2434 |
| 308.20 | 0.0772 | 0.3711 |
| 308.20 | 0.1082 | 0.4610 |
| 308.20 | 0.1178 | 0.4547 |
| 308.20 | 0.1488 | 0.5238 |
| 308.20 | 0.1823 | 0.5803 |
| 308.20 | 0.2315 | 0.6256 |
| 308.20 | 0.2325 | 0.6233 |
| 308.20 | 0.2834 | 0.6442 |
| 308.20 | 0.3885 | 0.5898 |
| 318.20 | 0.0303 | 0.1512 |
| 318.20 | 0.0466 | 0.2421 |
| 318.20 | 0.0687 | 0.3314 |
| 318.20 | 0.0768 | 0.5500 |
| 318.20 | 0.1003 | 0.4064 |
| 318.20 | 0.1602 | 0.5153 |
| 318.20 | 0.2015 | 0.5890 |
| 318.20 | 0.2039 | 0.4837 |
| 318.20 | 0.2426 | 0.6173 |
| 318.20 | 0.2429 | 0.6159 |
| 318.20 | 0.3095 | 0.6250 |
| 318.20 | 0.3105 | 0.6243 |