- Name
- Pentanoic acid, ethyl ester
- InChI
- InChI=1S/C7H14O2/c1-3-5-6-7(8)9-4-2/h3-6H2,1-2H3
- InChI Key
- ICMAFTSLXCXHRK-UHFFFAOYSA-N
- Formula
- C7H14O2
- SMILES
- CCCCC(=O)OCC
- Mol. Weight (g/mol)
- 130.18
- CAS
- 539-82-2
- Name
- Hexane, 1,6-dichloro-
- InChI
- InChI=1S/C6H12Cl2/c7-5-3-1-2-4-6-8/h1-6H2
- InChI Key
- OVISMSJCKCDOPU-UHFFFAOYSA-N
- Formula
- C6H12Cl2
- SMILES
- ClCCCCCCCl
- Mol. Weight (g/mol)
- 155.06
- CAS
- 2163-00-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Pentanoic acid, ethyl ester (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0607 | -0.0181 |
| 0.1270 | -0.0375 |
| 0.1968 | -0.0610 |
| 0.2640 | -0.0857 |
| 0.3289 | -0.1109 |
| 0.3890 | -0.1385 |
| 0.4445 | -0.1662 |
| 0.4953 | -0.1835 |
| 0.5409 | -0.1875 |
| 0.5672 | -0.1884 |
| 0.5813 | -0.1877 |
| 0.6117 | -0.1813 |
| 0.6723 | -0.1653 |
| 0.7364 | -0.1429 |
| 0.8027 | -0.1162 |
| 0.8717 | -0.0828 |
| 0.9373 | -0.0449 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Pentanoic acid, ethyl ester (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0607 | -0.0181 |
| 0.1270 | -0.0375 |
| 0.1968 | -0.0610 |
| 0.2640 | -0.0857 |
| 0.3289 | -0.1109 |
| 0.3890 | -0.1385 |
| 0.4445 | -0.1662 |
| 0.4953 | -0.1835 |
| 0.5409 | -0.1875 |
| 0.5672 | -0.1884 |
| 0.5813 | -0.1877 |
| 0.6117 | -0.1813 |
| 0.6723 | -0.1653 |
| 0.7364 | -0.1429 |
| 0.8027 | -0.1162 |
| 0.8717 | -0.0828 |
| 0.9373 | -0.0449 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Pentanoic acid, ethyl ester (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0538 | 1053.1 |
| 0.1126 | 1041.51 |
| 0.1693 | 1030.36 |
| 0.2307 | 1018.34 |
| 0.2870 | 1007.32 |
| 0.3464 | 995.69 |
| 0.5231 | 961.26 |
| 0.5825 | 949.74 |
| 0.7010 | 926.81 |
| 0.7586 | 915.69 |
| 0.8777 | 892.8 |
| 0.9400 | 880.88 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Pentanoic acid, ethyl ester (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0538 | 1053.1 |
| 0.1126 | 1041.51 |
| 0.1693 | 1030.36 |
| 0.2307 | 1018.34 |
| 0.2870 | 1007.32 |
| 0.3464 | 995.69 |
| 0.5231 | 961.26 |
| 0.5825 | 949.74 |
| 0.7010 | 926.81 |
| 0.7586 | 915.69 |
| 0.8777 | 892.8 |
| 0.9400 | 880.88 |