- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Cyclohexane, methyl-
- InChI
- InChI=1S/C7H14/c1-7-5-3-2-4-6-7/h7H,2-6H2,1H3
- InChI Key
- UAEPNZWRGJTJPN-UHFFFAOYSA-N
- Formula
- C7H14
- SMILES
- CC1CCCCC1
- Mol. Weight (g/mol)
- 98.19
- CAS
- 108-87-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (4)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (4)
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0648 | 0.0018 |
| 0.1102 | 0.0016 |
| 0.1475 | 0.0015 |
| 0.2041 | 0.0013 |
| 0.2422 | 0.0012 |
| 0.3030 | 0.0011 |
| 0.3511 | 0.0010 |
| 0.3947 | 0.0010 |
| 0.4603 | 0.0009 |
| 0.4954 | 0.0009 |
| 0.5589 | 0.0008 |
| 0.5780 | 0.0008 |
| 0.6707 | 0.0007 |
| 0.7727 | 0.0007 |
| 0.9011 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0021 |
| 298.15 | 0.1001 | 0.0016 |
| 298.15 | 0.2033 | 0.0013 |
| 298.15 | 0.3065 | 0.0011 |
| 298.15 | 0.4049 | 0.0010 |
| 298.15 | 0.5034 | 0.0008 |
| 298.15 | 0.6022 | 0.0008 |
| 298.15 | 0.7009 | 0.0007 |
| 298.15 | 0.8021 | 0.0007 |
| 298.15 | 0.9032 | 0.0007 |
| 298.15 | 1.0000 | 0.0007 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.1001 | 0.0014 |
| 303.15 | 0.2033 | 0.0012 |
| 303.15 | 0.3065 | 0.0010 |
| 303.15 | 0.4049 | 0.0009 |
| 303.15 | 0.5034 | 0.0008 |
| 303.15 | 0.6022 | 0.0007 |
| 303.15 | 0.7009 | 0.0007 |
| 303.15 | 0.8021 | 0.0007 |
| 303.15 | 0.9032 | 0.0006 |
| 303.15 | 1.0000 | 0.0006 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.1001 | 0.0012 |
| 308.15 | 0.2033 | 0.0010 |
| 308.15 | 0.3065 | 0.0009 |
| 308.15 | 0.4049 | 0.0008 |
| 308.15 | 0.5034 | 0.0007 |
| 308.15 | 0.6022 | 0.0007 |
| 308.15 | 0.7009 | 0.0006 |
| 308.15 | 0.8021 | 0.0006 |
| 308.15 | 0.9032 | 0.0006 |
| 308.15 | 1.0000 | 0.0006 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0648 | 0.0018 |
| 0.1102 | 0.0016 |
| 0.1475 | 0.0015 |
| 0.2041 | 0.0013 |
| 0.2422 | 0.0012 |
| 0.3030 | 0.0011 |
| 0.3511 | 0.0010 |
| 0.3947 | 0.0010 |
| 0.4603 | 0.0009 |
| 0.4954 | 0.0009 |
| 0.5589 | 0.0008 |
| 0.5780 | 0.0008 |
| 0.6707 | 0.0007 |
| 0.7727 | 0.0007 |
| 0.9011 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0021 |
| 298.15 | 0.1001 | 0.0016 |
| 298.15 | 0.2033 | 0.0013 |
| 298.15 | 0.3065 | 0.0011 |
| 298.15 | 0.4049 | 0.0010 |
| 298.15 | 0.5034 | 0.0008 |
| 298.15 | 0.6022 | 0.0008 |
| 298.15 | 0.7009 | 0.0007 |
| 298.15 | 0.8021 | 0.0007 |
| 298.15 | 0.9032 | 0.0007 |
| 298.15 | 1.0000 | 0.0007 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.1001 | 0.0014 |
| 303.15 | 0.2033 | 0.0012 |
| 303.15 | 0.3065 | 0.0010 |
| 303.15 | 0.4049 | 0.0009 |
| 303.15 | 0.5034 | 0.0008 |
| 303.15 | 0.6022 | 0.0007 |
| 303.15 | 0.7009 | 0.0007 |
| 303.15 | 0.8021 | 0.0007 |
| 303.15 | 0.9032 | 0.0006 |
| 303.15 | 1.0000 | 0.0006 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.1001 | 0.0012 |
| 308.15 | 0.2033 | 0.0010 |
| 308.15 | 0.3065 | 0.0009 |
| 308.15 | 0.4049 | 0.0008 |
| 308.15 | 0.5034 | 0.0007 |
| 308.15 | 0.6022 | 0.0007 |
| 308.15 | 0.7009 | 0.0006 |
| 308.15 | 0.8021 | 0.0006 |
| 308.15 | 0.9032 | 0.0006 |
| 308.15 | 1.0000 | 0.0006 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3765 |
| 298.15 | 0.1001 | 1.3822 |
| 298.15 | 0.2033 | 1.3879 |
| 298.15 | 0.3065 | 1.3936 |
| 298.15 | 0.4049 | 1.3983 |
| 298.15 | 0.5034 | 1.4029 |
| 298.15 | 0.6022 | 1.4068 |
| 298.15 | 0.7009 | 1.4106 |
| 298.15 | 0.8021 | 1.4145 |
| 298.15 | 0.9032 | 1.4184 |
| 298.15 | 1.0000 | 1.4217 |
| 303.15 | 0.0000 | 1.3741 |
| 303.15 | 0.1001 | 1.3798 |
| 303.15 | 0.2033 | 1.3854 |
| 303.15 | 0.3065 | 1.3909 |
| 303.15 | 0.4049 | 1.3956 |
| 303.15 | 0.5034 | 1.4001 |
| 303.15 | 0.6022 | 1.404 |
| 303.15 | 0.7009 | 1.408 |
| 303.15 | 0.8021 | 1.4118 |
| 303.15 | 0.9032 | 1.4158 |
| 303.15 | 1.0000 | 1.4192 |
| 308.15 | 0.0000 | 1.3716 |
| 308.15 | 0.1001 | 1.3775 |
| 308.15 | 0.2033 | 1.3829 |
| 308.15 | 0.3065 | 1.3883 |
| 308.15 | 0.4049 | 1.3928 |
| 308.15 | 0.5034 | 1.3973 |
| 308.15 | 0.6022 | 1.4013 |
| 308.15 | 0.7009 | 1.4053 |
| 308.15 | 0.8021 | 1.4092 |
| 308.15 | 0.9032 | 1.413 |
| 308.15 | 1.0000 | 1.4163 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3765 |
| 298.15 | 0.1001 | 1.3822 |
| 298.15 | 0.2033 | 1.3879 |
| 298.15 | 0.3065 | 1.3936 |
| 298.15 | 0.4049 | 1.3983 |
| 298.15 | 0.5034 | 1.4029 |
| 298.15 | 0.6022 | 1.4068 |
| 298.15 | 0.7009 | 1.4106 |
| 298.15 | 0.8021 | 1.4145 |
| 298.15 | 0.9032 | 1.4184 |
| 298.15 | 1.0000 | 1.4217 |
| 303.15 | 0.0000 | 1.3741 |
| 303.15 | 0.1001 | 1.3798 |
| 303.15 | 0.2033 | 1.3854 |
| 303.15 | 0.3065 | 1.3909 |
| 303.15 | 0.4049 | 1.3956 |
| 303.15 | 0.5034 | 1.4001 |
| 303.15 | 0.6022 | 1.404 |
| 303.15 | 0.7009 | 1.408 |
| 303.15 | 0.8021 | 1.4118 |
| 303.15 | 0.9032 | 1.4158 |
| 303.15 | 1.0000 | 1.4192 |
| 308.15 | 0.0000 | 1.3716 |
| 308.15 | 0.1001 | 1.3775 |
| 308.15 | 0.2033 | 1.3829 |
| 308.15 | 0.3065 | 1.3883 |
| 308.15 | 0.4049 | 1.3928 |
| 308.15 | 0.5034 | 1.3973 |
| 308.15 | 0.6022 | 1.4013 |
| 308.15 | 0.7009 | 1.4053 |
| 308.15 | 0.8021 | 1.4092 |
| 308.15 | 0.9032 | 1.413 |
| 308.15 | 1.0000 | 1.4163 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0648 | 778.57 |
| 0.1102 | 776.98 |
| 0.1475 | 775.78 |
| 0.2041 | 774.1 |
| 0.2422 | 773.07 |
| 0.3030 | 771.57 |
| 0.3511 | 770.5 |
| 0.3947 | 769.61 |
| 0.4603 | 768.4 |
| 0.4954 | 767.81 |
| 0.5589 | 766.86 |
| 0.5780 | 766.6 |
| 0.6707 | 765.53 |
| 0.7727 | 764.75 |
| 0.9011 | 764.45 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 781.05 |
| 298.15 | 0.1001 | 777.28 |
| 298.15 | 0.2033 | 774.39 |
| 298.15 | 0.3065 | 771.5 |
| 298.15 | 0.4049 | 769.55 |
| 298.15 | 0.5034 | 767.6 |
| 298.15 | 0.6022 | 766.22 |
| 298.15 | 0.7009 | 765.17 |
| 298.15 | 0.8021 | 764.75 |
| 298.15 | 0.9032 | 764.43 |
| 298.15 | 1.0000 | 764.99 |
| 303.15 | 0.0000 | 776.79 |
| 303.15 | 0.1001 | 772.86 |
| 303.15 | 0.2033 | 769.88 |
| 303.15 | 0.3065 | 766.95 |
| 303.15 | 0.4049 | 764.95 |
| 303.15 | 0.5034 | 763.01 |
| 303.15 | 0.6022 | 761.62 |
| 303.15 | 0.7009 | 760.61 |
| 303.15 | 0.8021 | 760.25 |
| 303.15 | 0.9032 | 759.88 |
| 303.15 | 1.0000 | 760.66 |
| 308.15 | 0.0000 | 772.43 |
| 308.15 | 0.1001 | 768.43 |
| 308.15 | 0.2033 | 765.38 |
| 308.15 | 0.3065 | 762.32 |
| 308.15 | 0.4049 | 760.33 |
| 308.15 | 0.5034 | 758.34 |
| 308.15 | 0.6022 | 757.0 |
| 308.15 | 0.7009 | 756.0 |
| 308.15 | 0.8021 | 755.69 |
| 308.15 | 0.9032 | 755.37 |
| 308.15 | 1.0000 | 756.3 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0648 | 778.57 |
| 0.1102 | 776.98 |
| 0.1475 | 775.78 |
| 0.2041 | 774.1 |
| 0.2422 | 773.07 |
| 0.3030 | 771.57 |
| 0.3511 | 770.5 |
| 0.3947 | 769.61 |
| 0.4603 | 768.4 |
| 0.4954 | 767.81 |
| 0.5589 | 766.86 |
| 0.5780 | 766.6 |
| 0.6707 | 765.53 |
| 0.7727 | 764.75 |
| 0.9011 | 764.45 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 781.05 |
| 298.15 | 0.1001 | 777.28 |
| 298.15 | 0.2033 | 774.39 |
| 298.15 | 0.3065 | 771.5 |
| 298.15 | 0.4049 | 769.55 |
| 298.15 | 0.5034 | 767.6 |
| 298.15 | 0.6022 | 766.22 |
| 298.15 | 0.7009 | 765.17 |
| 298.15 | 0.8021 | 764.75 |
| 298.15 | 0.9032 | 764.43 |
| 298.15 | 1.0000 | 764.99 |
| 303.15 | 0.0000 | 776.79 |
| 303.15 | 0.1001 | 772.86 |
| 303.15 | 0.2033 | 769.88 |
| 303.15 | 0.3065 | 766.95 |
| 303.15 | 0.4049 | 764.95 |
| 303.15 | 0.5034 | 763.01 |
| 303.15 | 0.6022 | 761.62 |
| 303.15 | 0.7009 | 760.61 |
| 303.15 | 0.8021 | 760.25 |
| 303.15 | 0.9032 | 759.88 |
| 303.15 | 1.0000 | 760.66 |
| 308.15 | 0.0000 | 772.43 |
| 308.15 | 0.1001 | 768.43 |
| 308.15 | 0.2033 | 765.38 |
| 308.15 | 0.3065 | 762.32 |
| 308.15 | 0.4049 | 760.33 |
| 308.15 | 0.5034 | 758.34 |
| 308.15 | 0.6022 | 757.0 |
| 308.15 | 0.7009 | 756.0 |
| 308.15 | 0.8021 | 755.69 |
| 308.15 | 0.9032 | 755.37 |
| 308.15 | 1.0000 | 756.3 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.1123 | 1143.0 |
| 0.2053 | 1143.0 |
| 0.3034 | 1144.0 |
| 0.3937 | 1148.0 |
| 0.5031 | 1155.0 |
| 0.5788 | 1160.0 |
| 0.6715 | 1168.0 |
| 0.7466 | 1176.0 |
| 0.7715 | 1178.0 |
| 0.8299 | 1184.0 |
| 0.8993 | 1194.0 |
| 0.9472 | 1201.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1144.0 |
| 0.1001 | 1151.0 |
| 0.2033 | 1159.0 |
| 0.3065 | 1166.0 |
| 0.4049 | 1173.0 |
| 0.5034 | 1181.0 |
| 0.6022 | 1188.0 |
| 0.7009 | 1195.0 |
| 0.8021 | 1203.0 |
| 0.9032 | 1210.0 |
| 1.0000 | 1217.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.1123 | 1143.0 |
| 0.2053 | 1143.0 |
| 0.3034 | 1144.0 |
| 0.3937 | 1148.0 |
| 0.5031 | 1155.0 |
| 0.5788 | 1160.0 |
| 0.6715 | 1168.0 |
| 0.7466 | 1176.0 |
| 0.7715 | 1178.0 |
| 0.8299 | 1184.0 |
| 0.8993 | 1194.0 |
| 0.9472 | 1201.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1144.0 |
| 0.1001 | 1151.0 |
| 0.2033 | 1159.0 |
| 0.3065 | 1166.0 |
| 0.4049 | 1173.0 |
| 0.5034 | 1181.0 |
| 0.6022 | 1188.0 |
| 0.7009 | 1195.0 |
| 0.8021 | 1203.0 |
| 0.9032 | 1210.0 |
| 1.0000 | 1217.0 |
Sources
- Speeds of sound, isentropic compressibilities, viscosities and excess molar volumes of binary mixtures of methylcyclohexane + 2-alkanols or ethanol at T = 298.15 K
- Physico-chemical and excess properties of the binary mixtures of methylcyclohexane + ethanol, + propan-1-ol, + propan-2-ol, + butan-1-ol, + 2-methyl-1-propanol, or 3-methyl-1-butanol at T = (298.15, 303.15, and 308.15) K