- Name
- Tetrahydrofuran
- InChI
- InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2
- InChI Key
- WYURNTSHIVDZCO-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- C1CCOC1
- Mol. Weight (g/mol)
- 72.11
- CAS
- 109-99-9
- Name
- Ethane, 1,1,2,2-tetrachloro-
- InChI
- InChI=1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H
- InChI Key
- QPFMBZIOSGYJDE-UHFFFAOYSA-N
- Formula
- C2H2Cl4
- SMILES
- ClC(Cl)C(Cl)Cl
- Mol. Weight (g/mol)
- 167.85
- CAS
- 79-34-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- Pvap - Vapor or sublimation pressure, kPa (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.1023 | 0.0014 |
| 0.2128 | 0.0013 |
| 0.3093 | 0.0012 |
| 0.4056 | 0.0011 |
| 0.5093 | 0.0010 |
| 0.6032 | 0.0009 |
| 0.7046 | 0.0008 |
| 0.8008 | 0.0007 |
| 0.8973 | 0.0006 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.1023 | 0.0014 |
| 0.2128 | 0.0013 |
| 0.3093 | 0.0012 |
| 0.4056 | 0.0011 |
| 0.5093 | 0.0010 |
| 0.6032 | 0.0009 |
| 0.7046 | 0.0008 |
| 0.8008 | 0.0007 |
| 0.8973 | 0.0006 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,2,2-tetrachloro- (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 283.15 | 0.0536 | 10.07 |
| 283.15 | 0.1168 | 9.18 |
| 283.15 | 0.2101 | 7.54 |
| 283.15 | 0.2724 | 6.44 |
| 283.15 | 0.3585 | 4.87 |
| 283.15 | 0.4236 | 3.85 |
| 283.15 | 0.5227 | 2.55 |
| 283.15 | 0.6101 | 1.69 |
| 283.15 | 0.6565 | 1.37 |
| 283.15 | 0.7444 | 0.92 |
| 283.15 | 0.7906 | 0.72 |
| 283.15 | 0.8433 | 0.55 |
| 283.15 | 0.9548 | 0.32 |
| 288.15 | 0.0537 | 12.84 |
| 288.15 | 0.1168 | 11.67 |
| 288.15 | 0.2102 | 9.66 |
| 288.15 | 0.2725 | 8.27 |
| 288.15 | 0.3586 | 6.30 |
| 288.15 | 0.4237 | 5.01 |
| 288.15 | 0.5228 | 3.36 |
| 288.15 | 0.6101 | 2.29 |
| 288.15 | 0.6566 | 1.88 |
| 288.15 | 0.7445 | 1.26 |
| 288.15 | 0.7906 | 0.99 |
| 288.15 | 0.8433 | 0.80 |
| 288.15 | 0.9548 | 0.47 |
| 293.15 | 0.0536 | 16.22 |
| 293.15 | 0.1169 | 14.76 |
| 293.15 | 0.2104 | 12.26 |
| 293.15 | 0.2727 | 10.49 |
| 293.15 | 0.3588 | 8.07 |
| 293.15 | 0.4238 | 6.48 |
| 293.15 | 0.5228 | 4.38 |
| 293.15 | 0.6102 | 3.01 |
| 293.15 | 0.6566 | 2.48 |
| 293.15 | 0.7445 | 1.69 |
| 293.15 | 0.7907 | 1.35 |
| 293.15 | 0.8433 | 1.08 |
| 293.15 | 0.9548 | 0.67 |
| 298.15 | 0.0537 | 20.30 |
| 298.15 | 0.1168 | 18.47 |
| 298.15 | 0.2106 | 15.38 |
| 298.15 | 0.2730 | 13.21 |
| 298.15 | 0.3590 | 10.24 |
| 298.15 | 0.4239 | 8.23 |
| 298.15 | 0.5229 | 5.64 |
| 298.15 | 0.6103 | 3.93 |
| 298.15 | 0.6567 | 3.24 |
| 298.15 | 0.7445 | 2.25 |
| 298.15 | 0.7907 | 1.80 |
| 298.15 | 0.8434 | 1.44 |
| 298.15 | 0.9548 | 0.89 |
| 303.15 | 0.0537 | 25.23 |
| 303.15 | 0.1169 | 22.97 |
| 303.15 | 0.2103 | 19.22 |
| 303.15 | 0.2727 | 16.55 |
| 303.15 | 0.3593 | 12.91 |
| 303.15 | 0.4241 | 10.44 |
| 303.15 | 0.5230 | 7.23 |
| 303.15 | 0.6104 | 5.09 |
| 303.15 | 0.6568 | 4.22 |
| 303.15 | 0.7446 | 2.97 |
| 303.15 | 0.7907 | 2.38 |
| 303.15 | 0.8434 | 1.92 |
| 303.15 | 0.9548 | 1.20 |
| 308.15 | 0.0537 | 30.96 |
| 308.15 | 0.1169 | 28.32 |
| 308.15 | 0.2105 | 23.72 |
| 308.15 | 0.2730 | 20.49 |
| 308.15 | 0.3596 | 16.02 |
| 308.15 | 0.4244 | 13.08 |
| 308.15 | 0.5232 | 9.15 |
| 308.15 | 0.6105 | 6.50 |
| 308.15 | 0.6569 | 5.42 |
| 308.15 | 0.7447 | 3.83 |
| 308.15 | 0.7908 | 3.13 |
| 308.15 | 0.8434 | 2.55 |
| 308.15 | 0.9548 | 1.58 |
| 313.15 | 0.0537 | 37.78 |
| 313.15 | 0.1170 | 34.58 |
| 313.15 | 0.2106 | 29.03 |
| 313.15 | 0.2731 | 25.14 |
| 313.15 | 0.3591 | 19.86 |
| 313.15 | 0.4240 | 16.26 |
| 313.15 | 0.5234 | 11.44 |
| 313.15 | 0.6107 | 8.18 |
| 313.15 | 0.6570 | 6.87 |
| 313.15 | 0.7448 | 4.90 |
| 313.15 | 0.7908 | 4.00 |
| 313.15 | 0.8434 | 3.28 |
| 313.15 | 0.9548 | 2.07 |
| 318.15 | 0.0538 | 45.78 |
| 318.15 | 0.1171 | 41.89 |
| 318.15 | 0.2109 | 35.24 |
| 318.15 | 0.2735 | 30.59 |
| 318.15 | 0.3592 | 24.31 |
| 318.15 | 0.4242 | 19.99 |
| 318.15 | 0.5238 | 14.20 |
| 318.15 | 0.6110 | 10.23 |
| 318.15 | 0.6572 | 8.64 |
| 318.15 | 0.7449 | 6.20 |
| 318.15 | 0.7909 | 5.14 |
| 318.15 | 0.8435 | 4.20 |
| 318.15 | 0.9548 | 2.69 |
| 323.15 | 0.0540 | 55.02 |
| 323.15 | 0.1173 | 50.43 |
| 323.15 | 0.2109 | 42.50 |
| 323.15 | 0.2738 | 36.95 |
| 323.15 | 0.3596 | 29.50 |
| 323.15 | 0.4244 | 24.40 |
| 323.15 | 0.5234 | 17.57 |
| 323.15 | 0.6114 | 12.73 |
| 323.15 | 0.6575 | 10.79 |
| 323.15 | 0.7452 | 7.79 |
| 323.15 | 0.7910 | 6.51 |
| 323.15 | 0.8436 | 5.37 |
| 323.15 | 0.9549 | 3.45 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,1,2,2-tetrachloro- (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 283.15 | 0.0536 | 10.07 |
| 283.15 | 0.1168 | 9.18 |
| 283.15 | 0.2101 | 7.54 |
| 283.15 | 0.2724 | 6.44 |
| 283.15 | 0.3585 | 4.87 |
| 283.15 | 0.4236 | 3.85 |
| 283.15 | 0.5227 | 2.55 |
| 283.15 | 0.6101 | 1.69 |
| 283.15 | 0.6565 | 1.37 |
| 283.15 | 0.7444 | 0.92 |
| 283.15 | 0.7906 | 0.72 |
| 283.15 | 0.8433 | 0.55 |
| 283.15 | 0.9548 | 0.32 |
| 288.15 | 0.0537 | 12.84 |
| 288.15 | 0.1168 | 11.67 |
| 288.15 | 0.2102 | 9.66 |
| 288.15 | 0.2725 | 8.27 |
| 288.15 | 0.3586 | 6.30 |
| 288.15 | 0.4237 | 5.01 |
| 288.15 | 0.5228 | 3.36 |
| 288.15 | 0.6101 | 2.29 |
| 288.15 | 0.6566 | 1.88 |
| 288.15 | 0.7445 | 1.26 |
| 288.15 | 0.7906 | 0.99 |
| 288.15 | 0.8433 | 0.80 |
| 288.15 | 0.9548 | 0.47 |
| 293.15 | 0.0536 | 16.22 |
| 293.15 | 0.1169 | 14.76 |
| 293.15 | 0.2104 | 12.26 |
| 293.15 | 0.2727 | 10.49 |
| 293.15 | 0.3588 | 8.07 |
| 293.15 | 0.4238 | 6.48 |
| 293.15 | 0.5228 | 4.38 |
| 293.15 | 0.6102 | 3.01 |
| 293.15 | 0.6566 | 2.48 |
| 293.15 | 0.7445 | 1.69 |
| 293.15 | 0.7907 | 1.35 |
| 293.15 | 0.8433 | 1.08 |
| 293.15 | 0.9548 | 0.67 |
| 298.15 | 0.0537 | 20.30 |
| 298.15 | 0.1168 | 18.47 |
| 298.15 | 0.2106 | 15.38 |
| 298.15 | 0.2730 | 13.21 |
| 298.15 | 0.3590 | 10.24 |
| 298.15 | 0.4239 | 8.23 |
| 298.15 | 0.5229 | 5.64 |
| 298.15 | 0.6103 | 3.93 |
| 298.15 | 0.6567 | 3.24 |
| 298.15 | 0.7445 | 2.25 |
| 298.15 | 0.7907 | 1.80 |
| 298.15 | 0.8434 | 1.44 |
| 298.15 | 0.9548 | 0.89 |
| 303.15 | 0.0537 | 25.23 |
| 303.15 | 0.1169 | 22.97 |
| 303.15 | 0.2103 | 19.22 |
| 303.15 | 0.2727 | 16.55 |
| 303.15 | 0.3593 | 12.91 |
| 303.15 | 0.4241 | 10.44 |
| 303.15 | 0.5230 | 7.23 |
| 303.15 | 0.6104 | 5.09 |
| 303.15 | 0.6568 | 4.22 |
| 303.15 | 0.7446 | 2.97 |
| 303.15 | 0.7907 | 2.38 |
| 303.15 | 0.8434 | 1.92 |
| 303.15 | 0.9548 | 1.20 |
| 308.15 | 0.0537 | 30.96 |
| 308.15 | 0.1169 | 28.32 |
| 308.15 | 0.2105 | 23.72 |
| 308.15 | 0.2730 | 20.49 |
| 308.15 | 0.3596 | 16.02 |
| 308.15 | 0.4244 | 13.08 |
| 308.15 | 0.5232 | 9.15 |
| 308.15 | 0.6105 | 6.50 |
| 308.15 | 0.6569 | 5.42 |
| 308.15 | 0.7447 | 3.83 |
| 308.15 | 0.7908 | 3.13 |
| 308.15 | 0.8434 | 2.55 |
| 308.15 | 0.9548 | 1.58 |
| 313.15 | 0.0537 | 37.78 |
| 313.15 | 0.1170 | 34.58 |
| 313.15 | 0.2106 | 29.03 |
| 313.15 | 0.2731 | 25.14 |
| 313.15 | 0.3591 | 19.86 |
| 313.15 | 0.4240 | 16.26 |
| 313.15 | 0.5234 | 11.44 |
| 313.15 | 0.6107 | 8.18 |
| 313.15 | 0.6570 | 6.87 |
| 313.15 | 0.7448 | 4.90 |
| 313.15 | 0.7908 | 4.00 |
| 313.15 | 0.8434 | 3.28 |
| 313.15 | 0.9548 | 2.07 |
| 318.15 | 0.0538 | 45.78 |
| 318.15 | 0.1171 | 41.89 |
| 318.15 | 0.2109 | 35.24 |
| 318.15 | 0.2735 | 30.59 |
| 318.15 | 0.3592 | 24.31 |
| 318.15 | 0.4242 | 19.99 |
| 318.15 | 0.5238 | 14.20 |
| 318.15 | 0.6110 | 10.23 |
| 318.15 | 0.6572 | 8.64 |
| 318.15 | 0.7449 | 6.20 |
| 318.15 | 0.7909 | 5.14 |
| 318.15 | 0.8435 | 4.20 |
| 318.15 | 0.9548 | 2.69 |
| 323.15 | 0.0540 | 55.02 |
| 323.15 | 0.1173 | 50.43 |
| 323.15 | 0.2109 | 42.50 |
| 323.15 | 0.2738 | 36.95 |
| 323.15 | 0.3596 | 29.50 |
| 323.15 | 0.4244 | 24.40 |
| 323.15 | 0.5234 | 17.57 |
| 323.15 | 0.6114 | 12.73 |
| 323.15 | 0.6575 | 10.79 |
| 323.15 | 0.7452 | 7.79 |
| 323.15 | 0.7910 | 6.51 |
| 323.15 | 0.8436 | 5.37 |
| 323.15 | 0.9549 | 3.45 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.1023 | 1.483 |
| 0.2128 | 1.476 |
| 0.3093 | 1.4701 |
| 0.4056 | 1.4639 |
| 0.5093 | 1.4556 |
| 0.6032 | 1.4472 |
| 0.7046 | 1.4368 |
| 0.8008 | 1.4268 |
| 0.8973 | 1.416 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.1023 | 1.483 |
| 0.2128 | 1.476 |
| 0.3093 | 1.4701 |
| 0.4056 | 1.4639 |
| 0.5093 | 1.4556 |
| 0.6032 | 1.4472 |
| 0.7046 | 1.4368 |
| 0.8008 | 1.4268 |
| 0.8973 | 1.416 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.1023 | 1523.21 |
| 0.2128 | 1460.02 |
| 0.3093 | 1401.59 |
| 0.4056 | 1340.18 |
| 0.5093 | 1270.31 |
| 0.6032 | 1203.28 |
| 0.7046 | 1126.91 |
| 0.8008 | 1050.12 |
| 0.8973 | 968.58 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.1023 | 1523.21 |
| 0.2128 | 1460.02 |
| 0.3093 | 1401.59 |
| 0.4056 | 1340.18 |
| 0.5093 | 1270.31 |
| 0.6032 | 1203.28 |
| 0.7046 | 1126.91 |
| 0.8008 | 1050.12 |
| 0.8973 | 968.58 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.1023 | 1138.0 |
| 0.2128 | 1143.0 |
| 0.3093 | 1149.0 |
| 0.4056 | 1157.0 |
| 0.5093 | 1168.0 |
| 0.6032 | 1180.0 |
| 0.7046 | 1195.0 |
| 0.8008 | 1212.0 |
| 0.8973 | 1231.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.1023 | 1138.0 |
| 0.2128 | 1143.0 |
| 0.3093 | 1149.0 |
| 0.4056 | 1157.0 |
| 0.5093 | 1168.0 |
| 0.6032 | 1180.0 |
| 0.7046 | 1195.0 |
| 0.8008 | 1212.0 |
| 0.8973 | 1231.0 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.8 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 417.45 |
| 0.1565 | 406.55 |
| 0.3576 | 390.45 |
| 0.4812 | 379.65 |
| 0.6024 | 368.75 |
| 0.6944 | 360.35 |
| 0.8197 | 349.55 |
| 0.9009 | 342.15 |
| 1.0000 | 337.55 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.8 (Liquid)
| Mole fraction of Tetrahydrofuran (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 417.45 |
| 0.1565 | 406.55 |
| 0.3576 | 390.45 |
| 0.4812 | 379.65 |
| 0.6024 | 368.75 |
| 0.6944 | 360.35 |
| 0.8197 | 349.55 |
| 0.9009 | 342.15 |
| 1.0000 | 337.55 |
Sources
- Isothermal (vapour + liquid) equilibrium for binary mixtures of (tetrahydrofuran + 1,1,2,2-tetrachloroethane or tetrachloroethene) at nine temperatures
- Densities, speeds of sound, isentropic compressibilities, refractive indexes, and viscosities of tetrahydrofuran with haloalkane or alkyl ethanoate at T = 303.15 K
- Bubble-Temperature Measurements on Some Binary Mixtures Formed by Tetrahydrofuran or Amyl Alcohol with Hydrocarbons, Chlorohydrocarbons, or Butanols at (94.6 or 95.8) kPa