- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Cyclohexane, methyl-
- InChI
- InChI=1S/C7H14/c1-7-5-3-2-4-6-7/h7H,2-6H2,1H3
- InChI Key
- UAEPNZWRGJTJPN-UHFFFAOYSA-N
- Formula
- C7H14
- SMILES
- CC1CCCCC1
- Mol. Weight (g/mol)
- 98.19
- CAS
- 108-87-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (4)
- Tboil - Boiling temperature at pressure P, K (2)
Mole fraction of Cyclohexane, methyl- (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Gas |
|---|---|
| 0.0560 | 0.1640 |
| 0.1530 | 0.3710 |
| 0.1980 | 0.4320 |
| 0.2440 | 0.5060 |
| 0.3000 | 0.5690 |
| 0.3530 | 0.6280 |
| 0.4540 | 0.7250 |
| 0.5020 | 0.7590 |
| 0.5440 | 0.7910 |
| 0.5980 | 0.8190 |
| 0.6480 | 0.8470 |
| 0.6950 | 0.8700 |
| 0.7450 | 0.8980 |
| 0.8100 | 0.9260 |
| 0.8500 | 0.9450 |
| 0.9010 | 0.9650 |
| 0.9460 | 0.9810 |
| 0.9800 | 0.9930 |
Mole fraction of Cyclohexane, methyl- (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Gas |
|---|---|
| 0.0560 | 0.1640 |
| 0.1530 | 0.3710 |
| 0.1980 | 0.4320 |
| 0.2440 | 0.5060 |
| 0.3000 | 0.5690 |
| 0.3530 | 0.6280 |
| 0.4540 | 0.7250 |
| 0.5020 | 0.7590 |
| 0.5440 | 0.7910 |
| 0.5980 | 0.8190 |
| 0.6480 | 0.8470 |
| 0.6950 | 0.8700 |
| 0.7450 | 0.8980 |
| 0.8100 | 0.9260 |
| 0.8500 | 0.9450 |
| 0.9010 | 0.9650 |
| 0.9460 | 0.9810 |
| 0.9800 | 0.9930 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.0993 | 0.0006 |
| 298.15 | 0.2037 | 0.0006 |
| 298.15 | 0.3028 | 0.0006 |
| 298.15 | 0.4047 | 0.0006 |
| 298.15 | 0.5382 | 0.0006 |
| 298.15 | 0.6035 | 0.0006 |
| 298.15 | 0.7030 | 0.0006 |
| 298.15 | 0.8037 | 0.0006 |
| 298.15 | 0.8981 | 0.0006 |
| 298.15 | 1.0000 | 0.0007 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.0993 | 0.0006 |
| 303.15 | 0.2037 | 0.0006 |
| 303.15 | 0.3028 | 0.0006 |
| 303.15 | 0.4047 | 0.0006 |
| 303.15 | 0.5382 | 0.0006 |
| 303.15 | 0.6035 | 0.0006 |
| 303.15 | 0.7030 | 0.0006 |
| 303.15 | 0.8037 | 0.0006 |
| 303.15 | 0.8981 | 0.0006 |
| 303.15 | 1.0000 | 0.0006 |
| 308.15 | 0.0000 | 0.0005 |
| 308.15 | 0.0993 | 0.0005 |
| 308.15 | 0.2037 | 0.0005 |
| 308.15 | 0.3028 | 0.0005 |
| 308.15 | 0.4047 | 0.0005 |
| 308.15 | 0.5382 | 0.0005 |
| 308.15 | 0.6035 | 0.0005 |
| 308.15 | 0.7030 | 0.0005 |
| 308.15 | 0.8037 | 0.0006 |
| 308.15 | 0.8981 | 0.0006 |
| 308.15 | 1.0000 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.0993 | 0.0006 |
| 298.15 | 0.2037 | 0.0006 |
| 298.15 | 0.3028 | 0.0006 |
| 298.15 | 0.4047 | 0.0006 |
| 298.15 | 0.5382 | 0.0006 |
| 298.15 | 0.6035 | 0.0006 |
| 298.15 | 0.7030 | 0.0006 |
| 298.15 | 0.8037 | 0.0006 |
| 298.15 | 0.8981 | 0.0006 |
| 298.15 | 1.0000 | 0.0007 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.0993 | 0.0006 |
| 303.15 | 0.2037 | 0.0006 |
| 303.15 | 0.3028 | 0.0006 |
| 303.15 | 0.4047 | 0.0006 |
| 303.15 | 0.5382 | 0.0006 |
| 303.15 | 0.6035 | 0.0006 |
| 303.15 | 0.7030 | 0.0006 |
| 303.15 | 0.8037 | 0.0006 |
| 303.15 | 0.8981 | 0.0006 |
| 303.15 | 1.0000 | 0.0006 |
| 308.15 | 0.0000 | 0.0005 |
| 308.15 | 0.0993 | 0.0005 |
| 308.15 | 0.2037 | 0.0005 |
| 308.15 | 0.3028 | 0.0005 |
| 308.15 | 0.4047 | 0.0005 |
| 308.15 | 0.5382 | 0.0005 |
| 308.15 | 0.6035 | 0.0005 |
| 308.15 | 0.7030 | 0.0005 |
| 308.15 | 0.8037 | 0.0006 |
| 308.15 | 0.8981 | 0.0006 |
| 308.15 | 1.0000 | 0.0006 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4926 |
| 298.15 | 0.0993 | 1.4848 |
| 298.15 | 0.2037 | 1.4767 |
| 298.15 | 0.3028 | 1.469 |
| 298.15 | 0.4047 | 1.4615 |
| 298.15 | 0.5382 | 1.4519 |
| 298.15 | 0.6035 | 1.4473 |
| 298.15 | 0.7030 | 1.4405 |
| 298.15 | 0.8037 | 1.4338 |
| 298.15 | 0.8981 | 1.4279 |
| 298.15 | 1.0000 | 1.4217 |
| 303.15 | 0.0000 | 1.4893 |
| 303.15 | 0.0993 | 1.482 |
| 303.15 | 0.2037 | 1.4743 |
| 303.15 | 0.3028 | 1.4668 |
| 303.15 | 0.4047 | 1.4594 |
| 303.15 | 0.5382 | 1.4498 |
| 303.15 | 0.6035 | 1.4451 |
| 303.15 | 0.7030 | 1.4384 |
| 303.15 | 0.8037 | 1.4314 |
| 303.15 | 0.8981 | 1.4253 |
| 303.15 | 1.0000 | 1.4192 |
| 308.15 | 0.0000 | 1.4867 |
| 308.15 | 0.0993 | 1.4793 |
| 308.15 | 0.2037 | 1.4718 |
| 308.15 | 0.3028 | 1.4646 |
| 308.15 | 0.4047 | 1.4572 |
| 308.15 | 0.5382 | 1.4476 |
| 308.15 | 0.6035 | 1.443 |
| 308.15 | 0.7030 | 1.4362 |
| 308.15 | 0.8037 | 1.429 |
| 308.15 | 0.8981 | 1.4228 |
| 308.15 | 1.0000 | 1.4163 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4931 |
| 298.15 | 0.0513 | 1.4891 |
| 298.15 | 0.0979 | 1.4853 |
| 298.15 | 0.1917 | 1.4779 |
| 298.15 | 0.3009 | 1.4694 |
| 298.15 | 0.3971 | 1.4621 |
| 298.15 | 0.4963 | 1.4548 |
| 298.15 | 0.5987 | 1.4476 |
| 298.15 | 0.6966 | 1.4405 |
| 298.15 | 0.7958 | 1.4339 |
| 298.15 | 0.8922 | 1.4274 |
| 298.15 | 0.9501 | 1.4238 |
| 298.15 | 1.0000 | 1.4206 |
| 313.15 | 0.0000 | 1.4844 |
| 313.15 | 0.0506 | 1.4812 |
| 313.15 | 0.1051 | 1.4771 |
| 313.15 | 0.2040 | 1.4691 |
| 313.15 | 0.3096 | 1.4608 |
| 313.15 | 0.4064 | 1.4536 |
| 313.15 | 0.5061 | 1.4464 |
| 313.15 | 0.6050 | 1.4393 |
| 313.15 | 0.7057 | 1.4323 |
| 313.15 | 0.8112 | 1.4251 |
| 313.15 | 0.9095 | 1.4185 |
| 313.15 | 0.9599 | 1.4154 |
| 313.15 | 1.0000 | 1.4127 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4926 |
| 298.15 | 0.0993 | 1.4848 |
| 298.15 | 0.2037 | 1.4767 |
| 298.15 | 0.3028 | 1.469 |
| 298.15 | 0.4047 | 1.4615 |
| 298.15 | 0.5382 | 1.4519 |
| 298.15 | 0.6035 | 1.4473 |
| 298.15 | 0.7030 | 1.4405 |
| 298.15 | 0.8037 | 1.4338 |
| 298.15 | 0.8981 | 1.4279 |
| 298.15 | 1.0000 | 1.4217 |
| 303.15 | 0.0000 | 1.4893 |
| 303.15 | 0.0993 | 1.482 |
| 303.15 | 0.2037 | 1.4743 |
| 303.15 | 0.3028 | 1.4668 |
| 303.15 | 0.4047 | 1.4594 |
| 303.15 | 0.5382 | 1.4498 |
| 303.15 | 0.6035 | 1.4451 |
| 303.15 | 0.7030 | 1.4384 |
| 303.15 | 0.8037 | 1.4314 |
| 303.15 | 0.8981 | 1.4253 |
| 303.15 | 1.0000 | 1.4192 |
| 308.15 | 0.0000 | 1.4867 |
| 308.15 | 0.0993 | 1.4793 |
| 308.15 | 0.2037 | 1.4718 |
| 308.15 | 0.3028 | 1.4646 |
| 308.15 | 0.4047 | 1.4572 |
| 308.15 | 0.5382 | 1.4476 |
| 308.15 | 0.6035 | 1.443 |
| 308.15 | 0.7030 | 1.4362 |
| 308.15 | 0.8037 | 1.429 |
| 308.15 | 0.8981 | 1.4228 |
| 308.15 | 1.0000 | 1.4163 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4931 |
| 298.15 | 0.0513 | 1.4891 |
| 298.15 | 0.0979 | 1.4853 |
| 298.15 | 0.1917 | 1.4779 |
| 298.15 | 0.3009 | 1.4694 |
| 298.15 | 0.3971 | 1.4621 |
| 298.15 | 0.4963 | 1.4548 |
| 298.15 | 0.5987 | 1.4476 |
| 298.15 | 0.6966 | 1.4405 |
| 298.15 | 0.7958 | 1.4339 |
| 298.15 | 0.8922 | 1.4274 |
| 298.15 | 0.9501 | 1.4238 |
| 298.15 | 1.0000 | 1.4206 |
| 313.15 | 0.0000 | 1.4844 |
| 313.15 | 0.0506 | 1.4812 |
| 313.15 | 0.1051 | 1.4771 |
| 313.15 | 0.2040 | 1.4691 |
| 313.15 | 0.3096 | 1.4608 |
| 313.15 | 0.4064 | 1.4536 |
| 313.15 | 0.5061 | 1.4464 |
| 313.15 | 0.6050 | 1.4393 |
| 313.15 | 0.7057 | 1.4323 |
| 313.15 | 0.8112 | 1.4251 |
| 313.15 | 0.9095 | 1.4185 |
| 313.15 | 0.9599 | 1.4154 |
| 313.15 | 1.0000 | 1.4127 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 856.7 |
| 298.15 | 0.0993 | 846.6 |
| 298.15 | 0.2037 | 836.2 |
| 298.15 | 0.3028 | 826.4 |
| 298.15 | 0.4047 | 816.7 |
| 298.15 | 0.5382 | 804.2 |
| 298.15 | 0.6035 | 798.3 |
| 298.15 | 0.7030 | 789.5 |
| 298.15 | 0.8037 | 780.8 |
| 298.15 | 0.8981 | 773.0 |
| 298.15 | 1.0000 | 765.0 |
| 303.15 | 0.0000 | 852.3 |
| 303.15 | 0.0993 | 842.3 |
| 303.15 | 0.2037 | 831.8 |
| 303.15 | 0.3028 | 822.1 |
| 303.15 | 0.4047 | 812.3 |
| 303.15 | 0.5382 | 799.9 |
| 303.15 | 0.6035 | 794.0 |
| 303.15 | 0.7030 | 785.1 |
| 303.15 | 0.8037 | 776.5 |
| 303.15 | 0.8981 | 768.7 |
| 303.15 | 1.0000 | 760.7 |
| 308.15 | 0.0000 | 848.0 |
| 308.15 | 0.0993 | 837.9 |
| 308.15 | 0.2037 | 827.5 |
| 308.15 | 0.3028 | 817.8 |
| 308.15 | 0.4047 | 808.0 |
| 308.15 | 0.5382 | 795.5 |
| 308.15 | 0.6035 | 789.6 |
| 308.15 | 0.7030 | 780.8 |
| 308.15 | 0.8037 | 772.2 |
| 308.15 | 0.8981 | 764.4 |
| 308.15 | 1.0000 | 756.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 856.6 |
| 298.15 | 0.0513 | 851.4 |
| 298.15 | 0.0979 | 846.7 |
| 298.15 | 0.1917 | 837.2 |
| 298.15 | 0.3009 | 826.5 |
| 298.15 | 0.3971 | 817.3 |
| 298.15 | 0.4963 | 808.0 |
| 298.15 | 0.5987 | 798.8 |
| 298.15 | 0.6966 | 789.9 |
| 298.15 | 0.7958 | 781.6 |
| 298.15 | 0.8922 | 773.4 |
| 298.15 | 0.9501 | 768.9 |
| 298.15 | 1.0000 | 765.0 |
| 313.15 | 0.0000 | 843.5 |
| 313.15 | 0.0506 | 838.4 |
| 313.15 | 0.1051 | 832.9 |
| 313.15 | 0.2040 | 823.1 |
| 313.15 | 0.3096 | 812.6 |
| 313.15 | 0.4064 | 803.4 |
| 313.15 | 0.5061 | 794.0 |
| 313.15 | 0.6050 | 785.1 |
| 313.15 | 0.7057 | 776.2 |
| 313.15 | 0.8112 | 767.2 |
| 313.15 | 0.9095 | 759.0 |
| 313.15 | 0.9599 | 755.0 |
| 313.15 | 1.0000 | 751.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 856.7 |
| 298.15 | 0.0993 | 846.6 |
| 298.15 | 0.2037 | 836.2 |
| 298.15 | 0.3028 | 826.4 |
| 298.15 | 0.4047 | 816.7 |
| 298.15 | 0.5382 | 804.2 |
| 298.15 | 0.6035 | 798.3 |
| 298.15 | 0.7030 | 789.5 |
| 298.15 | 0.8037 | 780.8 |
| 298.15 | 0.8981 | 773.0 |
| 298.15 | 1.0000 | 765.0 |
| 303.15 | 0.0000 | 852.3 |
| 303.15 | 0.0993 | 842.3 |
| 303.15 | 0.2037 | 831.8 |
| 303.15 | 0.3028 | 822.1 |
| 303.15 | 0.4047 | 812.3 |
| 303.15 | 0.5382 | 799.9 |
| 303.15 | 0.6035 | 794.0 |
| 303.15 | 0.7030 | 785.1 |
| 303.15 | 0.8037 | 776.5 |
| 303.15 | 0.8981 | 768.7 |
| 303.15 | 1.0000 | 760.7 |
| 308.15 | 0.0000 | 848.0 |
| 308.15 | 0.0993 | 837.9 |
| 308.15 | 0.2037 | 827.5 |
| 308.15 | 0.3028 | 817.8 |
| 308.15 | 0.4047 | 808.0 |
| 308.15 | 0.5382 | 795.5 |
| 308.15 | 0.6035 | 789.6 |
| 308.15 | 0.7030 | 780.8 |
| 308.15 | 0.8037 | 772.2 |
| 308.15 | 0.8981 | 764.4 |
| 308.15 | 1.0000 | 756.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 856.6 |
| 298.15 | 0.0513 | 851.4 |
| 298.15 | 0.0979 | 846.7 |
| 298.15 | 0.1917 | 837.2 |
| 298.15 | 0.3009 | 826.5 |
| 298.15 | 0.3971 | 817.3 |
| 298.15 | 0.4963 | 808.0 |
| 298.15 | 0.5987 | 798.8 |
| 298.15 | 0.6966 | 789.9 |
| 298.15 | 0.7958 | 781.6 |
| 298.15 | 0.8922 | 773.4 |
| 298.15 | 0.9501 | 768.9 |
| 298.15 | 1.0000 | 765.0 |
| 313.15 | 0.0000 | 843.5 |
| 313.15 | 0.0506 | 838.4 |
| 313.15 | 0.1051 | 832.9 |
| 313.15 | 0.2040 | 823.1 |
| 313.15 | 0.3096 | 812.6 |
| 313.15 | 0.4064 | 803.4 |
| 313.15 | 0.5061 | 794.0 |
| 313.15 | 0.6050 | 785.1 |
| 313.15 | 0.7057 | 776.2 |
| 313.15 | 0.8112 | 767.2 |
| 313.15 | 0.9095 | 759.0 |
| 313.15 | 0.9599 | 755.0 |
| 313.15 | 1.0000 | 751.9 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1326.0 |
| 0.0993 | 1315.0 |
| 0.2037 | 1303.0 |
| 0.3028 | 1293.0 |
| 0.4047 | 1282.0 |
| 0.5382 | 1268.0 |
| 0.6035 | 1261.0 |
| 0.7030 | 1250.0 |
| 0.8037 | 1239.0 |
| 0.8981 | 1228.0 |
| 1.0000 | 1217.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1310.0 |
| 298.15 | 0.0513 | 1303.0 |
| 298.15 | 0.0979 | 1297.0 |
| 298.15 | 0.1917 | 1285.0 |
| 298.15 | 0.3009 | 1272.0 |
| 298.15 | 0.3971 | 1262.0 |
| 298.15 | 0.4963 | 1252.0 |
| 298.15 | 0.5987 | 1243.0 |
| 298.15 | 0.6966 | 1234.0 |
| 298.15 | 0.7958 | 1227.0 |
| 298.15 | 0.8922 | 1221.0 |
| 298.15 | 0.9501 | 1217.0 |
| 298.15 | 1.0000 | 1215.0 |
| 313.15 | 0.0000 | 1248.0 |
| 313.15 | 0.0506 | 1242.0 |
| 313.15 | 0.1051 | 1234.0 |
| 313.15 | 0.2040 | 1221.0 |
| 313.15 | 0.3096 | 1209.0 |
| 313.15 | 0.4064 | 1198.0 |
| 313.15 | 0.5061 | 1188.0 |
| 313.15 | 0.6050 | 1179.0 |
| 313.15 | 0.7057 | 1170.0 |
| 313.15 | 0.8112 | 1162.0 |
| 313.15 | 0.9095 | 1155.0 |
| 313.15 | 0.9599 | 1152.0 |
| 313.15 | 1.0000 | 1150.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1326.0 |
| 0.0993 | 1315.0 |
| 0.2037 | 1303.0 |
| 0.3028 | 1293.0 |
| 0.4047 | 1282.0 |
| 0.5382 | 1268.0 |
| 0.6035 | 1261.0 |
| 0.7030 | 1250.0 |
| 0.8037 | 1239.0 |
| 0.8981 | 1228.0 |
| 1.0000 | 1217.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1310.0 |
| 298.15 | 0.0513 | 1303.0 |
| 298.15 | 0.0979 | 1297.0 |
| 298.15 | 0.1917 | 1285.0 |
| 298.15 | 0.3009 | 1272.0 |
| 298.15 | 0.3971 | 1262.0 |
| 298.15 | 0.4963 | 1252.0 |
| 298.15 | 0.5987 | 1243.0 |
| 298.15 | 0.6966 | 1234.0 |
| 298.15 | 0.7958 | 1227.0 |
| 298.15 | 0.8922 | 1221.0 |
| 298.15 | 0.9501 | 1217.0 |
| 298.15 | 1.0000 | 1215.0 |
| 313.15 | 0.0000 | 1248.0 |
| 313.15 | 0.0506 | 1242.0 |
| 313.15 | 0.1051 | 1234.0 |
| 313.15 | 0.2040 | 1221.0 |
| 313.15 | 0.3096 | 1209.0 |
| 313.15 | 0.4064 | 1198.0 |
| 313.15 | 0.5061 | 1188.0 |
| 313.15 | 0.6050 | 1179.0 |
| 313.15 | 0.7057 | 1170.0 |
| 313.15 | 0.8112 | 1162.0 |
| 313.15 | 0.9095 | 1155.0 |
| 313.15 | 0.9599 | 1152.0 |
| 313.15 | 1.0000 | 1150.0 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0560 | 407.55 |
| 0.1530 | 401.80 |
| 0.1980 | 399.38 |
| 0.2440 | 396.93 |
| 0.3000 | 394.46 |
| 0.3530 | 392.34 |
| 0.4540 | 388.79 |
| 0.5020 | 387.07 |
| 0.5440 | 385.62 |
| 0.5980 | 383.80 |
| 0.6480 | 382.27 |
| 0.6950 | 381.22 |
| 0.7450 | 379.88 |
| 0.8100 | 378.36 |
| 0.8500 | 377.28 |
| 0.9010 | 376.11 |
| 0.9460 | 375.07 |
| 0.9800 | 374.38 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Cyclohexane, methyl- (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0560 | 407.55 |
| 0.1530 | 401.80 |
| 0.1980 | 399.38 |
| 0.2440 | 396.93 |
| 0.3000 | 394.46 |
| 0.3530 | 392.34 |
| 0.4540 | 388.79 |
| 0.5020 | 387.07 |
| 0.5440 | 385.62 |
| 0.5980 | 383.80 |
| 0.6480 | 382.27 |
| 0.6950 | 381.22 |
| 0.7450 | 379.88 |
| 0.8100 | 378.36 |
| 0.8500 | 377.28 |
| 0.9010 | 376.11 |
| 0.9460 | 375.07 |
| 0.9800 | 374.38 |
Sources
- Excess and deviation properties for the binary mixtures of methylcyclohexane with benzene, toluene, p-xylene, mesitylene, and anisole at T = (298.15, 303.15, and 308.15) K
- Isobaric Vapor-Liquid Equilibria for Binary and Ternary Mixtures of Ethanol, Methylcyclohexane and p-Xylene
- Density, Speed of Sound, and Refractive Index for Binary Mixtures Containing Cycloalkanes with o-Xylene, m-Xylene, p-Xylene, and Mesitylene at T = (298.15 and 313.15) K