- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Anisole
- InChI
- InChI=1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- RDOXTESZEPMUJZ-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- COc1ccccc1
- Mol. Weight (g/mol)
- 108.14
- CAS
- 100-66-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (2)
Mole fraction of p-Xylene (1) [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Mole fraction of p-Xylene (1) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0580 | 0.0950 |
| 0.0920 | 0.1460 |
| 0.1850 | 0.2710 |
| 0.2980 | 0.4030 |
| 0.4000 | 0.5070 |
| 0.4960 | 0.5970 |
| 0.6300 | 0.7130 |
| 0.7060 | 0.7750 |
| 0.8040 | 0.8520 |
| 0.9070 | 0.9310 |
| 0.9460 | 0.9590 |
| 1.0000 | 1.0000 |
Mole fraction of p-Xylene (1) [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Mole fraction of p-Xylene (1) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0580 | 0.0950 |
| 0.0920 | 0.1460 |
| 0.1850 | 0.2710 |
| 0.2980 | 0.4030 |
| 0.4000 | 0.5070 |
| 0.4960 | 0.5970 |
| 0.6300 | 0.7130 |
| 0.7060 | 0.7750 |
| 0.8040 | 0.8520 |
| 0.9070 | 0.9310 |
| 0.9460 | 0.9590 |
| 1.0000 | 1.0000 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0000 | 0.0007 |
| 288.15 | 0.0822 | 0.0007 |
| 288.15 | 0.1870 | 0.0008 |
| 288.15 | 0.3100 | 0.0008 |
| 288.15 | 0.4700 | 0.0009 |
| 288.15 | 0.6370 | 0.0010 |
| 288.15 | 0.7470 | 0.0010 |
| 288.15 | 0.8220 | 0.0011 |
| 288.15 | 0.8880 | 0.0011 |
| 288.15 | 0.9490 | 0.0012 |
| 288.15 | 1.0000 | 0.0012 |
| 293.15 | 0.0000 | 0.0006 |
| 293.15 | 0.0822 | 0.0007 |
| 293.15 | 0.1870 | 0.0007 |
| 293.15 | 0.3100 | 0.0008 |
| 293.15 | 0.4700 | 0.0008 |
| 293.15 | 0.6370 | 0.0009 |
| 293.15 | 0.7470 | 0.0009 |
| 293.15 | 0.8220 | 0.0010 |
| 293.15 | 0.8880 | 0.0010 |
| 293.15 | 0.9490 | 0.0011 |
| 293.15 | 1.0000 | 0.0011 |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.0822 | 0.0006 |
| 298.15 | 0.1870 | 0.0007 |
| 298.15 | 0.3100 | 0.0007 |
| 298.15 | 0.4700 | 0.0008 |
| 298.15 | 0.6370 | 0.0008 |
| 298.15 | 0.7470 | 0.0009 |
| 298.15 | 0.8220 | 0.0010 |
| 298.15 | 0.8880 | 0.0010 |
| 298.15 | 0.9490 | 0.0010 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.0822 | 0.0006 |
| 303.15 | 0.1870 | 0.0006 |
| 303.15 | 0.3100 | 0.0007 |
| 303.15 | 0.4700 | 0.0007 |
| 303.15 | 0.6370 | 0.0008 |
| 303.15 | 0.7470 | 0.0008 |
| 303.15 | 0.8220 | 0.0009 |
| 303.15 | 0.8880 | 0.0009 |
| 303.15 | 0.9490 | 0.0009 |
| 303.15 | 1.0000 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0000 | 0.0007 |
| 288.15 | 0.0822 | 0.0007 |
| 288.15 | 0.1870 | 0.0008 |
| 288.15 | 0.3100 | 0.0008 |
| 288.15 | 0.4700 | 0.0009 |
| 288.15 | 0.6370 | 0.0010 |
| 288.15 | 0.7470 | 0.0010 |
| 288.15 | 0.8220 | 0.0011 |
| 288.15 | 0.8880 | 0.0011 |
| 288.15 | 0.9490 | 0.0012 |
| 288.15 | 1.0000 | 0.0012 |
| 293.15 | 0.0000 | 0.0006 |
| 293.15 | 0.0822 | 0.0007 |
| 293.15 | 0.1870 | 0.0007 |
| 293.15 | 0.3100 | 0.0008 |
| 293.15 | 0.4700 | 0.0008 |
| 293.15 | 0.6370 | 0.0009 |
| 293.15 | 0.7470 | 0.0009 |
| 293.15 | 0.8220 | 0.0010 |
| 293.15 | 0.8880 | 0.0010 |
| 293.15 | 0.9490 | 0.0011 |
| 293.15 | 1.0000 | 0.0011 |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.0822 | 0.0006 |
| 298.15 | 0.1870 | 0.0007 |
| 298.15 | 0.3100 | 0.0007 |
| 298.15 | 0.4700 | 0.0008 |
| 298.15 | 0.6370 | 0.0008 |
| 298.15 | 0.7470 | 0.0009 |
| 298.15 | 0.8220 | 0.0010 |
| 298.15 | 0.8880 | 0.0010 |
| 298.15 | 0.9490 | 0.0010 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.0822 | 0.0006 |
| 303.15 | 0.1870 | 0.0006 |
| 303.15 | 0.3100 | 0.0007 |
| 303.15 | 0.4700 | 0.0007 |
| 303.15 | 0.6370 | 0.0008 |
| 303.15 | 0.7470 | 0.0008 |
| 303.15 | 0.8220 | 0.0009 |
| 303.15 | 0.8880 | 0.0009 |
| 303.15 | 0.9490 | 0.0009 |
| 303.15 | 1.0000 | 0.0009 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.15 | 0.0000 | 1.4983 |
| 288.15 | 0.0994 | 1.5007 |
| 288.15 | 0.2471 | 1.5044 |
| 288.15 | 0.3745 | 1.5077 |
| 288.15 | 0.4960 | 1.5109 |
| 288.15 | 0.6455 | 1.5151 |
| 288.15 | 0.7466 | 1.5179 |
| 288.15 | 0.8972 | 1.5223 |
| 288.15 | 0.9490 | 1.5239 |
| 288.15 | 0.9772 | 1.5248 |
| 288.15 | 1.0000 | 1.5256 |
| 293.15 | 0.0000 | 1.4958 |
| 293.15 | 0.0994 | 1.4978 |
| 293.15 | 0.2471 | 1.5006 |
| 293.15 | 0.3745 | 1.5032 |
| 293.15 | 0.4960 | 1.5057 |
| 293.15 | 0.6455 | 1.5089 |
| 293.15 | 0.7466 | 1.5111 |
| 293.15 | 0.8972 | 1.5145 |
| 293.15 | 0.9490 | 1.5157 |
| 293.15 | 0.9772 | 1.5164 |
| 293.15 | 1.0000 | 1.5169 |
| 298.15 | 0.0000 | 1.4929 |
| 298.15 | 0.0994 | 1.4949 |
| 298.15 | 0.2471 | 1.4978 |
| 298.15 | 0.3745 | 1.5004 |
| 298.15 | 0.4960 | 1.5029 |
| 298.15 | 0.6455 | 1.5061 |
| 298.15 | 0.7466 | 1.5084 |
| 298.15 | 0.8972 | 1.5118 |
| 298.15 | 0.9490 | 1.5129 |
| 298.15 | 0.9772 | 1.5136 |
| 298.15 | 1.0000 | 1.5141 |
| 303.15 | 0.0000 | 1.4915 |
| 303.15 | 0.0994 | 1.4935 |
| 303.15 | 0.2471 | 1.4963 |
| 303.15 | 0.3745 | 1.4987 |
| 303.15 | 0.4960 | 1.5011 |
| 303.15 | 0.6455 | 1.5042 |
| 303.15 | 0.7466 | 1.5064 |
| 303.15 | 0.8972 | 1.5097 |
| 303.15 | 0.9490 | 1.5107 |
| 303.15 | 0.9772 | 1.5113 |
| 303.15 | 1.0000 | 1.5117 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid)
- Pressure, kPa = 93.13 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.517 |
| 0.0499 | 1.5157 |
| 0.1387 | 1.5138 |
| 0.1684 | 1.5131 |
| 0.2124 | 1.5122 |
| 0.2656 | 1.511 |
| 0.3055 | 1.5101 |
| 0.4128 | 1.5078 |
| 0.4494 | 1.507 |
| 0.4497 | 1.507 |
| 0.5122 | 1.5057 |
| 0.5626 | 1.5046 |
| 0.6095 | 1.5036 |
| 0.8055 | 1.4995 |
| 0.8904 | 1.4978 |
| 0.9613 | 1.4964 |
| 1.0000 | 1.4956 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.15 | 0.0000 | 1.4983 |
| 288.15 | 0.0994 | 1.5007 |
| 288.15 | 0.2471 | 1.5044 |
| 288.15 | 0.3745 | 1.5077 |
| 288.15 | 0.4960 | 1.5109 |
| 288.15 | 0.6455 | 1.5151 |
| 288.15 | 0.7466 | 1.5179 |
| 288.15 | 0.8972 | 1.5223 |
| 288.15 | 0.9490 | 1.5239 |
| 288.15 | 0.9772 | 1.5248 |
| 288.15 | 1.0000 | 1.5256 |
| 293.15 | 0.0000 | 1.4958 |
| 293.15 | 0.0994 | 1.4978 |
| 293.15 | 0.2471 | 1.5006 |
| 293.15 | 0.3745 | 1.5032 |
| 293.15 | 0.4960 | 1.5057 |
| 293.15 | 0.6455 | 1.5089 |
| 293.15 | 0.7466 | 1.5111 |
| 293.15 | 0.8972 | 1.5145 |
| 293.15 | 0.9490 | 1.5157 |
| 293.15 | 0.9772 | 1.5164 |
| 293.15 | 1.0000 | 1.5169 |
| 298.15 | 0.0000 | 1.4929 |
| 298.15 | 0.0994 | 1.4949 |
| 298.15 | 0.2471 | 1.4978 |
| 298.15 | 0.3745 | 1.5004 |
| 298.15 | 0.4960 | 1.5029 |
| 298.15 | 0.6455 | 1.5061 |
| 298.15 | 0.7466 | 1.5084 |
| 298.15 | 0.8972 | 1.5118 |
| 298.15 | 0.9490 | 1.5129 |
| 298.15 | 0.9772 | 1.5136 |
| 298.15 | 1.0000 | 1.5141 |
| 303.15 | 0.0000 | 1.4915 |
| 303.15 | 0.0994 | 1.4935 |
| 303.15 | 0.2471 | 1.4963 |
| 303.15 | 0.3745 | 1.4987 |
| 303.15 | 0.4960 | 1.5011 |
| 303.15 | 0.6455 | 1.5042 |
| 303.15 | 0.7466 | 1.5064 |
| 303.15 | 0.8972 | 1.5097 |
| 303.15 | 0.9490 | 1.5107 |
| 303.15 | 0.9772 | 1.5113 |
| 303.15 | 1.0000 | 1.5117 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid)
- Pressure, kPa = 93.13 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.517 |
| 0.0499 | 1.5157 |
| 0.1387 | 1.5138 |
| 0.1684 | 1.5131 |
| 0.2124 | 1.5122 |
| 0.2656 | 1.511 |
| 0.3055 | 1.5101 |
| 0.4128 | 1.5078 |
| 0.4494 | 1.507 |
| 0.4497 | 1.507 |
| 0.5122 | 1.5057 |
| 0.5626 | 1.5046 |
| 0.6095 | 1.5036 |
| 0.8055 | 1.4995 |
| 0.8904 | 1.4978 |
| 0.9613 | 1.4964 |
| 1.0000 | 1.4956 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 865.25 |
| 288.15 | 0.0994 | 877.53 |
| 288.15 | 0.2471 | 896.11 |
| 288.15 | 0.3745 | 912.51 |
| 288.15 | 0.4960 | 928.51 |
| 288.15 | 0.6455 | 948.69 |
| 288.15 | 0.7466 | 962.63 |
| 288.15 | 0.8972 | 983.79 |
| 288.15 | 0.9490 | 991.13 |
| 288.15 | 0.9772 | 995.17 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 860.92 |
| 293.15 | 0.0994 | 873.32 |
| 293.15 | 0.2471 | 891.85 |
| 293.15 | 0.3745 | 908.14 |
| 293.15 | 0.4960 | 924.05 |
| 293.15 | 0.6455 | 944.15 |
| 293.15 | 0.7466 | 958.06 |
| 293.15 | 0.8972 | 979.14 |
| 293.15 | 0.9490 | 986.45 |
| 293.15 | 0.9772 | 990.43 |
| 293.15 | 1.0000 | 993.65 |
| 298.15 | 0.0000 | 856.62 |
| 298.15 | 0.0994 | 869.02 |
| 298.15 | 0.2471 | 887.55 |
| 298.15 | 0.3745 | 903.84 |
| 298.15 | 0.4960 | 919.74 |
| 298.15 | 0.6455 | 939.83 |
| 298.15 | 0.7466 | 953.71 |
| 298.15 | 0.8972 | 974.73 |
| 298.15 | 0.9490 | 981.99 |
| 298.15 | 0.9772 | 985.95 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 852.25 |
| 303.15 | 0.0994 | 864.71 |
| 303.15 | 0.2471 | 883.2 |
| 303.15 | 0.3745 | 899.38 |
| 303.15 | 0.4960 | 915.2 |
| 303.15 | 0.6455 | 935.26 |
| 303.15 | 0.7466 | 949.14 |
| 303.15 | 0.8972 | 970.18 |
| 303.15 | 0.9490 | 977.4 |
| 303.15 | 0.9772 | 981.34 |
| 303.15 | 1.0000 | 984.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 865.253 |
| 288.15 | 0.0822 | 875.328 |
| 288.15 | 0.1870 | 888.441 |
| 288.15 | 0.3100 | 904.181 |
| 288.15 | 0.4700 | 925.057 |
| 288.15 | 0.6370 | 947.54 |
| 288.15 | 0.7470 | 962.692 |
| 288.15 | 0.8220 | 973.119 |
| 288.15 | 0.8880 | 982.387 |
| 288.15 | 0.9490 | 991.051 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 860.917 |
| 293.15 | 0.0822 | 871.032 |
| 293.15 | 0.1870 | 884.105 |
| 293.15 | 0.3100 | 899.758 |
| 293.15 | 0.4700 | 920.561 |
| 293.15 | 0.6370 | 942.968 |
| 293.15 | 0.7470 | 958.092 |
| 293.15 | 0.8220 | 968.502 |
| 293.15 | 0.8880 | 977.769 |
| 293.15 | 0.9490 | 986.356 |
| 293.15 | 1.0000 | 993.651 |
| 298.15 | 0.0000 | 856.617 |
| 298.15 | 0.0822 | 866.765 |
| 298.15 | 0.1870 | 879.807 |
| 298.15 | 0.3100 | 895.413 |
| 298.15 | 0.4700 | 916.177 |
| 298.15 | 0.6370 | 938.559 |
| 298.15 | 0.7470 | 953.665 |
| 298.15 | 0.8220 | 964.094 |
| 298.15 | 0.8880 | 973.344 |
| 298.15 | 0.9490 | 981.943 |
| 298.15 | 1.0000 | 989.105 |
| 303.15 | 0.0000 | 852.255 |
| 303.15 | 0.0822 | 862.434 |
| 303.15 | 0.1870 | 875.432 |
| 303.15 | 0.3100 | 890.974 |
| 303.15 | 0.4700 | 911.659 |
| 303.15 | 0.6370 | 933.983 |
| 303.15 | 0.7470 | 949.069 |
| 303.15 | 0.8220 | 959.511 |
| 303.15 | 0.8880 | 968.761 |
| 303.15 | 0.9490 | 977.313 |
| 303.15 | 1.0000 | 984.372 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 865.25 |
| 288.15 | 0.0994 | 877.53 |
| 288.15 | 0.2471 | 896.11 |
| 288.15 | 0.3745 | 912.51 |
| 288.15 | 0.4960 | 928.51 |
| 288.15 | 0.6455 | 948.69 |
| 288.15 | 0.7466 | 962.63 |
| 288.15 | 0.8972 | 983.79 |
| 288.15 | 0.9490 | 991.13 |
| 288.15 | 0.9772 | 995.17 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 860.92 |
| 293.15 | 0.0994 | 873.32 |
| 293.15 | 0.2471 | 891.85 |
| 293.15 | 0.3745 | 908.14 |
| 293.15 | 0.4960 | 924.05 |
| 293.15 | 0.6455 | 944.15 |
| 293.15 | 0.7466 | 958.06 |
| 293.15 | 0.8972 | 979.14 |
| 293.15 | 0.9490 | 986.45 |
| 293.15 | 0.9772 | 990.43 |
| 293.15 | 1.0000 | 993.65 |
| 298.15 | 0.0000 | 856.62 |
| 298.15 | 0.0994 | 869.02 |
| 298.15 | 0.2471 | 887.55 |
| 298.15 | 0.3745 | 903.84 |
| 298.15 | 0.4960 | 919.74 |
| 298.15 | 0.6455 | 939.83 |
| 298.15 | 0.7466 | 953.71 |
| 298.15 | 0.8972 | 974.73 |
| 298.15 | 0.9490 | 981.99 |
| 298.15 | 0.9772 | 985.95 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 852.25 |
| 303.15 | 0.0994 | 864.71 |
| 303.15 | 0.2471 | 883.2 |
| 303.15 | 0.3745 | 899.38 |
| 303.15 | 0.4960 | 915.2 |
| 303.15 | 0.6455 | 935.26 |
| 303.15 | 0.7466 | 949.14 |
| 303.15 | 0.8972 | 970.18 |
| 303.15 | 0.9490 | 977.4 |
| 303.15 | 0.9772 | 981.34 |
| 303.15 | 1.0000 | 984.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 865.253 |
| 288.15 | 0.0822 | 875.328 |
| 288.15 | 0.1870 | 888.441 |
| 288.15 | 0.3100 | 904.181 |
| 288.15 | 0.4700 | 925.057 |
| 288.15 | 0.6370 | 947.54 |
| 288.15 | 0.7470 | 962.692 |
| 288.15 | 0.8220 | 973.119 |
| 288.15 | 0.8880 | 982.387 |
| 288.15 | 0.9490 | 991.051 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 860.917 |
| 293.15 | 0.0822 | 871.032 |
| 293.15 | 0.1870 | 884.105 |
| 293.15 | 0.3100 | 899.758 |
| 293.15 | 0.4700 | 920.561 |
| 293.15 | 0.6370 | 942.968 |
| 293.15 | 0.7470 | 958.092 |
| 293.15 | 0.8220 | 968.502 |
| 293.15 | 0.8880 | 977.769 |
| 293.15 | 0.9490 | 986.356 |
| 293.15 | 1.0000 | 993.651 |
| 298.15 | 0.0000 | 856.617 |
| 298.15 | 0.0822 | 866.765 |
| 298.15 | 0.1870 | 879.807 |
| 298.15 | 0.3100 | 895.413 |
| 298.15 | 0.4700 | 916.177 |
| 298.15 | 0.6370 | 938.559 |
| 298.15 | 0.7470 | 953.665 |
| 298.15 | 0.8220 | 964.094 |
| 298.15 | 0.8880 | 973.344 |
| 298.15 | 0.9490 | 981.943 |
| 298.15 | 1.0000 | 989.105 |
| 303.15 | 0.0000 | 852.255 |
| 303.15 | 0.0822 | 862.434 |
| 303.15 | 0.1870 | 875.432 |
| 303.15 | 0.3100 | 890.974 |
| 303.15 | 0.4700 | 911.659 |
| 303.15 | 0.6370 | 933.983 |
| 303.15 | 0.7470 | 949.069 |
| 303.15 | 0.8220 | 959.511 |
| 303.15 | 0.8880 | 968.761 |
| 303.15 | 0.9490 | 977.313 |
| 303.15 | 1.0000 | 984.372 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1351.99 |
| 288.15 | 0.0822 | 1360.32 |
| 288.15 | 0.1870 | 1373.07 |
| 288.15 | 0.3100 | 1384.4 |
| 288.15 | 0.4700 | 1395.9 |
| 288.15 | 0.6370 | 1410.41 |
| 288.15 | 0.7470 | 1420.62 |
| 288.15 | 0.8220 | 1437.0 |
| 288.15 | 0.8880 | 1443.0 |
| 288.15 | 0.9490 | 1446.3 |
| 288.15 | 1.0000 | 1449.09 |
| 293.15 | 0.0000 | 1331.11 |
| 293.15 | 0.0822 | 1339.53 |
| 293.15 | 0.1870 | 1352.53 |
| 293.15 | 0.3100 | 1364.03 |
| 293.15 | 0.4700 | 1375.26 |
| 293.15 | 0.6370 | 1389.88 |
| 293.15 | 0.7470 | 1400.31 |
| 293.15 | 0.8220 | 1416.71 |
| 293.15 | 0.8880 | 1422.54 |
| 293.15 | 0.9490 | 1425.78 |
| 293.15 | 1.0000 | 1428.45 |
| 298.15 | 0.0000 | 1310.0 |
| 298.15 | 0.0822 | 1317.4 |
| 298.15 | 0.1870 | 1326.46 |
| 298.15 | 0.3100 | 1337.54 |
| 298.15 | 0.4700 | 1352.25 |
| 298.15 | 0.6370 | 1368.24 |
| 298.15 | 0.7470 | 1379.31 |
| 298.15 | 0.8220 | 1387.37 |
| 298.15 | 0.8880 | 1394.84 |
| 298.15 | 0.9490 | 1401.82 |
| 298.15 | 1.0000 | 1408.02 |
| 303.15 | 0.0000 | 1289.68 |
| 303.15 | 0.0822 | 1296.93 |
| 303.15 | 0.1870 | 1306.46 |
| 303.15 | 0.3100 | 1317.59 |
| 303.15 | 0.4700 | 1332.66 |
| 303.15 | 0.6370 | 1349.07 |
| 303.15 | 0.7470 | 1360.53 |
| 303.15 | 0.8220 | 1368.5 |
| 303.15 | 0.8880 | 1375.64 |
| 303.15 | 0.9490 | 1382.26 |
| 303.15 | 1.0000 | 1387.66 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1351.99 |
| 288.15 | 0.0822 | 1360.32 |
| 288.15 | 0.1870 | 1373.07 |
| 288.15 | 0.3100 | 1384.4 |
| 288.15 | 0.4700 | 1395.9 |
| 288.15 | 0.6370 | 1410.41 |
| 288.15 | 0.7470 | 1420.62 |
| 288.15 | 0.8220 | 1437.0 |
| 288.15 | 0.8880 | 1443.0 |
| 288.15 | 0.9490 | 1446.3 |
| 288.15 | 1.0000 | 1449.09 |
| 293.15 | 0.0000 | 1331.11 |
| 293.15 | 0.0822 | 1339.53 |
| 293.15 | 0.1870 | 1352.53 |
| 293.15 | 0.3100 | 1364.03 |
| 293.15 | 0.4700 | 1375.26 |
| 293.15 | 0.6370 | 1389.88 |
| 293.15 | 0.7470 | 1400.31 |
| 293.15 | 0.8220 | 1416.71 |
| 293.15 | 0.8880 | 1422.54 |
| 293.15 | 0.9490 | 1425.78 |
| 293.15 | 1.0000 | 1428.45 |
| 298.15 | 0.0000 | 1310.0 |
| 298.15 | 0.0822 | 1317.4 |
| 298.15 | 0.1870 | 1326.46 |
| 298.15 | 0.3100 | 1337.54 |
| 298.15 | 0.4700 | 1352.25 |
| 298.15 | 0.6370 | 1368.24 |
| 298.15 | 0.7470 | 1379.31 |
| 298.15 | 0.8220 | 1387.37 |
| 298.15 | 0.8880 | 1394.84 |
| 298.15 | 0.9490 | 1401.82 |
| 298.15 | 1.0000 | 1408.02 |
| 303.15 | 0.0000 | 1289.68 |
| 303.15 | 0.0822 | 1296.93 |
| 303.15 | 0.1870 | 1306.46 |
| 303.15 | 0.3100 | 1317.59 |
| 303.15 | 0.4700 | 1332.66 |
| 303.15 | 0.6370 | 1349.07 |
| 303.15 | 0.7470 | 1360.53 |
| 303.15 | 0.8220 | 1368.5 |
| 303.15 | 0.8880 | 1375.64 |
| 303.15 | 0.9490 | 1382.26 |
| 303.15 | 1.0000 | 1387.66 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 423.38 |
| 0.0580 | 421.91 |
| 0.0920 | 421.11 |
| 0.1850 | 419.14 |
| 0.2980 | 417.06 |
| 0.4000 | 415.41 |
| 0.4960 | 414.02 |
| 0.6300 | 412.29 |
| 0.7060 | 411.39 |
| 0.8040 | 410.32 |
| 0.9070 | 409.26 |
| 0.9460 | 408.89 |
| 1.0000 | 408.37 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 423.38 |
| 0.0580 | 421.91 |
| 0.0920 | 421.11 |
| 0.1850 | 419.14 |
| 0.2980 | 417.06 |
| 0.4000 | 415.41 |
| 0.4960 | 414.02 |
| 0.6300 | 412.29 |
| 0.7060 | 411.39 |
| 0.8040 | 410.32 |
| 0.9070 | 409.26 |
| 0.9460 | 408.89 |
| 1.0000 | 408.37 |
Sources
- Excess molar volumes and refractive indices of (methoxybenzene + benzene, or toluene, or o-xylene, or m-xylene, or p-xylene, or mesitylene) binary mixtures between T = (288.15 to 303.15) K
- Refractive Index and Vapor-Liquid Equilibrium Data for the Binary Systems of Anisole with Xylene Isomers at 93.13 kPa
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene with Anisole at (288.15, 293.15, 298.15, and 303.15) K