- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Vapor Liquid Equilibrium at Constant Pressure
- Vapor Liquid Equilibrium at Constant Temperature (2)
Mole fraction of Ethyl Acetate (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Mole fraction of Ethyl Acetate (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0940 | 0.1550 |
| 0.1970 | 0.2910 |
| 0.2430 | 0.3440 |
| 0.2840 | 0.3870 |
| 0.3690 | 0.4600 |
| 0.4870 | 0.5530 |
| 0.5650 | 0.6030 |
| 0.6830 | 0.6890 |
| 0.7090 | 0.7100 |
| 0.7310 | 0.7250 |
| 0.7640 | 0.7510 |
| 0.8180 | 0.7980 |
| 0.9420 | 0.9230 |
| 1.0000 | 1.0000 |
Mole fraction of Ethyl Acetate (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Mole fraction of Ethyl Acetate (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0940 | 0.1550 |
| 0.1970 | 0.2910 |
| 0.2430 | 0.3440 |
| 0.2840 | 0.3870 |
| 0.3690 | 0.4600 |
| 0.4870 | 0.5530 |
| 0.5650 | 0.6030 |
| 0.6830 | 0.6890 |
| 0.7090 | 0.7100 |
| 0.7310 | 0.7250 |
| 0.7640 | 0.7510 |
| 0.8180 | 0.7980 |
| 0.9420 | 0.9230 |
| 1.0000 | 1.0000 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 10000 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0390 | 0.2719 |
| 0.0700 | 0.4751 |
| 0.1000 | 0.6471 |
| 0.1320 | 0.8052 |
| 0.1630 | 0.9524 |
| 0.1960 | 1.0818 |
| 0.2290 | 1.2072 |
| 0.2620 | 1.3097 |
| 0.2960 | 1.406 |
| 0.3310 | 1.4915 |
| 0.3660 | 1.5567 |
| 0.4020 | 1.6174 |
| 0.4390 | 1.6528 |
| 0.4760 | 1.6903 |
| 0.5140 | 1.7123 |
| 0.5530 | 1.6967 |
| 0.5920 | 1.6833 |
| 0.6320 | 1.6308 |
| 0.6730 | 1.5668 |
| 0.7150 | 1.4676 |
| 0.7580 | 1.3443 |
| 0.8010 | 1.1861 |
| 0.8450 | 0.9990 |
| 0.8910 | 0.7611 |
| 0.9370 | 0.4823 |
| 0.9520 | 0.3780 |
| 0.9690 | 0.2541 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 10000 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0390 | 0.2719 |
| 0.0700 | 0.4751 |
| 0.1000 | 0.6471 |
| 0.1320 | 0.8052 |
| 0.1630 | 0.9524 |
| 0.1960 | 1.0818 |
| 0.2290 | 1.2072 |
| 0.2620 | 1.3097 |
| 0.2960 | 1.406 |
| 0.3310 | 1.4915 |
| 0.3660 | 1.5567 |
| 0.4020 | 1.6174 |
| 0.4390 | 1.6528 |
| 0.4760 | 1.6903 |
| 0.5140 | 1.7123 |
| 0.5530 | 1.6967 |
| 0.5920 | 1.6833 |
| 0.6320 | 1.6308 |
| 0.6730 | 1.5668 |
| 0.7150 | 1.4676 |
| 0.7580 | 1.3443 |
| 0.8010 | 1.1861 |
| 0.8450 | 0.9990 |
| 0.8910 | 0.7611 |
| 0.9370 | 0.4823 |
| 0.9520 | 0.3780 |
| 0.9690 | 0.2541 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.3724 |
| 293.15 | 0.0475 | 1.3723 |
| 293.15 | 0.0945 | 1.3722 |
| 293.15 | 0.1954 | 1.3721 |
| 293.15 | 0.2986 | 1.3722 |
| 293.15 | 0.3908 | 1.3724 |
| 293.15 | 0.4948 | 1.3728 |
| 293.15 | 0.5967 | 1.3733 |
| 293.15 | 0.6937 | 1.3739 |
| 293.15 | 0.8006 | 1.3747 |
| 293.15 | 0.8994 | 1.3758 |
| 293.15 | 0.9507 | 1.3764 |
| 293.15 | 1.0000 | 1.3771 |
| 298.15 | 0.0000 | 1.3698 |
| 298.15 | 0.0475 | 1.3696 |
| 298.15 | 0.0945 | 1.3695 |
| 298.15 | 0.1954 | 1.3695 |
| 298.15 | 0.2986 | 1.3696 |
| 298.15 | 0.3908 | 1.3698 |
| 298.15 | 0.4948 | 1.3703 |
| 298.15 | 0.5967 | 1.3708 |
| 298.15 | 0.6937 | 1.3715 |
| 298.15 | 0.8006 | 1.3724 |
| 298.15 | 0.8994 | 1.3735 |
| 298.15 | 0.9507 | 1.3742 |
| 298.15 | 1.0000 | 1.375 |
| 303.15 | 0.0000 | 1.3671 |
| 303.15 | 0.0475 | 1.367 |
| 303.15 | 0.0945 | 1.3669 |
| 303.15 | 0.1954 | 1.3668 |
| 303.15 | 0.2986 | 1.367 |
| 303.15 | 0.3908 | 1.3673 |
| 303.15 | 0.4948 | 1.3678 |
| 303.15 | 0.5967 | 1.3684 |
| 303.15 | 0.6937 | 1.369 |
| 303.15 | 0.8006 | 1.37 |
| 303.15 | 0.8994 | 1.3713 |
| 303.15 | 0.9507 | 1.372 |
| 303.15 | 1.0000 | 1.3728 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.3724 |
| 293.15 | 0.0475 | 1.3723 |
| 293.15 | 0.0945 | 1.3722 |
| 293.15 | 0.1954 | 1.3721 |
| 293.15 | 0.2986 | 1.3722 |
| 293.15 | 0.3908 | 1.3724 |
| 293.15 | 0.4948 | 1.3728 |
| 293.15 | 0.5967 | 1.3733 |
| 293.15 | 0.6937 | 1.3739 |
| 293.15 | 0.8006 | 1.3747 |
| 293.15 | 0.8994 | 1.3758 |
| 293.15 | 0.9507 | 1.3764 |
| 293.15 | 1.0000 | 1.3771 |
| 298.15 | 0.0000 | 1.3698 |
| 298.15 | 0.0475 | 1.3696 |
| 298.15 | 0.0945 | 1.3695 |
| 298.15 | 0.1954 | 1.3695 |
| 298.15 | 0.2986 | 1.3696 |
| 298.15 | 0.3908 | 1.3698 |
| 298.15 | 0.4948 | 1.3703 |
| 298.15 | 0.5967 | 1.3708 |
| 298.15 | 0.6937 | 1.3715 |
| 298.15 | 0.8006 | 1.3724 |
| 298.15 | 0.8994 | 1.3735 |
| 298.15 | 0.9507 | 1.3742 |
| 298.15 | 1.0000 | 1.375 |
| 303.15 | 0.0000 | 1.3671 |
| 303.15 | 0.0475 | 1.367 |
| 303.15 | 0.0945 | 1.3669 |
| 303.15 | 0.1954 | 1.3668 |
| 303.15 | 0.2986 | 1.367 |
| 303.15 | 0.3908 | 1.3673 |
| 303.15 | 0.4948 | 1.3678 |
| 303.15 | 0.5967 | 1.3684 |
| 303.15 | 0.6937 | 1.369 |
| 303.15 | 0.8006 | 1.37 |
| 303.15 | 0.8994 | 1.3713 |
| 303.15 | 0.9507 | 1.372 |
| 303.15 | 1.0000 | 1.3728 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 900.5 |
| 293.15 | 0.0475 | 895.2 |
| 293.15 | 0.0945 | 890.1 |
| 293.15 | 0.1954 | 879.0 |
| 293.15 | 0.2986 | 867.8 |
| 293.15 | 0.3908 | 857.6 |
| 293.15 | 0.4948 | 845.9 |
| 293.15 | 0.5967 | 834.0 |
| 293.15 | 0.6937 | 822.6 |
| 293.15 | 0.8006 | 809.6 |
| 293.15 | 0.8994 | 797.6 |
| 293.15 | 0.9507 | 791.2 |
| 293.15 | 1.0000 | 785.0 |
| 298.15 | 0.0000 | 894.4 |
| 298.15 | 0.0475 | 889.2 |
| 298.15 | 0.0945 | 884.1 |
| 298.15 | 0.1954 | 873.1 |
| 298.15 | 0.2986 | 862.0 |
| 298.15 | 0.3908 | 852.0 |
| 298.15 | 0.4948 | 840.5 |
| 298.15 | 0.5967 | 828.8 |
| 298.15 | 0.6937 | 817.6 |
| 298.15 | 0.8006 | 804.9 |
| 298.15 | 0.8994 | 793.1 |
| 298.15 | 0.9507 | 786.9 |
| 298.15 | 1.0000 | 781.0 |
| 303.15 | 0.0000 | 888.2 |
| 303.15 | 0.0475 | 882.9 |
| 303.15 | 0.0945 | 877.8 |
| 303.15 | 0.1954 | 867.0 |
| 303.15 | 0.2986 | 856.1 |
| 303.15 | 0.3908 | 846.3 |
| 303.15 | 0.4948 | 835.0 |
| 303.15 | 0.5967 | 823.5 |
| 303.15 | 0.6937 | 812.5 |
| 303.15 | 0.8006 | 800.0 |
| 303.15 | 0.8994 | 788.5 |
| 303.15 | 0.9507 | 782.4 |
| 303.15 | 1.0000 | 776.6 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 900.5 |
| 293.15 | 0.0475 | 895.2 |
| 293.15 | 0.0945 | 890.1 |
| 293.15 | 0.1954 | 879.0 |
| 293.15 | 0.2986 | 867.8 |
| 293.15 | 0.3908 | 857.6 |
| 293.15 | 0.4948 | 845.9 |
| 293.15 | 0.5967 | 834.0 |
| 293.15 | 0.6937 | 822.6 |
| 293.15 | 0.8006 | 809.6 |
| 293.15 | 0.8994 | 797.6 |
| 293.15 | 0.9507 | 791.2 |
| 293.15 | 1.0000 | 785.0 |
| 298.15 | 0.0000 | 894.4 |
| 298.15 | 0.0475 | 889.2 |
| 298.15 | 0.0945 | 884.1 |
| 298.15 | 0.1954 | 873.1 |
| 298.15 | 0.2986 | 862.0 |
| 298.15 | 0.3908 | 852.0 |
| 298.15 | 0.4948 | 840.5 |
| 298.15 | 0.5967 | 828.8 |
| 298.15 | 0.6937 | 817.6 |
| 298.15 | 0.8006 | 804.9 |
| 298.15 | 0.8994 | 793.1 |
| 298.15 | 0.9507 | 786.9 |
| 298.15 | 1.0000 | 781.0 |
| 303.15 | 0.0000 | 888.2 |
| 303.15 | 0.0475 | 882.9 |
| 303.15 | 0.0945 | 877.8 |
| 303.15 | 0.1954 | 867.0 |
| 303.15 | 0.2986 | 856.1 |
| 303.15 | 0.3908 | 846.3 |
| 303.15 | 0.4948 | 835.0 |
| 303.15 | 0.5967 | 823.5 |
| 303.15 | 0.6937 | 812.5 |
| 303.15 | 0.8006 | 800.0 |
| 303.15 | 0.8994 | 788.5 |
| 303.15 | 0.9507 | 782.4 |
| 303.15 | 1.0000 | 776.6 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1162.0 |
| 293.15 | 0.0475 | 1160.0 |
| 293.15 | 0.0945 | 1158.0 |
| 293.15 | 0.1954 | 1154.0 |
| 293.15 | 0.2986 | 1150.0 |
| 293.15 | 0.3908 | 1147.0 |
| 293.15 | 0.4948 | 1145.0 |
| 293.15 | 0.5967 | 1145.0 |
| 293.15 | 0.6937 | 1146.0 |
| 293.15 | 0.8006 | 1148.0 |
| 293.15 | 0.8994 | 1151.0 |
| 293.15 | 0.9507 | 1153.0 |
| 293.15 | 1.0000 | 1156.0 |
| 298.15 | 0.0000 | 1141.0 |
| 298.15 | 0.0475 | 1138.0 |
| 298.15 | 0.0945 | 1136.0 |
| 298.15 | 0.1954 | 1132.0 |
| 298.15 | 0.2986 | 1129.0 |
| 298.15 | 0.3908 | 1126.0 |
| 298.15 | 0.4948 | 1125.0 |
| 298.15 | 0.5967 | 1126.0 |
| 298.15 | 0.6937 | 1127.0 |
| 298.15 | 0.8006 | 1129.0 |
| 298.15 | 0.8994 | 1133.0 |
| 298.15 | 0.9507 | 1136.0 |
| 298.15 | 1.0000 | 1139.0 |
| 303.15 | 0.0000 | 1111.0 |
| 303.15 | 0.0475 | 1109.0 |
| 303.15 | 0.0945 | 1107.0 |
| 303.15 | 0.1954 | 1104.0 |
| 303.15 | 0.2986 | 1102.0 |
| 303.15 | 0.3908 | 1101.0 |
| 303.15 | 0.4948 | 1102.0 |
| 303.15 | 0.5967 | 1103.0 |
| 303.15 | 0.6937 | 1105.0 |
| 303.15 | 0.8006 | 1108.0 |
| 303.15 | 0.8994 | 1113.0 |
| 303.15 | 0.9507 | 1116.0 |
| 303.15 | 1.0000 | 1121.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1162.0 |
| 293.15 | 0.0475 | 1160.0 |
| 293.15 | 0.0945 | 1158.0 |
| 293.15 | 0.1954 | 1154.0 |
| 293.15 | 0.2986 | 1150.0 |
| 293.15 | 0.3908 | 1147.0 |
| 293.15 | 0.4948 | 1145.0 |
| 293.15 | 0.5967 | 1145.0 |
| 293.15 | 0.6937 | 1146.0 |
| 293.15 | 0.8006 | 1148.0 |
| 293.15 | 0.8994 | 1151.0 |
| 293.15 | 0.9507 | 1153.0 |
| 293.15 | 1.0000 | 1156.0 |
| 298.15 | 0.0000 | 1141.0 |
| 298.15 | 0.0475 | 1138.0 |
| 298.15 | 0.0945 | 1136.0 |
| 298.15 | 0.1954 | 1132.0 |
| 298.15 | 0.2986 | 1129.0 |
| 298.15 | 0.3908 | 1126.0 |
| 298.15 | 0.4948 | 1125.0 |
| 298.15 | 0.5967 | 1126.0 |
| 298.15 | 0.6937 | 1127.0 |
| 298.15 | 0.8006 | 1129.0 |
| 298.15 | 0.8994 | 1133.0 |
| 298.15 | 0.9507 | 1136.0 |
| 298.15 | 1.0000 | 1139.0 |
| 303.15 | 0.0000 | 1111.0 |
| 303.15 | 0.0475 | 1109.0 |
| 303.15 | 0.0945 | 1107.0 |
| 303.15 | 0.1954 | 1104.0 |
| 303.15 | 0.2986 | 1102.0 |
| 303.15 | 0.3908 | 1101.0 |
| 303.15 | 0.4948 | 1102.0 |
| 303.15 | 0.5967 | 1103.0 |
| 303.15 | 0.6937 | 1105.0 |
| 303.15 | 0.8006 | 1108.0 |
| 303.15 | 0.8994 | 1113.0 |
| 303.15 | 0.9507 | 1116.0 |
| 303.15 | 1.0000 | 1121.0 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 355.37 |
| 0.0940 | 353.04 |
| 0.1970 | 351.72 |
| 0.2430 | 351.23 |
| 0.2840 | 350.79 |
| 0.3690 | 349.99 |
| 0.4870 | 349.21 |
| 0.5650 | 348.79 |
| 0.6830 | 348.58 |
| 0.7090 | 348.53 |
| 0.7310 | 348.55 |
| 0.7640 | 348.58 |
| 0.8180 | 348.72 |
| 0.9420 | 349.45 |
| 1.0000 | 350.14 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 355.37 |
| 0.0940 | 353.04 |
| 0.1970 | 351.72 |
| 0.2430 | 351.23 |
| 0.2840 | 350.79 |
| 0.3690 | 349.99 |
| 0.4870 | 349.21 |
| 0.5650 | 348.79 |
| 0.6830 | 348.58 |
| 0.7090 | 348.53 |
| 0.7310 | 348.55 |
| 0.7640 | 348.58 |
| 0.8180 | 348.72 |
| 0.9420 | 349.45 |
| 1.0000 | 350.14 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Ethyl Acetate (2) - Liquid | y1[mol/mol] of Ethyl Acetate (2) - Vapour |
| 354.15 | 0.1000 | 0.1658 |
| 351.95 | 0.2000 | 0.2889 |
| 350.55 | 0.3000 | 0.3876 |
| 349.55 | 0.4000 | 0.4806 |
| 349.35 | 0.5000 | 0.5498 |
| 349.15 | 0.6000 | 0.6268 |
| 349.55 | 0.7000 | 0.7066 |
| 348.65 | 0.8000 | 0.7836 |
| 349.75 | 0.9000 | 0.8854 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 313.15 (VLE)
| Fixed | Measured | |
|---|---|---|
| P [kPa] - VLE | x1[mol/mol] of Ethyl Acetate (2) - Liquid | y1[mol/mol] of Ethyl Acetate (2) - Vapour |
| 15.732 | 0.0380 | 0.1347 |
| 16.065 | 0.0500 | 0.1660 |
| 16.799 | 0.0700 | 0.2175 |
| 18.265 | 0.1155 | 0.3065 |
| 19.798 | 0.1500 | 0.3730 |
| 20.332 | 0.1990 | 0.4230 |
| 21.532 | 0.2700 | 0.4950 |
| 21.865 | 0.2900 | 0.5040 |
| 23.198 | 0.3850 | 0.5780 |
| 23.731 | 0.4615 | 0.6225 |
| 24.465 | 0.5400 | 0.6665 |
| 25.465 | 0.6405 | 0.7120 |
| 25.865 | 0.8140 | 0.8150 |
| 25.598 | 0.9085 | 0.8986 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 333.15 (VLE)
| Fixed | Measured | |
|---|---|---|
| P [kPa] - VLE | x1[mol/mol] of Ethyl Acetate (2) - Liquid | y1[mol/mol] of Ethyl Acetate (2) - Vapour |
| 41.663 | 0.0455 | 0.1254 |
| 42.863 | 0.0740 | 0.1585 |
| 43.93 | 0.0855 | 0.1900 |
| 44.063 | 0.0935 | 0.2176 |
| 45.73 | 0.1295 | 0.2628 |
| 47.329 | 0.1590 | 0.2980 |
| 47.796 | 0.1755 | 0.3205 |
| 51.329 | 0.2665 | 0.4213 |
| 52.529 | 0.3135 | 0.4613 |
| 53.929 | 0.3600 | 0.4881 |
| 54.862 | 0.4275 | 0.5369 |
| 55.062 | 0.4320 | 0.5413 |
| 55.995 | 0.4915 | 0.5832 |
| 57.395 | 0.5905 | 0.6422 |
| 57.595 | 0.6800 | 0.6977 |
| 57.862 | 0.7525 | 0.7445 |
| 57.395 | 0.8350 | 0.8205 |
| 57.595 | 0.9195 | 0.9000 |
| 56.662 | 0.9225 | 0.8932 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Separation of ethyl acetate and 2-propanol azeotropic mixture using ionic liquids as entrainers
- Mixing properties of binary mixtures presenting azeotropes at several temperatures
- Molar excess enthalpies of ethyl acetate + alkanols at T=298.15K, p=10MPa