- Name
- n-Propyl acetate
- InChI
- InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3
- InChI Key
- YKYONYBAUNKHLG-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCCOC(C)=O
- Mol. Weight (g/mol)
- 102.13
- CAS
- 109-60-4
- Name
- Ethane, 1,2-dichloro-
- InChI
- InChI=1S/C2H4Cl2/c3-1-2-4/h1-2H2
- InChI Key
- WSLDOOZREJYCGB-UHFFFAOYSA-N
- Formula
- C2H4Cl2
- SMILES
- ClCCCl
- Mol. Weight (g/mol)
- 98.96
- CAS
- 107-06-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- ρl - Mass density, kg/m3 (2)
- Tboil - Boiling temperature at pressure P, K (2)
Mole fraction of Ethane, 1,2-dichloro- (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Mole fraction of Ethane, 1,2-dichloro- (2) - Gas |
|---|---|
| 1.0000 | 1.0000 |
| 0.8674 | 0.9106 |
| 0.8347 | 0.8880 |
| 0.7962 | 0.8605 |
| 0.7612 | 0.8349 |
| 0.7308 | 0.8124 |
| 0.6846 | 0.7781 |
| 0.6462 | 0.7488 |
| 0.5579 | 0.6798 |
| 0.5484 | 0.6741 |
| 0.5063 | 0.6395 |
| 0.4434 | 0.5802 |
| 0.3865 | 0.5288 |
| 0.3180 | 0.4568 |
| 0.2899 | 0.4277 |
| 0.2448 | 0.3760 |
| 0.1892 | 0.3048 |
| 0.1594 | 0.2642 |
| 0.0818 | 0.1450 |
| 0.0537 | 0.0983 |
| 0.0000 | 0.0000 |
Mole fraction of Ethane, 1,2-dichloro- (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Mole fraction of Ethane, 1,2-dichloro- (2) - Gas |
|---|---|
| 1.0000 | 1.0000 |
| 0.8674 | 0.9106 |
| 0.8347 | 0.8880 |
| 0.7962 | 0.8605 |
| 0.7612 | 0.8349 |
| 0.7308 | 0.8124 |
| 0.6846 | 0.7781 |
| 0.6462 | 0.7488 |
| 0.5579 | 0.6798 |
| 0.5484 | 0.6741 |
| 0.5063 | 0.6395 |
| 0.4434 | 0.5802 |
| 0.3865 | 0.5288 |
| 0.3180 | 0.4568 |
| 0.2899 | 0.4277 |
| 0.2448 | 0.3760 |
| 0.1892 | 0.3048 |
| 0.1594 | 0.2642 |
| 0.0818 | 0.1450 |
| 0.0537 | 0.0983 |
| 0.0000 | 0.0000 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of n-Propyl acetate (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0472 | -0.0650 |
| 0.1047 | -0.1390 |
| 0.1719 | -0.2340 |
| 0.2424 | -0.3320 |
| 0.3127 | -0.4250 |
| 0.3806 | -0.4910 |
| 0.4423 | -0.5350 |
| 0.5012 | -0.5510 |
| 0.5663 | -0.5450 |
| 0.6408 | -0.5110 |
| 0.7169 | -0.4460 |
| 0.8115 | -0.3280 |
| 0.9076 | -0.1870 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of n-Propyl acetate (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0472 | -0.0650 |
| 0.1047 | -0.1390 |
| 0.1719 | -0.2340 |
| 0.2424 | -0.3320 |
| 0.3127 | -0.4250 |
| 0.3806 | -0.4910 |
| 0.4423 | -0.5350 |
| 0.5012 | -0.5510 |
| 0.5663 | -0.5450 |
| 0.6408 | -0.5110 |
| 0.7169 | -0.4460 |
| 0.8115 | -0.3280 |
| 0.9076 | -0.1870 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of n-Propyl acetate (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0403 | 1224.14 |
| 0.0822 | 1202.71 |
| 0.1258 | 1181.25 |
| 0.1723 | 1159.34 |
| 0.2206 | 1137.71 |
| 0.2710 | 1116.1 |
| 0.3230 | 1094.66 |
| 0.3773 | 1073.38 |
| 0.4350 | 1051.79 |
| 0.4925 | 1031.26 |
| 0.5542 | 1010.09 |
| 0.6231 | 987.69 |
| 0.6930 | 966.04 |
| 0.7654 | 944.7 |
| 0.8389 | 924.07 |
| 0.9173 | 903.11 |
| 1.0000 | 882.08 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of n-Propyl acetate (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0403 | 1224.14 |
| 0.0822 | 1202.71 |
| 0.1258 | 1181.25 |
| 0.1723 | 1159.34 |
| 0.2206 | 1137.71 |
| 0.2710 | 1116.1 |
| 0.3230 | 1094.66 |
| 0.3773 | 1073.38 |
| 0.4350 | 1051.79 |
| 0.4925 | 1031.26 |
| 0.5542 | 1010.09 |
| 0.6231 | 987.69 |
| 0.6930 | 966.04 |
| 0.7654 | 944.7 |
| 0.8389 | 924.07 |
| 0.9173 | 903.11 |
| 1.0000 | 882.08 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 1.0000 | 356.59 |
| 0.8674 | 358.03 |
| 0.8347 | 358.45 |
| 0.7962 | 358.84 |
| 0.7612 | 359.19 |
| 0.7308 | 359.47 |
| 0.6846 | 359.91 |
| 0.6462 | 360.43 |
| 0.5579 | 361.97 |
| 0.5484 | 362.17 |
| 0.5063 | 362.61 |
| 0.4434 | 363.73 |
| 0.3865 | 365.22 |
| 0.3180 | 366.39 |
| 0.2899 | 366.90 |
| 0.2448 | 367.84 |
| 0.1892 | 369.01 |
| 0.1594 | 369.75 |
| 0.0818 | 372.06 |
| 0.0537 | 372.79 |
| 0.0000 | 374.65 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 1.0000 | 356.59 |
| 0.8674 | 358.03 |
| 0.8347 | 358.45 |
| 0.7962 | 358.84 |
| 0.7612 | 359.19 |
| 0.7308 | 359.47 |
| 0.6846 | 359.91 |
| 0.6462 | 360.43 |
| 0.5579 | 361.97 |
| 0.5484 | 362.17 |
| 0.5063 | 362.61 |
| 0.4434 | 363.73 |
| 0.3865 | 365.22 |
| 0.3180 | 366.39 |
| 0.2899 | 366.90 |
| 0.2448 | 367.84 |
| 0.1892 | 369.01 |
| 0.1594 | 369.75 |
| 0.0818 | 372.06 |
| 0.0537 | 372.79 |
| 0.0000 | 374.65 |
Sources
- Thermodynamic study of (alkyl esters + a,x-alkyl dihalides) VII. HE m and VE m for 20 binary mixtures {xCu 1H2u 1CO2C3H7 + (1 x)a,x-ClCH2(CH2)v 2CH2Cl}, where u = 1 to 4, a = 1 and v = x = 2 to 6. An analysis of behavior using the COSMO-RS methodology
- Isobaric Vapor-Liquid Equilibrium for the Binary Systems of 1,2-Dichloroethane + sec-Butyl Acetate, n-Propyl Acetate, and tert-Butyl Acetate at 101.3 kPa