- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Ethane, 1,2-dimethoxy-
- InChI
- InChI=1S/C4H10O2/c1-5-3-4-6-2/h3-4H2,1-2H3
- InChI Key
- XTHFKEDIFFGKHM-UHFFFAOYSA-N
- Formula
- C4H10O2
- SMILES
- COCCOC
- Mol. Weight (g/mol)
- 90.12
- CAS
- 110-71-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
- Excess molar volume, m3/mol (2)
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 856.95 |
| 298.15 | 0.1002 | 857.45 |
| 298.15 | 0.2004 | 857.95 |
| 298.15 | 0.2996 | 858.44 |
| 298.15 | 0.4001 | 858.93 |
| 298.15 | 0.5009 | 859.41 |
| 298.15 | 0.5997 | 859.85 |
| 298.15 | 0.7018 | 860.28 |
| 298.15 | 0.8005 | 860.66 |
| 298.15 | 0.8998 | 861.02 |
| 298.15 | 1.0000 | 861.36 |
| 303.15 | 0.0000 | 852.61 |
| 303.15 | 0.0999 | 853.1 |
| 303.15 | 0.2007 | 853.58 |
| 303.15 | 0.3002 | 854.06 |
| 303.15 | 0.3999 | 854.52 |
| 303.15 | 0.4999 | 854.97 |
| 303.15 | 0.6001 | 855.4 |
| 303.15 | 0.7011 | 855.81 |
| 303.15 | 0.8003 | 856.19 |
| 303.15 | 0.9003 | 856.52 |
| 303.15 | 1.0000 | 856.79 |
| 308.15 | 0.0000 | 848.27 |
| 308.15 | 0.0996 | 848.66 |
| 308.15 | 0.1998 | 849.05 |
| 308.15 | 0.2997 | 849.41 |
| 308.15 | 0.4001 | 849.76 |
| 308.15 | 0.4995 | 850.09 |
| 308.15 | 0.6004 | 850.4 |
| 308.15 | 0.6993 | 850.67 |
| 308.15 | 0.7993 | 850.93 |
| 308.15 | 0.8998 | 851.14 |
| 308.15 | 1.0000 | 851.24 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 856.95 |
| 298.15 | 0.1002 | 857.45 |
| 298.15 | 0.2004 | 857.95 |
| 298.15 | 0.2996 | 858.44 |
| 298.15 | 0.4001 | 858.93 |
| 298.15 | 0.5009 | 859.41 |
| 298.15 | 0.5997 | 859.85 |
| 298.15 | 0.7018 | 860.28 |
| 298.15 | 0.8005 | 860.66 |
| 298.15 | 0.8998 | 861.02 |
| 298.15 | 1.0000 | 861.36 |
| 303.15 | 0.0000 | 852.61 |
| 303.15 | 0.0999 | 853.1 |
| 303.15 | 0.2007 | 853.58 |
| 303.15 | 0.3002 | 854.06 |
| 303.15 | 0.3999 | 854.52 |
| 303.15 | 0.4999 | 854.97 |
| 303.15 | 0.6001 | 855.4 |
| 303.15 | 0.7011 | 855.81 |
| 303.15 | 0.8003 | 856.19 |
| 303.15 | 0.9003 | 856.52 |
| 303.15 | 1.0000 | 856.79 |
| 308.15 | 0.0000 | 848.27 |
| 308.15 | 0.0996 | 848.66 |
| 308.15 | 0.1998 | 849.05 |
| 308.15 | 0.2997 | 849.41 |
| 308.15 | 0.4001 | 849.76 |
| 308.15 | 0.4995 | 850.09 |
| 308.15 | 0.6004 | 850.4 |
| 308.15 | 0.6993 | 850.67 |
| 308.15 | 0.7993 | 850.93 |
| 308.15 | 0.8998 | 851.14 |
| 308.15 | 1.0000 | 851.24 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0281 |
| 298.15 | 0.1002 | 0.0276 |
| 298.15 | 0.2004 | 0.0272 |
| 298.15 | 0.2996 | 0.0267 |
| 298.15 | 0.4001 | 0.0263 |
| 298.15 | 0.5009 | 0.0259 |
| 298.15 | 0.5997 | 0.0255 |
| 298.15 | 0.7018 | 0.0252 |
| 298.15 | 0.8005 | 0.0249 |
| 298.15 | 0.8998 | 0.0246 |
| 298.15 | 1.0000 | 0.0243 |
| 303.15 | 0.0000 | 0.0276 |
| 303.15 | 0.0999 | 0.0271 |
| 303.15 | 0.2007 | 0.0267 |
| 303.15 | 0.3002 | 0.0262 |
| 303.15 | 0.3999 | 0.0258 |
| 303.15 | 0.4999 | 0.0254 |
| 303.15 | 0.6001 | 0.0250 |
| 303.15 | 0.7011 | 0.0247 |
| 303.15 | 0.8003 | 0.0244 |
| 303.15 | 0.9003 | 0.0240 |
| 303.15 | 1.0000 | 0.0237 |
| 308.15 | 0.0000 | 0.0271 |
| 308.15 | 0.0996 | 0.0266 |
| 308.15 | 0.1998 | 0.0262 |
| 308.15 | 0.2997 | 0.0257 |
| 308.15 | 0.4001 | 0.0253 |
| 308.15 | 0.4995 | 0.0249 |
| 308.15 | 0.6004 | 0.0245 |
| 308.15 | 0.6993 | 0.0242 |
| 308.15 | 0.7993 | 0.0238 |
| 308.15 | 0.8998 | 0.0235 |
| 308.15 | 1.0000 | 0.0232 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0281 |
| 298.15 | 0.1002 | 0.0276 |
| 298.15 | 0.2004 | 0.0272 |
| 298.15 | 0.2996 | 0.0267 |
| 298.15 | 0.4001 | 0.0263 |
| 298.15 | 0.5009 | 0.0259 |
| 298.15 | 0.5997 | 0.0255 |
| 298.15 | 0.7018 | 0.0252 |
| 298.15 | 0.8005 | 0.0249 |
| 298.15 | 0.8998 | 0.0246 |
| 298.15 | 1.0000 | 0.0243 |
| 303.15 | 0.0000 | 0.0276 |
| 303.15 | 0.0999 | 0.0271 |
| 303.15 | 0.2007 | 0.0267 |
| 303.15 | 0.3002 | 0.0262 |
| 303.15 | 0.3999 | 0.0258 |
| 303.15 | 0.4999 | 0.0254 |
| 303.15 | 0.6001 | 0.0250 |
| 303.15 | 0.7011 | 0.0247 |
| 303.15 | 0.8003 | 0.0244 |
| 303.15 | 0.9003 | 0.0240 |
| 303.15 | 1.0000 | 0.0237 |
| 308.15 | 0.0000 | 0.0271 |
| 308.15 | 0.0996 | 0.0266 |
| 308.15 | 0.1998 | 0.0262 |
| 308.15 | 0.2997 | 0.0257 |
| 308.15 | 0.4001 | 0.0253 |
| 308.15 | 0.4995 | 0.0249 |
| 308.15 | 0.6004 | 0.0245 |
| 308.15 | 0.6993 | 0.0242 |
| 308.15 | 0.7993 | 0.0238 |
| 308.15 | 0.8998 | 0.0235 |
| 308.15 | 1.0000 | 0.0232 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 298.15 | 0.0000 | 0.0000 |
| 298.15 | 0.1002 | -1.7200e-08 |
| 298.15 | 0.2004 | -3.2100e-08 |
| 298.15 | 0.2996 | -4.4000e-08 |
| 298.15 | 0.4001 | -5.2900e-08 |
| 298.15 | 0.5009 | -5.7900e-08 |
| 298.15 | 0.5997 | -5.7100e-08 |
| 298.15 | 0.7018 | -5.0600e-08 |
| 298.15 | 0.8005 | -3.8400e-08 |
| 298.15 | 0.8998 | -2.1500e-08 |
| 298.15 | 1.0000 | 0.0000 |
| 303.15 | 0.0000 | 0.0000 |
| 303.15 | 0.0999 | -1.8500e-08 |
| 303.15 | 0.2007 | -3.3900e-08 |
| 303.15 | 0.3002 | -4.6900e-08 |
| 303.15 | 0.3999 | -5.4800e-08 |
| 303.15 | 0.4999 | -6.0400e-08 |
| 303.15 | 0.6001 | -6.0000e-08 |
| 303.15 | 0.7011 | -5.4500e-08 |
| 303.15 | 0.8003 | -4.4400e-08 |
| 303.15 | 0.9003 | -2.7200e-08 |
| 303.15 | 1.0000 | 0.0000 |
| 308.15 | 0.0000 | 0.0000 |
| 308.15 | 0.0996 | -1.9700e-08 |
| 308.15 | 0.1998 | -3.7400e-08 |
| 308.15 | 0.2997 | -4.9300e-08 |
| 308.15 | 0.4001 | -5.7900e-08 |
| 308.15 | 0.4995 | -6.2600e-08 |
| 308.15 | 0.6004 | -6.2500e-08 |
| 308.15 | 0.6993 | -5.6600e-08 |
| 308.15 | 0.7993 | -4.7700e-08 |
| 308.15 | 0.8998 | -3.1100e-08 |
| 308.15 | 1.0000 | 0.0000 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 298.15 | 0.0000 | 0.0000 |
| 298.15 | 0.1002 | -1.7200e-08 |
| 298.15 | 0.2004 | -3.2100e-08 |
| 298.15 | 0.2996 | -4.4000e-08 |
| 298.15 | 0.4001 | -5.2900e-08 |
| 298.15 | 0.5009 | -5.7900e-08 |
| 298.15 | 0.5997 | -5.7100e-08 |
| 298.15 | 0.7018 | -5.0600e-08 |
| 298.15 | 0.8005 | -3.8400e-08 |
| 298.15 | 0.8998 | -2.1500e-08 |
| 298.15 | 1.0000 | 0.0000 |
| 303.15 | 0.0000 | 0.0000 |
| 303.15 | 0.0999 | -1.8500e-08 |
| 303.15 | 0.2007 | -3.3900e-08 |
| 303.15 | 0.3002 | -4.6900e-08 |
| 303.15 | 0.3999 | -5.4800e-08 |
| 303.15 | 0.4999 | -6.0400e-08 |
| 303.15 | 0.6001 | -6.0000e-08 |
| 303.15 | 0.7011 | -5.4500e-08 |
| 303.15 | 0.8003 | -4.4400e-08 |
| 303.15 | 0.9003 | -2.7200e-08 |
| 303.15 | 1.0000 | 0.0000 |
| 308.15 | 0.0000 | 0.0000 |
| 308.15 | 0.0996 | -1.9700e-08 |
| 308.15 | 0.1998 | -3.7400e-08 |
| 308.15 | 0.2997 | -4.9300e-08 |
| 308.15 | 0.4001 | -5.7900e-08 |
| 308.15 | 0.4995 | -6.2600e-08 |
| 308.15 | 0.6004 | -6.2500e-08 |
| 308.15 | 0.6993 | -5.6600e-08 |
| 308.15 | 0.7993 | -4.7700e-08 |
| 308.15 | 0.8998 | -3.1100e-08 |
| 308.15 | 1.0000 | 0.0000 |