- Name
- Formamide, N,N-dimethyl-
- InChI
- InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3
- InChI Key
- ZMXDDKWLCZADIW-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CN(C)C=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 68-12-2
- Name
- 2-Propenoic acid, butyl ester
- InChI
- InChI=1S/C7H12O2/c1-3-5-6-9-7(8)4-2/h4H,2-3,5-6H2,1H3
- InChI Key
- CQEYYJKEWSMYFG-UHFFFAOYSA-N
- Formula
- C7H12O2
- SMILES
- C=CC(=O)OCCCC
- Mol. Weight (g/mol)
- 128.17
- CAS
- 141-32-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 885.4 |
| 0.1699 | 882.93 |
| 0.3078 | 883.92 |
| 0.4456 | 891.03 |
| 0.5488 | 897.06 |
| 0.6528 | 904.42 |
| 0.7328 | 910.66 |
| 0.8132 | 917.38 |
| 0.8876 | 924.71 |
| 0.9427 | 930.0 |
| 1.0000 | 935.88 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 903.6 |
| 288.15 | 0.0698 | 905.63 |
| 288.15 | 0.1405 | 907.81 |
| 288.15 | 0.2075 | 910.02 |
| 288.15 | 0.2786 | 912.52 |
| 288.15 | 0.3512 | 915.26 |
| 288.15 | 0.4200 | 918.06 |
| 288.15 | 0.4906 | 921.15 |
| 288.15 | 0.5562 | 924.25 |
| 288.15 | 0.6372 | 928.42 |
| 288.15 | 0.7199 | 933.11 |
| 288.15 | 0.7859 | 937.24 |
| 288.15 | 0.8553 | 941.99 |
| 288.15 | 0.9312 | 947.76 |
| 288.15 | 1.0000 | 953.61 |
| 293.15 | 0.0000 | 898.85 |
| 293.15 | 0.0698 | 900.91 |
| 293.15 | 0.1405 | 903.12 |
| 293.15 | 0.2075 | 905.35 |
| 293.15 | 0.2786 | 907.86 |
| 293.15 | 0.3512 | 910.62 |
| 293.15 | 0.4200 | 913.44 |
| 293.15 | 0.4906 | 916.54 |
| 293.15 | 0.5562 | 919.66 |
| 293.15 | 0.6372 | 923.85 |
| 293.15 | 0.7199 | 928.56 |
| 293.15 | 0.7859 | 932.71 |
| 293.15 | 0.8553 | 937.47 |
| 293.15 | 0.9312 | 943.25 |
| 293.15 | 1.0000 | 949.1 |
| 298.15 | 0.0000 | 894.1 |
| 298.15 | 0.0698 | 896.19 |
| 298.15 | 0.1405 | 898.43 |
| 298.15 | 0.2075 | 900.67 |
| 298.15 | 0.2786 | 903.2 |
| 298.15 | 0.3512 | 905.98 |
| 298.15 | 0.4200 | 908.81 |
| 298.15 | 0.4906 | 911.93 |
| 298.15 | 0.5562 | 915.07 |
| 298.15 | 0.6372 | 919.28 |
| 298.15 | 0.7199 | 924.01 |
| 298.15 | 0.7859 | 928.18 |
| 298.15 | 0.8553 | 932.95 |
| 298.15 | 0.9312 | 938.74 |
| 298.15 | 1.0000 | 944.6 |
| 303.15 | 0.0000 | 889.35 |
| 303.15 | 0.0698 | 891.47 |
| 303.15 | 0.1405 | 893.73 |
| 303.15 | 0.2075 | 895.99 |
| 303.15 | 0.2786 | 898.54 |
| 303.15 | 0.3512 | 901.34 |
| 303.15 | 0.4200 | 904.18 |
| 303.15 | 0.4906 | 907.32 |
| 303.15 | 0.5562 | 910.47 |
| 303.15 | 0.6372 | 914.7 |
| 303.15 | 0.7199 | 919.46 |
| 303.15 | 0.7859 | 923.65 |
| 303.15 | 0.8553 | 928.43 |
| 303.15 | 0.9312 | 934.23 |
| 303.15 | 1.0000 | 940.1 |
| 308.15 | 0.0000 | 884.6 |
| 308.15 | 0.0698 | 886.75 |
| 308.15 | 0.1405 | 889.03 |
| 308.15 | 0.2075 | 891.31 |
| 308.15 | 0.2786 | 893.88 |
| 308.15 | 0.3512 | 896.7 |
| 308.15 | 0.4200 | 899.55 |
| 308.15 | 0.4906 | 902.71 |
| 308.15 | 0.5562 | 905.87 |
| 308.15 | 0.6372 | 910.12 |
| 308.15 | 0.7199 | 914.91 |
| 308.15 | 0.7859 | 919.11 |
| 308.15 | 0.8553 | 923.91 |
| 308.15 | 0.9312 | 929.72 |
| 308.15 | 1.0000 | 935.6 |
| 313.15 | 0.0000 | 879.85 |
| 313.15 | 0.0698 | 882.03 |
| 313.15 | 0.1405 | 884.33 |
| 313.15 | 0.2075 | 886.63 |
| 313.15 | 0.2786 | 889.22 |
| 313.15 | 0.3512 | 892.05 |
| 313.15 | 0.4200 | 894.92 |
| 313.15 | 0.4906 | 898.1 |
| 313.15 | 0.5562 | 901.27 |
| 313.15 | 0.6372 | 905.54 |
| 313.15 | 0.7199 | 910.35 |
| 313.15 | 0.7859 | 914.57 |
| 313.15 | 0.8553 | 919.39 |
| 313.15 | 0.9312 | 925.21 |
| 313.15 | 1.0000 | 931.1 |
| 318.15 | 0.0000 | 875.1 |
| 318.15 | 0.0698 | 877.31 |
| 318.15 | 0.1405 | 879.63 |
| 318.15 | 0.2075 | 881.95 |
| 318.15 | 0.2786 | 884.56 |
| 318.15 | 0.3512 | 887.4 |
| 318.15 | 0.4200 | 890.29 |
| 318.15 | 0.4906 | 893.48 |
| 318.15 | 0.5562 | 896.67 |
| 318.15 | 0.6372 | 900.96 |
| 318.15 | 0.7199 | 905.79 |
| 318.15 | 0.7859 | 910.03 |
| 318.15 | 0.8553 | 914.87 |
| 318.15 | 0.9312 | 920.7 |
| 318.15 | 1.0000 | 926.6 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 885.4 |
| 0.1699 | 882.93 |
| 0.3078 | 883.92 |
| 0.4456 | 891.03 |
| 0.5488 | 897.06 |
| 0.6528 | 904.42 |
| 0.7328 | 910.66 |
| 0.8132 | 917.38 |
| 0.8876 | 924.71 |
| 0.9427 | 930.0 |
| 1.0000 | 935.88 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 903.6 |
| 288.15 | 0.0698 | 905.63 |
| 288.15 | 0.1405 | 907.81 |
| 288.15 | 0.2075 | 910.02 |
| 288.15 | 0.2786 | 912.52 |
| 288.15 | 0.3512 | 915.26 |
| 288.15 | 0.4200 | 918.06 |
| 288.15 | 0.4906 | 921.15 |
| 288.15 | 0.5562 | 924.25 |
| 288.15 | 0.6372 | 928.42 |
| 288.15 | 0.7199 | 933.11 |
| 288.15 | 0.7859 | 937.24 |
| 288.15 | 0.8553 | 941.99 |
| 288.15 | 0.9312 | 947.76 |
| 288.15 | 1.0000 | 953.61 |
| 293.15 | 0.0000 | 898.85 |
| 293.15 | 0.0698 | 900.91 |
| 293.15 | 0.1405 | 903.12 |
| 293.15 | 0.2075 | 905.35 |
| 293.15 | 0.2786 | 907.86 |
| 293.15 | 0.3512 | 910.62 |
| 293.15 | 0.4200 | 913.44 |
| 293.15 | 0.4906 | 916.54 |
| 293.15 | 0.5562 | 919.66 |
| 293.15 | 0.6372 | 923.85 |
| 293.15 | 0.7199 | 928.56 |
| 293.15 | 0.7859 | 932.71 |
| 293.15 | 0.8553 | 937.47 |
| 293.15 | 0.9312 | 943.25 |
| 293.15 | 1.0000 | 949.1 |
| 298.15 | 0.0000 | 894.1 |
| 298.15 | 0.0698 | 896.19 |
| 298.15 | 0.1405 | 898.43 |
| 298.15 | 0.2075 | 900.67 |
| 298.15 | 0.2786 | 903.2 |
| 298.15 | 0.3512 | 905.98 |
| 298.15 | 0.4200 | 908.81 |
| 298.15 | 0.4906 | 911.93 |
| 298.15 | 0.5562 | 915.07 |
| 298.15 | 0.6372 | 919.28 |
| 298.15 | 0.7199 | 924.01 |
| 298.15 | 0.7859 | 928.18 |
| 298.15 | 0.8553 | 932.95 |
| 298.15 | 0.9312 | 938.74 |
| 298.15 | 1.0000 | 944.6 |
| 303.15 | 0.0000 | 889.35 |
| 303.15 | 0.0698 | 891.47 |
| 303.15 | 0.1405 | 893.73 |
| 303.15 | 0.2075 | 895.99 |
| 303.15 | 0.2786 | 898.54 |
| 303.15 | 0.3512 | 901.34 |
| 303.15 | 0.4200 | 904.18 |
| 303.15 | 0.4906 | 907.32 |
| 303.15 | 0.5562 | 910.47 |
| 303.15 | 0.6372 | 914.7 |
| 303.15 | 0.7199 | 919.46 |
| 303.15 | 0.7859 | 923.65 |
| 303.15 | 0.8553 | 928.43 |
| 303.15 | 0.9312 | 934.23 |
| 303.15 | 1.0000 | 940.1 |
| 308.15 | 0.0000 | 884.6 |
| 308.15 | 0.0698 | 886.75 |
| 308.15 | 0.1405 | 889.03 |
| 308.15 | 0.2075 | 891.31 |
| 308.15 | 0.2786 | 893.88 |
| 308.15 | 0.3512 | 896.7 |
| 308.15 | 0.4200 | 899.55 |
| 308.15 | 0.4906 | 902.71 |
| 308.15 | 0.5562 | 905.87 |
| 308.15 | 0.6372 | 910.12 |
| 308.15 | 0.7199 | 914.91 |
| 308.15 | 0.7859 | 919.11 |
| 308.15 | 0.8553 | 923.91 |
| 308.15 | 0.9312 | 929.72 |
| 308.15 | 1.0000 | 935.6 |
| 313.15 | 0.0000 | 879.85 |
| 313.15 | 0.0698 | 882.03 |
| 313.15 | 0.1405 | 884.33 |
| 313.15 | 0.2075 | 886.63 |
| 313.15 | 0.2786 | 889.22 |
| 313.15 | 0.3512 | 892.05 |
| 313.15 | 0.4200 | 894.92 |
| 313.15 | 0.4906 | 898.1 |
| 313.15 | 0.5562 | 901.27 |
| 313.15 | 0.6372 | 905.54 |
| 313.15 | 0.7199 | 910.35 |
| 313.15 | 0.7859 | 914.57 |
| 313.15 | 0.8553 | 919.39 |
| 313.15 | 0.9312 | 925.21 |
| 313.15 | 1.0000 | 931.1 |
| 318.15 | 0.0000 | 875.1 |
| 318.15 | 0.0698 | 877.31 |
| 318.15 | 0.1405 | 879.63 |
| 318.15 | 0.2075 | 881.95 |
| 318.15 | 0.2786 | 884.56 |
| 318.15 | 0.3512 | 887.4 |
| 318.15 | 0.4200 | 890.29 |
| 318.15 | 0.4906 | 893.48 |
| 318.15 | 0.5562 | 896.67 |
| 318.15 | 0.6372 | 900.96 |
| 318.15 | 0.7199 | 905.79 |
| 318.15 | 0.7859 | 910.03 |
| 318.15 | 0.8553 | 914.87 |
| 318.15 | 0.9312 | 920.7 |
| 318.15 | 1.0000 | 926.6 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1168.56 |
| 0.1699 | 1194.7 |
| 0.3078 | 1219.52 |
| 0.4456 | 1246.5 |
| 0.5488 | 1269.2 |
| 0.6528 | 1297.09 |
| 0.7328 | 1323.0 |
| 0.8132 | 1350.34 |
| 0.8470 | 1362.47 |
| 0.9427 | 1401.26 |
| 1.0000 | 1424.3 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1168.56 |
| 0.1699 | 1194.7 |
| 0.3078 | 1219.52 |
| 0.4456 | 1246.5 |
| 0.5488 | 1269.2 |
| 0.6528 | 1297.09 |
| 0.7328 | 1323.0 |
| 0.8132 | 1350.34 |
| 0.8470 | 1362.47 |
| 0.9427 | 1401.26 |
| 1.0000 | 1424.3 |
Sources
- Ultrasonic velocities, densities, and excess molar volumes of binary mixtures of N,N-dimethyl formamide with methyl acrylate, or ethyl acrylate, or butyl acrylate, or 2-ethyl hexyl acrylate at T = 308.15 K
- Densities and volumetric properties of binary mixtures of N,N-dimethylformamide/N,N-dimethylacetamide with some alkyl acrylates at temperatures from 288.15 K to 318.15 K