- Name
- Glycerin
- InChI
- InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2
- InChI Key
- PEDCQBHIVMGVHV-UHFFFAOYSA-N
- Formula
- C3H8O3
- SMILES
- OCC(O)CO
- Mol. Weight (g/mol)
- 92.09
- CAS
- 56-81-5
- Name
- Ethanol, 2-diethylamino-, hydrochloride
- InChI
- InChI=1S/C6H15NO.ClH/c1-3-7(4-2)5-6-8;/h8H,3-6H2,1-2H3;1H
- InChI Key
- DBQUKJMNGUJRFI-UHFFFAOYSA-N
- Formula
- C6H16ClNO
- SMILES
- CCN(CC)CCO.Cl
- Mol. Weight (g/mol)
- 153.65
- CAS
- 14426-20-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- η - Viscosity, Pa*s (2)
- σcond - Electrical conductivity, S/m (4)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (8)
- γ - Surface tension liquid-gas, N/m (2)
- Tfus - Solid-liquid equilibrium temperature, K (6)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.3333 (Liquid)
| Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 303.15 | 83.46 |
| 308.15 | 83.96 |
| 313.15 | 84.39 |
| 318.15 | 85.16 |
| 323.15 | 85.72 |
| 328.15 | 86.36 |
| 333.15 | 86.96 |
| 338.15 | 87.79 |
| 343.15 | 88.46 |
| 348.15 | 89.09 |
| 353.15 | 89.76 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.3333 (Liquid)
| Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 303.15 | 83.46 |
| 308.15 | 83.96 |
| 313.15 | 84.39 |
| 318.15 | 85.16 |
| 323.15 | 85.72 |
| 328.15 | 86.36 |
| 333.15 | 86.96 |
| 338.15 | 87.79 |
| 343.15 | 88.46 |
| 348.15 | 89.09 |
| 353.15 | 89.76 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.333 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 298.15 | 0.5131 |
| 303.15 | 0.3515 |
| 308.15 | 0.2513 |
| 313.15 | 0.1829 |
| 318.15 | 0.1380 |
| 323.15 | 0.1042 |
| 328.15 | 0.0828 |
| 333.15 | 0.0655 |
| 338.15 | 0.0523 |
| 343.15 | 0.0426 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.333 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 298.15 | 0.5131 |
| 303.15 | 0.3515 |
| 308.15 | 0.2513 |
| 313.15 | 0.1829 |
| 318.15 | 0.1380 |
| 323.15 | 0.1042 |
| 328.15 | 0.0828 |
| 333.15 | 0.0655 |
| 338.15 | 0.0523 |
| 343.15 | 0.0426 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Electrical conductivity, S/m - Liquid |
| 298.15 | 0.3400 | 0.0750 |
| 303.15 | 0.3400 | 0.1177 |
| 308.15 | 0.3400 | 0.1635 |
| 313.15 | 0.3400 | 0.2067 |
| 318.15 | 0.3400 | 0.2716 |
| 323.15 | 0.3400 | 0.3381 |
| 328.15 | 0.3400 | 0.3903 |
| 333.15 | 0.3400 | 0.4878 |
| 338.15 | 0.3400 | 0.5754 |
| 343.15 | 0.3400 | 0.6521 |
| 348.15 | 0.3400 | 0.7754 |
| 353.15 | 0.3400 | 0.9109 |
| 298.15 | 0.2500 | 0.0602 |
| 303.15 | 0.2500 | 0.0958 |
| 308.15 | 0.2500 | 0.1041 |
| 313.15 | 0.2500 | 0.1562 |
| 318.15 | 0.2500 | 0.2112 |
| 323.15 | 0.2500 | 0.2637 |
| 328.15 | 0.2500 | 0.3426 |
| 333.15 | 0.2500 | 0.4086 |
| 338.15 | 0.2500 | 0.4916 |
| 343.15 | 0.2500 | 0.5748 |
| 348.15 | 0.2500 | 0.6474 |
| 353.15 | 0.2500 | 0.7100 |
| 298.15 | 0.2000 | 0.0487 |
| 303.15 | 0.2000 | 0.0780 |
| 308.15 | 0.2000 | 0.1099 |
| 313.15 | 0.2000 | 0.1387 |
| 318.15 | 0.2000 | 0.1878 |
| 323.15 | 0.2000 | 0.2357 |
| 328.15 | 0.2000 | 0.2716 |
| 333.15 | 0.2000 | 0.3246 |
| 338.15 | 0.2000 | 0.3962 |
| 343.15 | 0.2000 | 0.4646 |
| 348.15 | 0.2000 | 0.5335 |
| 353.15 | 0.2000 | 0.6095 |
Electrical conductivity, S/m [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.3333 (Liquid)
| Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
|---|---|
| 298.15 | 0.0690 |
| 303.15 | 0.0980 |
| 308.15 | 0.1340 |
| 313.15 | 0.1750 |
| 318.15 | 0.2280 |
| 323.15 | 0.2930 |
| 328.15 | 0.3680 |
| 333.15 | 0.4560 |
| 338.15 | 0.5560 |
| 343.15 | 0.6670 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Electrical conductivity, S/m - Liquid |
| 298.15 | 0.3400 | 0.0750 |
| 303.15 | 0.3400 | 0.1177 |
| 308.15 | 0.3400 | 0.1635 |
| 313.15 | 0.3400 | 0.2067 |
| 318.15 | 0.3400 | 0.2716 |
| 323.15 | 0.3400 | 0.3381 |
| 328.15 | 0.3400 | 0.3903 |
| 333.15 | 0.3400 | 0.4878 |
| 338.15 | 0.3400 | 0.5754 |
| 343.15 | 0.3400 | 0.6521 |
| 348.15 | 0.3400 | 0.7754 |
| 353.15 | 0.3400 | 0.9109 |
| 298.15 | 0.2500 | 0.0602 |
| 303.15 | 0.2500 | 0.0958 |
| 308.15 | 0.2500 | 0.1041 |
| 313.15 | 0.2500 | 0.1562 |
| 318.15 | 0.2500 | 0.2112 |
| 323.15 | 0.2500 | 0.2637 |
| 328.15 | 0.2500 | 0.3426 |
| 333.15 | 0.2500 | 0.4086 |
| 338.15 | 0.2500 | 0.4916 |
| 343.15 | 0.2500 | 0.5748 |
| 348.15 | 0.2500 | 0.6474 |
| 353.15 | 0.2500 | 0.7100 |
| 298.15 | 0.2000 | 0.0487 |
| 303.15 | 0.2000 | 0.0780 |
| 308.15 | 0.2000 | 0.1099 |
| 313.15 | 0.2000 | 0.1387 |
| 318.15 | 0.2000 | 0.1878 |
| 323.15 | 0.2000 | 0.2357 |
| 328.15 | 0.2000 | 0.2716 |
| 333.15 | 0.2000 | 0.3246 |
| 338.15 | 0.2000 | 0.3962 |
| 343.15 | 0.2000 | 0.4646 |
| 348.15 | 0.2000 | 0.5335 |
| 353.15 | 0.2000 | 0.6095 |
Electrical conductivity, S/m [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.3333 (Liquid)
| Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
|---|---|
| 298.15 | 0.0690 |
| 303.15 | 0.0980 |
| 308.15 | 0.1340 |
| 313.15 | 0.1750 |
| 318.15 | 0.2280 |
| 323.15 | 0.2930 |
| 328.15 | 0.3680 |
| 333.15 | 0.4560 |
| 338.15 | 0.5560 |
| 343.15 | 0.6670 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Glycerin (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.3400 | 1.4853 |
| 0.2500 | 1.4825 |
| 0.2000 | 1.4812 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.333 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 298.15 | 1.4856 |
| 303.15 | 1.4844 |
| 308.15 | 1.4831 |
| 313.15 | 1.4818 |
| 318.15 | 1.4805 |
| 323.15 | 1.4792 |
| 328.15 | 1.478 |
| 333.15 | 1.4766 |
| 338.15 | 1.4753 |
| 343.15 | 1.474 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Glycerin (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.3400 | 1.4853 |
| 0.2500 | 1.4825 |
| 0.2000 | 1.4812 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.333 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 298.15 | 1.4856 |
| 303.15 | 1.4844 |
| 308.15 | 1.4831 |
| 313.15 | 1.4818 |
| 318.15 | 1.4805 |
| 323.15 | 1.4792 |
| 328.15 | 1.478 |
| 333.15 | 1.4766 |
| 338.15 | 1.4753 |
| 343.15 | 1.474 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.3400 | 1183.6 |
| 0.2500 | 1205.7 |
| 0.2000 | 1220.4 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.333 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 298.15 | 1176.6 |
| 303.15 | 1173.5 |
| 308.15 | 1170.3 |
| 313.15 | 1167.2 |
| 318.15 | 1164.2 |
| 323.15 | 1161.2 |
| 328.15 | 1158.2 |
| 333.15 | 1155.2 |
| 338.15 | 1152.2 |
| 343.15 | 1149.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.2000 | 298.15 | 1220.1 |
| 0.2000 | 303.15 | 1217.3 |
| 0.2000 | 308.15 | 1214.1 |
| 0.2000 | 313.15 | 1211.4 |
| 0.2000 | 318.15 | 1208.1 |
| 0.2000 | 323.15 | 1204.8 |
| 0.2000 | 328.15 | 1202.1 |
| 0.2000 | 333.15 | 1198.9 |
| 0.2000 | 338.15 | 1196.1 |
| 0.2000 | 343.15 | 1193.6 |
| 0.2000 | 348.15 | 1190.1 |
| 0.2000 | 353.15 | 1187.3 |
| 0.2000 | 358.15 | 1184.1 |
| 0.2000 | 363.15 | 1180.7 |
| 0.2000 | 368.15 | 1178.1 |
| 0.2500 | 298.15 | 1205.1 |
| 0.2500 | 303.15 | 1202.0 |
| 0.2500 | 308.15 | 1199.0 |
| 0.2500 | 313.15 | 1196.1 |
| 0.2500 | 318.15 | 1192.9 |
| 0.2500 | 323.15 | 1188.4 |
| 0.2500 | 328.15 | 1186.8 |
| 0.2500 | 333.15 | 1184.0 |
| 0.2500 | 338.15 | 1180.7 |
| 0.2500 | 343.15 | 1177.7 |
| 0.2500 | 348.15 | 1174.6 |
| 0.2500 | 353.15 | 1171.9 |
| 0.2500 | 358.15 | 1168.5 |
| 0.2500 | 363.15 | 1166.1 |
| 0.2500 | 368.15 | 1162.4 |
| 0.3300 | 303.15 | 1170.0 |
| 0.3300 | 313.15 | 1163.8 |
| 0.3300 | 323.15 | 1158.5 |
| 0.3300 | 333.15 | 1153.1 |
| 0.3300 | 343.15 | 1145.8 |
| 0.3300 | 353.15 | 1140.3 |
| 0.3300 | 363.15 | 1134.4 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.2 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 298.15 | 1205.0 |
| 303.15 | 1202.0 |
| 308.15 | 1199.0 |
| 313.15 | 1196.0 |
| 318.15 | 1193.0 |
| 323.15 | 1188.0 |
| 328.15 | 1187.0 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.3400 | 1183.6 |
| 0.2500 | 1205.7 |
| 0.2000 | 1220.4 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.333 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 298.15 | 1176.6 |
| 303.15 | 1173.5 |
| 308.15 | 1170.3 |
| 313.15 | 1167.2 |
| 318.15 | 1164.2 |
| 323.15 | 1161.2 |
| 328.15 | 1158.2 |
| 333.15 | 1155.2 |
| 338.15 | 1152.2 |
| 343.15 | 1149.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.2000 | 298.15 | 1220.1 |
| 0.2000 | 303.15 | 1217.3 |
| 0.2000 | 308.15 | 1214.1 |
| 0.2000 | 313.15 | 1211.4 |
| 0.2000 | 318.15 | 1208.1 |
| 0.2000 | 323.15 | 1204.8 |
| 0.2000 | 328.15 | 1202.1 |
| 0.2000 | 333.15 | 1198.9 |
| 0.2000 | 338.15 | 1196.1 |
| 0.2000 | 343.15 | 1193.6 |
| 0.2000 | 348.15 | 1190.1 |
| 0.2000 | 353.15 | 1187.3 |
| 0.2000 | 358.15 | 1184.1 |
| 0.2000 | 363.15 | 1180.7 |
| 0.2000 | 368.15 | 1178.1 |
| 0.2500 | 298.15 | 1205.1 |
| 0.2500 | 303.15 | 1202.0 |
| 0.2500 | 308.15 | 1199.0 |
| 0.2500 | 313.15 | 1196.1 |
| 0.2500 | 318.15 | 1192.9 |
| 0.2500 | 323.15 | 1188.4 |
| 0.2500 | 328.15 | 1186.8 |
| 0.2500 | 333.15 | 1184.0 |
| 0.2500 | 338.15 | 1180.7 |
| 0.2500 | 343.15 | 1177.7 |
| 0.2500 | 348.15 | 1174.6 |
| 0.2500 | 353.15 | 1171.9 |
| 0.2500 | 358.15 | 1168.5 |
| 0.2500 | 363.15 | 1166.1 |
| 0.2500 | 368.15 | 1162.4 |
| 0.3300 | 303.15 | 1170.0 |
| 0.3300 | 313.15 | 1163.8 |
| 0.3300 | 323.15 | 1158.5 |
| 0.3300 | 333.15 | 1153.1 |
| 0.3300 | 343.15 | 1145.8 |
| 0.3300 | 353.15 | 1140.3 |
| 0.3300 | 363.15 | 1134.4 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0.2 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 298.15 | 1205.0 |
| 303.15 | 1202.0 |
| 308.15 | 1199.0 |
| 313.15 | 1196.0 |
| 318.15 | 1193.0 |
| 323.15 | 1188.0 |
| 328.15 | 1187.0 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Mole fraction = 0.2 (Liquid)
| Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 298.15 | 0.0589 |
| 303.15 | 0.0583 |
| 308.15 | 0.0576 |
| 313.15 | 0.0570 |
| 318.15 | 0.0564 |
| 323.15 | 0.0557 |
| 328.15 | 0.0552 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Mole fraction = 0.2 (Liquid)
| Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 298.15 | 0.0589 |
| 303.15 | 0.0583 |
| 308.15 | 0.0576 |
| 313.15 | 0.0570 |
| 318.15 | 0.0564 |
| 323.15 | 0.0557 |
| 328.15 | 0.0552 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.3400 | 271.82 |
| 0.2500 | 274.85 |
| 0.2000 | 275.12 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.3400 | 271.82 |
| 0.2500 | 274.85 |
| 0.2000 | 275.12 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.3300 | 271.82 |
| 0.2500 | 274.85 |
| 0.2000 | 275.12 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.3400 | 271.82 |
| 0.2500 | 274.85 |
| 0.2000 | 275.12 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.3400 | 271.82 |
| 0.2500 | 274.85 |
| 0.2000 | 275.12 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol, 2-diethylamino-, hydrochloride (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.3300 | 271.82 |
| 0.2500 | 274.85 |
| 0.2000 | 275.12 |
Sources
- Prediction of refractive index and density of deep eutectic solvents using atomic contributions
- Electrical conductivity of ammonium and phosphonium based deepeutectic solvents: Measurements and artificial intelligence-basedprediction
- Densities, refractive indices, and viscosities of N,N-diethylethanol ammonium chloride - glycerol or - ethylene glycol deep eutectic solvents and their aqueous solutions
- Densities of Ammonium and Phosphonium based Deep Eutectic Solvents: Prediction using Artificial Intelligent and Group Contribution Techniques
- Molar heat capacities and electrical conductivities of two ammonium-based deepeutectic solvents and their aqueous solutions
- Application of the Eotvos and Guggenheim empirical rules for predicting the density and surface tension of ionic liquids analogues