- Name
- Formamide, N,N-dimethyl-
- InChI
- InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3
- InChI Key
- ZMXDDKWLCZADIW-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CN(C)C=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 68-12-2
- Name
- Methyl Alcohol
- InChI
- InChI=1S/CH4O/c1-2/h2H,1H3
- InChI Key
- OKKJLVBELUTLKV-UHFFFAOYSA-N
- Formula
- CH4O
- SMILES
- CO
- Mol. Weight (g/mol)
- 32.04
- CAS
- 67-56-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Alcohol (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0009 |
| 293.15 | 0.0998 | 0.0008 |
| 293.15 | 0.2000 | 0.0008 |
| 293.15 | 0.3000 | 0.0008 |
| 293.15 | 0.4002 | 0.0008 |
| 293.15 | 0.5000 | 0.0007 |
| 293.15 | 0.6000 | 0.0007 |
| 293.15 | 0.6997 | 0.0007 |
| 293.15 | 0.8000 | 0.0006 |
| 293.15 | 0.8998 | 0.0006 |
| 293.15 | 1.0000 | 0.0006 |
| 298.15 | 0.0000 | 0.0008 |
| 298.15 | 0.0998 | 0.0008 |
| 298.15 | 0.2000 | 0.0008 |
| 298.15 | 0.3000 | 0.0007 |
| 298.15 | 0.4002 | 0.0007 |
| 298.15 | 0.5000 | 0.0007 |
| 298.15 | 0.6000 | 0.0006 |
| 298.15 | 0.6997 | 0.0006 |
| 298.15 | 0.8000 | 0.0006 |
| 298.15 | 0.8998 | 0.0006 |
| 298.15 | 1.0000 | 0.0005 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0998 | 0.0007 |
| 303.15 | 0.2000 | 0.0007 |
| 303.15 | 0.3000 | 0.0007 |
| 303.15 | 0.4002 | 0.0007 |
| 303.15 | 0.5000 | 0.0006 |
| 303.15 | 0.6000 | 0.0006 |
| 303.15 | 0.6997 | 0.0006 |
| 303.15 | 0.8000 | 0.0006 |
| 303.15 | 0.8998 | 0.0005 |
| 303.15 | 1.0000 | 0.0005 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0998 | 0.0007 |
| 313.15 | 0.2000 | 0.0006 |
| 313.15 | 0.3000 | 0.0006 |
| 313.15 | 0.4002 | 0.0006 |
| 313.15 | 0.5000 | 0.0006 |
| 313.15 | 0.6000 | 0.0005 |
| 313.15 | 0.6997 | 0.0005 |
| 313.15 | 0.8000 | 0.0005 |
| 313.15 | 0.8998 | 0.0005 |
| 313.15 | 1.0000 | 0.0004 |
| 323.15 | 0.0000 | 0.0006 |
| 323.15 | 0.0998 | 0.0006 |
| 323.15 | 0.2000 | 0.0006 |
| 323.15 | 0.3000 | 0.0005 |
| 323.15 | 0.4002 | 0.0005 |
| 323.15 | 0.5000 | 0.0005 |
| 323.15 | 0.6000 | 0.0005 |
| 323.15 | 0.6997 | 0.0005 |
| 323.15 | 0.8000 | 0.0004 |
| 323.15 | 0.8998 | 0.0004 |
| 323.15 | 1.0000 | 0.0004 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Alcohol (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0009 |
| 293.15 | 0.0998 | 0.0008 |
| 293.15 | 0.2000 | 0.0008 |
| 293.15 | 0.3000 | 0.0008 |
| 293.15 | 0.4002 | 0.0008 |
| 293.15 | 0.5000 | 0.0007 |
| 293.15 | 0.6000 | 0.0007 |
| 293.15 | 0.6997 | 0.0007 |
| 293.15 | 0.8000 | 0.0006 |
| 293.15 | 0.8998 | 0.0006 |
| 293.15 | 1.0000 | 0.0006 |
| 298.15 | 0.0000 | 0.0008 |
| 298.15 | 0.0998 | 0.0008 |
| 298.15 | 0.2000 | 0.0008 |
| 298.15 | 0.3000 | 0.0007 |
| 298.15 | 0.4002 | 0.0007 |
| 298.15 | 0.5000 | 0.0007 |
| 298.15 | 0.6000 | 0.0006 |
| 298.15 | 0.6997 | 0.0006 |
| 298.15 | 0.8000 | 0.0006 |
| 298.15 | 0.8998 | 0.0006 |
| 298.15 | 1.0000 | 0.0005 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0998 | 0.0007 |
| 303.15 | 0.2000 | 0.0007 |
| 303.15 | 0.3000 | 0.0007 |
| 303.15 | 0.4002 | 0.0007 |
| 303.15 | 0.5000 | 0.0006 |
| 303.15 | 0.6000 | 0.0006 |
| 303.15 | 0.6997 | 0.0006 |
| 303.15 | 0.8000 | 0.0006 |
| 303.15 | 0.8998 | 0.0005 |
| 303.15 | 1.0000 | 0.0005 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0998 | 0.0007 |
| 313.15 | 0.2000 | 0.0006 |
| 313.15 | 0.3000 | 0.0006 |
| 313.15 | 0.4002 | 0.0006 |
| 313.15 | 0.5000 | 0.0006 |
| 313.15 | 0.6000 | 0.0005 |
| 313.15 | 0.6997 | 0.0005 |
| 313.15 | 0.8000 | 0.0005 |
| 313.15 | 0.8998 | 0.0005 |
| 313.15 | 1.0000 | 0.0004 |
| 323.15 | 0.0000 | 0.0006 |
| 323.15 | 0.0998 | 0.0006 |
| 323.15 | 0.2000 | 0.0006 |
| 323.15 | 0.3000 | 0.0005 |
| 323.15 | 0.4002 | 0.0005 |
| 323.15 | 0.5000 | 0.0005 |
| 323.15 | 0.6000 | 0.0005 |
| 323.15 | 0.6997 | 0.0005 |
| 323.15 | 0.8000 | 0.0004 |
| 323.15 | 0.8998 | 0.0004 |
| 323.15 | 1.0000 | 0.0004 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 786.58 |
| 0.0496 | 803.451 |
| 0.0991 | 818.484 |
| 0.1981 | 843.566 |
| 0.4022 | 881.976 |
| 0.4986 | 896.174 |
| 0.5982 | 909.277 |
| 0.8028 | 928.308 |
| 0.8997 | 936.786 |
| 1.0000 | 943.974 |
| 0.0502 | 803.39 |
| 0.1084 | 818.189 |
| 0.1988 | 843.761 |
| 0.4022 | 882.138 |
| 0.5013 | 896.278 |
| 0.6008 | 908.588 |
| 0.8054 | 928.317 |
| 0.9039 | 936.718 |
| 0.0511 | 803.056 |
| 0.1021 | 818.46 |
| 0.2004 | 843.0 |
| 0.4054 | 881.38 |
| 0.5002 | 894.978 |
| 0.6031 | 909.254 |
| 0.7998 | 928.355 |
| 0.9033 | 936.655 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Alcohol (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 948.95 |
| 293.15 | 0.0998 | 941.81 |
| 293.15 | 0.2000 | 933.68 |
| 293.15 | 0.3000 | 924.38 |
| 293.15 | 0.4002 | 913.69 |
| 293.15 | 0.5000 | 901.23 |
| 293.15 | 0.6000 | 886.58 |
| 293.15 | 0.6997 | 869.36 |
| 293.15 | 0.8000 | 848.69 |
| 293.15 | 0.8998 | 823.22 |
| 293.15 | 1.0000 | 791.51 |
| 298.15 | 0.0000 | 944.21 |
| 298.15 | 0.0998 | 937.03 |
| 298.15 | 0.2000 | 928.89 |
| 298.15 | 0.3000 | 919.58 |
| 298.15 | 0.4002 | 908.89 |
| 298.15 | 0.5000 | 896.4 |
| 298.15 | 0.6000 | 881.75 |
| 298.15 | 0.6997 | 864.56 |
| 298.15 | 0.8000 | 843.91 |
| 298.15 | 0.8998 | 818.49 |
| 298.15 | 1.0000 | 786.82 |
| 303.15 | 0.0000 | 939.45 |
| 303.15 | 0.0998 | 932.15 |
| 303.15 | 0.2000 | 924.01 |
| 303.15 | 0.3000 | 914.7 |
| 303.15 | 0.4002 | 904.02 |
| 303.15 | 0.5000 | 891.48 |
| 303.15 | 0.6000 | 876.84 |
| 303.15 | 0.6997 | 859.66 |
| 303.15 | 0.8000 | 839.02 |
| 303.15 | 0.8998 | 813.64 |
| 303.15 | 1.0000 | 782.06 |
| 313.15 | 0.0000 | 929.86 |
| 313.15 | 0.0998 | 922.72 |
| 313.15 | 0.2000 | 914.56 |
| 313.15 | 0.3000 | 905.21 |
| 313.15 | 0.4002 | 894.53 |
| 313.15 | 0.5000 | 881.96 |
| 313.15 | 0.6000 | 867.29 |
| 313.15 | 0.6997 | 850.11 |
| 313.15 | 0.8000 | 829.51 |
| 313.15 | 0.8998 | 804.2 |
| 313.15 | 1.0000 | 772.72 |
| 323.15 | 0.0000 | 920.92 |
| 323.15 | 0.0998 | 913.2 |
| 323.15 | 0.2000 | 905.01 |
| 323.15 | 0.3000 | 895.61 |
| 323.15 | 0.4002 | 884.91 |
| 323.15 | 0.5000 | 872.28 |
| 323.15 | 0.6000 | 857.57 |
| 323.15 | 0.6997 | 840.42 |
| 323.15 | 0.8000 | 819.82 |
| 323.15 | 0.8998 | 794.57 |
| 323.15 | 1.0000 | 763.22 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 786.58 |
| 0.0496 | 803.451 |
| 0.0991 | 818.484 |
| 0.1981 | 843.566 |
| 0.4022 | 881.976 |
| 0.4986 | 896.174 |
| 0.5982 | 909.277 |
| 0.8028 | 928.308 |
| 0.8997 | 936.786 |
| 1.0000 | 943.974 |
| 0.0502 | 803.39 |
| 0.1084 | 818.189 |
| 0.1988 | 843.761 |
| 0.4022 | 882.138 |
| 0.5013 | 896.278 |
| 0.6008 | 908.588 |
| 0.8054 | 928.317 |
| 0.9039 | 936.718 |
| 0.0511 | 803.056 |
| 0.1021 | 818.46 |
| 0.2004 | 843.0 |
| 0.4054 | 881.38 |
| 0.5002 | 894.978 |
| 0.6031 | 909.254 |
| 0.7998 | 928.355 |
| 0.9033 | 936.655 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Alcohol (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 948.95 |
| 293.15 | 0.0998 | 941.81 |
| 293.15 | 0.2000 | 933.68 |
| 293.15 | 0.3000 | 924.38 |
| 293.15 | 0.4002 | 913.69 |
| 293.15 | 0.5000 | 901.23 |
| 293.15 | 0.6000 | 886.58 |
| 293.15 | 0.6997 | 869.36 |
| 293.15 | 0.8000 | 848.69 |
| 293.15 | 0.8998 | 823.22 |
| 293.15 | 1.0000 | 791.51 |
| 298.15 | 0.0000 | 944.21 |
| 298.15 | 0.0998 | 937.03 |
| 298.15 | 0.2000 | 928.89 |
| 298.15 | 0.3000 | 919.58 |
| 298.15 | 0.4002 | 908.89 |
| 298.15 | 0.5000 | 896.4 |
| 298.15 | 0.6000 | 881.75 |
| 298.15 | 0.6997 | 864.56 |
| 298.15 | 0.8000 | 843.91 |
| 298.15 | 0.8998 | 818.49 |
| 298.15 | 1.0000 | 786.82 |
| 303.15 | 0.0000 | 939.45 |
| 303.15 | 0.0998 | 932.15 |
| 303.15 | 0.2000 | 924.01 |
| 303.15 | 0.3000 | 914.7 |
| 303.15 | 0.4002 | 904.02 |
| 303.15 | 0.5000 | 891.48 |
| 303.15 | 0.6000 | 876.84 |
| 303.15 | 0.6997 | 859.66 |
| 303.15 | 0.8000 | 839.02 |
| 303.15 | 0.8998 | 813.64 |
| 303.15 | 1.0000 | 782.06 |
| 313.15 | 0.0000 | 929.86 |
| 313.15 | 0.0998 | 922.72 |
| 313.15 | 0.2000 | 914.56 |
| 313.15 | 0.3000 | 905.21 |
| 313.15 | 0.4002 | 894.53 |
| 313.15 | 0.5000 | 881.96 |
| 313.15 | 0.6000 | 867.29 |
| 313.15 | 0.6997 | 850.11 |
| 313.15 | 0.8000 | 829.51 |
| 313.15 | 0.8998 | 804.2 |
| 313.15 | 1.0000 | 772.72 |
| 323.15 | 0.0000 | 920.92 |
| 323.15 | 0.0998 | 913.2 |
| 323.15 | 0.2000 | 905.01 |
| 323.15 | 0.3000 | 895.61 |
| 323.15 | 0.4002 | 884.91 |
| 323.15 | 0.5000 | 872.28 |
| 323.15 | 0.6000 | 857.57 |
| 323.15 | 0.6997 | 840.42 |
| 323.15 | 0.8000 | 819.82 |
| 323.15 | 0.8998 | 794.57 |
| 323.15 | 1.0000 | 763.22 |
Speed of sound, m/s [ref]
Operational condition: Frequency, MHz = 2 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid | Speed of sound, m/s - Liquid |
| 303.00 | 0.0000 | 771.9 | 1089.0 |
| 303.00 | 0.2000 | 818.7 | 1133.8 |
| 303.00 | 0.4000 | 801.17 | 1201.2 |
| 303.00 | 0.6000 | 853.8 | 1249.2 |
| 303.00 | 0.8000 | 888.88 | 1339.4 |
| 303.00 | 1.0000 | 953.21 | 1469.8 |
| 308.00 | 0.0000 | 764.7 | 1069.6 |
| 308.00 | 0.2000 | 811.76 | 1126.8 |
| 308.00 | 0.4000 | 794.11 | 1187.4 |
| 308.00 | 0.6000 | 852.94 | 1243.4 |
| 308.00 | 0.8000 | 888.23 | 1320.0 |
| 308.00 | 1.0000 | 952.94 | 1433.2 |
| 313.00 | 0.0000 | 757.4 | 1057.2 |
| 313.00 | 0.2000 | 798.81 | 1110.8 |
| 313.00 | 0.4000 | 786.98 | 1169.2 |
| 313.00 | 0.6000 | 846.15 | 1219.4 |
| 313.00 | 0.8000 | 881.65 | 1313.2 |
| 313.00 | 1.0000 | 952.66 | 1418.0 |
| 318.00 | 0.0000 | 750.0 | 1033.2 |
| 318.00 | 0.2000 | 785.71 | 1097.7 |
| 318.00 | 0.4000 | 773.8 | 1152.0 |
| 318.00 | 0.6000 | 833.33 | 1208.0 |
| 318.00 | 0.8000 | 875.0 | 1275.4 |
| 318.00 | 1.0000 | 952.38 | 1402.2 |
| 323.00 | 0.0000 | 718.6 | 1008.0 |
| 323.00 | 0.2000 | 778.44 | 1095.4 |
| 323.00 | 0.4000 | 754.49 | 1136.0 |
| 323.00 | 0.6000 | 803.35 | 1189.0 |
| 323.00 | 0.8000 | 868.26 | 1257.2 |
| 323.00 | 1.0000 | 952.09 | 1374.8 |
Speed of sound, m/s [ref]
Operational condition: Frequency, MHz = 2 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid | Speed of sound, m/s - Liquid |
| 303.00 | 0.0000 | 771.9 | 1089.0 |
| 303.00 | 0.2000 | 818.7 | 1133.8 |
| 303.00 | 0.4000 | 801.17 | 1201.2 |
| 303.00 | 0.6000 | 853.8 | 1249.2 |
| 303.00 | 0.8000 | 888.88 | 1339.4 |
| 303.00 | 1.0000 | 953.21 | 1469.8 |
| 308.00 | 0.0000 | 764.7 | 1069.6 |
| 308.00 | 0.2000 | 811.76 | 1126.8 |
| 308.00 | 0.4000 | 794.11 | 1187.4 |
| 308.00 | 0.6000 | 852.94 | 1243.4 |
| 308.00 | 0.8000 | 888.23 | 1320.0 |
| 308.00 | 1.0000 | 952.94 | 1433.2 |
| 313.00 | 0.0000 | 757.4 | 1057.2 |
| 313.00 | 0.2000 | 798.81 | 1110.8 |
| 313.00 | 0.4000 | 786.98 | 1169.2 |
| 313.00 | 0.6000 | 846.15 | 1219.4 |
| 313.00 | 0.8000 | 881.65 | 1313.2 |
| 313.00 | 1.0000 | 952.66 | 1418.0 |
| 318.00 | 0.0000 | 750.0 | 1033.2 |
| 318.00 | 0.2000 | 785.71 | 1097.7 |
| 318.00 | 0.4000 | 773.8 | 1152.0 |
| 318.00 | 0.6000 | 833.33 | 1208.0 |
| 318.00 | 0.8000 | 875.0 | 1275.4 |
| 318.00 | 1.0000 | 952.38 | 1402.2 |
| 323.00 | 0.0000 | 718.6 | 1008.0 |
| 323.00 | 0.2000 | 778.44 | 1095.4 |
| 323.00 | 0.4000 | 754.49 | 1136.0 |
| 323.00 | 0.6000 | 803.35 | 1189.0 |
| 323.00 | 0.8000 | 868.26 | 1257.2 |
| 323.00 | 1.0000 | 952.09 | 1374.8 |
Sources
- Ultrasonic study on binary mixture containing dimethylformamide and methanol over the entire miscibility range (0less thanxless than1) at temperatures 303 323K
- Ionic molar volumes in methanol mixtures with acetonitrile, N,N-dimethylformamide and propylene carbonate at T = 298.15 K
- Volumetric Properties and Viscosities of Binary Mixtures of N,N-Dimethylformamide with Methanol and Ethanol in the Temperature Range (293.15 to 333.15) K