- Name
- Urea, N,N-diethyl-
- InChI
- InChI=1S/C5H12N2O/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3,(H2,6,8)
- InChI Key
- TUMNHQRORINJKE-UHFFFAOYSA-N
- Formula
- C5H12N2O
- SMILES
- CCN(CC)C(N)=O
- Mol. Weight (g/mol)
- 116.16
- CAS
- 634-95-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Urea, N,N-diethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 999.1 |
| 288.15 | 0.0535 | 999.376 |
| 288.15 | 0.0856 | 999.546 |
| 288.15 | 0.1181 | 999.725 |
| 288.15 | 0.1603 | 999.959 |
| 288.15 | 0.2142 | 1000.267 |
| 288.15 | 0.2689 | 1000.589 |
| 288.15 | 0.3254 | 1000.929 |
| 293.15 | 0.0000 | 998.209 |
| 293.15 | 0.0535 | 998.462 |
| 293.15 | 0.0856 | 998.62 |
| 293.15 | 0.1181 | 998.786 |
| 293.15 | 0.1603 | 999.002 |
| 293.15 | 0.2142 | 999.288 |
| 293.15 | 0.2689 | 999.586 |
| 293.15 | 0.3254 | 999.905 |
| 298.15 | 0.0000 | 997.054 |
| 298.15 | 0.0535 | 997.288 |
| 298.15 | 0.0856 | 997.435 |
| 298.15 | 0.1181 | 997.589 |
| 298.15 | 0.1603 | 997.788 |
| 298.15 | 0.2142 | 998.052 |
| 298.15 | 0.2689 | 998.328 |
| 298.15 | 0.3254 | 998.628 |
| 303.15 | 0.0000 | 995.661 |
| 303.15 | 0.0535 | 995.875 |
| 303.15 | 0.0856 | 996.012 |
| 303.15 | 0.1181 | 996.154 |
| 303.15 | 0.1603 | 996.338 |
| 303.15 | 0.2142 | 996.585 |
| 303.15 | 0.2689 | 996.837 |
| 303.15 | 0.3254 | 997.108 |
| 308.15 | 0.0000 | 994.04 |
| 308.15 | 0.0535 | 994.243 |
| 308.15 | 0.0856 | 994.369 |
| 308.15 | 0.1181 | 994.501 |
| 308.15 | 0.1603 | 994.672 |
| 308.15 | 0.2142 | 994.898 |
| 308.15 | 0.2689 | 995.135 |
| 308.15 | 0.3254 | 995.381 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Urea, N,N-diethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 999.1 |
| 288.15 | 0.0535 | 999.376 |
| 288.15 | 0.0856 | 999.546 |
| 288.15 | 0.1181 | 999.725 |
| 288.15 | 0.1603 | 999.959 |
| 288.15 | 0.2142 | 1000.267 |
| 288.15 | 0.2689 | 1000.589 |
| 288.15 | 0.3254 | 1000.929 |
| 293.15 | 0.0000 | 998.209 |
| 293.15 | 0.0535 | 998.462 |
| 293.15 | 0.0856 | 998.62 |
| 293.15 | 0.1181 | 998.786 |
| 293.15 | 0.1603 | 999.002 |
| 293.15 | 0.2142 | 999.288 |
| 293.15 | 0.2689 | 999.586 |
| 293.15 | 0.3254 | 999.905 |
| 298.15 | 0.0000 | 997.054 |
| 298.15 | 0.0535 | 997.288 |
| 298.15 | 0.0856 | 997.435 |
| 298.15 | 0.1181 | 997.589 |
| 298.15 | 0.1603 | 997.788 |
| 298.15 | 0.2142 | 998.052 |
| 298.15 | 0.2689 | 998.328 |
| 298.15 | 0.3254 | 998.628 |
| 303.15 | 0.0000 | 995.661 |
| 303.15 | 0.0535 | 995.875 |
| 303.15 | 0.0856 | 996.012 |
| 303.15 | 0.1181 | 996.154 |
| 303.15 | 0.1603 | 996.338 |
| 303.15 | 0.2142 | 996.585 |
| 303.15 | 0.2689 | 996.837 |
| 303.15 | 0.3254 | 997.108 |
| 308.15 | 0.0000 | 994.04 |
| 308.15 | 0.0535 | 994.243 |
| 308.15 | 0.0856 | 994.369 |
| 308.15 | 0.1181 | 994.501 |
| 308.15 | 0.1603 | 994.672 |
| 308.15 | 0.2142 | 994.898 |
| 308.15 | 0.2689 | 995.135 |
| 308.15 | 0.3254 | 995.381 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Urea, N,N-diethyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1466.5 |
| 288.15 | 0.0856 | 1474.9 |
| 288.15 | 0.1181 | 1478.0 |
| 288.15 | 0.1603 | 1482.0 |
| 288.15 | 0.2142 | 1487.0 |
| 288.15 | 0.2689 | 1491.9 |
| 288.15 | 0.3254 | 1496.9 |
| 293.15 | 0.0000 | 1482.4 |
| 293.15 | 0.0856 | 1490.4 |
| 293.15 | 0.1181 | 1493.2 |
| 293.15 | 0.1603 | 1496.8 |
| 293.15 | 0.2142 | 1501.4 |
| 293.15 | 0.2689 | 1506.0 |
| 293.15 | 0.3254 | 1510.3 |
| 298.15 | 0.0000 | 1496.6 |
| 298.15 | 0.0856 | 1503.9 |
| 298.15 | 0.1181 | 1506.6 |
| 298.15 | 0.1603 | 1509.9 |
| 298.15 | 0.2142 | 1514.1 |
| 298.15 | 0.2689 | 1518.2 |
| 298.15 | 0.3254 | 1522.2 |
| 303.15 | 0.0000 | 1509.0 |
| 303.15 | 0.0856 | 1515.7 |
| 303.15 | 0.1181 | 1518.1 |
| 303.15 | 0.1603 | 1521.2 |
| 303.15 | 0.2142 | 1525.0 |
| 303.15 | 0.2689 | 1528.8 |
| 303.15 | 0.3254 | 1532.6 |
| 308.15 | 0.0000 | 1519.9 |
| 308.15 | 0.0856 | 1525.8 |
| 308.15 | 0.1181 | 1528.0 |
| 308.15 | 0.1603 | 1530.8 |
| 308.15 | 0.2142 | 1534.3 |
| 308.15 | 0.2689 | 1537.8 |
| 308.15 | 0.3254 | 1541.3 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Urea, N,N-diethyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1466.5 |
| 288.15 | 0.0856 | 1474.9 |
| 288.15 | 0.1181 | 1478.0 |
| 288.15 | 0.1603 | 1482.0 |
| 288.15 | 0.2142 | 1487.0 |
| 288.15 | 0.2689 | 1491.9 |
| 288.15 | 0.3254 | 1496.9 |
| 293.15 | 0.0000 | 1482.4 |
| 293.15 | 0.0856 | 1490.4 |
| 293.15 | 0.1181 | 1493.2 |
| 293.15 | 0.1603 | 1496.8 |
| 293.15 | 0.2142 | 1501.4 |
| 293.15 | 0.2689 | 1506.0 |
| 293.15 | 0.3254 | 1510.3 |
| 298.15 | 0.0000 | 1496.6 |
| 298.15 | 0.0856 | 1503.9 |
| 298.15 | 0.1181 | 1506.6 |
| 298.15 | 0.1603 | 1509.9 |
| 298.15 | 0.2142 | 1514.1 |
| 298.15 | 0.2689 | 1518.2 |
| 298.15 | 0.3254 | 1522.2 |
| 303.15 | 0.0000 | 1509.0 |
| 303.15 | 0.0856 | 1515.7 |
| 303.15 | 0.1181 | 1518.1 |
| 303.15 | 0.1603 | 1521.2 |
| 303.15 | 0.2142 | 1525.0 |
| 303.15 | 0.2689 | 1528.8 |
| 303.15 | 0.3254 | 1532.6 |
| 308.15 | 0.0000 | 1519.9 |
| 308.15 | 0.0856 | 1525.8 |
| 308.15 | 0.1181 | 1528.0 |
| 308.15 | 0.1603 | 1530.8 |
| 308.15 | 0.2142 | 1534.3 |
| 308.15 | 0.2689 | 1537.8 |
| 308.15 | 0.3254 | 1541.3 |