- Name
- Benzene, (1-methylethyl)-
- InChI
- InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3
- InChI Key
- RWGFKTVRMDUZSP-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- CC(C)c1ccccc1
- Mol. Weight (g/mol)
- 120.19
- CAS
- 98-82-8
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Datasets
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 298.15 | 0.0005 |
| 298.15 | 0.9996 |
| 308.15 | 0.0005 |
| 308.15 | 0.9994 |
| 318.15 | 0.0008 |
| 318.15 | 0.9991 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 293.20 | 0.9998 |
| 293.20 | 0.0006 |
| 298.20 | 0.9996 |
| 298.20 | 0.0009 |
| 308.20 | 0.9994 |
| 308.20 | 0.0011 |
Mass fraction of Water (2) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 81.5 (Liquid mixture 1)
| Mass fraction of Water (2) - Liquid mixture 1 |
|---|
| 0.9996 |
| 0.0009 |
Mass fraction of Benzene, (1-methylethyl)- (1) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 81.5 (Liquid mixture 1)
| Mass fraction of Benzene, (1-methylethyl)- (1) - Liquid mixture 1 |
|---|
| 0.9984 |
| 0.9990 |
| 0.9992 |
| 0.9994 |
Henry's Law constant (molality scale), kPa*kg/mol of Benzene, (1-methylethyl)- (1) [ref]
Operational condition: Molality, mol/kg = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (molality scale), kPa*kg/mol of Benzene, (1-methylethyl)- (1) - Liquid |
|---|---|
| 274.15 | 212.08 |
| 294.65 | 536.23 |
| 294.65 | 587.91 |
| 296.15 | 622.14 |
| 310.15 | 1380.18 |
| 313.15 | 1962.7 |
| 326.15 | 3257.4 |
| 331.15 | 3127.4 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 298.15 | 0.0005 |
| 298.15 | 0.9996 |
| 308.15 | 0.0005 |
| 308.15 | 0.9994 |
| 318.15 | 0.0008 |
| 318.15 | 0.9991 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 293.20 | 0.9998 |
| 293.20 | 0.0006 |
| 298.20 | 0.9996 |
| 298.20 | 0.0009 |
| 308.20 | 0.9994 |
| 308.20 | 0.0011 |
Mass fraction of Water (2) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 81.5 (Liquid mixture 1)
| Mass fraction of Water (2) - Liquid mixture 1 |
|---|
| 0.9996 |
| 0.0009 |
Mass fraction of Benzene, (1-methylethyl)- (1) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 81.5 (Liquid mixture 1)
| Mass fraction of Benzene, (1-methylethyl)- (1) - Liquid mixture 1 |
|---|
| 0.9984 |
| 0.9990 |
| 0.9992 |
| 0.9994 |
Henry's Law constant (molality scale), kPa*kg/mol of Benzene, (1-methylethyl)- (1) [ref]
Operational condition: Molality, mol/kg = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (molality scale), kPa*kg/mol of Benzene, (1-methylethyl)- (1) - Liquid |
|---|---|
| 274.15 | 212.08 |
| 294.65 | 536.23 |
| 294.65 | 587.91 |
| 296.15 | 622.14 |
| 310.15 | 1380.18 |
| 313.15 | 1962.7 |
| 326.15 | 3257.4 |
| 331.15 | 3127.4 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.9998 | 1.3335 |
| 293.20 | 0.0006 | 1.4915 |
| 298.20 | 0.9996 | 1.333 |
| 298.20 | 0.0009 | 1.49 |
| 308.20 | 0.9994 | 1.3319 |
| 308.20 | 0.0011 | 1.4859 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 81.5 (Liquid)
| Mass fraction of Water (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.9996 | 1.333 |
| 0.0009 | 1.49 |
| 0.0016 | 1.4886 |
| 0.0010 | 1.4885 |
| 0.0008 | 1.4888 |
| 0.0008 | 1.4886 |
| 0.0006 | 1.4885 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.9998 | 1.3335 |
| 293.20 | 0.0006 | 1.4915 |
| 298.20 | 0.9996 | 1.333 |
| 298.20 | 0.0009 | 1.49 |
| 308.20 | 0.9994 | 1.3319 |
| 308.20 | 0.0011 | 1.4859 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 81.5 (Liquid)
| Mass fraction of Water (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.9996 | 1.333 |
| 0.0009 | 1.49 |
| 0.0016 | 1.4886 |
| 0.0010 | 1.4885 |
| 0.0008 | 1.4888 |
| 0.0008 | 1.4886 |
| 0.0006 | 1.4885 |
Sources
- Experimental and correlational study of phase equilibria in aqueous mixtures of phosphoric acid with aromatic hydrocarbons at various temperatures
- Liquid-Liquid Equilibrium of the Ternary System of Water + Phenol + (Propan-2-yl) Benzene at Several Temperatures
- Salt Effects on Liquid-Liquid Equilibria of Water + Phenol + (Propan-2-yl) Benzene + Salts Systems
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values