- Name
- Ethanol
- InChI
- InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3
- InChI Key
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N
- Formula
- C2H6O
- SMILES
- CCO
- Mol. Weight (g/mol)
- 46.07
- CAS
- 64-17-5
- Name
- Furaneol
- InChI
- InChI=1S/C6H8O3/c1-3-5(7)6(8)4(2)9-3/h3,8H,1-2H3
- InChI Key
- INAXVXBDKKUCGI-UHFFFAOYSA-N
- Formula
- C6H8O3
- SMILES
- CC1=C(O)C(=O)C(C)O1
- Mol. Weight (g/mol)
- 128.13
- CAS
- 3658-77-3
Datasets
Mole fraction of Furaneol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Furaneol (2) - Liquid |
|---|---|
| 283.15 | 0.1201 |
| 288.15 | 0.1508 |
| 293.15 | 0.1881 |
| 298.15 | 0.2341 |
| 303.15 | 0.2867 |
| 308.15 | 0.3513 |
| 313.15 | 0.4271 |
Mole fraction of Furaneol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Furaneol (2) - Liquid |
|---|---|
| 283.15 | 0.1191 |
| 288.15 | 0.1489 |
| 293.15 | 0.1906 |
| 298.15 | 0.2372 |
| 303.15 | 0.2892 |
| 308.15 | 0.3492 |
| 313.15 | 0.4255 |
Mole fraction of Furaneol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Furaneol (2) - Liquid |
|---|---|
| 283.15 | 0.1154 |
| 288.15 | 0.1552 |
| 293.15 | 0.1943 |
| 298.15 | 0.2256 |
| 303.15 | 0.2559 |
| 308.15 | 0.3002 |
| 313.15 | 0.3491 |
| 318.15 | 0.4123 |
Mole fraction of Furaneol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Furaneol (2) - Liquid |
|---|---|
| 283.15 | 0.1160 |
| 288.15 | 0.1494 |
| 293.15 | 0.1902 |
| 298.15 | 0.2175 |
| 303.15 | 0.2492 |
| 308.15 | 0.2990 |
| 313.15 | 0.3554 |
| 318.15 | 0.4146 |
Mole fraction of Furaneol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Furaneol (2) - Liquid |
|---|---|
| 283.15 | 0.1201 |
| 288.15 | 0.1508 |
| 293.15 | 0.1881 |
| 298.15 | 0.2341 |
| 303.15 | 0.2867 |
| 308.15 | 0.3513 |
| 313.15 | 0.4271 |
Mole fraction of Furaneol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Furaneol (2) - Liquid |
|---|---|
| 283.15 | 0.1191 |
| 288.15 | 0.1489 |
| 293.15 | 0.1906 |
| 298.15 | 0.2372 |
| 303.15 | 0.2892 |
| 308.15 | 0.3492 |
| 313.15 | 0.4255 |
Mole fraction of Furaneol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Furaneol (2) - Liquid |
|---|---|
| 283.15 | 0.1154 |
| 288.15 | 0.1552 |
| 293.15 | 0.1943 |
| 298.15 | 0.2256 |
| 303.15 | 0.2559 |
| 308.15 | 0.3002 |
| 313.15 | 0.3491 |
| 318.15 | 0.4123 |
Mole fraction of Furaneol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Furaneol (2) - Liquid |
|---|---|
| 283.15 | 0.1160 |
| 288.15 | 0.1494 |
| 293.15 | 0.1902 |
| 298.15 | 0.2175 |
| 303.15 | 0.2492 |
| 308.15 | 0.2990 |
| 313.15 | 0.3554 |
| 318.15 | 0.4146 |