- Name
- Benzene, nitro-
- InChI
- InChI=1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H
- InChI Key
- LQNUZADURLCDLV-UHFFFAOYSA-N
- Formula
- C6H5NO2
- SMILES
- O=[N+]([O-])c1ccccc1
- Mol. Weight (g/mol)
- 123.11
- CAS
- 98-95-3
- Name
- Ethane, 1,2-dichloro-
- InChI
- InChI=1S/C2H4Cl2/c3-1-2-4/h1-2H2
- InChI Key
- WSLDOOZREJYCGB-UHFFFAOYSA-N
- Formula
- C2H4Cl2
- SMILES
- ClCCCl
- Mol. Weight (g/mol)
- 98.96
- CAS
- 107-06-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- Tboil - Boiling temperature at pressure P, K (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.5524 |
| 293.15 | 0.1008 | 1.5432 |
| 293.15 | 0.1993 | 1.5343 |
| 293.15 | 0.3000 | 1.5252 |
| 293.15 | 0.3997 | 1.5159 |
| 293.15 | 0.4991 | 1.5061 |
| 293.15 | 0.6004 | 1.4952 |
| 293.15 | 0.7006 | 1.4835 |
| 293.15 | 0.8010 | 1.4709 |
| 293.15 | 0.8997 | 1.4579 |
| 293.15 | 1.0000 | 1.4447 |
| 303.15 | 0.0000 | 1.5476 |
| 303.15 | 0.1008 | 1.5388 |
| 303.15 | 0.1993 | 1.53 |
| 303.15 | 0.3000 | 1.5209 |
| 303.15 | 0.3997 | 1.5116 |
| 303.15 | 0.4991 | 1.5016 |
| 303.15 | 0.6004 | 1.4907 |
| 303.15 | 0.7006 | 1.4789 |
| 303.15 | 0.8010 | 1.4662 |
| 303.15 | 0.8997 | 1.453 |
| 303.15 | 1.0000 | 1.4395 |
| 313.15 | 0.0000 | 1.5429 |
| 313.15 | 0.1008 | 1.5344 |
| 313.15 | 0.1993 | 1.5258 |
| 313.15 | 0.3000 | 1.5167 |
| 313.15 | 0.3997 | 1.5073 |
| 313.15 | 0.4991 | 1.4973 |
| 313.15 | 0.6004 | 1.4862 |
| 313.15 | 0.7006 | 1.4744 |
| 313.15 | 0.8010 | 1.4615 |
| 313.15 | 0.8997 | 1.4482 |
| 313.15 | 1.0000 | 1.4342 |
| 323.15 | 0.0000 | 1.5379 |
| 323.15 | 0.1008 | 1.5297 |
| 323.15 | 0.1993 | 1.5214 |
| 323.15 | 0.3000 | 1.5124 |
| 323.15 | 0.3997 | 1.503 |
| 323.15 | 0.4991 | 1.4929 |
| 323.15 | 0.6004 | 1.4817 |
| 323.15 | 0.7006 | 1.4698 |
| 323.15 | 0.8010 | 1.4569 |
| 323.15 | 0.8997 | 1.4434 |
| 323.15 | 1.0000 | 1.429 |
| 333.15 | 0.0000 | 1.5329 |
| 333.15 | 0.1008 | 1.525 |
| 333.15 | 0.1993 | 1.5169 |
| 333.15 | 0.3000 | 1.5081 |
| 333.15 | 0.3997 | 1.4987 |
| 333.15 | 0.4991 | 1.4885 |
| 333.15 | 0.6004 | 1.4772 |
| 333.15 | 0.7006 | 1.4652 |
| 333.15 | 0.8010 | 1.4522 |
| 333.15 | 0.8997 | 1.4386 |
| 333.15 | 1.0000 | 1.4237 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.5524 |
| 293.15 | 0.1008 | 1.5432 |
| 293.15 | 0.1993 | 1.5343 |
| 293.15 | 0.3000 | 1.5252 |
| 293.15 | 0.3997 | 1.5159 |
| 293.15 | 0.4991 | 1.5061 |
| 293.15 | 0.6004 | 1.4952 |
| 293.15 | 0.7006 | 1.4835 |
| 293.15 | 0.8010 | 1.4709 |
| 293.15 | 0.8997 | 1.4579 |
| 293.15 | 1.0000 | 1.4447 |
| 303.15 | 0.0000 | 1.5476 |
| 303.15 | 0.1008 | 1.5388 |
| 303.15 | 0.1993 | 1.53 |
| 303.15 | 0.3000 | 1.5209 |
| 303.15 | 0.3997 | 1.5116 |
| 303.15 | 0.4991 | 1.5016 |
| 303.15 | 0.6004 | 1.4907 |
| 303.15 | 0.7006 | 1.4789 |
| 303.15 | 0.8010 | 1.4662 |
| 303.15 | 0.8997 | 1.453 |
| 303.15 | 1.0000 | 1.4395 |
| 313.15 | 0.0000 | 1.5429 |
| 313.15 | 0.1008 | 1.5344 |
| 313.15 | 0.1993 | 1.5258 |
| 313.15 | 0.3000 | 1.5167 |
| 313.15 | 0.3997 | 1.5073 |
| 313.15 | 0.4991 | 1.4973 |
| 313.15 | 0.6004 | 1.4862 |
| 313.15 | 0.7006 | 1.4744 |
| 313.15 | 0.8010 | 1.4615 |
| 313.15 | 0.8997 | 1.4482 |
| 313.15 | 1.0000 | 1.4342 |
| 323.15 | 0.0000 | 1.5379 |
| 323.15 | 0.1008 | 1.5297 |
| 323.15 | 0.1993 | 1.5214 |
| 323.15 | 0.3000 | 1.5124 |
| 323.15 | 0.3997 | 1.503 |
| 323.15 | 0.4991 | 1.4929 |
| 323.15 | 0.6004 | 1.4817 |
| 323.15 | 0.7006 | 1.4698 |
| 323.15 | 0.8010 | 1.4569 |
| 323.15 | 0.8997 | 1.4434 |
| 323.15 | 1.0000 | 1.429 |
| 333.15 | 0.0000 | 1.5329 |
| 333.15 | 0.1008 | 1.525 |
| 333.15 | 0.1993 | 1.5169 |
| 333.15 | 0.3000 | 1.5081 |
| 333.15 | 0.3997 | 1.4987 |
| 333.15 | 0.4991 | 1.4885 |
| 333.15 | 0.6004 | 1.4772 |
| 333.15 | 0.7006 | 1.4652 |
| 333.15 | 0.8010 | 1.4522 |
| 333.15 | 0.8997 | 1.4386 |
| 333.15 | 1.0000 | 1.4237 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1203.05 |
| 293.15 | 0.1008 | 1206.99 |
| 293.15 | 0.1993 | 1211.04 |
| 293.15 | 0.3000 | 1215.35 |
| 293.15 | 0.3997 | 1219.84 |
| 293.15 | 0.4991 | 1224.55 |
| 293.15 | 0.6004 | 1229.62 |
| 293.15 | 0.7006 | 1234.94 |
| 293.15 | 0.8010 | 1240.51 |
| 293.15 | 0.8997 | 1246.65 |
| 293.15 | 1.0000 | 1252.82 |
| 303.15 | 0.0000 | 1193.15 |
| 303.15 | 0.1008 | 1196.83 |
| 303.15 | 0.1993 | 1200.58 |
| 303.15 | 0.3000 | 1204.56 |
| 303.15 | 0.3997 | 1208.67 |
| 303.15 | 0.4991 | 1212.96 |
| 303.15 | 0.6004 | 1217.53 |
| 303.15 | 0.7006 | 1222.31 |
| 303.15 | 0.8010 | 1227.39 |
| 303.15 | 0.8997 | 1232.66 |
| 303.15 | 1.0000 | 1238.27 |
| 313.15 | 0.0000 | 1183.21 |
| 313.15 | 0.1008 | 1186.61 |
| 313.15 | 0.1993 | 1190.03 |
| 313.15 | 0.3000 | 1193.66 |
| 313.15 | 0.3997 | 1197.36 |
| 313.15 | 0.4991 | 1201.23 |
| 313.15 | 0.6004 | 1205.32 |
| 313.15 | 0.7006 | 1209.57 |
| 313.15 | 0.8010 | 1214.06 |
| 313.15 | 0.8997 | 1218.68 |
| 313.15 | 1.0000 | 1223.53 |
| 323.15 | 0.0000 | 1173.27 |
| 323.15 | 0.1008 | 1176.36 |
| 323.15 | 0.1993 | 1179.45 |
| 323.15 | 0.3000 | 1182.68 |
| 323.15 | 0.3997 | 1185.98 |
| 323.15 | 0.4991 | 1189.39 |
| 323.15 | 0.6004 | 1193.0 |
| 323.15 | 0.7006 | 1196.72 |
| 323.15 | 0.8010 | 1200.58 |
| 323.15 | 0.8997 | 1204.5 |
| 323.15 | 1.0000 | 1208.61 |
| 333.15 | 0.0000 | 1163.32 |
| 333.15 | 0.1008 | 1166.07 |
| 333.15 | 0.1993 | 1168.82 |
| 333.15 | 0.3000 | 1171.66 |
| 333.15 | 0.3997 | 1174.52 |
| 333.15 | 0.4991 | 1177.48 |
| 333.15 | 0.6004 | 1180.62 |
| 333.15 | 0.7006 | 1183.82 |
| 333.15 | 0.8010 | 1187.03 |
| 333.15 | 0.8997 | 1190.22 |
| 333.15 | 1.0000 | 1193.61 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1203.05 |
| 293.15 | 0.1008 | 1206.99 |
| 293.15 | 0.1993 | 1211.04 |
| 293.15 | 0.3000 | 1215.35 |
| 293.15 | 0.3997 | 1219.84 |
| 293.15 | 0.4991 | 1224.55 |
| 293.15 | 0.6004 | 1229.62 |
| 293.15 | 0.7006 | 1234.94 |
| 293.15 | 0.8010 | 1240.51 |
| 293.15 | 0.8997 | 1246.65 |
| 293.15 | 1.0000 | 1252.82 |
| 303.15 | 0.0000 | 1193.15 |
| 303.15 | 0.1008 | 1196.83 |
| 303.15 | 0.1993 | 1200.58 |
| 303.15 | 0.3000 | 1204.56 |
| 303.15 | 0.3997 | 1208.67 |
| 303.15 | 0.4991 | 1212.96 |
| 303.15 | 0.6004 | 1217.53 |
| 303.15 | 0.7006 | 1222.31 |
| 303.15 | 0.8010 | 1227.39 |
| 303.15 | 0.8997 | 1232.66 |
| 303.15 | 1.0000 | 1238.27 |
| 313.15 | 0.0000 | 1183.21 |
| 313.15 | 0.1008 | 1186.61 |
| 313.15 | 0.1993 | 1190.03 |
| 313.15 | 0.3000 | 1193.66 |
| 313.15 | 0.3997 | 1197.36 |
| 313.15 | 0.4991 | 1201.23 |
| 313.15 | 0.6004 | 1205.32 |
| 313.15 | 0.7006 | 1209.57 |
| 313.15 | 0.8010 | 1214.06 |
| 313.15 | 0.8997 | 1218.68 |
| 313.15 | 1.0000 | 1223.53 |
| 323.15 | 0.0000 | 1173.27 |
| 323.15 | 0.1008 | 1176.36 |
| 323.15 | 0.1993 | 1179.45 |
| 323.15 | 0.3000 | 1182.68 |
| 323.15 | 0.3997 | 1185.98 |
| 323.15 | 0.4991 | 1189.39 |
| 323.15 | 0.6004 | 1193.0 |
| 323.15 | 0.7006 | 1196.72 |
| 323.15 | 0.8010 | 1200.58 |
| 323.15 | 0.8997 | 1204.5 |
| 323.15 | 1.0000 | 1208.61 |
| 333.15 | 0.0000 | 1163.32 |
| 333.15 | 0.1008 | 1166.07 |
| 333.15 | 0.1993 | 1168.82 |
| 333.15 | 0.3000 | 1171.66 |
| 333.15 | 0.3997 | 1174.52 |
| 333.15 | 0.4991 | 1177.48 |
| 333.15 | 0.6004 | 1180.62 |
| 333.15 | 0.7006 | 1183.82 |
| 333.15 | 0.8010 | 1187.03 |
| 333.15 | 0.8997 | 1190.22 |
| 333.15 | 1.0000 | 1193.61 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 94.6 (Liquid)
| Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 481.15 |
| 0.1775 | 417.25 |
| 0.3014 | 397.55 |
| 0.4632 | 381.65 |
| 0.5642 | 374.45 |
| 0.6609 | 368.85 |
| 0.7952 | 362.45 |
| 0.8859 | 358.85 |
| 1.0000 | 354.95 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 94.6 (Liquid)
| Mole fraction of Ethane, 1,2-dichloro- (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 481.15 |
| 0.1775 | 417.25 |
| 0.3014 | 397.55 |
| 0.4632 | 381.65 |
| 0.5642 | 374.45 |
| 0.6609 | 368.85 |
| 0.7952 | 362.45 |
| 0.8859 | 358.85 |
| 1.0000 | 354.95 |
Sources
- Theoretical and experimental study on volumetric and electromagnetic properties of binary systems consisting of 1,2-dichloroethane with benzene and its derivatives at T = (293.15 to 333.15) K
- Bubble Temperature Measurements on the Binary Mixtures of n-Heptane or Nitrobenzene or Chlorobenzene with Some Chloroethanes and Chloroethylenes at (94.6 to 95.8) kPa