- Name
- Toluene
- InChI
- InChI=1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- YXFVVABEGXRONW-UHFFFAOYSA-N
- Formula
- C7H8
- SMILES
- Cc1ccccc1
- Mol. Weight (g/mol)
- 92.14
- CAS
- 108-88-3
- Name
- Benzenamine, 3,5-dichloro-
- InChI
- InChI=1S/C6H5Cl2N/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2
- InChI Key
- UQRLKWGPEVNVHT-UHFFFAOYSA-N
- Formula
- C6H5Cl2N
- SMILES
- Nc1cc(Cl)cc(Cl)c1
- Mol. Weight (g/mol)
- 162.02
- CAS
- 626-43-7
- Name
- Benzene, 1,3,5-trichloro-
- InChI
- InChI=1S/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H
- InChI Key
- XKEFYDZQGKAQCN-UHFFFAOYSA-N
- Formula
- C6H3Cl3
- SMILES
- Clc1cc(Cl)cc(Cl)c1
- Mol. Weight (g/mol)
- 181.45
- CAS
- 108-70-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Benzene, 1,3,5-trichloro- (3) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Benzenamine, 3,5-dichloro- (2) - Liquid | Mass fraction of Benzene, 1,3,5-trichloro- (3) - Liquid |
| 283.15 | 0.0536 | 0.3704 |
| 283.15 | 0.0938 | 0.3634 |
| 283.15 | 0.1312 | 0.3523 |
| 283.15 | 0.1832 | 0.3330 |
| 283.15 | 0.2243 | 0.3258 |
| 283.15 | 0.2597 | 0.3126 |
| 283.15 | 0.2798 | 0.3045 |
| 283.15 | 0.3167 | 0.2921 |
| 293.15 | 0.0774 | 0.4670 |
| 293.15 | 0.1317 | 0.4421 |
| 293.15 | 0.1722 | 0.4197 |
| 293.15 | 0.2146 | 0.4003 |
| 293.15 | 0.2556 | 0.3784 |
| 293.15 | 0.2911 | 0.3624 |
| 293.15 | 0.3351 | 0.3476 |
| 293.15 | 0.3757 | 0.3295 |
| 303.15 | 0.0766 | 0.5657 |
| 303.15 | 0.1334 | 0.5360 |
| 303.15 | 0.2148 | 0.4840 |
| 303.15 | 0.2911 | 0.4402 |
| 303.15 | 0.3355 | 0.4191 |
| 303.15 | 0.3642 | 0.4014 |
| 303.15 | 0.4151 | 0.3733 |
| 303.15 | 0.4501 | 0.3581 |
Mass fraction of Benzene, 1,3,5-trichloro- (3) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass fraction of Benzene, 1,3,5-trichloro- (3) - Liquid |
|---|---|
| 283.15 | 0.2921 |
| 293.15 | 0.3295 |
| 303.15 | 0.3581 |
Mass fraction of Benzenamine, 3,5-dichloro- (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass fraction of Benzenamine, 3,5-dichloro- (2) - Liquid |
|---|---|
| 283.15 | 0.3167 |
| 293.15 | 0.3757 |
| 303.15 | 0.4501 |
Mass fraction of Benzene, 1,3,5-trichloro- (3) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Benzenamine, 3,5-dichloro- (2) - Liquid | Mass fraction of Benzene, 1,3,5-trichloro- (3) - Liquid |
| 283.15 | 0.3167 | 0.2921 |
| 283.15 | 0.3291 | 0.2301 |
| 283.15 | 0.3488 | 0.1803 |
| 283.15 | 0.3761 | 0.1059 |
| 283.15 | 0.4182 | 0.0000 |
| 293.15 | 0.3757 | 0.3295 |
| 293.15 | 0.3971 | 0.2933 |
| 293.15 | 0.4240 | 0.2264 |
| 293.15 | 0.4798 | 0.0964 |
| 293.15 | 0.5336 | 0.0000 |
| 303.15 | 0.4501 | 0.3581 |
| 303.15 | 0.4781 | 0.3129 |
| 303.15 | 0.5291 | 0.2329 |
| 303.15 | 0.5766 | 0.1376 |
| 303.15 | 0.6436 | 0.0000 |
Mass fraction of Benzene, 1,3,5-trichloro- (3) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Benzenamine, 3,5-dichloro- (2) - Liquid | Mass fraction of Benzene, 1,3,5-trichloro- (3) - Liquid |
| 283.15 | 0.0536 | 0.3704 |
| 283.15 | 0.0938 | 0.3634 |
| 283.15 | 0.1312 | 0.3523 |
| 283.15 | 0.1832 | 0.3330 |
| 283.15 | 0.2243 | 0.3258 |
| 283.15 | 0.2597 | 0.3126 |
| 283.15 | 0.2798 | 0.3045 |
| 283.15 | 0.3167 | 0.2921 |
| 293.15 | 0.0774 | 0.4670 |
| 293.15 | 0.1317 | 0.4421 |
| 293.15 | 0.1722 | 0.4197 |
| 293.15 | 0.2146 | 0.4003 |
| 293.15 | 0.2556 | 0.3784 |
| 293.15 | 0.2911 | 0.3624 |
| 293.15 | 0.3351 | 0.3476 |
| 293.15 | 0.3757 | 0.3295 |
| 303.15 | 0.0766 | 0.5657 |
| 303.15 | 0.1334 | 0.5360 |
| 303.15 | 0.2148 | 0.4840 |
| 303.15 | 0.2911 | 0.4402 |
| 303.15 | 0.3355 | 0.4191 |
| 303.15 | 0.3642 | 0.4014 |
| 303.15 | 0.4151 | 0.3733 |
| 303.15 | 0.4501 | 0.3581 |
Mass fraction of Benzene, 1,3,5-trichloro- (3) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass fraction of Benzene, 1,3,5-trichloro- (3) - Liquid |
|---|---|
| 283.15 | 0.2921 |
| 293.15 | 0.3295 |
| 303.15 | 0.3581 |
Mass fraction of Benzenamine, 3,5-dichloro- (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass fraction of Benzenamine, 3,5-dichloro- (2) - Liquid |
|---|---|
| 283.15 | 0.3167 |
| 293.15 | 0.3757 |
| 303.15 | 0.4501 |
Mass fraction of Benzene, 1,3,5-trichloro- (3) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Benzenamine, 3,5-dichloro- (2) - Liquid | Mass fraction of Benzene, 1,3,5-trichloro- (3) - Liquid |
| 283.15 | 0.3167 | 0.2921 |
| 283.15 | 0.3291 | 0.2301 |
| 283.15 | 0.3488 | 0.1803 |
| 283.15 | 0.3761 | 0.1059 |
| 283.15 | 0.4182 | 0.0000 |
| 293.15 | 0.3757 | 0.3295 |
| 293.15 | 0.3971 | 0.2933 |
| 293.15 | 0.4240 | 0.2264 |
| 293.15 | 0.4798 | 0.0964 |
| 293.15 | 0.5336 | 0.0000 |
| 303.15 | 0.4501 | 0.3581 |
| 303.15 | 0.4781 | 0.3129 |
| 303.15 | 0.5291 | 0.2329 |
| 303.15 | 0.5766 | 0.1376 |
| 303.15 | 0.6436 | 0.0000 |