- Name
- Toluene
- InChI
- InChI=1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- YXFVVABEGXRONW-UHFFFAOYSA-N
- Formula
- C7H8
- SMILES
- Cc1ccccc1
- Mol. Weight (g/mol)
- 92.14
- CAS
- 108-88-3
- Name
- Benzoic acid
- InChI
- InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)
- InChI Key
- WPYMKLBDIGXBTP-UHFFFAOYSA-N
- Formula
- C7H6O2
- SMILES
- O=C(O)c1ccccc1
- Mol. Weight (g/mol)
- 122.12
- CAS
- 65-85-0
Datasets
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.1 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 273.15 | 0.0340 |
| 283.15 | 0.0428 |
| 293.15 | 0.0616 |
| 298.15 | 0.0741 |
| 303.15 | 0.0892 |
| 313.15 | 0.1270 |
| 323.15 | 0.1784 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.1 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 283.15 | 0.0425 |
| 293.15 | 0.0620 |
| 298.15 | 0.0745 |
| 303.15 | 0.0891 |
| 313.15 | 0.1266 |
| 323.15 | 0.1790 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 293.15 | 0.0619 |
| 303.15 | 0.0889 |
| 313.15 | 0.1280 |
| 323.15 | 0.1770 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 273.15 | 0.0339 |
| 283.15 | 0.0428 |
| 293.15 | 0.0616 |
| 298.15 | 0.0742 |
| 303.15 | 0.0893 |
| 313.15 | 0.1273 |
| 323.15 | 0.1780 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 283.15 | 0.0421 |
| 293.15 | 0.0627 |
| 298.15 | 0.0732 |
| 303.15 | 0.0907 |
| 313.15 | 0.1265 |
| 323.15 | 0.1804 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 283.15 | 0.0418 |
| 293.15 | 0.0614 |
| 303.15 | 0.0887 |
| 313.15 | 0.1255 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 273.15 | 0.0327 |
| 278.15 | 0.0359 |
| 283.15 | 0.0433 |
| 288.15 | 0.0521 |
| 293.15 | 0.0619 |
| 298.15 | 0.0749 |
| 303.15 | 0.0907 |
| 308.15 | 0.1090 |
| 313.15 | 0.1312 |
| 318.15 | 0.1580 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 293.15 | 0.0620 |
| 303.15 | 0.0880 |
| 313.15 | 0.1270 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 293.15 | 0.0619 |
| 303.15 | 0.0889 |
| 313.15 | 0.1280 |
| 323.15 | 0.1770 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 283.15 | 0.1290 |
| 293.15 | 0.1380 |
| 303.15 | 0.1640 |
| 313.15 | 0.1970 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 273.15 | 0.0340 |
| 283.15 | 0.0426 |
| 293.15 | 0.0614 |
| 298.15 | 0.0740 |
| 303.15 | 0.0901 |
| 313.15 | 0.1270 |
| 323.15 | 0.1783 |
Mass ratio of solute to solvent [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent - Liquid |
|---|---|
| 278.15 | 0.0482 |
| 283.15 | 0.0592 |
| 293.15 | 0.0877 |
| 303.15 | 0.1308 |
| 313.15 | 0.1942 |
| 323.15 | 0.2868 |
Mass ratio of solute to solvent of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (2) - Liquid |
|---|---|
| 301.05 | 0.1133 |
| 306.05 | 0.1317 |
| 311.75 | 0.1616 |
| 316.95 | 0.1981 |
| 323.35 | 0.2446 |
| 330.25 | 0.3014 |
| 336.55 | 0.3791 |
| 340.75 | 0.4765 |
| 344.65 | 0.5882 |
| 348.25 | 0.7153 |
| 351.35 | 0.8616 |
| 354.05 | 1.026 |
| 306.05 | 0.1333 |
| 311.75 | 0.1632 |
| 316.95 | 0.1997 |
| 322.65 | 0.2462 |
| 328.25 | 0.3030 |
| 334.55 | 0.3807 |
| 339.85 | 0.4781 |
| 344.65 | 0.5899 |
| 348.25 | 0.7169 |
| 351.35 | 0.8633 |
| 354.05 | 1.0278 |
| 323.35 | 0.2462 |
| 330.25 | 0.3030 |
| 336.55 | 0.3807 |
| 340.75 | 0.4781 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.1 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 273.15 | 0.0340 |
| 283.15 | 0.0428 |
| 293.15 | 0.0616 |
| 298.15 | 0.0741 |
| 303.15 | 0.0892 |
| 313.15 | 0.1270 |
| 323.15 | 0.1784 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.1 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 283.15 | 0.0425 |
| 293.15 | 0.0620 |
| 298.15 | 0.0745 |
| 303.15 | 0.0891 |
| 313.15 | 0.1266 |
| 323.15 | 0.1790 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 293.15 | 0.0619 |
| 303.15 | 0.0889 |
| 313.15 | 0.1280 |
| 323.15 | 0.1770 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 273.15 | 0.0339 |
| 283.15 | 0.0428 |
| 293.15 | 0.0616 |
| 298.15 | 0.0742 |
| 303.15 | 0.0893 |
| 313.15 | 0.1273 |
| 323.15 | 0.1780 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 283.15 | 0.0421 |
| 293.15 | 0.0627 |
| 298.15 | 0.0732 |
| 303.15 | 0.0907 |
| 313.15 | 0.1265 |
| 323.15 | 0.1804 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 283.15 | 0.0418 |
| 293.15 | 0.0614 |
| 303.15 | 0.0887 |
| 313.15 | 0.1255 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 273.15 | 0.0327 |
| 278.15 | 0.0359 |
| 283.15 | 0.0433 |
| 288.15 | 0.0521 |
| 293.15 | 0.0619 |
| 298.15 | 0.0749 |
| 303.15 | 0.0907 |
| 308.15 | 0.1090 |
| 313.15 | 0.1312 |
| 318.15 | 0.1580 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 293.15 | 0.0620 |
| 303.15 | 0.0880 |
| 313.15 | 0.1270 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 293.15 | 0.0619 |
| 303.15 | 0.0889 |
| 313.15 | 0.1280 |
| 323.15 | 0.1770 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 283.15 | 0.1290 |
| 293.15 | 0.1380 |
| 303.15 | 0.1640 |
| 313.15 | 0.1970 |
Mole fraction of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (2) - Liquid |
|---|---|
| 273.15 | 0.0340 |
| 283.15 | 0.0426 |
| 293.15 | 0.0614 |
| 298.15 | 0.0740 |
| 303.15 | 0.0901 |
| 313.15 | 0.1270 |
| 323.15 | 0.1783 |
Mass ratio of solute to solvent [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent - Liquid |
|---|---|
| 278.15 | 0.0482 |
| 283.15 | 0.0592 |
| 293.15 | 0.0877 |
| 303.15 | 0.1308 |
| 313.15 | 0.1942 |
| 323.15 | 0.2868 |
Mass ratio of solute to solvent of Benzoic acid (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (2) - Liquid |
|---|---|
| 301.05 | 0.1133 |
| 306.05 | 0.1317 |
| 311.75 | 0.1616 |
| 316.95 | 0.1981 |
| 323.35 | 0.2446 |
| 330.25 | 0.3014 |
| 336.55 | 0.3791 |
| 340.75 | 0.4765 |
| 344.65 | 0.5882 |
| 348.25 | 0.7153 |
| 351.35 | 0.8616 |
| 354.05 | 1.026 |
| 306.05 | 0.1333 |
| 311.75 | 0.1632 |
| 316.95 | 0.1997 |
| 322.65 | 0.2462 |
| 328.25 | 0.3030 |
| 334.55 | 0.3807 |
| 339.85 | 0.4781 |
| 344.65 | 0.5899 |
| 348.25 | 0.7169 |
| 351.35 | 0.8633 |
| 354.05 | 1.0278 |
| 323.35 | 0.2462 |
| 330.25 | 0.3030 |
| 336.55 | 0.3807 |
| 340.75 | 0.4781 |
Sources
- Solubility determination and thermodynamic models for dehydroepiandrosterone acetate in mixed solvents of (ethyl acetate + methanol), (ethyl acetate + ethanol) and (ethyl acetate + isopropanol)
- Solubility determination and thermodynamic modeling of 3-methyl-4- nitrobenzoic acid in twelve organic solvents from T = (283.15-318.15) K and mixing properties of solutions
- Solubility parameter of lenalidomide for predicting the type of solubility profile and application of thermodynamic model
- Solubility Measurement and Thermodynamic Modeling of 4-Nitrophthalimide in Twelve Pure Solvents at Elevated Temperatures Ranging from (273.15 to 323.15) K
- Solid-Liquid Phase Equilibria of the Ternary System (2-Naphthaldehyde + 4-Methylphthalic Anhydride + Ethyl Acetate) at (288.15, 298.15, and 308.15) K
- Solubility Measurement and Modeling of 1-(3-nitrophenyl)Ethanone and 1-(4-nitrophenyl)Ethenone in Nine Pure Organic Solvents from T = (278.15 to 318.15) K and Mixing Properties of Solutions
- Experiment and Computation of Solubility and Dissolution Properties for Enalapril Maleate and Its Intermediate in Pure Solvents
- Influence of Different Solvent Properties and Composition for the Solubility of Iopromide
- Experiment and Application of the Solid-Liquid Phase Equilibrium for Ternary 2-Nitro-p-phenylenediamine + Ethyl Acetate + Isopropanol and 2-Nitro-p-phenylenediamine + 4-Nitro-o-phenylenediamine + N-Methyl-2-pyrrolidone systems
- Solubility Determination and Thermodynamic Modeling of 2-Mercaptobenzimidazole in 12 Solvents from T = 278.15 K to T = 318.15 K
- Solubility Increment and Thermodynamic Analysis of Bioactive Antofloxacin Hydrochloride in Aqueous ChCl/PTS Deep Eutectic Solvent and Cosolvent Mixtures
- Solubility of Benzoic Acid in Pure Solvents and Binary Mixtures
- Solubilities of Benzoic Acid in Binary Methylbenzene + Benzyl Alcohol and Methylbenzene + Benzaldehyde Solvent Mixtures