- Name
- 2-Pentanol
- InChI
- InChI=1S/C5H12O/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3
- InChI Key
- JYVLIDXNZAXMDK-UHFFFAOYSA-N
- Formula
- C5H12O
- SMILES
- CCCC(C)O
- Mol. Weight (g/mol)
- 88.15
- CAS
- 6032-29-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Activity coefficient (2)
- Mass fraction (14)
- Pvap - Vapor or sublimation pressure, kPa (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (4)
- Tboil - Boiling temperature at pressure P, K (2)
Activity coefficient of 2-Pentanol (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Pentanol (1) - Liquid |
|---|---|
| 273.35 | 58.8 |
| 283.15 | 73.9 |
| 293.15 | 89.2 |
| 293.15 | 86.1 |
| 303.15 | 104.0 |
| 303.15 | 103.0 |
| 313.15 | 119.0 |
| 323.15 | 129.0 |
| 333.15 | 134.0 |
| 343.15 | 134.0 |
| 353.15 | 124.0 |
| 363.15 | 130.0 |
| 371.15 | 118.0 |
Activity coefficient of 2-Pentanol (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Pentanol (1) - Liquid |
|---|---|
| 273.35 | 58.8 |
| 283.15 | 73.9 |
| 293.15 | 89.2 |
| 293.15 | 86.1 |
| 303.15 | 104.0 |
| 303.15 | 103.0 |
| 313.15 | 119.0 |
| 323.15 | 129.0 |
| 333.15 | 134.0 |
| 343.15 | 134.0 |
| 353.15 | 124.0 |
| 363.15 | 130.0 |
| 371.15 | 118.0 |
Mass fraction of 2-Pentanol (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 2)
- Temperature, K = 298 (Liquid mixture 2)
| Mass fraction of 2-Pentanol (1) - Liquid mixture 2 |
|---|
| 0.7980 |
| 0.0280 |
Mass fraction of Water (2) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 100 (Liquid mixture 1)
| Mass fraction of Water (2) - Liquid mixture 1 |
|---|
| 0.9477 |
| 0.1177 |
Mole fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (2) - Liquid mixture 2 |
|---|---|
| 313.15 | 0.9930 |
| 303.15 | 0.9920 |
| 365.37 | 0.9930 |
Mole fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 313.15 | 0.3800 |
| 303.15 | 0.3640 |
| 365.37 | 0.4290 |
Mole fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Water (2) - Liquid | Mole fraction of Water (2) - Gas |
|---|---|
| 0.9930 | 0.7500 |
| 0.4290 | 0.7500 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 298.20 | 0.9576 |
| 298.20 | 0.1067 |
| 308.20 | 0.9599 |
| 308.20 | 0.1090 |
| 318.20 | 0.9593 |
| 318.20 | 0.1122 |
Mole fraction of Water (2) [ref]
Operational condition: Temperature, K = 523 (Liquid)
| Mole fraction of Water (2) - Liquid | Mole fraction of Water (2) - Gas |
|---|---|
| 0.2410 | 0.4310 |
| 0.3340 | 0.5810 |
| 0.4160 | 0.6390 |
| 0.8640 | 0.7640 |
| 0.9710 | 0.8230 |
| 0.9930 | 0.9010 |
Mass fraction of 2-Pentanol (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 2)
- Temperature, K = 298 (Liquid mixture 2)
| Mass fraction of 2-Pentanol (1) - Liquid mixture 2 |
|---|
| 0.7980 |
| 0.0280 |
Mass fraction of Water (2) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 100 (Liquid mixture 1)
| Mass fraction of Water (2) - Liquid mixture 1 |
|---|
| 0.9477 |
| 0.1177 |
Mole fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (2) - Liquid mixture 2 |
|---|---|
| 313.15 | 0.9930 |
| 303.15 | 0.9920 |
| 365.37 | 0.9930 |
Mole fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 313.15 | 0.3800 |
| 303.15 | 0.3640 |
| 365.37 | 0.4290 |
Mole fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Water (2) - Liquid | Mole fraction of Water (2) - Gas |
|---|---|
| 0.9930 | 0.7500 |
| 0.4290 | 0.7500 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 298.20 | 0.9576 |
| 298.20 | 0.1067 |
| 308.20 | 0.9599 |
| 308.20 | 0.1090 |
| 318.20 | 0.9593 |
| 318.20 | 0.1122 |
Mole fraction of Water (2) [ref]
Operational condition: Temperature, K = 523 (Liquid)
| Mole fraction of Water (2) - Liquid | Mole fraction of Water (2) - Gas |
|---|---|
| 0.2410 | 0.4310 |
| 0.3340 | 0.5810 |
| 0.4160 | 0.6390 |
| 0.8640 | 0.7640 |
| 0.9710 | 0.8230 |
| 0.9930 | 0.9010 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 523 (Liquid)
| Mole fraction of Water (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.2410 | 3300.00 |
| 0.3340 | 4000.00 |
| 0.4160 | 4340.00 |
| 0.8640 | 4940.00 |
| 0.9710 | 4710.00 |
| 0.9930 | 4340.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 523 (Liquid)
| Mole fraction of Water (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.2410 | 3300.00 |
| 0.3340 | 4000.00 |
| 0.4160 | 4340.00 |
| 0.8640 | 4940.00 |
| 0.9710 | 4710.00 |
| 0.9930 | 4340.00 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 100 (Liquid)
| Mass fraction of Water (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.9477 | 1.3377 |
| 0.1177 | 1.3992 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 100 (Liquid)
| Mass fraction of Water (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.9477 | 1.3377 |
| 0.1177 | 1.3992 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 100 (Liquid)
| Mass fraction of Water (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.9477 | 989.77 |
| 0.1177 | 827.45 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 282.15 | 0.0010 | 998.992 |
| 281.65 | 0.0010 | 999.025 |
| 281.15 | 0.0010 | 999.058 |
| 280.65 | 0.0010 | 999.09 |
| 280.15 | 0.0010 | 999.115 |
| 279.65 | 0.0010 | 999.133 |
| 279.15 | 0.0010 | 999.163 |
| 278.65 | 0.0010 | 999.177 |
| 278.15 | 0.0010 | 999.187 |
| 277.65 | 0.0010 | 999.19 |
| 277.15 | 0.0010 | 999.185 |
| 276.65 | 0.0010 | 999.193 |
| 276.15 | 0.0010 | 999.187 |
| 275.65 | 0.0010 | 999.177 |
| 275.15 | 0.0010 | 999.16 |
| 274.65 | 0.0010 | 999.148 |
| 274.15 | 0.0010 | 999.119 |
| 273.65 | 0.0010 | 999.095 |
| 282.15 | 0.0021 | 998.234 |
| 281.65 | 0.0021 | 998.267 |
| 281.15 | 0.0021 | 998.301 |
| 280.65 | 0.0021 | 998.332 |
| 280.15 | 0.0021 | 998.36 |
| 279.65 | 0.0021 | 998.376 |
| 279.15 | 0.0021 | 998.401 |
| 278.65 | 0.0021 | 998.416 |
| 278.15 | 0.0021 | 998.426 |
| 277.65 | 0.0021 | 998.439 |
| 277.15 | 0.0021 | 998.444 |
| 276.65 | 0.0021 | 998.445 |
| 276.15 | 0.0021 | 998.44 |
| 275.65 | 0.0021 | 998.43 |
| 275.15 | 0.0021 | 998.416 |
| 274.65 | 0.0021 | 998.4 |
| 274.15 | 0.0021 | 998.377 |
| 273.65 | 0.0021 | 998.354 |
| 282.15 | 0.0041 | 996.841 |
| 281.65 | 0.0041 | 996.878 |
| 281.15 | 0.0041 | 996.915 |
| 280.65 | 0.0041 | 996.951 |
| 280.15 | 0.0041 | 996.978 |
| 279.65 | 0.0041 | 997.002 |
| 279.15 | 0.0041 | 997.037 |
| 278.65 | 0.0041 | 997.053 |
| 278.15 | 0.0041 | 997.066 |
| 277.65 | 0.0041 | 997.076 |
| 277.15 | 0.0041 | 997.082 |
| 276.65 | 0.0041 | 997.092 |
| 276.15 | 0.0041 | 997.09 |
| 275.65 | 0.0041 | 997.08 |
| 275.15 | 0.0041 | 997.073 |
| 274.65 | 0.0041 | 997.057 |
| 274.15 | 0.0041 | 997.038 |
| 273.65 | 0.0041 | 997.02 |
| 282.15 | 0.0060 | 995.688 |
| 281.65 | 0.0060 | 995.731 |
| 281.15 | 0.0060 | 995.769 |
| 280.65 | 0.0060 | 995.806 |
| 280.15 | 0.0060 | 995.84 |
| 279.65 | 0.0060 | 995.867 |
| 279.15 | 0.0060 | 995.898 |
| 278.65 | 0.0060 | 995.923 |
| 278.15 | 0.0060 | 995.938 |
| 277.65 | 0.0060 | 995.952 |
| 277.15 | 0.0060 | 995.964 |
| 276.65 | 0.0060 | 995.974 |
| 276.15 | 0.0060 | 995.972 |
| 275.65 | 0.0060 | 995.972 |
| 275.15 | 0.0060 | 995.965 |
| 274.65 | 0.0060 | 995.957 |
| 274.15 | 0.0060 | 995.939 |
| 273.65 | 0.0060 | 995.922 |
| 282.15 | 0.0068 | 995.214 |
| 281.65 | 0.0068 | 995.261 |
| 281.15 | 0.0068 | 995.301 |
| 280.65 | 0.0068 | 995.342 |
| 280.15 | 0.0068 | 995.375 |
| 279.65 | 0.0068 | 995.403 |
| 279.15 | 0.0068 | 995.439 |
| 278.65 | 0.0068 | 995.466 |
| 278.15 | 0.0068 | 995.484 |
| 277.65 | 0.0068 | 995.498 |
| 277.15 | 0.0068 | 995.512 |
| 276.65 | 0.0068 | 995.524 |
| 276.15 | 0.0068 | 995.527 |
| 275.65 | 0.0068 | 995.524 |
| 275.15 | 0.0068 | 995.523 |
| 274.65 | 0.0068 | 995.51 |
| 274.15 | 0.0068 | 995.499 |
| 273.65 | 0.0068 | 995.484 |
| 282.15 | 0.0086 | 994.273 |
| 281.65 | 0.0086 | 994.318 |
| 281.15 | 0.0086 | 994.365 |
| 280.65 | 0.0086 | 994.408 |
| 280.15 | 0.0086 | 994.439 |
| 279.65 | 0.0086 | 994.471 |
| 279.15 | 0.0086 | 994.519 |
| 278.65 | 0.0086 | 994.542 |
| 278.15 | 0.0086 | 994.566 |
| 277.65 | 0.0086 | 994.583 |
| 277.15 | 0.0086 | 994.604 |
| 276.65 | 0.0086 | 994.619 |
| 276.15 | 0.0086 | 994.622 |
| 275.65 | 0.0086 | 994.627 |
| 275.15 | 0.0086 | 994.625 |
| 274.65 | 0.0086 | 994.622 |
| 274.15 | 0.0086 | 994.61 |
| 273.65 | 0.0086 | 994.604 |
| 282.15 | 1.0000 | 817.5 |
| 281.65 | 1.0000 | 817.9 |
| 281.15 | 1.0000 | 818.3 |
| 280.65 | 1.0000 | 818.7 |
| 280.15 | 1.0000 | 819.1 |
| 279.65 | 1.0000 | 819.4 |
| 279.15 | 1.0000 | 819.8 |
| 278.65 | 1.0000 | 820.2 |
| 278.15 | 1.0000 | 820.6 |
| 277.65 | 1.0000 | 820.9 |
| 277.15 | 1.0000 | 821.3 |
| 276.65 | 1.0000 | 821.7 |
| 276.15 | 1.0000 | 822.1 |
| 275.65 | 1.0000 | 822.5 |
| 275.15 | 1.0000 | 822.8 |
| 274.65 | 1.0000 | 823.2 |
| 274.15 | 1.0000 | 823.6 |
| 273.65 | 1.0000 | 824.0 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 100 (Liquid)
| Mass fraction of Water (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.9477 | 989.77 |
| 0.1177 | 827.45 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 282.15 | 0.0010 | 998.992 |
| 281.65 | 0.0010 | 999.025 |
| 281.15 | 0.0010 | 999.058 |
| 280.65 | 0.0010 | 999.09 |
| 280.15 | 0.0010 | 999.115 |
| 279.65 | 0.0010 | 999.133 |
| 279.15 | 0.0010 | 999.163 |
| 278.65 | 0.0010 | 999.177 |
| 278.15 | 0.0010 | 999.187 |
| 277.65 | 0.0010 | 999.19 |
| 277.15 | 0.0010 | 999.185 |
| 276.65 | 0.0010 | 999.193 |
| 276.15 | 0.0010 | 999.187 |
| 275.65 | 0.0010 | 999.177 |
| 275.15 | 0.0010 | 999.16 |
| 274.65 | 0.0010 | 999.148 |
| 274.15 | 0.0010 | 999.119 |
| 273.65 | 0.0010 | 999.095 |
| 282.15 | 0.0021 | 998.234 |
| 281.65 | 0.0021 | 998.267 |
| 281.15 | 0.0021 | 998.301 |
| 280.65 | 0.0021 | 998.332 |
| 280.15 | 0.0021 | 998.36 |
| 279.65 | 0.0021 | 998.376 |
| 279.15 | 0.0021 | 998.401 |
| 278.65 | 0.0021 | 998.416 |
| 278.15 | 0.0021 | 998.426 |
| 277.65 | 0.0021 | 998.439 |
| 277.15 | 0.0021 | 998.444 |
| 276.65 | 0.0021 | 998.445 |
| 276.15 | 0.0021 | 998.44 |
| 275.65 | 0.0021 | 998.43 |
| 275.15 | 0.0021 | 998.416 |
| 274.65 | 0.0021 | 998.4 |
| 274.15 | 0.0021 | 998.377 |
| 273.65 | 0.0021 | 998.354 |
| 282.15 | 0.0041 | 996.841 |
| 281.65 | 0.0041 | 996.878 |
| 281.15 | 0.0041 | 996.915 |
| 280.65 | 0.0041 | 996.951 |
| 280.15 | 0.0041 | 996.978 |
| 279.65 | 0.0041 | 997.002 |
| 279.15 | 0.0041 | 997.037 |
| 278.65 | 0.0041 | 997.053 |
| 278.15 | 0.0041 | 997.066 |
| 277.65 | 0.0041 | 997.076 |
| 277.15 | 0.0041 | 997.082 |
| 276.65 | 0.0041 | 997.092 |
| 276.15 | 0.0041 | 997.09 |
| 275.65 | 0.0041 | 997.08 |
| 275.15 | 0.0041 | 997.073 |
| 274.65 | 0.0041 | 997.057 |
| 274.15 | 0.0041 | 997.038 |
| 273.65 | 0.0041 | 997.02 |
| 282.15 | 0.0060 | 995.688 |
| 281.65 | 0.0060 | 995.731 |
| 281.15 | 0.0060 | 995.769 |
| 280.65 | 0.0060 | 995.806 |
| 280.15 | 0.0060 | 995.84 |
| 279.65 | 0.0060 | 995.867 |
| 279.15 | 0.0060 | 995.898 |
| 278.65 | 0.0060 | 995.923 |
| 278.15 | 0.0060 | 995.938 |
| 277.65 | 0.0060 | 995.952 |
| 277.15 | 0.0060 | 995.964 |
| 276.65 | 0.0060 | 995.974 |
| 276.15 | 0.0060 | 995.972 |
| 275.65 | 0.0060 | 995.972 |
| 275.15 | 0.0060 | 995.965 |
| 274.65 | 0.0060 | 995.957 |
| 274.15 | 0.0060 | 995.939 |
| 273.65 | 0.0060 | 995.922 |
| 282.15 | 0.0068 | 995.214 |
| 281.65 | 0.0068 | 995.261 |
| 281.15 | 0.0068 | 995.301 |
| 280.65 | 0.0068 | 995.342 |
| 280.15 | 0.0068 | 995.375 |
| 279.65 | 0.0068 | 995.403 |
| 279.15 | 0.0068 | 995.439 |
| 278.65 | 0.0068 | 995.466 |
| 278.15 | 0.0068 | 995.484 |
| 277.65 | 0.0068 | 995.498 |
| 277.15 | 0.0068 | 995.512 |
| 276.65 | 0.0068 | 995.524 |
| 276.15 | 0.0068 | 995.527 |
| 275.65 | 0.0068 | 995.524 |
| 275.15 | 0.0068 | 995.523 |
| 274.65 | 0.0068 | 995.51 |
| 274.15 | 0.0068 | 995.499 |
| 273.65 | 0.0068 | 995.484 |
| 282.15 | 0.0086 | 994.273 |
| 281.65 | 0.0086 | 994.318 |
| 281.15 | 0.0086 | 994.365 |
| 280.65 | 0.0086 | 994.408 |
| 280.15 | 0.0086 | 994.439 |
| 279.65 | 0.0086 | 994.471 |
| 279.15 | 0.0086 | 994.519 |
| 278.65 | 0.0086 | 994.542 |
| 278.15 | 0.0086 | 994.566 |
| 277.65 | 0.0086 | 994.583 |
| 277.15 | 0.0086 | 994.604 |
| 276.65 | 0.0086 | 994.619 |
| 276.15 | 0.0086 | 994.622 |
| 275.65 | 0.0086 | 994.627 |
| 275.15 | 0.0086 | 994.625 |
| 274.65 | 0.0086 | 994.622 |
| 274.15 | 0.0086 | 994.61 |
| 273.65 | 0.0086 | 994.604 |
| 282.15 | 1.0000 | 817.5 |
| 281.65 | 1.0000 | 817.9 |
| 281.15 | 1.0000 | 818.3 |
| 280.65 | 1.0000 | 818.7 |
| 280.15 | 1.0000 | 819.1 |
| 279.65 | 1.0000 | 819.4 |
| 279.15 | 1.0000 | 819.8 |
| 278.65 | 1.0000 | 820.2 |
| 278.15 | 1.0000 | 820.6 |
| 277.65 | 1.0000 | 820.9 |
| 277.15 | 1.0000 | 821.3 |
| 276.65 | 1.0000 | 821.7 |
| 276.15 | 1.0000 | 822.1 |
| 275.65 | 1.0000 | 822.5 |
| 275.15 | 1.0000 | 822.8 |
| 274.65 | 1.0000 | 823.2 |
| 274.15 | 1.0000 | 823.6 |
| 273.65 | 1.0000 | 824.0 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Water (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.9930 | 365.37 |
| 0.4290 | 365.37 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Water (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.9930 | 365.37 |
| 0.4290 | 365.37 |
Sources
- The influence of cation, anion and temperature on the liquid-liquid equilibrium of some pentanols-water system
- Liquid-liquid equilibrium in systems used for the production of 5-hydroxymethylfurfural from biomass using alcohols as solvents
- Temperature of maximum density for aqueous mixtures of three pentanol isomers
- Phase equilibria of the water + 1-butanol + 2-pentanol ternary system at 101.3 kPa
- Experimental and modeling study of liquid phase equilibria for (water + phosphoric acid + sec-alcohols) systems
- Measurement and Correlation of Vapor-Liquid Equilibria for Water + 2-Propanol, Water + 2-Butanol, and Water + 2-Pentanol Systems at High Temperatures and Pressures
- Temperature Dependence of Limiting Activity Coefficients, Henry s Law Constants, and Related Infinite Dilution Properties of Branched Pentanols in Water. Measurement, Critical Compilation, Correlation, and Recommended Data